` suffix\n * (such as 'top.px', 'font-style.em').\n * The value is an expression to be evaluated.\n * The resulting non-null value, expressed in the given unit,\n * is assigned to the given style property.\n * If the result of evaluation is null, the corresponding style is removed.\n *\n * @publicApi\n */\nclass NgStyle {\n constructor(_ngEl, _differs, _renderer) {\n this._ngEl = _ngEl;\n this._differs = _differs;\n this._renderer = _renderer;\n this._ngStyle = null;\n this._differ = null;\n }\n set ngStyle(values) {\n this._ngStyle = values;\n if (!this._differ && values) {\n this._differ = this._differs.find(values).create();\n }\n }\n ngDoCheck() {\n if (this._differ) {\n const changes = this._differ.diff(this._ngStyle);\n if (changes) {\n this._applyChanges(changes);\n }\n }\n }\n _setStyle(nameAndUnit, value) {\n const [name, unit] = nameAndUnit.split('.');\n value = value != null && unit ? `${value}${unit}` : value;\n if (value != null) {\n this._renderer.setStyle(this._ngEl.nativeElement, name, value);\n }\n else {\n this._renderer.removeStyle(this._ngEl.nativeElement, name);\n }\n }\n _applyChanges(changes) {\n changes.forEachRemovedItem((record) => this._setStyle(record.key, null));\n changes.forEachAddedItem((record) => this._setStyle(record.key, record.currentValue));\n changes.forEachChangedItem((record) => this._setStyle(record.key, record.currentValue));\n }\n}\nNgStyle.ɵfac = function NgStyle_Factory(t) { return new (t || NgStyle)(ɵngcc0.ɵɵdirectiveInject(ɵngcc0.ElementRef), ɵngcc0.ɵɵdirectiveInject(ɵngcc0.KeyValueDiffers), ɵngcc0.ɵɵdirectiveInject(ɵngcc0.Renderer2)); };\nNgStyle.ɵdir = ɵngcc0.ɵɵdefineDirective({ type: NgStyle, selectors: [[\"\", \"ngStyle\", \"\"]], inputs: { ngStyle: \"ngStyle\" } });\nNgStyle.ctorParameters = () => [\n { type: ElementRef },\n { type: KeyValueDiffers },\n { type: Renderer2 }\n];\nNgStyle.propDecorators = {\n ngStyle: [{ type: Input, args: ['ngStyle',] }]\n};\n/*@__PURE__*/ (function () { ɵngcc0.ɵsetClassMetadata(NgStyle, [{\n type: Directive,\n args: [{ selector: '[ngStyle]' }]\n }], function () { return [{ type: ɵngcc0.ElementRef }, { type: ɵngcc0.KeyValueDiffers }, { type: ɵngcc0.Renderer2 }]; }, { ngStyle: [{\n type: Input,\n args: ['ngStyle']\n }] }); })();\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * @ngModule CommonModule\n *\n * @description\n *\n * Inserts an embedded view from a prepared `TemplateRef`.\n *\n * You can attach a context object to the `EmbeddedViewRef` by setting `[ngTemplateOutletContext]`.\n * `[ngTemplateOutletContext]` should be an object, the object's keys will be available for binding\n * by the local template `let` declarations.\n *\n * @usageNotes\n * ```\n * \n * ```\n *\n * Using the key `$implicit` in the context object will set its value as default.\n *\n * ### Example\n *\n * {@example common/ngTemplateOutlet/ts/module.ts region='NgTemplateOutlet'}\n *\n * @publicApi\n */\nclass NgTemplateOutlet {\n constructor(_viewContainerRef) {\n this._viewContainerRef = _viewContainerRef;\n this._viewRef = null;\n /**\n * A context object to attach to the {@link EmbeddedViewRef}. This should be an\n * object, the object's keys will be available for binding by the local template `let`\n * declarations.\n * Using the key `$implicit` in the context object will set its value as default.\n */\n this.ngTemplateOutletContext = null;\n /**\n * A string defining the template reference and optionally the context object for the template.\n */\n this.ngTemplateOutlet = null;\n }\n ngOnChanges(changes) {\n const recreateView = this._shouldRecreateView(changes);\n if (recreateView) {\n const viewContainerRef = this._viewContainerRef;\n if (this._viewRef) {\n viewContainerRef.remove(viewContainerRef.indexOf(this._viewRef));\n }\n this._viewRef = this.ngTemplateOutlet ?\n viewContainerRef.createEmbeddedView(this.ngTemplateOutlet, this.ngTemplateOutletContext) :\n null;\n }\n else if (this._viewRef && this.ngTemplateOutletContext) {\n this._updateExistingContext(this.ngTemplateOutletContext);\n }\n }\n /**\n * We need to re-create existing embedded view if:\n * - templateRef has changed\n * - context has changes\n *\n * We mark context object as changed when the corresponding object\n * shape changes (new properties are added or existing properties are removed).\n * In other words we consider context with the same properties as \"the same\" even\n * if object reference changes (see https://github.com/angular/angular/issues/13407).\n */\n _shouldRecreateView(changes) {\n const ctxChange = changes['ngTemplateOutletContext'];\n return !!changes['ngTemplateOutlet'] || (ctxChange && this._hasContextShapeChanged(ctxChange));\n }\n _hasContextShapeChanged(ctxChange) {\n const prevCtxKeys = Object.keys(ctxChange.previousValue || {});\n const currCtxKeys = Object.keys(ctxChange.currentValue || {});\n if (prevCtxKeys.length === currCtxKeys.length) {\n for (let propName of currCtxKeys) {\n if (prevCtxKeys.indexOf(propName) === -1) {\n return true;\n }\n }\n return false;\n }\n return true;\n }\n _updateExistingContext(ctx) {\n for (let propName of Object.keys(ctx)) {\n this._viewRef.context[propName] = this.ngTemplateOutletContext[propName];\n }\n }\n}\nNgTemplateOutlet.ɵfac = function NgTemplateOutlet_Factory(t) { return new (t || NgTemplateOutlet)(ɵngcc0.ɵɵdirectiveInject(ɵngcc0.ViewContainerRef)); };\nNgTemplateOutlet.ɵdir = ɵngcc0.ɵɵdefineDirective({ type: NgTemplateOutlet, selectors: [[\"\", \"ngTemplateOutlet\", \"\"]], inputs: { ngTemplateOutletContext: \"ngTemplateOutletContext\", ngTemplateOutlet: \"ngTemplateOutlet\" }, features: [ɵngcc0.ɵɵNgOnChangesFeature] });\nNgTemplateOutlet.ctorParameters = () => [\n { type: ViewContainerRef }\n];\nNgTemplateOutlet.propDecorators = {\n ngTemplateOutletContext: [{ type: Input }],\n ngTemplateOutlet: [{ type: Input }]\n};\n/*@__PURE__*/ (function () { ɵngcc0.ɵsetClassMetadata(NgTemplateOutlet, [{\n type: Directive,\n args: [{ selector: '[ngTemplateOutlet]' }]\n }], function () { return [{ type: ɵngcc0.ViewContainerRef }]; }, { ngTemplateOutletContext: [{\n type: Input\n }], ngTemplateOutlet: [{\n type: Input\n }] }); })();\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * A collection of Angular directives that are likely to be used in each and every Angular\n * application.\n */\nconst COMMON_DIRECTIVES = [\n NgClass,\n NgComponentOutlet,\n NgForOf,\n NgIf,\n NgTemplateOutlet,\n NgStyle,\n NgSwitch,\n NgSwitchCase,\n NgSwitchDefault,\n NgPlural,\n NgPluralCase,\n];\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nfunction invalidPipeArgumentError(type, value) {\n return Error(`InvalidPipeArgument: '${value}' for pipe '${ɵstringify(type)}'`);\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nclass ObservableStrategy {\n createSubscription(async, updateLatestValue) {\n return async.subscribe({\n next: updateLatestValue,\n error: (e) => {\n throw e;\n }\n });\n }\n dispose(subscription) {\n subscription.unsubscribe();\n }\n onDestroy(subscription) {\n subscription.unsubscribe();\n }\n}\nclass PromiseStrategy {\n createSubscription(async, updateLatestValue) {\n return async.then(updateLatestValue, e => {\n throw e;\n });\n }\n dispose(subscription) { }\n onDestroy(subscription) { }\n}\nconst _promiseStrategy = new PromiseStrategy();\nconst _observableStrategy = new ObservableStrategy();\n/**\n * @ngModule CommonModule\n * @description\n *\n * Unwraps a value from an asynchronous primitive.\n *\n * The `async` pipe subscribes to an `Observable` or `Promise` and returns the latest value it has\n * emitted. When a new value is emitted, the `async` pipe marks the component to be checked for\n * changes. When the component gets destroyed, the `async` pipe unsubscribes automatically to avoid\n * potential memory leaks.\n *\n * @usageNotes\n *\n * ### Examples\n *\n * This example binds a `Promise` to the view. Clicking the `Resolve` button resolves the\n * promise.\n *\n * {@example common/pipes/ts/async_pipe.ts region='AsyncPipePromise'}\n *\n * It's also possible to use `async` with Observables. The example below binds the `time` Observable\n * to the view. The Observable continuously updates the view with the current time.\n *\n * {@example common/pipes/ts/async_pipe.ts region='AsyncPipeObservable'}\n *\n * @publicApi\n */\nclass AsyncPipe {\n constructor(_ref) {\n this._ref = _ref;\n this._latestValue = null;\n this._subscription = null;\n this._obj = null;\n this._strategy = null;\n }\n ngOnDestroy() {\n if (this._subscription) {\n this._dispose();\n }\n }\n transform(obj) {\n if (!this._obj) {\n if (obj) {\n this._subscribe(obj);\n }\n return this._latestValue;\n }\n if (obj !== this._obj) {\n this._dispose();\n return this.transform(obj);\n }\n return this._latestValue;\n }\n _subscribe(obj) {\n this._obj = obj;\n this._strategy = this._selectStrategy(obj);\n this._subscription = this._strategy.createSubscription(obj, (value) => this._updateLatestValue(obj, value));\n }\n _selectStrategy(obj) {\n if (ɵisPromise(obj)) {\n return _promiseStrategy;\n }\n if (ɵisObservable(obj)) {\n return _observableStrategy;\n }\n throw invalidPipeArgumentError(AsyncPipe, obj);\n }\n _dispose() {\n this._strategy.dispose(this._subscription);\n this._latestValue = null;\n this._subscription = null;\n this._obj = null;\n }\n _updateLatestValue(async, value) {\n if (async === this._obj) {\n this._latestValue = value;\n this._ref.markForCheck();\n }\n }\n}\nAsyncPipe.ɵfac = function AsyncPipe_Factory(t) { return new (t || AsyncPipe)(ɵngcc0.ɵɵinjectPipeChangeDetectorRef()); };\nAsyncPipe.ɵpipe = ɵngcc0.ɵɵdefinePipe({ name: \"async\", type: AsyncPipe, pure: false });\nAsyncPipe.ctorParameters = () => [\n { type: ChangeDetectorRef }\n];\n/*@__PURE__*/ (function () { ɵngcc0.ɵsetClassMetadata(AsyncPipe, [{\n type: Pipe,\n args: [{ name: 'async', pure: false }]\n }], function () { return [{ type: ɵngcc0.ChangeDetectorRef }]; }, null); })();\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Transforms text to all lower case.\n *\n * @see `UpperCasePipe`\n * @see `TitleCasePipe`\n * @usageNotes\n *\n * The following example defines a view that allows the user to enter\n * text, and then uses the pipe to convert the input text to all lower case.\n *\n * \n *\n * @ngModule CommonModule\n * @publicApi\n */\nclass LowerCasePipe {\n transform(value) {\n if (value == null)\n return null;\n if (typeof value !== 'string') {\n throw invalidPipeArgumentError(LowerCasePipe, value);\n }\n return value.toLowerCase();\n }\n}\nLowerCasePipe.ɵfac = function LowerCasePipe_Factory(t) { return new (t || LowerCasePipe)(); };\nLowerCasePipe.ɵpipe = ɵngcc0.ɵɵdefinePipe({ name: \"lowercase\", type: LowerCasePipe, pure: true });\n/*@__PURE__*/ (function () { ɵngcc0.ɵsetClassMetadata(LowerCasePipe, [{\n type: Pipe,\n args: [{ name: 'lowercase' }]\n }], null, null); })();\n//\n// Regex below matches any Unicode word and compatible with ES5. In ES2018 the same result\n// can be achieved by using /\\p{L}\\S*/gu and also known as Unicode Property Escapes\n// (https://2ality.com/2017/07/regexp-unicode-property-escapes.html). Since there is no\n// transpilation of this functionality down to ES5 without external tool, the only solution is\n// to use already transpiled form. Example can be found here -\n// https://mothereff.in/regexpu#input=var+regex+%3D+/%5Cp%7BL%7D/u%3B&unicodePropertyEscape=1\n//\nconst unicodeWordMatch = /(?:[A-Za-z\\xAA\\xB5\\xBA\\xC0-\\xD6\\xD8-\\xF6\\xF8-\\u02C1\\u02C6-\\u02D1\\u02E0-\\u02E4\\u02EC\\u02EE\\u0370-\\u0374\\u0376\\u0377\\u037A-\\u037D\\u037F\\u0386\\u0388-\\u038A\\u038C\\u038E-\\u03A1\\u03A3-\\u03F5\\u03F7-\\u0481\\u048A-\\u052F\\u0531-\\u0556\\u0559\\u0561-\\u0587\\u05D0-\\u05EA\\u05F0-\\u05F2\\u0620-\\u064A\\u066E\\u066F\\u0671-\\u06D3\\u06D5\\u06E5\\u06E6\\u06EE\\u06EF\\u06FA-\\u06FC\\u06FF\\u0710\\u0712-\\u072F\\u074D-\\u07A5\\u07B1\\u07CA-\\u07EA\\u07F4\\u07F5\\u07FA\\u0800-\\u0815\\u081A\\u0824\\u0828\\u0840-\\u0858\\u0860-\\u086A\\u08A0-\\u08B4\\u08B6-\\u08BD\\u0904-\\u0939\\u093D\\u0950\\u0958-\\u0961\\u0971-\\u0980\\u0985-\\u098C\\u098F\\u0990\\u0993-\\u09A8\\u09AA-\\u09B0\\u09B2\\u09B6-\\u09B9\\u09BD\\u09CE\\u09DC\\u09DD\\u09DF-\\u09E1\\u09F0\\u09F1\\u09FC\\u0A05-\\u0A0A\\u0A0F\\u0A10\\u0A13-\\u0A28\\u0A2A-\\u0A30\\u0A32\\u0A33\\u0A35\\u0A36\\u0A38\\u0A39\\u0A59-\\u0A5C\\u0A5E\\u0A72-\\u0A74\\u0A85-\\u0A8D\\u0A8F-\\u0A91\\u0A93-\\u0AA8\\u0AAA-\\u0AB0\\u0AB2\\u0AB3\\u0AB5-\\u0AB9\\u0ABD\\u0AD0\\u0AE0\\u0AE1\\u0AF9\\u0B05-\\u0B0C\\u0B0F\\u0B10\\u0B13-\\u0B28\\u0B2A-\\u0B30\\u0B32\\u0B33\\u0B35-\\u0B39\\u0B3D\\u0B5C\\u0B5D\\u0B5F-\\u0B61\\u0B71\\u0B83\\u0B85-\\u0B8A\\u0B8E-\\u0B90\\u0B92-\\u0B95\\u0B99\\u0B9A\\u0B9C\\u0B9E\\u0B9F\\u0BA3\\u0BA4\\u0BA8-\\u0BAA\\u0BAE-\\u0BB9\\u0BD0\\u0C05-\\u0C0C\\u0C0E-\\u0C10\\u0C12-\\u0C28\\u0C2A-\\u0C39\\u0C3D\\u0C58-\\u0C5A\\u0C60\\u0C61\\u0C80\\u0C85-\\u0C8C\\u0C8E-\\u0C90\\u0C92-\\u0CA8\\u0CAA-\\u0CB3\\u0CB5-\\u0CB9\\u0CBD\\u0CDE\\u0CE0\\u0CE1\\u0CF1\\u0CF2\\u0D05-\\u0D0C\\u0D0E-\\u0D10\\u0D12-\\u0D3A\\u0D3D\\u0D4E\\u0D54-\\u0D56\\u0D5F-\\u0D61\\u0D7A-\\u0D7F\\u0D85-\\u0D96\\u0D9A-\\u0DB1\\u0DB3-\\u0DBB\\u0DBD\\u0DC0-\\u0DC6\\u0E01-\\u0E30\\u0E32\\u0E33\\u0E40-\\u0E46\\u0E81\\u0E82\\u0E84\\u0E87\\u0E88\\u0E8A\\u0E8D\\u0E94-\\u0E97\\u0E99-\\u0E9F\\u0EA1-\\u0EA3\\u0EA5\\u0EA7\\u0EAA\\u0EAB\\u0EAD-\\u0EB0\\u0EB2\\u0EB3\\u0EBD\\u0EC0-\\u0EC4\\u0EC6\\u0EDC-\\u0EDF\\u0F00\\u0F40-\\u0F47\\u0F49-\\u0F6C\\u0F88-\\u0F8C\\u1000-\\u102A\\u103F\\u1050-\\u1055\\u105A-\\u105D\\u1061\\u1065\\u1066\\u106E-\\u1070\\u1075-\\u1081\\u108E\\u10A0-\\u10C5\\u10C7\\u10CD\\u10D0-\\u10FA\\u10FC-\\u1248\\u124A-\\u124D\\u1250-\\u1256\\u1258\\u125A-\\u125D\\u1260-\\u1288\\u128A-\\u128D\\u1290-\\u12B0\\u12B2-\\u12B5\\u12B8-\\u12BE\\u12C0\\u12C2-\\u12C5\\u12C8-\\u12D6\\u12D8-\\u1310\\u1312-\\u1315\\u1318-\\u135A\\u1380-\\u138F\\u13A0-\\u13F5\\u13F8-\\u13FD\\u1401-\\u166C\\u166F-\\u167F\\u1681-\\u169A\\u16A0-\\u16EA\\u16F1-\\u16F8\\u1700-\\u170C\\u170E-\\u1711\\u1720-\\u1731\\u1740-\\u1751\\u1760-\\u176C\\u176E-\\u1770\\u1780-\\u17B3\\u17D7\\u17DC\\u1820-\\u1877\\u1880-\\u1884\\u1887-\\u18A8\\u18AA\\u18B0-\\u18F5\\u1900-\\u191E\\u1950-\\u196D\\u1970-\\u1974\\u1980-\\u19AB\\u19B0-\\u19C9\\u1A00-\\u1A16\\u1A20-\\u1A54\\u1AA7\\u1B05-\\u1B33\\u1B45-\\u1B4B\\u1B83-\\u1BA0\\u1BAE\\u1BAF\\u1BBA-\\u1BE5\\u1C00-\\u1C23\\u1C4D-\\u1C4F\\u1C5A-\\u1C7D\\u1C80-\\u1C88\\u1CE9-\\u1CEC\\u1CEE-\\u1CF1\\u1CF5\\u1CF6\\u1D00-\\u1DBF\\u1E00-\\u1F15\\u1F18-\\u1F1D\\u1F20-\\u1F45\\u1F48-\\u1F4D\\u1F50-\\u1F57\\u1F59\\u1F5B\\u1F5D\\u1F5F-\\u1F7D\\u1F80-\\u1FB4\\u1FB6-\\u1FBC\\u1FBE\\u1FC2-\\u1FC4\\u1FC6-\\u1FCC\\u1FD0-\\u1FD3\\u1FD6-\\u1FDB\\u1FE0-\\u1FEC\\u1FF2-\\u1FF4\\u1FF6-\\u1FFC\\u2071\\u207F\\u2090-\\u209C\\u2102\\u2107\\u210A-\\u2113\\u2115\\u2119-\\u211D\\u2124\\u2126\\u2128\\u212A-\\u212D\\u212F-\\u2139\\u213C-\\u213F\\u2145-\\u2149\\u214E\\u2183\\u2184\\u2C00-\\u2C2E\\u2C30-\\u2C5E\\u2C60-\\u2CE4\\u2CEB-\\u2CEE\\u2CF2\\u2CF3\\u2D00-\\u2D25\\u2D27\\u2D2D\\u2D30-\\u2D67\\u2D6F\\u2D80-\\u2D96\\u2DA0-\\u2DA6\\u2DA8-\\u2DAE\\u2DB0-\\u2DB6\\u2DB8-\\u2DBE\\u2DC0-\\u2DC6\\u2DC8-\\u2DCE\\u2DD0-\\u2DD6\\u2DD8-\\u2DDE\\u2E2F\\u3005\\u3006\\u3031-\\u3035\\u303B\\u303C\\u3041-\\u3096\\u309D-\\u309F\\u30A1-\\u30FA\\u30FC-\\u30FF\\u3105-\\u312E\\u3131-\\u318E\\u31A0-\\u31BA\\u31F0-\\u31FF\\u3400-\\u4DB5\\u4E00-\\u9FEA\\uA000-\\uA48C\\uA4D0-\\uA4FD\\uA500-\\uA60C\\uA610-\\uA61F\\uA62A\\uA62B\\uA640-\\uA66E\\uA67F-\\uA69D\\uA6A0-\\uA6E5\\uA717-\\uA71F\\uA722-\\uA788\\uA78B-\\uA7AE\\uA7B0-\\uA7B7\\uA7F7-\\uA801\\uA803-\\uA805\\uA807-\\uA80A\\uA80C-\\uA822\\uA840-\\uA873\\uA882-\\uA8B3\\uA8F2-\\uA8F7\\uA8FB\\uA8FD\\uA90A-\\uA925\\uA930-\\uA946\\uA960-\\uA97C\\uA984-\\uA9B2\\uA9CF\\uA9E0-\\uA9E4\\uA9E6-\\uA9EF\\uA9FA-\\uA9FE\\uAA00-\\uAA28\\uAA40-\\uAA42\\uAA44-\\uAA4B\\uAA60-\\uAA76\\uAA7A\\uAA7E-\\uAAAF\\uAAB1\\uAAB5\\uAAB6\\uAAB9-\\uAABD\\uAAC0\\uAAC2\\uAADB-\\uAADD\\uAAE0-\\uAAEA\\uAAF2-\\uAAF4\\uAB01-\\uAB06\\uAB09-\\uAB0E\\uAB11-\\uAB16\\uAB20-\\uAB26\\uAB28-\\uAB2E\\uAB30-\\uAB5A\\uAB5C-\\uAB65\\uAB70-\\uABE2\\uAC00-\\uD7A3\\uD7B0-\\uD7C6\\uD7CB-\\uD7FB\\uF900-\\uFA6D\\uFA70-\\uFAD9\\uFB00-\\uFB06\\uFB13-\\uFB17\\uFB1D\\uFB1F-\\uFB28\\uFB2A-\\uFB36\\uFB38-\\uFB3C\\uFB3E\\uFB40\\uFB41\\uFB43\\uFB44\\uFB46-\\uFBB1\\uFBD3-\\uFD3D\\uFD50-\\uFD8F\\uFD92-\\uFDC7\\uFDF0-\\uFDFB\\uFE70-\\uFE74\\uFE76-\\uFEFC\\uFF21-\\uFF3A\\uFF41-\\uFF5A\\uFF66-\\uFFBE\\uFFC2-\\uFFC7\\uFFCA-\\uFFCF\\uFFD2-\\uFFD7\\uFFDA-\\uFFDC]|\\uD800[\\uDC00-\\uDC0B\\uDC0D-\\uDC26\\uDC28-\\uDC3A\\uDC3C\\uDC3D\\uDC3F-\\uDC4D\\uDC50-\\uDC5D\\uDC80-\\uDCFA\\uDE80-\\uDE9C\\uDEA0-\\uDED0\\uDF00-\\uDF1F\\uDF2D-\\uDF40\\uDF42-\\uDF49\\uDF50-\\uDF75\\uDF80-\\uDF9D\\uDFA0-\\uDFC3\\uDFC8-\\uDFCF]|\\uD801[\\uDC00-\\uDC9D\\uDCB0-\\uDCD3\\uDCD8-\\uDCFB\\uDD00-\\uDD27\\uDD30-\\uDD63\\uDE00-\\uDF36\\uDF40-\\uDF55\\uDF60-\\uDF67]|\\uD802[\\uDC00-\\uDC05\\uDC08\\uDC0A-\\uDC35\\uDC37\\uDC38\\uDC3C\\uDC3F-\\uDC55\\uDC60-\\uDC76\\uDC80-\\uDC9E\\uDCE0-\\uDCF2\\uDCF4\\uDCF5\\uDD00-\\uDD15\\uDD20-\\uDD39\\uDD80-\\uDDB7\\uDDBE\\uDDBF\\uDE00\\uDE10-\\uDE13\\uDE15-\\uDE17\\uDE19-\\uDE33\\uDE60-\\uDE7C\\uDE80-\\uDE9C\\uDEC0-\\uDEC7\\uDEC9-\\uDEE4\\uDF00-\\uDF35\\uDF40-\\uDF55\\uDF60-\\uDF72\\uDF80-\\uDF91]|\\uD803[\\uDC00-\\uDC48\\uDC80-\\uDCB2\\uDCC0-\\uDCF2]|\\uD804[\\uDC03-\\uDC37\\uDC83-\\uDCAF\\uDCD0-\\uDCE8\\uDD03-\\uDD26\\uDD50-\\uDD72\\uDD76\\uDD83-\\uDDB2\\uDDC1-\\uDDC4\\uDDDA\\uDDDC\\uDE00-\\uDE11\\uDE13-\\uDE2B\\uDE80-\\uDE86\\uDE88\\uDE8A-\\uDE8D\\uDE8F-\\uDE9D\\uDE9F-\\uDEA8\\uDEB0-\\uDEDE\\uDF05-\\uDF0C\\uDF0F\\uDF10\\uDF13-\\uDF28\\uDF2A-\\uDF30\\uDF32\\uDF33\\uDF35-\\uDF39\\uDF3D\\uDF50\\uDF5D-\\uDF61]|\\uD805[\\uDC00-\\uDC34\\uDC47-\\uDC4A\\uDC80-\\uDCAF\\uDCC4\\uDCC5\\uDCC7\\uDD80-\\uDDAE\\uDDD8-\\uDDDB\\uDE00-\\uDE2F\\uDE44\\uDE80-\\uDEAA\\uDF00-\\uDF19]|\\uD806[\\uDCA0-\\uDCDF\\uDCFF\\uDE00\\uDE0B-\\uDE32\\uDE3A\\uDE50\\uDE5C-\\uDE83\\uDE86-\\uDE89\\uDEC0-\\uDEF8]|\\uD807[\\uDC00-\\uDC08\\uDC0A-\\uDC2E\\uDC40\\uDC72-\\uDC8F\\uDD00-\\uDD06\\uDD08\\uDD09\\uDD0B-\\uDD30\\uDD46]|\\uD808[\\uDC00-\\uDF99]|\\uD809[\\uDC80-\\uDD43]|[\\uD80C\\uD81C-\\uD820\\uD840-\\uD868\\uD86A-\\uD86C\\uD86F-\\uD872\\uD874-\\uD879][\\uDC00-\\uDFFF]|\\uD80D[\\uDC00-\\uDC2E]|\\uD811[\\uDC00-\\uDE46]|\\uD81A[\\uDC00-\\uDE38\\uDE40-\\uDE5E\\uDED0-\\uDEED\\uDF00-\\uDF2F\\uDF40-\\uDF43\\uDF63-\\uDF77\\uDF7D-\\uDF8F]|\\uD81B[\\uDF00-\\uDF44\\uDF50\\uDF93-\\uDF9F\\uDFE0\\uDFE1]|\\uD821[\\uDC00-\\uDFEC]|\\uD822[\\uDC00-\\uDEF2]|\\uD82C[\\uDC00-\\uDD1E\\uDD70-\\uDEFB]|\\uD82F[\\uDC00-\\uDC6A\\uDC70-\\uDC7C\\uDC80-\\uDC88\\uDC90-\\uDC99]|\\uD835[\\uDC00-\\uDC54\\uDC56-\\uDC9C\\uDC9E\\uDC9F\\uDCA2\\uDCA5\\uDCA6\\uDCA9-\\uDCAC\\uDCAE-\\uDCB9\\uDCBB\\uDCBD-\\uDCC3\\uDCC5-\\uDD05\\uDD07-\\uDD0A\\uDD0D-\\uDD14\\uDD16-\\uDD1C\\uDD1E-\\uDD39\\uDD3B-\\uDD3E\\uDD40-\\uDD44\\uDD46\\uDD4A-\\uDD50\\uDD52-\\uDEA5\\uDEA8-\\uDEC0\\uDEC2-\\uDEDA\\uDEDC-\\uDEFA\\uDEFC-\\uDF14\\uDF16-\\uDF34\\uDF36-\\uDF4E\\uDF50-\\uDF6E\\uDF70-\\uDF88\\uDF8A-\\uDFA8\\uDFAA-\\uDFC2\\uDFC4-\\uDFCB]|\\uD83A[\\uDC00-\\uDCC4\\uDD00-\\uDD43]|\\uD83B[\\uDE00-\\uDE03\\uDE05-\\uDE1F\\uDE21\\uDE22\\uDE24\\uDE27\\uDE29-\\uDE32\\uDE34-\\uDE37\\uDE39\\uDE3B\\uDE42\\uDE47\\uDE49\\uDE4B\\uDE4D-\\uDE4F\\uDE51\\uDE52\\uDE54\\uDE57\\uDE59\\uDE5B\\uDE5D\\uDE5F\\uDE61\\uDE62\\uDE64\\uDE67-\\uDE6A\\uDE6C-\\uDE72\\uDE74-\\uDE77\\uDE79-\\uDE7C\\uDE7E\\uDE80-\\uDE89\\uDE8B-\\uDE9B\\uDEA1-\\uDEA3\\uDEA5-\\uDEA9\\uDEAB-\\uDEBB]|\\uD869[\\uDC00-\\uDED6\\uDF00-\\uDFFF]|\\uD86D[\\uDC00-\\uDF34\\uDF40-\\uDFFF]|\\uD86E[\\uDC00-\\uDC1D\\uDC20-\\uDFFF]|\\uD873[\\uDC00-\\uDEA1\\uDEB0-\\uDFFF]|\\uD87A[\\uDC00-\\uDFE0]|\\uD87E[\\uDC00-\\uDE1D])\\S*/g;\n/**\n * Transforms text to title case.\n * Capitalizes the first letter of each word and transforms the\n * rest of the word to lower case.\n * Words are delimited by any whitespace character, such as a space, tab, or line-feed character.\n *\n * @see `LowerCasePipe`\n * @see `UpperCasePipe`\n *\n * @usageNotes\n * The following example shows the result of transforming various strings into title case.\n *\n * \n *\n * @ngModule CommonModule\n * @publicApi\n */\nclass TitleCasePipe {\n transform(value) {\n if (value == null)\n return null;\n if (typeof value !== 'string') {\n throw invalidPipeArgumentError(TitleCasePipe, value);\n }\n return value.replace(unicodeWordMatch, (txt => txt[0].toUpperCase() + txt.substr(1).toLowerCase()));\n }\n}\nTitleCasePipe.ɵfac = function TitleCasePipe_Factory(t) { return new (t || TitleCasePipe)(); };\nTitleCasePipe.ɵpipe = ɵngcc0.ɵɵdefinePipe({ name: \"titlecase\", type: TitleCasePipe, pure: true });\n/*@__PURE__*/ (function () { ɵngcc0.ɵsetClassMetadata(TitleCasePipe, [{\n type: Pipe,\n args: [{ name: 'titlecase' }]\n }], null, null); })();\n/**\n * Transforms text to all upper case.\n * @see `LowerCasePipe`\n * @see `TitleCasePipe`\n *\n * @ngModule CommonModule\n * @publicApi\n */\nclass UpperCasePipe {\n transform(value) {\n if (value == null)\n return null;\n if (typeof value !== 'string') {\n throw invalidPipeArgumentError(UpperCasePipe, value);\n }\n return value.toUpperCase();\n }\n}\nUpperCasePipe.ɵfac = function UpperCasePipe_Factory(t) { return new (t || UpperCasePipe)(); };\nUpperCasePipe.ɵpipe = ɵngcc0.ɵɵdefinePipe({ name: \"uppercase\", type: UpperCasePipe, pure: true });\n/*@__PURE__*/ (function () { ɵngcc0.ɵsetClassMetadata(UpperCasePipe, [{\n type: Pipe,\n args: [{ name: 'uppercase' }]\n }], null, null); })();\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n// clang-format off\n/**\n * @ngModule CommonModule\n * @description\n *\n * Formats a date value according to locale rules.\n *\n * Only the `en-US` locale data comes with Angular. To localize dates\n * in another language, you must import the corresponding locale data.\n * See the [I18n guide](guide/i18n#i18n-pipes) for more information.\n *\n * @see `formatDate()`\n *\n *\n * @usageNotes\n *\n * The result of this pipe is not reevaluated when the input is mutated. To avoid the need to\n * reformat the date on every change-detection cycle, treat the date as an immutable object\n * and change the reference when the pipe needs to run again.\n *\n * ### Pre-defined format options\n *\n * | Option | Equivalent to | Examples (given in `en-US` locale) |\n * |---------------|-------------------------------------|-------------------------------------------------|\n * | `'short'` | `'M/d/yy, h:mm a'` | `6/15/15, 9:03 AM` |\n * | `'medium'` | `'MMM d, y, h:mm:ss a'` | `Jun 15, 2015, 9:03:01 AM` |\n * | `'long'` | `'MMMM d, y, h:mm:ss a z'` | `June 15, 2015 at 9:03:01 AM GMT+1` |\n * | `'full'` | `'EEEE, MMMM d, y, h:mm:ss a zzzz'` | `Monday, June 15, 2015 at 9:03:01 AM GMT+01:00` |\n * | `'shortDate'` | `'M/d/yy'` | `6/15/15` |\n * | `'mediumDate'`| `'MMM d, y'` | `Jun 15, 2015` |\n * | `'longDate'` | `'MMMM d, y'` | `June 15, 2015` |\n * | `'fullDate'` | `'EEEE, MMMM d, y'` | `Monday, June 15, 2015` |\n * | `'shortTime'` | `'h:mm a'` | `9:03 AM` |\n * | `'mediumTime'`| `'h:mm:ss a'` | `9:03:01 AM` |\n * | `'longTime'` | `'h:mm:ss a z'` | `9:03:01 AM GMT+1` |\n * | `'fullTime'` | `'h:mm:ss a zzzz'` | `9:03:01 AM GMT+01:00` |\n *\n * ### Custom format options\n *\n * You can construct a format string using symbols to specify the components\n * of a date-time value, as described in the following table.\n * Format details depend on the locale.\n * Fields marked with (*) are only available in the extra data set for the given locale.\n *\n * | Field type | Format | Description | Example Value |\n * |--------------------|-------------|---------------------------------------------------------------|------------------------------------------------------------|\n * | Era | G, GG & GGG | Abbreviated | AD |\n * | | GGGG | Wide | Anno Domini |\n * | | GGGGG | Narrow | A |\n * | Year | y | Numeric: minimum digits | 2, 20, 201, 2017, 20173 |\n * | | yy | Numeric: 2 digits + zero padded | 02, 20, 01, 17, 73 |\n * | | yyy | Numeric: 3 digits + zero padded | 002, 020, 201, 2017, 20173 |\n * | | yyyy | Numeric: 4 digits or more + zero padded | 0002, 0020, 0201, 2017, 20173 |\n * | Week-numbering year| Y | Numeric: minimum digits | 2, 20, 201, 2017, 20173 |\n * | | YY | Numeric: 2 digits + zero padded | 02, 20, 01, 17, 73 |\n * | | YYY | Numeric: 3 digits + zero padded | 002, 020, 201, 2017, 20173 |\n * | | YYYY | Numeric: 4 digits or more + zero padded | 0002, 0020, 0201, 2017, 20173 |\n * | Month | M | Numeric: 1 digit | 9, 12 |\n * | | MM | Numeric: 2 digits + zero padded | 09, 12 |\n * | | MMM | Abbreviated | Sep |\n * | | MMMM | Wide | September |\n * | | MMMMM | Narrow | S |\n * | Month standalone | L | Numeric: 1 digit | 9, 12 |\n * | | LL | Numeric: 2 digits + zero padded | 09, 12 |\n * | | LLL | Abbreviated | Sep |\n * | | LLLL | Wide | September |\n * | | LLLLL | Narrow | S |\n * | Week of year | w | Numeric: minimum digits | 1... 53 |\n * | | ww | Numeric: 2 digits + zero padded | 01... 53 |\n * | Week of month | W | Numeric: 1 digit | 1... 5 |\n * | Day of month | d | Numeric: minimum digits | 1 |\n * | | dd | Numeric: 2 digits + zero padded | 01 |\n * | Week day | E, EE & EEE | Abbreviated | Tue |\n * | | EEEE | Wide | Tuesday |\n * | | EEEEE | Narrow | T |\n * | | EEEEEE | Short | Tu |\n * | Period | a, aa & aaa | Abbreviated | am/pm or AM/PM |\n * | | aaaa | Wide (fallback to `a` when missing) | ante meridiem/post meridiem |\n * | | aaaaa | Narrow | a/p |\n * | Period* | B, BB & BBB | Abbreviated | mid. |\n * | | BBBB | Wide | am, pm, midnight, noon, morning, afternoon, evening, night |\n * | | BBBBB | Narrow | md |\n * | Period standalone* | b, bb & bbb | Abbreviated | mid. |\n * | | bbbb | Wide | am, pm, midnight, noon, morning, afternoon, evening, night |\n * | | bbbbb | Narrow | md |\n * | Hour 1-12 | h | Numeric: minimum digits | 1, 12 |\n * | | hh | Numeric: 2 digits + zero padded | 01, 12 |\n * | Hour 0-23 | H | Numeric: minimum digits | 0, 23 |\n * | | HH | Numeric: 2 digits + zero padded | 00, 23 |\n * | Minute | m | Numeric: minimum digits | 8, 59 |\n * | | mm | Numeric: 2 digits + zero padded | 08, 59 |\n * | Second | s | Numeric: minimum digits | 0... 59 |\n * | | ss | Numeric: 2 digits + zero padded | 00... 59 |\n * | Fractional seconds | S | Numeric: 1 digit | 0... 9 |\n * | | SS | Numeric: 2 digits + zero padded | 00... 99 |\n * | | SSS | Numeric: 3 digits + zero padded (= milliseconds) | 000... 999 |\n * | Zone | z, zz & zzz | Short specific non location format (fallback to O) | GMT-8 |\n * | | zzzz | Long specific non location format (fallback to OOOO) | GMT-08:00 |\n * | | Z, ZZ & ZZZ | ISO8601 basic format | -0800 |\n * | | ZZZZ | Long localized GMT format | GMT-8:00 |\n * | | ZZZZZ | ISO8601 extended format + Z indicator for offset 0 (= XXXXX) | -08:00 |\n * | | O, OO & OOO | Short localized GMT format | GMT-8 |\n * | | OOOO | Long localized GMT format | GMT-08:00 |\n *\n * Note that timezone correction is not applied to an ISO string that has no time component, such as \"2016-09-19\"\n *\n * ### Format examples\n *\n * These examples transform a date into various formats,\n * assuming that `dateObj` is a JavaScript `Date` object for\n * year: 2015, month: 6, day: 15, hour: 21, minute: 43, second: 11,\n * given in the local time for the `en-US` locale.\n *\n * ```\n * {{ dateObj | date }} // output is 'Jun 15, 2015'\n * {{ dateObj | date:'medium' }} // output is 'Jun 15, 2015, 9:43:11 PM'\n * {{ dateObj | date:'shortTime' }} // output is '9:43 PM'\n * {{ dateObj | date:'mm:ss' }} // output is '43:11'\n * ```\n *\n * ### Usage example\n *\n * The following component uses a date pipe to display the current date in different formats.\n *\n * ```\n * @Component({\n * selector: 'date-pipe',\n * template: `\n *
Today is {{today | date}}
\n *
Or if you prefer, {{today | date:'fullDate'}}
\n *
The time is {{today | date:'h:mm a z'}}
\n *
\n *\n * **Deprecation notice:**\n *\n * The default currency code is currently always `USD` but this is deprecated from v9.\n *\n * **In v11 the default currency code will be taken from the current locale identified by\n * the `LOCAL_ID` token. See the [i18n guide](guide/i18n#setting-up-the-locale-of-your-app) for\n * more information.**\n *\n * If you need the previous behavior then set it by creating a `DEFAULT_CURRENCY_CODE` provider in\n * your application `NgModule`:\n *\n * ```ts\n * {provide: DEFAULT_CURRENCY_CODE, useValue: 'USD'}\n * ```\n *\n *
\n *\n * @see `getCurrencySymbol()`\n * @see `formatCurrency()`\n *\n * @usageNotes\n * The following code shows how the pipe transforms numbers\n * into text strings, according to various format specifications,\n * where the caller's default locale is `en-US`.\n *\n * \n *\n * @publicApi\n */\nclass CurrencyPipe {\n constructor(_locale, _defaultCurrencyCode = 'USD') {\n this._locale = _locale;\n this._defaultCurrencyCode = _defaultCurrencyCode;\n }\n transform(value, currencyCode, display = 'symbol', digitsInfo, locale) {\n if (!isValue(value))\n return null;\n locale = locale || this._locale;\n if (typeof display === 'boolean') {\n if ((typeof ngDevMode === 'undefined' || ngDevMode) && console && console.warn) {\n console.warn(`Warning: the currency pipe has been changed in Angular v5. The symbolDisplay option (third parameter) is now a string instead of a boolean. The accepted values are \"code\", \"symbol\" or \"symbol-narrow\".`);\n }\n display = display ? 'symbol' : 'code';\n }\n let currency = currencyCode || this._defaultCurrencyCode;\n if (display !== 'code') {\n if (display === 'symbol' || display === 'symbol-narrow') {\n currency = getCurrencySymbol(currency, display === 'symbol' ? 'wide' : 'narrow', locale);\n }\n else {\n currency = display;\n }\n }\n try {\n const num = strToNumber(value);\n return formatCurrency(num, locale, currency, currencyCode, digitsInfo);\n }\n catch (error) {\n throw invalidPipeArgumentError(CurrencyPipe, error.message);\n }\n }\n}\nCurrencyPipe.ɵfac = function CurrencyPipe_Factory(t) { return new (t || CurrencyPipe)(ɵngcc0.ɵɵdirectiveInject(LOCALE_ID), ɵngcc0.ɵɵdirectiveInject(DEFAULT_CURRENCY_CODE)); };\nCurrencyPipe.ɵpipe = ɵngcc0.ɵɵdefinePipe({ name: \"currency\", type: CurrencyPipe, pure: true });\nCurrencyPipe.ctorParameters = () => [\n { type: String, decorators: [{ type: Inject, args: [LOCALE_ID,] }] },\n { type: String, decorators: [{ type: Inject, args: [DEFAULT_CURRENCY_CODE,] }] }\n];\n/*@__PURE__*/ (function () { ɵngcc0.ɵsetClassMetadata(CurrencyPipe, [{\n type: Pipe,\n args: [{ name: 'currency' }]\n }], function () { return [{ type: String, decorators: [{\n type: Inject,\n args: [LOCALE_ID]\n }] }, { type: String, decorators: [{\n type: Inject,\n args: [DEFAULT_CURRENCY_CODE]\n }] }]; }, null); })();\nfunction isValue(value) {\n return !(value == null || value === '' || value !== value);\n}\n/**\n * Transforms a string into a number (if needed).\n */\nfunction strToNumber(value) {\n // Convert strings to numbers\n if (typeof value === 'string' && !isNaN(Number(value) - parseFloat(value))) {\n return Number(value);\n }\n if (typeof value !== 'number') {\n throw new Error(`${value} is not a number`);\n }\n return value;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * @ngModule CommonModule\n * @description\n *\n * Creates a new `Array` or `String` containing a subset (slice) of the elements.\n *\n * @usageNotes\n *\n * All behavior is based on the expected behavior of the JavaScript API `Array.prototype.slice()`\n * and `String.prototype.slice()`.\n *\n * When operating on an `Array`, the returned `Array` is always a copy even when all\n * the elements are being returned.\n *\n * When operating on a blank value, the pipe returns the blank value.\n *\n * ### List Example\n *\n * This `ngFor` example:\n *\n * {@example common/pipes/ts/slice_pipe.ts region='SlicePipe_list'}\n *\n * produces the following:\n *\n * ```html\n * b\n * c\n * ```\n *\n * ### String Examples\n *\n * {@example common/pipes/ts/slice_pipe.ts region='SlicePipe_string'}\n *\n * @publicApi\n */\nclass SlicePipe {\n transform(value, start, end) {\n if (value == null)\n return null;\n if (!this.supports(value)) {\n throw invalidPipeArgumentError(SlicePipe, value);\n }\n return value.slice(start, end);\n }\n supports(obj) {\n return typeof obj === 'string' || Array.isArray(obj);\n }\n}\nSlicePipe.ɵfac = function SlicePipe_Factory(t) { return new (t || SlicePipe)(); };\nSlicePipe.ɵpipe = ɵngcc0.ɵɵdefinePipe({ name: \"slice\", type: SlicePipe, pure: false });\n/*@__PURE__*/ (function () { ɵngcc0.ɵsetClassMetadata(SlicePipe, [{\n type: Pipe,\n args: [{ name: 'slice', pure: false }]\n }], null, null); })();\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * A collection of Angular pipes that are likely to be used in each and every application.\n */\nconst COMMON_PIPES = [\n AsyncPipe,\n UpperCasePipe,\n LowerCasePipe,\n JsonPipe,\n SlicePipe,\n DecimalPipe,\n PercentPipe,\n TitleCasePipe,\n CurrencyPipe,\n DatePipe,\n I18nPluralPipe,\n I18nSelectPipe,\n KeyValuePipe,\n];\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n// Note: This does not contain the location providers,\n// as they need some platform specific implementations to work.\n/**\n * Exports all the basic Angular directives and pipes,\n * such as `NgIf`, `NgForOf`, `DecimalPipe`, and so on.\n * Re-exported by `BrowserModule`, which is included automatically in the root\n * `AppModule` when you create a new app with the CLI `new` command.\n *\n * * The `providers` options configure the NgModule's injector to provide\n * localization dependencies to members.\n * * The `exports` options make the declared directives and pipes available for import\n * by other NgModules.\n *\n * @publicApi\n */\nclass CommonModule {\n}\nCommonModule.ɵmod = ɵngcc0.ɵɵdefineNgModule({ type: CommonModule });\nCommonModule.ɵinj = ɵngcc0.ɵɵdefineInjector({ factory: function CommonModule_Factory(t) { return new (t || CommonModule)(); }, providers: [\n { provide: NgLocalization, useClass: NgLocaleLocalization },\n ] });\n(function () { (typeof ngJitMode === \"undefined\" || ngJitMode) && ɵngcc0.ɵɵsetNgModuleScope(CommonModule, { declarations: [NgClass, NgComponentOutlet, NgForOf, NgIf, NgTemplateOutlet, NgStyle, NgSwitch, NgSwitchCase, NgSwitchDefault, NgPlural, NgPluralCase, AsyncPipe, UpperCasePipe, LowerCasePipe, JsonPipe, SlicePipe, DecimalPipe, PercentPipe, TitleCasePipe, CurrencyPipe, DatePipe, I18nPluralPipe, I18nSelectPipe, KeyValuePipe], exports: [NgClass, NgComponentOutlet, NgForOf, NgIf, NgTemplateOutlet, NgStyle, NgSwitch, NgSwitchCase, NgSwitchDefault, NgPlural, NgPluralCase, AsyncPipe, UpperCasePipe, LowerCasePipe, JsonPipe, SlicePipe, DecimalPipe, PercentPipe, TitleCasePipe, CurrencyPipe, DatePipe, I18nPluralPipe, I18nSelectPipe, KeyValuePipe] }); })();\n/*@__PURE__*/ (function () { ɵngcc0.ɵsetClassMetadata(CommonModule, [{\n type: NgModule,\n args: [{\n declarations: [COMMON_DIRECTIVES, COMMON_PIPES],\n exports: [COMMON_DIRECTIVES, COMMON_PIPES],\n providers: [\n { provide: NgLocalization, useClass: NgLocaleLocalization },\n ]\n }]\n }], null, null); })();\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nconst PLATFORM_BROWSER_ID = 'browser';\nconst PLATFORM_SERVER_ID = 'server';\nconst PLATFORM_WORKER_APP_ID = 'browserWorkerApp';\nconst PLATFORM_WORKER_UI_ID = 'browserWorkerUi';\n/**\n * Returns whether a platform id represents a browser platform.\n * @publicApi\n */\nfunction isPlatformBrowser(platformId) {\n return platformId === PLATFORM_BROWSER_ID;\n}\n/**\n * Returns whether a platform id represents a server platform.\n * @publicApi\n */\nfunction isPlatformServer(platformId) {\n return platformId === PLATFORM_SERVER_ID;\n}\n/**\n * Returns whether a platform id represents a web worker app platform.\n * @publicApi\n */\nfunction isPlatformWorkerApp(platformId) {\n return platformId === PLATFORM_WORKER_APP_ID;\n}\n/**\n * Returns whether a platform id represents a web worker UI platform.\n * @publicApi\n */\nfunction isPlatformWorkerUi(platformId) {\n return platformId === PLATFORM_WORKER_UI_ID;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * @publicApi\n */\nconst VERSION = new Version('11.0.9');\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Defines a scroll position manager. Implemented by `BrowserViewportScroller`.\n *\n * @publicApi\n */\nclass ViewportScroller {\n}\n// De-sugared tree-shakable injection\n// See #23917\n/** @nocollapse */\nViewportScroller.ɵprov = ɵɵdefineInjectable({\n token: ViewportScroller,\n providedIn: 'root',\n factory: () => new BrowserViewportScroller(ɵɵinject(DOCUMENT), window)\n});\n/**\n * Manages the scroll position for a browser window.\n */\nclass BrowserViewportScroller {\n constructor(document, window) {\n this.document = document;\n this.window = window;\n this.offset = () => [0, 0];\n }\n /**\n * Configures the top offset used when scrolling to an anchor.\n * @param offset A position in screen coordinates (a tuple with x and y values)\n * or a function that returns the top offset position.\n *\n */\n setOffset(offset) {\n if (Array.isArray(offset)) {\n this.offset = () => offset;\n }\n else {\n this.offset = offset;\n }\n }\n /**\n * Retrieves the current scroll position.\n * @returns The position in screen coordinates.\n */\n getScrollPosition() {\n if (this.supportsScrolling()) {\n return [this.window.pageXOffset, this.window.pageYOffset];\n }\n else {\n return [0, 0];\n }\n }\n /**\n * Sets the scroll position.\n * @param position The new position in screen coordinates.\n */\n scrollToPosition(position) {\n if (this.supportsScrolling()) {\n this.window.scrollTo(position[0], position[1]);\n }\n }\n /**\n * Scrolls to an element and attempts to focus the element.\n *\n * Note that the function name here is misleading in that the target string may be an ID for a\n * non-anchor element.\n *\n * @param target The ID of an element or name of the anchor.\n *\n * @see https://html.spec.whatwg.org/#the-indicated-part-of-the-document\n * @see https://html.spec.whatwg.org/#scroll-to-fragid\n */\n scrollToAnchor(target) {\n var _a;\n if (!this.supportsScrolling()) {\n return;\n }\n // TODO(atscott): The correct behavior for `getElementsByName` would be to also verify that the\n // element is an anchor. However, this could be considered a breaking change and should be\n // done in a major version.\n const elSelected = (_a = this.document.getElementById(target)) !== null && _a !== void 0 ? _a : this.document.getElementsByName(target)[0];\n if (elSelected === undefined) {\n return;\n }\n this.scrollToElement(elSelected);\n // After scrolling to the element, the spec dictates that we follow the focus steps for the\n // target. Rather than following the robust steps, simply attempt focus.\n this.attemptFocus(elSelected);\n }\n /**\n * Disables automatic scroll restoration provided by the browser.\n */\n setHistoryScrollRestoration(scrollRestoration) {\n if (this.supportScrollRestoration()) {\n const history = this.window.history;\n if (history && history.scrollRestoration) {\n history.scrollRestoration = scrollRestoration;\n }\n }\n }\n /**\n * Scrolls to an element using the native offset and the specified offset set on this scroller.\n *\n * The offset can be used when we know that there is a floating header and scrolling naively to an\n * element (ex: `scrollIntoView`) leaves the element hidden behind the floating header.\n */\n scrollToElement(el) {\n const rect = el.getBoundingClientRect();\n const left = rect.left + this.window.pageXOffset;\n const top = rect.top + this.window.pageYOffset;\n const offset = this.offset();\n this.window.scrollTo(left - offset[0], top - offset[1]);\n }\n /**\n * Calls `focus` on the `focusTarget` and returns `true` if the element was focused successfully.\n *\n * If `false`, further steps may be necessary to determine a valid substitute to be focused\n * instead.\n *\n * @see https://html.spec.whatwg.org/#get-the-focusable-area\n * @see https://developer.mozilla.org/en-US/docs/Web/API/HTMLOrForeignElement/focus\n * @see https://html.spec.whatwg.org/#focusable-area\n */\n attemptFocus(focusTarget) {\n focusTarget.focus();\n return this.document.activeElement === focusTarget;\n }\n /**\n * We only support scroll restoration when we can get a hold of window.\n * This means that we do not support this behavior when running in a web worker.\n *\n * Lifting this restriction right now would require more changes in the dom adapter.\n * Since webworkers aren't widely used, we will lift it once RouterScroller is\n * battle-tested.\n */\n supportScrollRestoration() {\n try {\n if (!this.supportsScrolling()) {\n return false;\n }\n // The `scrollRestoration` property could be on the `history` instance or its prototype.\n const scrollRestorationDescriptor = getScrollRestorationProperty(this.window.history) ||\n getScrollRestorationProperty(Object.getPrototypeOf(this.window.history));\n // We can write to the `scrollRestoration` property if it is a writable data field or it has a\n // setter function.\n return !!scrollRestorationDescriptor &&\n !!(scrollRestorationDescriptor.writable || scrollRestorationDescriptor.set);\n }\n catch (_a) {\n return false;\n }\n }\n supportsScrolling() {\n try {\n return !!this.window && !!this.window.scrollTo && 'pageXOffset' in this.window;\n }\n catch (_a) {\n return false;\n }\n }\n}\nfunction getScrollRestorationProperty(obj) {\n return Object.getOwnPropertyDescriptor(obj, 'scrollRestoration');\n}\n/**\n * Provides an empty implementation of the viewport scroller.\n */\nclass NullViewportScroller {\n /**\n * Empty implementation\n */\n setOffset(offset) { }\n /**\n * Empty implementation\n */\n getScrollPosition() {\n return [0, 0];\n }\n /**\n * Empty implementation\n */\n scrollToPosition(position) { }\n /**\n * Empty implementation\n */\n scrollToAnchor(anchor) { }\n /**\n * Empty implementation\n */\n setHistoryScrollRestoration(scrollRestoration) { }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n// This file only reexports content of the `src` folder. Keep it that way.\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * Generated bundle index. Do not edit.\n */\n\nexport { APP_BASE_HREF, AsyncPipe, CommonModule, CurrencyPipe, DOCUMENT, DatePipe, DecimalPipe, FormStyle, FormatWidth, HashLocationStrategy, I18nPluralPipe, I18nSelectPipe, JsonPipe, KeyValuePipe, LOCATION_INITIALIZED, Location, LocationStrategy, LowerCasePipe, NgClass, NgComponentOutlet, NgForOf, NgForOfContext, NgIf, NgIfContext, NgLocaleLocalization, NgLocalization, NgPlural, NgPluralCase, NgStyle, NgSwitch, NgSwitchCase, NgSwitchDefault, NgTemplateOutlet, NumberFormatStyle, NumberSymbol, PathLocationStrategy, PercentPipe, PlatformLocation, Plural, SlicePipe, TitleCasePipe, TranslationWidth, UpperCasePipe, VERSION, ViewportScroller, WeekDay, formatCurrency, formatDate, formatNumber, formatPercent, getCurrencySymbol, getLocaleCurrencyCode, getLocaleCurrencyName, getLocaleCurrencySymbol, getLocaleDateFormat, getLocaleDateTimeFormat, getLocaleDayNames, getLocaleDayPeriods, getLocaleDirection, getLocaleEraNames, getLocaleExtraDayPeriodRules, getLocaleExtraDayPeriods, getLocaleFirstDayOfWeek, getLocaleId, getLocaleMonthNames, getLocaleNumberFormat, getLocaleNumberSymbol, getLocalePluralCase, getLocaleTimeFormat, getLocaleWeekEndRange, getNumberOfCurrencyDigits, isPlatformBrowser, isPlatformServer, isPlatformWorkerApp, isPlatformWorkerUi, registerLocaleData, BrowserPlatformLocation as ɵBrowserPlatformLocation, DomAdapter as ɵDomAdapter, NullViewportScroller as ɵNullViewportScroller, PLATFORM_BROWSER_ID as ɵPLATFORM_BROWSER_ID, PLATFORM_SERVER_ID as ɵPLATFORM_SERVER_ID, PLATFORM_WORKER_APP_ID as ɵPLATFORM_WORKER_APP_ID, PLATFORM_WORKER_UI_ID as ɵPLATFORM_WORKER_UI_ID, useBrowserPlatformLocation as ɵangular_packages_common_common_a, createBrowserPlatformLocation as ɵangular_packages_common_common_b, createLocation as ɵangular_packages_common_common_c, provideLocationStrategy as ɵangular_packages_common_common_d, COMMON_DIRECTIVES as ɵangular_packages_common_common_e, COMMON_PIPES as ɵangular_packages_common_common_f, getDOM as ɵgetDOM, parseCookieValue as ɵparseCookieValue, setRootDomAdapter as ɵsetRootDomAdapter };\n\n//# sourceMappingURL=common.js.map","// prev/next buttons\n( function( window, factory ) {\n // universal module definition\n if ( typeof define == 'function' && define.amd ) {\n // AMD\n define( [\n './flickity',\n 'unipointer/unipointer',\n 'fizzy-ui-utils/utils',\n ], function( Flickity, Unipointer, utils ) {\n return factory( window, Flickity, Unipointer, utils );\n } );\n } else if ( typeof module == 'object' && module.exports ) {\n // CommonJS\n module.exports = factory(\n window,\n require('./flickity'),\n require('unipointer'),\n require('fizzy-ui-utils')\n );\n } else {\n // browser global\n factory(\n window,\n window.Flickity,\n window.Unipointer,\n window.fizzyUIUtils\n );\n }\n\n}( window, function factory( window, Flickity, Unipointer, utils ) {\n'use strict';\n\nvar svgURI = 'http://www.w3.org/2000/svg';\n\n// -------------------------- PrevNextButton -------------------------- //\n\nfunction PrevNextButton( direction, parent ) {\n this.direction = direction;\n this.parent = parent;\n this._create();\n}\n\nPrevNextButton.prototype = Object.create( Unipointer.prototype );\n\nPrevNextButton.prototype._create = function() {\n // properties\n this.isEnabled = true;\n this.isPrevious = this.direction == -1;\n var leftDirection = this.parent.options.rightToLeft ? 1 : -1;\n this.isLeft = this.direction == leftDirection;\n\n var element = this.element = document.createElement('button');\n element.className = 'flickity-button flickity-prev-next-button';\n element.className += this.isPrevious ? ' previous' : ' next';\n // prevent button from submitting form http://stackoverflow.com/a/10836076/182183\n element.setAttribute( 'type', 'button' );\n // init as disabled\n this.disable();\n\n element.setAttribute( 'aria-label', this.isPrevious ? 'Previous' : 'Next' );\n\n // create arrow\n var svg = this.createSVG();\n element.appendChild( svg );\n // events\n this.parent.on( 'select', this.update.bind( this ) );\n this.on( 'pointerDown', this.parent.childUIPointerDown.bind( this.parent ) );\n};\n\nPrevNextButton.prototype.activate = function() {\n this.bindStartEvent( this.element );\n this.element.addEventListener( 'click', this );\n // add to DOM\n this.parent.element.appendChild( this.element );\n};\n\nPrevNextButton.prototype.deactivate = function() {\n // remove from DOM\n this.parent.element.removeChild( this.element );\n // click events\n this.unbindStartEvent( this.element );\n this.element.removeEventListener( 'click', this );\n};\n\nPrevNextButton.prototype.createSVG = function() {\n var svg = document.createElementNS( svgURI, 'svg' );\n svg.setAttribute( 'class', 'flickity-button-icon' );\n svg.setAttribute( 'viewBox', '0 0 100 100' );\n var path = document.createElementNS( svgURI, 'path' );\n var pathMovements = getArrowMovements( this.parent.options.arrowShape );\n path.setAttribute( 'd', pathMovements );\n path.setAttribute( 'class', 'arrow' );\n // rotate arrow\n if ( !this.isLeft ) {\n path.setAttribute( 'transform', 'translate(100, 100) rotate(180) ' );\n }\n svg.appendChild( path );\n return svg;\n};\n\n// get SVG path movmement\nfunction getArrowMovements( shape ) {\n // use shape as movement if string\n if ( typeof shape == 'string' ) {\n return shape;\n }\n // create movement string\n return 'M ' + shape.x0 + ',50' +\n ' L ' + shape.x1 + ',' + ( shape.y1 + 50 ) +\n ' L ' + shape.x2 + ',' + ( shape.y2 + 50 ) +\n ' L ' + shape.x3 + ',50 ' +\n ' L ' + shape.x2 + ',' + ( 50 - shape.y2 ) +\n ' L ' + shape.x1 + ',' + ( 50 - shape.y1 ) +\n ' Z';\n}\n\nPrevNextButton.prototype.handleEvent = utils.handleEvent;\n\nPrevNextButton.prototype.onclick = function() {\n if ( !this.isEnabled ) {\n return;\n }\n this.parent.uiChange();\n var method = this.isPrevious ? 'previous' : 'next';\n this.parent[ method ]();\n};\n\n// ----- ----- //\n\nPrevNextButton.prototype.enable = function() {\n if ( this.isEnabled ) {\n return;\n }\n this.element.disabled = false;\n this.isEnabled = true;\n};\n\nPrevNextButton.prototype.disable = function() {\n if ( !this.isEnabled ) {\n return;\n }\n this.element.disabled = true;\n this.isEnabled = false;\n};\n\nPrevNextButton.prototype.update = function() {\n // index of first or last slide, if previous or next\n var slides = this.parent.slides;\n // enable is wrapAround and at least 2 slides\n if ( this.parent.options.wrapAround && slides.length > 1 ) {\n this.enable();\n return;\n }\n var lastIndex = slides.length ? slides.length - 1 : 0;\n var boundIndex = this.isPrevious ? 0 : lastIndex;\n var method = this.parent.selectedIndex == boundIndex ? 'disable' : 'enable';\n this[ method ]();\n};\n\nPrevNextButton.prototype.destroy = function() {\n this.deactivate();\n this.allOff();\n};\n\n// -------------------------- Flickity prototype -------------------------- //\n\nutils.extend( Flickity.defaults, {\n prevNextButtons: true,\n arrowShape: {\n x0: 10,\n x1: 60, y1: 50,\n x2: 70, y2: 40,\n x3: 30,\n },\n} );\n\nFlickity.createMethods.push('_createPrevNextButtons');\nvar proto = Flickity.prototype;\n\nproto._createPrevNextButtons = function() {\n if ( !this.options.prevNextButtons ) {\n return;\n }\n\n this.prevButton = new PrevNextButton( -1, this );\n this.nextButton = new PrevNextButton( 1, this );\n\n this.on( 'activate', this.activatePrevNextButtons );\n};\n\nproto.activatePrevNextButtons = function() {\n this.prevButton.activate();\n this.nextButton.activate();\n this.on( 'deactivate', this.deactivatePrevNextButtons );\n};\n\nproto.deactivatePrevNextButtons = function() {\n this.prevButton.deactivate();\n this.nextButton.deactivate();\n this.off( 'deactivate', this.deactivatePrevNextButtons );\n};\n\n// -------------------------- -------------------------- //\n\nFlickity.PrevNextButton = PrevNextButton;\n\nreturn Flickity;\n\n} ) );\n","import { mergeMap } from './mergeMap';\nimport { identity } from '../util/identity';\nexport function mergeAll(concurrent = Number.POSITIVE_INFINITY) {\n return mergeMap(identity, concurrent);\n}\n//# sourceMappingURL=mergeAll.js.map","/**\n * Copyright (c) 2014-present, Facebook, Inc.\n *\n * This source code is licensed under the MIT license found in the\n * LICENSE file in the root directory of this source tree.\n */\n\nvar runtime = (function (exports) {\n \"use strict\";\n\n var Op = Object.prototype;\n var hasOwn = Op.hasOwnProperty;\n var undefined; // More compressible than void 0.\n var $Symbol = typeof Symbol === \"function\" ? Symbol : {};\n var iteratorSymbol = $Symbol.iterator || \"@@iterator\";\n var asyncIteratorSymbol = $Symbol.asyncIterator || \"@@asyncIterator\";\n var toStringTagSymbol = $Symbol.toStringTag || \"@@toStringTag\";\n\n function define(obj, key, value) {\n Object.defineProperty(obj, key, {\n value: value,\n enumerable: true,\n configurable: true,\n writable: true\n });\n return obj[key];\n }\n try {\n // IE 8 has a broken Object.defineProperty that only works on DOM objects.\n define({}, \"\");\n } catch (err) {\n define = function(obj, key, value) {\n return obj[key] = value;\n };\n }\n\n function wrap(innerFn, outerFn, self, tryLocsList) {\n // If outerFn provided and outerFn.prototype is a Generator, then outerFn.prototype instanceof Generator.\n var protoGenerator = outerFn && outerFn.prototype instanceof Generator ? outerFn : Generator;\n var generator = Object.create(protoGenerator.prototype);\n var context = new Context(tryLocsList || []);\n\n // The ._invoke method unifies the implementations of the .next,\n // .throw, and .return methods.\n generator._invoke = makeInvokeMethod(innerFn, self, context);\n\n return generator;\n }\n exports.wrap = wrap;\n\n // Try/catch helper to minimize deoptimizations. Returns a completion\n // record like context.tryEntries[i].completion. This interface could\n // have been (and was previously) designed to take a closure to be\n // invoked without arguments, but in all the cases we care about we\n // already have an existing method we want to call, so there's no need\n // to create a new function object. We can even get away with assuming\n // the method takes exactly one argument, since that happens to be true\n // in every case, so we don't have to touch the arguments object. The\n // only additional allocation required is the completion record, which\n // has a stable shape and so hopefully should be cheap to allocate.\n function tryCatch(fn, obj, arg) {\n try {\n return { type: \"normal\", arg: fn.call(obj, arg) };\n } catch (err) {\n return { type: \"throw\", arg: err };\n }\n }\n\n var GenStateSuspendedStart = \"suspendedStart\";\n var GenStateSuspendedYield = \"suspendedYield\";\n var GenStateExecuting = \"executing\";\n var GenStateCompleted = \"completed\";\n\n // Returning this object from the innerFn has the same effect as\n // breaking out of the dispatch switch statement.\n var ContinueSentinel = {};\n\n // Dummy constructor functions that we use as the .constructor and\n // .constructor.prototype properties for functions that return Generator\n // objects. For full spec compliance, you may wish to configure your\n // minifier not to mangle the names of these two functions.\n function Generator() {}\n function GeneratorFunction() {}\n function GeneratorFunctionPrototype() {}\n\n // This is a polyfill for %IteratorPrototype% for environments that\n // don't natively support it.\n var IteratorPrototype = {};\n IteratorPrototype[iteratorSymbol] = function () {\n return this;\n };\n\n var getProto = Object.getPrototypeOf;\n var NativeIteratorPrototype = getProto && getProto(getProto(values([])));\n if (NativeIteratorPrototype &&\n NativeIteratorPrototype !== Op &&\n hasOwn.call(NativeIteratorPrototype, iteratorSymbol)) {\n // This environment has a native %IteratorPrototype%; use it instead\n // of the polyfill.\n IteratorPrototype = NativeIteratorPrototype;\n }\n\n var Gp = GeneratorFunctionPrototype.prototype =\n Generator.prototype = Object.create(IteratorPrototype);\n GeneratorFunction.prototype = Gp.constructor = GeneratorFunctionPrototype;\n GeneratorFunctionPrototype.constructor = GeneratorFunction;\n GeneratorFunction.displayName = define(\n GeneratorFunctionPrototype,\n toStringTagSymbol,\n \"GeneratorFunction\"\n );\n\n // Helper for defining the .next, .throw, and .return methods of the\n // Iterator interface in terms of a single ._invoke method.\n function defineIteratorMethods(prototype) {\n [\"next\", \"throw\", \"return\"].forEach(function(method) {\n define(prototype, method, function(arg) {\n return this._invoke(method, arg);\n });\n });\n }\n\n exports.isGeneratorFunction = function(genFun) {\n var ctor = typeof genFun === \"function\" && genFun.constructor;\n return ctor\n ? ctor === GeneratorFunction ||\n // For the native GeneratorFunction constructor, the best we can\n // do is to check its .name property.\n (ctor.displayName || ctor.name) === \"GeneratorFunction\"\n : false;\n };\n\n exports.mark = function(genFun) {\n if (Object.setPrototypeOf) {\n Object.setPrototypeOf(genFun, GeneratorFunctionPrototype);\n } else {\n genFun.__proto__ = GeneratorFunctionPrototype;\n define(genFun, toStringTagSymbol, \"GeneratorFunction\");\n }\n genFun.prototype = Object.create(Gp);\n return genFun;\n };\n\n // Within the body of any async function, `await x` is transformed to\n // `yield regeneratorRuntime.awrap(x)`, so that the runtime can test\n // `hasOwn.call(value, \"__await\")` to determine if the yielded value is\n // meant to be awaited.\n exports.awrap = function(arg) {\n return { __await: arg };\n };\n\n function AsyncIterator(generator, PromiseImpl) {\n function invoke(method, arg, resolve, reject) {\n var record = tryCatch(generator[method], generator, arg);\n if (record.type === \"throw\") {\n reject(record.arg);\n } else {\n var result = record.arg;\n var value = result.value;\n if (value &&\n typeof value === \"object\" &&\n hasOwn.call(value, \"__await\")) {\n return PromiseImpl.resolve(value.__await).then(function(value) {\n invoke(\"next\", value, resolve, reject);\n }, function(err) {\n invoke(\"throw\", err, resolve, reject);\n });\n }\n\n return PromiseImpl.resolve(value).then(function(unwrapped) {\n // When a yielded Promise is resolved, its final value becomes\n // the .value of the Promise<{value,done}> result for the\n // current iteration.\n result.value = unwrapped;\n resolve(result);\n }, function(error) {\n // If a rejected Promise was yielded, throw the rejection back\n // into the async generator function so it can be handled there.\n return invoke(\"throw\", error, resolve, reject);\n });\n }\n }\n\n var previousPromise;\n\n function enqueue(method, arg) {\n function callInvokeWithMethodAndArg() {\n return new PromiseImpl(function(resolve, reject) {\n invoke(method, arg, resolve, reject);\n });\n }\n\n return previousPromise =\n // If enqueue has been called before, then we want to wait until\n // all previous Promises have been resolved before calling invoke,\n // so that results are always delivered in the correct order. If\n // enqueue has not been called before, then it is important to\n // call invoke immediately, without waiting on a callback to fire,\n // so that the async generator function has the opportunity to do\n // any necessary setup in a predictable way. This predictability\n // is why the Promise constructor synchronously invokes its\n // executor callback, and why async functions synchronously\n // execute code before the first await. Since we implement simple\n // async functions in terms of async generators, it is especially\n // important to get this right, even though it requires care.\n previousPromise ? previousPromise.then(\n callInvokeWithMethodAndArg,\n // Avoid propagating failures to Promises returned by later\n // invocations of the iterator.\n callInvokeWithMethodAndArg\n ) : callInvokeWithMethodAndArg();\n }\n\n // Define the unified helper method that is used to implement .next,\n // .throw, and .return (see defineIteratorMethods).\n this._invoke = enqueue;\n }\n\n defineIteratorMethods(AsyncIterator.prototype);\n AsyncIterator.prototype[asyncIteratorSymbol] = function () {\n return this;\n };\n exports.AsyncIterator = AsyncIterator;\n\n // Note that simple async functions are implemented on top of\n // AsyncIterator objects; they just return a Promise for the value of\n // the final result produced by the iterator.\n exports.async = function(innerFn, outerFn, self, tryLocsList, PromiseImpl) {\n if (PromiseImpl === void 0) PromiseImpl = Promise;\n\n var iter = new AsyncIterator(\n wrap(innerFn, outerFn, self, tryLocsList),\n PromiseImpl\n );\n\n return exports.isGeneratorFunction(outerFn)\n ? iter // If outerFn is a generator, return the full iterator.\n : iter.next().then(function(result) {\n return result.done ? result.value : iter.next();\n });\n };\n\n function makeInvokeMethod(innerFn, self, context) {\n var state = GenStateSuspendedStart;\n\n return function invoke(method, arg) {\n if (state === GenStateExecuting) {\n throw new Error(\"Generator is already running\");\n }\n\n if (state === GenStateCompleted) {\n if (method === \"throw\") {\n throw arg;\n }\n\n // Be forgiving, per 25.3.3.3.3 of the spec:\n // https://people.mozilla.org/~jorendorff/es6-draft.html#sec-generatorresume\n return doneResult();\n }\n\n context.method = method;\n context.arg = arg;\n\n while (true) {\n var delegate = context.delegate;\n if (delegate) {\n var delegateResult = maybeInvokeDelegate(delegate, context);\n if (delegateResult) {\n if (delegateResult === ContinueSentinel) continue;\n return delegateResult;\n }\n }\n\n if (context.method === \"next\") {\n // Setting context._sent for legacy support of Babel's\n // function.sent implementation.\n context.sent = context._sent = context.arg;\n\n } else if (context.method === \"throw\") {\n if (state === GenStateSuspendedStart) {\n state = GenStateCompleted;\n throw context.arg;\n }\n\n context.dispatchException(context.arg);\n\n } else if (context.method === \"return\") {\n context.abrupt(\"return\", context.arg);\n }\n\n state = GenStateExecuting;\n\n var record = tryCatch(innerFn, self, context);\n if (record.type === \"normal\") {\n // If an exception is thrown from innerFn, we leave state ===\n // GenStateExecuting and loop back for another invocation.\n state = context.done\n ? GenStateCompleted\n : GenStateSuspendedYield;\n\n if (record.arg === ContinueSentinel) {\n continue;\n }\n\n return {\n value: record.arg,\n done: context.done\n };\n\n } else if (record.type === \"throw\") {\n state = GenStateCompleted;\n // Dispatch the exception by looping back around to the\n // context.dispatchException(context.arg) call above.\n context.method = \"throw\";\n context.arg = record.arg;\n }\n }\n };\n }\n\n // Call delegate.iterator[context.method](context.arg) and handle the\n // result, either by returning a { value, done } result from the\n // delegate iterator, or by modifying context.method and context.arg,\n // setting context.delegate to null, and returning the ContinueSentinel.\n function maybeInvokeDelegate(delegate, context) {\n var method = delegate.iterator[context.method];\n if (method === undefined) {\n // A .throw or .return when the delegate iterator has no .throw\n // method always terminates the yield* loop.\n context.delegate = null;\n\n if (context.method === \"throw\") {\n // Note: [\"return\"] must be used for ES3 parsing compatibility.\n if (delegate.iterator[\"return\"]) {\n // If the delegate iterator has a return method, give it a\n // chance to clean up.\n context.method = \"return\";\n context.arg = undefined;\n maybeInvokeDelegate(delegate, context);\n\n if (context.method === \"throw\") {\n // If maybeInvokeDelegate(context) changed context.method from\n // \"return\" to \"throw\", let that override the TypeError below.\n return ContinueSentinel;\n }\n }\n\n context.method = \"throw\";\n context.arg = new TypeError(\n \"The iterator does not provide a 'throw' method\");\n }\n\n return ContinueSentinel;\n }\n\n var record = tryCatch(method, delegate.iterator, context.arg);\n\n if (record.type === \"throw\") {\n context.method = \"throw\";\n context.arg = record.arg;\n context.delegate = null;\n return ContinueSentinel;\n }\n\n var info = record.arg;\n\n if (! info) {\n context.method = \"throw\";\n context.arg = new TypeError(\"iterator result is not an object\");\n context.delegate = null;\n return ContinueSentinel;\n }\n\n if (info.done) {\n // Assign the result of the finished delegate to the temporary\n // variable specified by delegate.resultName (see delegateYield).\n context[delegate.resultName] = info.value;\n\n // Resume execution at the desired location (see delegateYield).\n context.next = delegate.nextLoc;\n\n // If context.method was \"throw\" but the delegate handled the\n // exception, let the outer generator proceed normally. If\n // context.method was \"next\", forget context.arg since it has been\n // \"consumed\" by the delegate iterator. If context.method was\n // \"return\", allow the original .return call to continue in the\n // outer generator.\n if (context.method !== \"return\") {\n context.method = \"next\";\n context.arg = undefined;\n }\n\n } else {\n // Re-yield the result returned by the delegate method.\n return info;\n }\n\n // The delegate iterator is finished, so forget it and continue with\n // the outer generator.\n context.delegate = null;\n return ContinueSentinel;\n }\n\n // Define Generator.prototype.{next,throw,return} in terms of the\n // unified ._invoke helper method.\n defineIteratorMethods(Gp);\n\n define(Gp, toStringTagSymbol, \"Generator\");\n\n // A Generator should always return itself as the iterator object when the\n // @@iterator function is called on it. Some browsers' implementations of the\n // iterator prototype chain incorrectly implement this, causing the Generator\n // object to not be returned from this call. This ensures that doesn't happen.\n // See https://github.com/facebook/regenerator/issues/274 for more details.\n Gp[iteratorSymbol] = function() {\n return this;\n };\n\n Gp.toString = function() {\n return \"[object Generator]\";\n };\n\n function pushTryEntry(locs) {\n var entry = { tryLoc: locs[0] };\n\n if (1 in locs) {\n entry.catchLoc = locs[1];\n }\n\n if (2 in locs) {\n entry.finallyLoc = locs[2];\n entry.afterLoc = locs[3];\n }\n\n this.tryEntries.push(entry);\n }\n\n function resetTryEntry(entry) {\n var record = entry.completion || {};\n record.type = \"normal\";\n delete record.arg;\n entry.completion = record;\n }\n\n function Context(tryLocsList) {\n // The root entry object (effectively a try statement without a catch\n // or a finally block) gives us a place to store values thrown from\n // locations where there is no enclosing try statement.\n this.tryEntries = [{ tryLoc: \"root\" }];\n tryLocsList.forEach(pushTryEntry, this);\n this.reset(true);\n }\n\n exports.keys = function(object) {\n var keys = [];\n for (var key in object) {\n keys.push(key);\n }\n keys.reverse();\n\n // Rather than returning an object with a next method, we keep\n // things simple and return the next function itself.\n return function next() {\n while (keys.length) {\n var key = keys.pop();\n if (key in object) {\n next.value = key;\n next.done = false;\n return next;\n }\n }\n\n // To avoid creating an additional object, we just hang the .value\n // and .done properties off the next function object itself. This\n // also ensures that the minifier will not anonymize the function.\n next.done = true;\n return next;\n };\n };\n\n function values(iterable) {\n if (iterable) {\n var iteratorMethod = iterable[iteratorSymbol];\n if (iteratorMethod) {\n return iteratorMethod.call(iterable);\n }\n\n if (typeof iterable.next === \"function\") {\n return iterable;\n }\n\n if (!isNaN(iterable.length)) {\n var i = -1, next = function next() {\n while (++i < iterable.length) {\n if (hasOwn.call(iterable, i)) {\n next.value = iterable[i];\n next.done = false;\n return next;\n }\n }\n\n next.value = undefined;\n next.done = true;\n\n return next;\n };\n\n return next.next = next;\n }\n }\n\n // Return an iterator with no values.\n return { next: doneResult };\n }\n exports.values = values;\n\n function doneResult() {\n return { value: undefined, done: true };\n }\n\n Context.prototype = {\n constructor: Context,\n\n reset: function(skipTempReset) {\n this.prev = 0;\n this.next = 0;\n // Resetting context._sent for legacy support of Babel's\n // function.sent implementation.\n this.sent = this._sent = undefined;\n this.done = false;\n this.delegate = null;\n\n this.method = \"next\";\n this.arg = undefined;\n\n this.tryEntries.forEach(resetTryEntry);\n\n if (!skipTempReset) {\n for (var name in this) {\n // Not sure about the optimal order of these conditions:\n if (name.charAt(0) === \"t\" &&\n hasOwn.call(this, name) &&\n !isNaN(+name.slice(1))) {\n this[name] = undefined;\n }\n }\n }\n },\n\n stop: function() {\n this.done = true;\n\n var rootEntry = this.tryEntries[0];\n var rootRecord = rootEntry.completion;\n if (rootRecord.type === \"throw\") {\n throw rootRecord.arg;\n }\n\n return this.rval;\n },\n\n dispatchException: function(exception) {\n if (this.done) {\n throw exception;\n }\n\n var context = this;\n function handle(loc, caught) {\n record.type = \"throw\";\n record.arg = exception;\n context.next = loc;\n\n if (caught) {\n // If the dispatched exception was caught by a catch block,\n // then let that catch block handle the exception normally.\n context.method = \"next\";\n context.arg = undefined;\n }\n\n return !! caught;\n }\n\n for (var i = this.tryEntries.length - 1; i >= 0; --i) {\n var entry = this.tryEntries[i];\n var record = entry.completion;\n\n if (entry.tryLoc === \"root\") {\n // Exception thrown outside of any try block that could handle\n // it, so set the completion value of the entire function to\n // throw the exception.\n return handle(\"end\");\n }\n\n if (entry.tryLoc <= this.prev) {\n var hasCatch = hasOwn.call(entry, \"catchLoc\");\n var hasFinally = hasOwn.call(entry, \"finallyLoc\");\n\n if (hasCatch && hasFinally) {\n if (this.prev < entry.catchLoc) {\n return handle(entry.catchLoc, true);\n } else if (this.prev < entry.finallyLoc) {\n return handle(entry.finallyLoc);\n }\n\n } else if (hasCatch) {\n if (this.prev < entry.catchLoc) {\n return handle(entry.catchLoc, true);\n }\n\n } else if (hasFinally) {\n if (this.prev < entry.finallyLoc) {\n return handle(entry.finallyLoc);\n }\n\n } else {\n throw new Error(\"try statement without catch or finally\");\n }\n }\n }\n },\n\n abrupt: function(type, arg) {\n for (var i = this.tryEntries.length - 1; i >= 0; --i) {\n var entry = this.tryEntries[i];\n if (entry.tryLoc <= this.prev &&\n hasOwn.call(entry, \"finallyLoc\") &&\n this.prev < entry.finallyLoc) {\n var finallyEntry = entry;\n break;\n }\n }\n\n if (finallyEntry &&\n (type === \"break\" ||\n type === \"continue\") &&\n finallyEntry.tryLoc <= arg &&\n arg <= finallyEntry.finallyLoc) {\n // Ignore the finally entry if control is not jumping to a\n // location outside the try/catch block.\n finallyEntry = null;\n }\n\n var record = finallyEntry ? finallyEntry.completion : {};\n record.type = type;\n record.arg = arg;\n\n if (finallyEntry) {\n this.method = \"next\";\n this.next = finallyEntry.finallyLoc;\n return ContinueSentinel;\n }\n\n return this.complete(record);\n },\n\n complete: function(record, afterLoc) {\n if (record.type === \"throw\") {\n throw record.arg;\n }\n\n if (record.type === \"break\" ||\n record.type === \"continue\") {\n this.next = record.arg;\n } else if (record.type === \"return\") {\n this.rval = this.arg = record.arg;\n this.method = \"return\";\n this.next = \"end\";\n } else if (record.type === \"normal\" && afterLoc) {\n this.next = afterLoc;\n }\n\n return ContinueSentinel;\n },\n\n finish: function(finallyLoc) {\n for (var i = this.tryEntries.length - 1; i >= 0; --i) {\n var entry = this.tryEntries[i];\n if (entry.finallyLoc === finallyLoc) {\n this.complete(entry.completion, entry.afterLoc);\n resetTryEntry(entry);\n return ContinueSentinel;\n }\n }\n },\n\n \"catch\": function(tryLoc) {\n for (var i = this.tryEntries.length - 1; i >= 0; --i) {\n var entry = this.tryEntries[i];\n if (entry.tryLoc === tryLoc) {\n var record = entry.completion;\n if (record.type === \"throw\") {\n var thrown = record.arg;\n resetTryEntry(entry);\n }\n return thrown;\n }\n }\n\n // The context.catch method must only be called with a location\n // argument that corresponds to a known catch block.\n throw new Error(\"illegal catch attempt\");\n },\n\n delegateYield: function(iterable, resultName, nextLoc) {\n this.delegate = {\n iterator: values(iterable),\n resultName: resultName,\n nextLoc: nextLoc\n };\n\n if (this.method === \"next\") {\n // Deliberately forget the last sent value so that we don't\n // accidentally pass it on to the delegate.\n this.arg = undefined;\n }\n\n return ContinueSentinel;\n }\n };\n\n // Regardless of whether this script is executing as a CommonJS module\n // or not, return the runtime object so that we can declare the variable\n // regeneratorRuntime in the outer scope, which allows this module to be\n // injected easily by `bin/regenerator --include-runtime script.js`.\n return exports;\n\n}(\n // If this script is executing as a CommonJS module, use module.exports\n // as the regeneratorRuntime namespace. Otherwise create a new empty\n // object. Either way, the resulting object will be used to initialize\n // the regeneratorRuntime variable at the top of this file.\n typeof module === \"object\" ? module.exports : {}\n));\n\ntry {\n regeneratorRuntime = runtime;\n} catch (accidentalStrictMode) {\n // This module should not be running in strict mode, so the above\n // assignment should always work unless something is misconfigured. Just\n // in case runtime.js accidentally runs in strict mode, we can escape\n // strict mode using a global Function call. This could conceivably fail\n // if a Content Security Policy forbids using Function, but in that case\n // the proper solution is to fix the accidental strict mode problem. If\n // you've misconfigured your bundler to force strict mode and applied a\n // CSP to forbid Function, and you're not willing to fix either of those\n // problems, please detail your unique predicament in a GitHub issue.\n Function(\"r\", \"regeneratorRuntime = r\")(runtime);\n}\n","import { Observable } from '../Observable';\nexport function throwError(error, scheduler) {\n if (!scheduler) {\n return new Observable(subscriber => subscriber.error(error));\n }\n else {\n return new Observable(subscriber => scheduler.schedule(dispatch, 0, { error, subscriber }));\n }\n}\nfunction dispatch({ error, subscriber }) {\n subscriber.error(error);\n}\n//# sourceMappingURL=throwError.js.map","'use strict';\n\n/* eslint complexity: [2, 18], max-statements: [2, 33] */\nmodule.exports = function hasSymbols() {\n\tif (typeof Symbol !== 'function' || typeof Object.getOwnPropertySymbols !== 'function') { return false; }\n\tif (typeof Symbol.iterator === 'symbol') { return true; }\n\n\tvar obj = {};\n\tvar sym = Symbol('test');\n\tvar symObj = Object(sym);\n\tif (typeof sym === 'string') { return false; }\n\n\tif (Object.prototype.toString.call(sym) !== '[object Symbol]') { return false; }\n\tif (Object.prototype.toString.call(symObj) !== '[object Symbol]') { return false; }\n\n\t// temp disabled per https://github.com/ljharb/object.assign/issues/17\n\t// if (sym instanceof Symbol) { return false; }\n\t// temp disabled per https://github.com/WebReflection/get-own-property-symbols/issues/4\n\t// if (!(symObj instanceof Symbol)) { return false; }\n\n\t// if (typeof Symbol.prototype.toString !== 'function') { return false; }\n\t// if (String(sym) !== Symbol.prototype.toString.call(sym)) { return false; }\n\n\tvar symVal = 42;\n\tobj[sym] = symVal;\n\tfor (sym in obj) { return false; } // eslint-disable-line no-restricted-syntax\n\tif (typeof Object.keys === 'function' && Object.keys(obj).length !== 0) { return false; }\n\n\tif (typeof Object.getOwnPropertyNames === 'function' && Object.getOwnPropertyNames(obj).length !== 0) { return false; }\n\n\tvar syms = Object.getOwnPropertySymbols(obj);\n\tif (syms.length !== 1 || syms[0] !== sym) { return false; }\n\n\tif (!Object.prototype.propertyIsEnumerable.call(obj, sym)) { return false; }\n\n\tif (typeof Object.getOwnPropertyDescriptor === 'function') {\n\t\tvar descriptor = Object.getOwnPropertyDescriptor(obj, sym);\n\t\tif (descriptor.value !== symVal || descriptor.enumerable !== true) { return false; }\n\t}\n\n\treturn true;\n};\n","import { OuterSubscriber } from '../OuterSubscriber';\nimport { InnerSubscriber } from '../InnerSubscriber';\nimport { subscribeToResult } from '../util/subscribeToResult';\nexport function catchError(selector) {\n return function catchErrorOperatorFunction(source) {\n const operator = new CatchOperator(selector);\n const caught = source.lift(operator);\n return (operator.caught = caught);\n };\n}\nclass CatchOperator {\n constructor(selector) {\n this.selector = selector;\n }\n call(subscriber, source) {\n return source.subscribe(new CatchSubscriber(subscriber, this.selector, this.caught));\n }\n}\nclass CatchSubscriber extends OuterSubscriber {\n constructor(destination, selector, caught) {\n super(destination);\n this.selector = selector;\n this.caught = caught;\n }\n error(err) {\n if (!this.isStopped) {\n let result;\n try {\n result = this.selector(err, this.caught);\n }\n catch (err2) {\n super.error(err2);\n return;\n }\n this._unsubscribeAndRecycle();\n const innerSubscriber = new InnerSubscriber(this, undefined, undefined);\n this.add(innerSubscriber);\n const innerSubscription = subscribeToResult(this, result, undefined, undefined, innerSubscriber);\n if (innerSubscription !== innerSubscriber) {\n this.add(innerSubscription);\n }\n }\n }\n}\n//# sourceMappingURL=catchError.js.map","export function identity(x) {\n return x;\n}\n//# sourceMappingURL=identity.js.map","'use strict';\n\nvar implementation = require('./implementation');\n\nmodule.exports = Function.prototype.bind || implementation;\n","/**\n * @license Angular v11.0.9\n * (c) 2010-2020 Google LLC. https://angular.io/\n * License: MIT\n */\n\nimport { ɵAnimationGroupPlayer, NoopAnimationPlayer, AUTO_STYLE, ɵPRE_STYLE, sequence, style } from '@angular/animations';\nimport { Injectable } from '@angular/core';\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nimport * as ɵngcc0 from '@angular/core';\nfunction isBrowser() {\n return (typeof window !== 'undefined' && typeof window.document !== 'undefined');\n}\nfunction isNode() {\n // Checking only for `process` isn't enough to identify whether or not we're in a Node\n // environment, because Webpack by default will polyfill the `process`. While we can discern\n // that Webpack polyfilled it by looking at `process.browser`, it's very Webpack-specific and\n // might not be future-proof. Instead we look at the stringified version of `process` which\n // is `[object process]` in Node and `[object Object]` when polyfilled.\n return typeof process !== 'undefined' && {}.toString.call(process) === '[object process]';\n}\nfunction optimizeGroupPlayer(players) {\n switch (players.length) {\n case 0:\n return new NoopAnimationPlayer();\n case 1:\n return players[0];\n default:\n return new ɵAnimationGroupPlayer(players);\n }\n}\nfunction normalizeKeyframes(driver, normalizer, element, keyframes, preStyles = {}, postStyles = {}) {\n const errors = [];\n const normalizedKeyframes = [];\n let previousOffset = -1;\n let previousKeyframe = null;\n keyframes.forEach(kf => {\n const offset = kf['offset'];\n const isSameOffset = offset == previousOffset;\n const normalizedKeyframe = (isSameOffset && previousKeyframe) || {};\n Object.keys(kf).forEach(prop => {\n let normalizedProp = prop;\n let normalizedValue = kf[prop];\n if (prop !== 'offset') {\n normalizedProp = normalizer.normalizePropertyName(normalizedProp, errors);\n switch (normalizedValue) {\n case ɵPRE_STYLE:\n normalizedValue = preStyles[prop];\n break;\n case AUTO_STYLE:\n normalizedValue = postStyles[prop];\n break;\n default:\n normalizedValue =\n normalizer.normalizeStyleValue(prop, normalizedProp, normalizedValue, errors);\n break;\n }\n }\n normalizedKeyframe[normalizedProp] = normalizedValue;\n });\n if (!isSameOffset) {\n normalizedKeyframes.push(normalizedKeyframe);\n }\n previousKeyframe = normalizedKeyframe;\n previousOffset = offset;\n });\n if (errors.length) {\n const LINE_START = '\\n - ';\n throw new Error(`Unable to animate due to the following errors:${LINE_START}${errors.join(LINE_START)}`);\n }\n return normalizedKeyframes;\n}\nfunction listenOnPlayer(player, eventName, event, callback) {\n switch (eventName) {\n case 'start':\n player.onStart(() => callback(event && copyAnimationEvent(event, 'start', player)));\n break;\n case 'done':\n player.onDone(() => callback(event && copyAnimationEvent(event, 'done', player)));\n break;\n case 'destroy':\n player.onDestroy(() => callback(event && copyAnimationEvent(event, 'destroy', player)));\n break;\n }\n}\nfunction copyAnimationEvent(e, phaseName, player) {\n const totalTime = player.totalTime;\n const disabled = player.disabled ? true : false;\n const event = makeAnimationEvent(e.element, e.triggerName, e.fromState, e.toState, phaseName || e.phaseName, totalTime == undefined ? e.totalTime : totalTime, disabled);\n const data = e['_data'];\n if (data != null) {\n event['_data'] = data;\n }\n return event;\n}\nfunction makeAnimationEvent(element, triggerName, fromState, toState, phaseName = '', totalTime = 0, disabled) {\n return { element, triggerName, fromState, toState, phaseName, totalTime, disabled: !!disabled };\n}\nfunction getOrSetAsInMap(map, key, defaultValue) {\n let value;\n if (map instanceof Map) {\n value = map.get(key);\n if (!value) {\n map.set(key, value = defaultValue);\n }\n }\n else {\n value = map[key];\n if (!value) {\n value = map[key] = defaultValue;\n }\n }\n return value;\n}\nfunction parseTimelineCommand(command) {\n const separatorPos = command.indexOf(':');\n const id = command.substring(1, separatorPos);\n const action = command.substr(separatorPos + 1);\n return [id, action];\n}\nlet _contains = (elm1, elm2) => false;\nconst ɵ0 = _contains;\nlet _matches = (element, selector) => false;\nconst ɵ1 = _matches;\nlet _query = (element, selector, multi) => {\n return [];\n};\nconst ɵ2 = _query;\n// Define utility methods for browsers and platform-server(domino) where Element\n// and utility methods exist.\nconst _isNode = isNode();\nif (_isNode || typeof Element !== 'undefined') {\n // this is well supported in all browsers\n _contains = (elm1, elm2) => {\n return elm1.contains(elm2);\n };\n _matches = (() => {\n if (_isNode || Element.prototype.matches) {\n return (element, selector) => element.matches(selector);\n }\n else {\n const proto = Element.prototype;\n const fn = proto.matchesSelector || proto.mozMatchesSelector || proto.msMatchesSelector ||\n proto.oMatchesSelector || proto.webkitMatchesSelector;\n if (fn) {\n return (element, selector) => fn.apply(element, [selector]);\n }\n else {\n return _matches;\n }\n }\n })();\n _query = (element, selector, multi) => {\n let results = [];\n if (multi) {\n // DO NOT REFACTOR TO USE SPREAD SYNTAX.\n // For element queries that return sufficiently large NodeList objects,\n // using spread syntax to populate the results array causes a RangeError\n // due to the call stack limit being reached. `Array.from` can not be used\n // as well, since NodeList is not iterable in IE 11, see\n // https://developer.mozilla.org/en-US/docs/Web/API/NodeList\n // More info is available in #38551.\n const elems = element.querySelectorAll(selector);\n for (let i = 0; i < elems.length; i++) {\n results.push(elems[i]);\n }\n }\n else {\n const elm = element.querySelector(selector);\n if (elm) {\n results.push(elm);\n }\n }\n return results;\n };\n}\nfunction containsVendorPrefix(prop) {\n // Webkit is the only real popular vendor prefix nowadays\n // cc: http://shouldiprefix.com/\n return prop.substring(1, 6) == 'ebkit'; // webkit or Webkit\n}\nlet _CACHED_BODY = null;\nlet _IS_WEBKIT = false;\nfunction validateStyleProperty(prop) {\n if (!_CACHED_BODY) {\n _CACHED_BODY = getBodyNode() || {};\n _IS_WEBKIT = _CACHED_BODY.style ? ('WebkitAppearance' in _CACHED_BODY.style) : false;\n }\n let result = true;\n if (_CACHED_BODY.style && !containsVendorPrefix(prop)) {\n result = prop in _CACHED_BODY.style;\n if (!result && _IS_WEBKIT) {\n const camelProp = 'Webkit' + prop.charAt(0).toUpperCase() + prop.substr(1);\n result = camelProp in _CACHED_BODY.style;\n }\n }\n return result;\n}\nfunction getBodyNode() {\n if (typeof document != 'undefined') {\n return document.body;\n }\n return null;\n}\nconst matchesElement = _matches;\nconst containsElement = _contains;\nconst invokeQuery = _query;\nfunction hypenatePropsObject(object) {\n const newObj = {};\n Object.keys(object).forEach(prop => {\n const newProp = prop.replace(/([a-z])([A-Z])/g, '$1-$2');\n newObj[newProp] = object[prop];\n });\n return newObj;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * @publicApi\n */\nclass NoopAnimationDriver {\n validateStyleProperty(prop) {\n return validateStyleProperty(prop);\n }\n matchesElement(element, selector) {\n return matchesElement(element, selector);\n }\n containsElement(elm1, elm2) {\n return containsElement(elm1, elm2);\n }\n query(element, selector, multi) {\n return invokeQuery(element, selector, multi);\n }\n computeStyle(element, prop, defaultValue) {\n return defaultValue || '';\n }\n animate(element, keyframes, duration, delay, easing, previousPlayers = [], scrubberAccessRequested) {\n return new NoopAnimationPlayer(duration, delay);\n }\n}\nNoopAnimationDriver.ɵfac = function NoopAnimationDriver_Factory(t) { return new (t || NoopAnimationDriver)(); };\nNoopAnimationDriver.ɵprov = ɵngcc0.ɵɵdefineInjectable({ token: NoopAnimationDriver, factory: NoopAnimationDriver.ɵfac });\n/*@__PURE__*/ (function () { ɵngcc0.ɵsetClassMetadata(NoopAnimationDriver, [{\n type: Injectable\n }], null, null); })();\n/**\n * @publicApi\n */\nclass AnimationDriver {\n}\nAnimationDriver.NOOP = new NoopAnimationDriver();\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nconst ONE_SECOND = 1000;\nconst SUBSTITUTION_EXPR_START = '{{';\nconst SUBSTITUTION_EXPR_END = '}}';\nconst ENTER_CLASSNAME = 'ng-enter';\nconst LEAVE_CLASSNAME = 'ng-leave';\nconst ENTER_SELECTOR = '.ng-enter';\nconst LEAVE_SELECTOR = '.ng-leave';\nconst NG_TRIGGER_CLASSNAME = 'ng-trigger';\nconst NG_TRIGGER_SELECTOR = '.ng-trigger';\nconst NG_ANIMATING_CLASSNAME = 'ng-animating';\nconst NG_ANIMATING_SELECTOR = '.ng-animating';\nfunction resolveTimingValue(value) {\n if (typeof value == 'number')\n return value;\n const matches = value.match(/^(-?[\\.\\d]+)(m?s)/);\n if (!matches || matches.length < 2)\n return 0;\n return _convertTimeValueToMS(parseFloat(matches[1]), matches[2]);\n}\nfunction _convertTimeValueToMS(value, unit) {\n switch (unit) {\n case 's':\n return value * ONE_SECOND;\n default: // ms or something else\n return value;\n }\n}\nfunction resolveTiming(timings, errors, allowNegativeValues) {\n return timings.hasOwnProperty('duration') ?\n timings :\n parseTimeExpression(timings, errors, allowNegativeValues);\n}\nfunction parseTimeExpression(exp, errors, allowNegativeValues) {\n const regex = /^(-?[\\.\\d]+)(m?s)(?:\\s+(-?[\\.\\d]+)(m?s))?(?:\\s+([-a-z]+(?:\\(.+?\\))?))?$/i;\n let duration;\n let delay = 0;\n let easing = '';\n if (typeof exp === 'string') {\n const matches = exp.match(regex);\n if (matches === null) {\n errors.push(`The provided timing value \"${exp}\" is invalid.`);\n return { duration: 0, delay: 0, easing: '' };\n }\n duration = _convertTimeValueToMS(parseFloat(matches[1]), matches[2]);\n const delayMatch = matches[3];\n if (delayMatch != null) {\n delay = _convertTimeValueToMS(parseFloat(delayMatch), matches[4]);\n }\n const easingVal = matches[5];\n if (easingVal) {\n easing = easingVal;\n }\n }\n else {\n duration = exp;\n }\n if (!allowNegativeValues) {\n let containsErrors = false;\n let startIndex = errors.length;\n if (duration < 0) {\n errors.push(`Duration values below 0 are not allowed for this animation step.`);\n containsErrors = true;\n }\n if (delay < 0) {\n errors.push(`Delay values below 0 are not allowed for this animation step.`);\n containsErrors = true;\n }\n if (containsErrors) {\n errors.splice(startIndex, 0, `The provided timing value \"${exp}\" is invalid.`);\n }\n }\n return { duration, delay, easing };\n}\nfunction copyObj(obj, destination = {}) {\n Object.keys(obj).forEach(prop => {\n destination[prop] = obj[prop];\n });\n return destination;\n}\nfunction normalizeStyles(styles) {\n const normalizedStyles = {};\n if (Array.isArray(styles)) {\n styles.forEach(data => copyStyles(data, false, normalizedStyles));\n }\n else {\n copyStyles(styles, false, normalizedStyles);\n }\n return normalizedStyles;\n}\nfunction copyStyles(styles, readPrototype, destination = {}) {\n if (readPrototype) {\n // we make use of a for-in loop so that the\n // prototypically inherited properties are\n // revealed from the backFill map\n for (let prop in styles) {\n destination[prop] = styles[prop];\n }\n }\n else {\n copyObj(styles, destination);\n }\n return destination;\n}\nfunction getStyleAttributeString(element, key, value) {\n // Return the key-value pair string to be added to the style attribute for the\n // given CSS style key.\n if (value) {\n return key + ':' + value + ';';\n }\n else {\n return '';\n }\n}\nfunction writeStyleAttribute(element) {\n // Read the style property of the element and manually reflect it to the\n // style attribute. This is needed because Domino on platform-server doesn't\n // understand the full set of allowed CSS properties and doesn't reflect some\n // of them automatically.\n let styleAttrValue = '';\n for (let i = 0; i < element.style.length; i++) {\n const key = element.style.item(i);\n styleAttrValue += getStyleAttributeString(element, key, element.style.getPropertyValue(key));\n }\n for (const key in element.style) {\n // Skip internal Domino properties that don't need to be reflected.\n if (!element.style.hasOwnProperty(key) || key.startsWith('_')) {\n continue;\n }\n const dashKey = camelCaseToDashCase(key);\n styleAttrValue += getStyleAttributeString(element, dashKey, element.style[key]);\n }\n element.setAttribute('style', styleAttrValue);\n}\nfunction setStyles(element, styles, formerStyles) {\n if (element['style']) {\n Object.keys(styles).forEach(prop => {\n const camelProp = dashCaseToCamelCase(prop);\n if (formerStyles && !formerStyles.hasOwnProperty(prop)) {\n formerStyles[prop] = element.style[camelProp];\n }\n element.style[camelProp] = styles[prop];\n });\n // On the server set the 'style' attribute since it's not automatically reflected.\n if (isNode()) {\n writeStyleAttribute(element);\n }\n }\n}\nfunction eraseStyles(element, styles) {\n if (element['style']) {\n Object.keys(styles).forEach(prop => {\n const camelProp = dashCaseToCamelCase(prop);\n element.style[camelProp] = '';\n });\n // On the server set the 'style' attribute since it's not automatically reflected.\n if (isNode()) {\n writeStyleAttribute(element);\n }\n }\n}\nfunction normalizeAnimationEntry(steps) {\n if (Array.isArray(steps)) {\n if (steps.length == 1)\n return steps[0];\n return sequence(steps);\n }\n return steps;\n}\nfunction validateStyleParams(value, options, errors) {\n const params = options.params || {};\n const matches = extractStyleParams(value);\n if (matches.length) {\n matches.forEach(varName => {\n if (!params.hasOwnProperty(varName)) {\n errors.push(`Unable to resolve the local animation param ${varName} in the given list of values`);\n }\n });\n }\n}\nconst PARAM_REGEX = new RegExp(`${SUBSTITUTION_EXPR_START}\\\\s*(.+?)\\\\s*${SUBSTITUTION_EXPR_END}`, 'g');\nfunction extractStyleParams(value) {\n let params = [];\n if (typeof value === 'string') {\n let match;\n while (match = PARAM_REGEX.exec(value)) {\n params.push(match[1]);\n }\n PARAM_REGEX.lastIndex = 0;\n }\n return params;\n}\nfunction interpolateParams(value, params, errors) {\n const original = value.toString();\n const str = original.replace(PARAM_REGEX, (_, varName) => {\n let localVal = params[varName];\n // this means that the value was never overridden by the data passed in by the user\n if (!params.hasOwnProperty(varName)) {\n errors.push(`Please provide a value for the animation param ${varName}`);\n localVal = '';\n }\n return localVal.toString();\n });\n // we do this to assert that numeric values stay as they are\n return str == original ? value : str;\n}\nfunction iteratorToArray(iterator) {\n const arr = [];\n let item = iterator.next();\n while (!item.done) {\n arr.push(item.value);\n item = iterator.next();\n }\n return arr;\n}\nfunction mergeAnimationOptions(source, destination) {\n if (source.params) {\n const p0 = source.params;\n if (!destination.params) {\n destination.params = {};\n }\n const p1 = destination.params;\n Object.keys(p0).forEach(param => {\n if (!p1.hasOwnProperty(param)) {\n p1[param] = p0[param];\n }\n });\n }\n return destination;\n}\nconst DASH_CASE_REGEXP = /-+([a-z0-9])/g;\nfunction dashCaseToCamelCase(input) {\n return input.replace(DASH_CASE_REGEXP, (...m) => m[1].toUpperCase());\n}\nfunction camelCaseToDashCase(input) {\n return input.replace(/([a-z])([A-Z])/g, '$1-$2').toLowerCase();\n}\nfunction allowPreviousPlayerStylesMerge(duration, delay) {\n return duration === 0 || delay === 0;\n}\nfunction balancePreviousStylesIntoKeyframes(element, keyframes, previousStyles) {\n const previousStyleProps = Object.keys(previousStyles);\n if (previousStyleProps.length && keyframes.length) {\n let startingKeyframe = keyframes[0];\n let missingStyleProps = [];\n previousStyleProps.forEach(prop => {\n if (!startingKeyframe.hasOwnProperty(prop)) {\n missingStyleProps.push(prop);\n }\n startingKeyframe[prop] = previousStyles[prop];\n });\n if (missingStyleProps.length) {\n // tslint:disable-next-line\n for (var i = 1; i < keyframes.length; i++) {\n let kf = keyframes[i];\n missingStyleProps.forEach(function (prop) {\n kf[prop] = computeStyle(element, prop);\n });\n }\n }\n }\n return keyframes;\n}\nfunction visitDslNode(visitor, node, context) {\n switch (node.type) {\n case 7 /* Trigger */:\n return visitor.visitTrigger(node, context);\n case 0 /* State */:\n return visitor.visitState(node, context);\n case 1 /* Transition */:\n return visitor.visitTransition(node, context);\n case 2 /* Sequence */:\n return visitor.visitSequence(node, context);\n case 3 /* Group */:\n return visitor.visitGroup(node, context);\n case 4 /* Animate */:\n return visitor.visitAnimate(node, context);\n case 5 /* Keyframes */:\n return visitor.visitKeyframes(node, context);\n case 6 /* Style */:\n return visitor.visitStyle(node, context);\n case 8 /* Reference */:\n return visitor.visitReference(node, context);\n case 9 /* AnimateChild */:\n return visitor.visitAnimateChild(node, context);\n case 10 /* AnimateRef */:\n return visitor.visitAnimateRef(node, context);\n case 11 /* Query */:\n return visitor.visitQuery(node, context);\n case 12 /* Stagger */:\n return visitor.visitStagger(node, context);\n default:\n throw new Error(`Unable to resolve animation metadata node #${node.type}`);\n }\n}\nfunction computeStyle(element, prop) {\n return window.getComputedStyle(element)[prop];\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nconst ANY_STATE = '*';\nfunction parseTransitionExpr(transitionValue, errors) {\n const expressions = [];\n if (typeof transitionValue == 'string') {\n transitionValue.split(/\\s*,\\s*/).forEach(str => parseInnerTransitionStr(str, expressions, errors));\n }\n else {\n expressions.push(transitionValue);\n }\n return expressions;\n}\nfunction parseInnerTransitionStr(eventStr, expressions, errors) {\n if (eventStr[0] == ':') {\n const result = parseAnimationAlias(eventStr, errors);\n if (typeof result == 'function') {\n expressions.push(result);\n return;\n }\n eventStr = result;\n }\n const match = eventStr.match(/^(\\*|[-\\w]+)\\s*()\\s*(\\*|[-\\w]+)$/);\n if (match == null || match.length < 4) {\n errors.push(`The provided transition expression \"${eventStr}\" is not supported`);\n return expressions;\n }\n const fromState = match[1];\n const separator = match[2];\n const toState = match[3];\n expressions.push(makeLambdaFromStates(fromState, toState));\n const isFullAnyStateExpr = fromState == ANY_STATE && toState == ANY_STATE;\n if (separator[0] == '<' && !isFullAnyStateExpr) {\n expressions.push(makeLambdaFromStates(toState, fromState));\n }\n}\nfunction parseAnimationAlias(alias, errors) {\n switch (alias) {\n case ':enter':\n return 'void => *';\n case ':leave':\n return '* => void';\n case ':increment':\n return (fromState, toState) => parseFloat(toState) > parseFloat(fromState);\n case ':decrement':\n return (fromState, toState) => parseFloat(toState) < parseFloat(fromState);\n default:\n errors.push(`The transition alias value \"${alias}\" is not supported`);\n return '* => *';\n }\n}\n// DO NOT REFACTOR ... keep the follow set instantiations\n// with the values intact (closure compiler for some reason\n// removes follow-up lines that add the values outside of\n// the constructor...\nconst TRUE_BOOLEAN_VALUES = new Set(['true', '1']);\nconst FALSE_BOOLEAN_VALUES = new Set(['false', '0']);\nfunction makeLambdaFromStates(lhs, rhs) {\n const LHS_MATCH_BOOLEAN = TRUE_BOOLEAN_VALUES.has(lhs) || FALSE_BOOLEAN_VALUES.has(lhs);\n const RHS_MATCH_BOOLEAN = TRUE_BOOLEAN_VALUES.has(rhs) || FALSE_BOOLEAN_VALUES.has(rhs);\n return (fromState, toState) => {\n let lhsMatch = lhs == ANY_STATE || lhs == fromState;\n let rhsMatch = rhs == ANY_STATE || rhs == toState;\n if (!lhsMatch && LHS_MATCH_BOOLEAN && typeof fromState === 'boolean') {\n lhsMatch = fromState ? TRUE_BOOLEAN_VALUES.has(lhs) : FALSE_BOOLEAN_VALUES.has(lhs);\n }\n if (!rhsMatch && RHS_MATCH_BOOLEAN && typeof toState === 'boolean') {\n rhsMatch = toState ? TRUE_BOOLEAN_VALUES.has(rhs) : FALSE_BOOLEAN_VALUES.has(rhs);\n }\n return lhsMatch && rhsMatch;\n };\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nconst SELF_TOKEN = ':self';\nconst SELF_TOKEN_REGEX = new RegExp(`\\s*${SELF_TOKEN}\\s*,?`, 'g');\n/*\n * [Validation]\n * The visitor code below will traverse the animation AST generated by the animation verb functions\n * (the output is a tree of objects) and attempt to perform a series of validations on the data. The\n * following corner-cases will be validated:\n *\n * 1. Overlap of animations\n * Given that a CSS property cannot be animated in more than one place at the same time, it's\n * important that this behavior is detected and validated. The way in which this occurs is that\n * each time a style property is examined, a string-map containing the property will be updated with\n * the start and end times for when the property is used within an animation step.\n *\n * If there are two or more parallel animations that are currently running (these are invoked by the\n * group()) on the same element then the validator will throw an error. Since the start/end timing\n * values are collected for each property then if the current animation step is animating the same\n * property and its timing values fall anywhere into the window of time that the property is\n * currently being animated within then this is what causes an error.\n *\n * 2. Timing values\n * The validator will validate to see if a timing value of `duration delay easing` or\n * `durationNumber` is valid or not.\n *\n * (note that upon validation the code below will replace the timing data with an object containing\n * {duration,delay,easing}.\n *\n * 3. Offset Validation\n * Each of the style() calls are allowed to have an offset value when placed inside of keyframes().\n * Offsets within keyframes() are considered valid when:\n *\n * - No offsets are used at all\n * - Each style() entry contains an offset value\n * - Each offset is between 0 and 1\n * - Each offset is greater to or equal than the previous one\n *\n * Otherwise an error will be thrown.\n */\nfunction buildAnimationAst(driver, metadata, errors) {\n return new AnimationAstBuilderVisitor(driver).build(metadata, errors);\n}\nconst ROOT_SELECTOR = '';\nclass AnimationAstBuilderVisitor {\n constructor(_driver) {\n this._driver = _driver;\n }\n build(metadata, errors) {\n const context = new AnimationAstBuilderContext(errors);\n this._resetContextStyleTimingState(context);\n return visitDslNode(this, normalizeAnimationEntry(metadata), context);\n }\n _resetContextStyleTimingState(context) {\n context.currentQuerySelector = ROOT_SELECTOR;\n context.collectedStyles = {};\n context.collectedStyles[ROOT_SELECTOR] = {};\n context.currentTime = 0;\n }\n visitTrigger(metadata, context) {\n let queryCount = context.queryCount = 0;\n let depCount = context.depCount = 0;\n const states = [];\n const transitions = [];\n if (metadata.name.charAt(0) == '@') {\n context.errors.push('animation triggers cannot be prefixed with an `@` sign (e.g. trigger(\\'@foo\\', [...]))');\n }\n metadata.definitions.forEach(def => {\n this._resetContextStyleTimingState(context);\n if (def.type == 0 /* State */) {\n const stateDef = def;\n const name = stateDef.name;\n name.toString().split(/\\s*,\\s*/).forEach(n => {\n stateDef.name = n;\n states.push(this.visitState(stateDef, context));\n });\n stateDef.name = name;\n }\n else if (def.type == 1 /* Transition */) {\n const transition = this.visitTransition(def, context);\n queryCount += transition.queryCount;\n depCount += transition.depCount;\n transitions.push(transition);\n }\n else {\n context.errors.push('only state() and transition() definitions can sit inside of a trigger()');\n }\n });\n return {\n type: 7 /* Trigger */,\n name: metadata.name,\n states,\n transitions,\n queryCount,\n depCount,\n options: null\n };\n }\n visitState(metadata, context) {\n const styleAst = this.visitStyle(metadata.styles, context);\n const astParams = (metadata.options && metadata.options.params) || null;\n if (styleAst.containsDynamicStyles) {\n const missingSubs = new Set();\n const params = astParams || {};\n styleAst.styles.forEach(value => {\n if (isObject(value)) {\n const stylesObj = value;\n Object.keys(stylesObj).forEach(prop => {\n extractStyleParams(stylesObj[prop]).forEach(sub => {\n if (!params.hasOwnProperty(sub)) {\n missingSubs.add(sub);\n }\n });\n });\n }\n });\n if (missingSubs.size) {\n const missingSubsArr = iteratorToArray(missingSubs.values());\n context.errors.push(`state(\"${metadata\n .name}\", ...) must define default values for all the following style substitutions: ${missingSubsArr.join(', ')}`);\n }\n }\n return {\n type: 0 /* State */,\n name: metadata.name,\n style: styleAst,\n options: astParams ? { params: astParams } : null\n };\n }\n visitTransition(metadata, context) {\n context.queryCount = 0;\n context.depCount = 0;\n const animation = visitDslNode(this, normalizeAnimationEntry(metadata.animation), context);\n const matchers = parseTransitionExpr(metadata.expr, context.errors);\n return {\n type: 1 /* Transition */,\n matchers,\n animation,\n queryCount: context.queryCount,\n depCount: context.depCount,\n options: normalizeAnimationOptions(metadata.options)\n };\n }\n visitSequence(metadata, context) {\n return {\n type: 2 /* Sequence */,\n steps: metadata.steps.map(s => visitDslNode(this, s, context)),\n options: normalizeAnimationOptions(metadata.options)\n };\n }\n visitGroup(metadata, context) {\n const currentTime = context.currentTime;\n let furthestTime = 0;\n const steps = metadata.steps.map(step => {\n context.currentTime = currentTime;\n const innerAst = visitDslNode(this, step, context);\n furthestTime = Math.max(furthestTime, context.currentTime);\n return innerAst;\n });\n context.currentTime = furthestTime;\n return {\n type: 3 /* Group */,\n steps,\n options: normalizeAnimationOptions(metadata.options)\n };\n }\n visitAnimate(metadata, context) {\n const timingAst = constructTimingAst(metadata.timings, context.errors);\n context.currentAnimateTimings = timingAst;\n let styleAst;\n let styleMetadata = metadata.styles ? metadata.styles : style({});\n if (styleMetadata.type == 5 /* Keyframes */) {\n styleAst = this.visitKeyframes(styleMetadata, context);\n }\n else {\n let styleMetadata = metadata.styles;\n let isEmpty = false;\n if (!styleMetadata) {\n isEmpty = true;\n const newStyleData = {};\n if (timingAst.easing) {\n newStyleData['easing'] = timingAst.easing;\n }\n styleMetadata = style(newStyleData);\n }\n context.currentTime += timingAst.duration + timingAst.delay;\n const _styleAst = this.visitStyle(styleMetadata, context);\n _styleAst.isEmptyStep = isEmpty;\n styleAst = _styleAst;\n }\n context.currentAnimateTimings = null;\n return {\n type: 4 /* Animate */,\n timings: timingAst,\n style: styleAst,\n options: null\n };\n }\n visitStyle(metadata, context) {\n const ast = this._makeStyleAst(metadata, context);\n this._validateStyleAst(ast, context);\n return ast;\n }\n _makeStyleAst(metadata, context) {\n const styles = [];\n if (Array.isArray(metadata.styles)) {\n metadata.styles.forEach(styleTuple => {\n if (typeof styleTuple == 'string') {\n if (styleTuple == AUTO_STYLE) {\n styles.push(styleTuple);\n }\n else {\n context.errors.push(`The provided style string value ${styleTuple} is not allowed.`);\n }\n }\n else {\n styles.push(styleTuple);\n }\n });\n }\n else {\n styles.push(metadata.styles);\n }\n let containsDynamicStyles = false;\n let collectedEasing = null;\n styles.forEach(styleData => {\n if (isObject(styleData)) {\n const styleMap = styleData;\n const easing = styleMap['easing'];\n if (easing) {\n collectedEasing = easing;\n delete styleMap['easing'];\n }\n if (!containsDynamicStyles) {\n for (let prop in styleMap) {\n const value = styleMap[prop];\n if (value.toString().indexOf(SUBSTITUTION_EXPR_START) >= 0) {\n containsDynamicStyles = true;\n break;\n }\n }\n }\n }\n });\n return {\n type: 6 /* Style */,\n styles,\n easing: collectedEasing,\n offset: metadata.offset,\n containsDynamicStyles,\n options: null\n };\n }\n _validateStyleAst(ast, context) {\n const timings = context.currentAnimateTimings;\n let endTime = context.currentTime;\n let startTime = context.currentTime;\n if (timings && startTime > 0) {\n startTime -= timings.duration + timings.delay;\n }\n ast.styles.forEach(tuple => {\n if (typeof tuple == 'string')\n return;\n Object.keys(tuple).forEach(prop => {\n if (!this._driver.validateStyleProperty(prop)) {\n context.errors.push(`The provided animation property \"${prop}\" is not a supported CSS property for animations`);\n return;\n }\n const collectedStyles = context.collectedStyles[context.currentQuerySelector];\n const collectedEntry = collectedStyles[prop];\n let updateCollectedStyle = true;\n if (collectedEntry) {\n if (startTime != endTime && startTime >= collectedEntry.startTime &&\n endTime <= collectedEntry.endTime) {\n context.errors.push(`The CSS property \"${prop}\" that exists between the times of \"${collectedEntry.startTime}ms\" and \"${collectedEntry\n .endTime}ms\" is also being animated in a parallel animation between the times of \"${startTime}ms\" and \"${endTime}ms\"`);\n updateCollectedStyle = false;\n }\n // we always choose the smaller start time value since we\n // want to have a record of the entire animation window where\n // the style property is being animated in between\n startTime = collectedEntry.startTime;\n }\n if (updateCollectedStyle) {\n collectedStyles[prop] = { startTime, endTime };\n }\n if (context.options) {\n validateStyleParams(tuple[prop], context.options, context.errors);\n }\n });\n });\n }\n visitKeyframes(metadata, context) {\n const ast = { type: 5 /* Keyframes */, styles: [], options: null };\n if (!context.currentAnimateTimings) {\n context.errors.push(`keyframes() must be placed inside of a call to animate()`);\n return ast;\n }\n const MAX_KEYFRAME_OFFSET = 1;\n let totalKeyframesWithOffsets = 0;\n const offsets = [];\n let offsetsOutOfOrder = false;\n let keyframesOutOfRange = false;\n let previousOffset = 0;\n const keyframes = metadata.steps.map(styles => {\n const style = this._makeStyleAst(styles, context);\n let offsetVal = style.offset != null ? style.offset : consumeOffset(style.styles);\n let offset = 0;\n if (offsetVal != null) {\n totalKeyframesWithOffsets++;\n offset = style.offset = offsetVal;\n }\n keyframesOutOfRange = keyframesOutOfRange || offset < 0 || offset > 1;\n offsetsOutOfOrder = offsetsOutOfOrder || offset < previousOffset;\n previousOffset = offset;\n offsets.push(offset);\n return style;\n });\n if (keyframesOutOfRange) {\n context.errors.push(`Please ensure that all keyframe offsets are between 0 and 1`);\n }\n if (offsetsOutOfOrder) {\n context.errors.push(`Please ensure that all keyframe offsets are in order`);\n }\n const length = metadata.steps.length;\n let generatedOffset = 0;\n if (totalKeyframesWithOffsets > 0 && totalKeyframesWithOffsets < length) {\n context.errors.push(`Not all style() steps within the declared keyframes() contain offsets`);\n }\n else if (totalKeyframesWithOffsets == 0) {\n generatedOffset = MAX_KEYFRAME_OFFSET / (length - 1);\n }\n const limit = length - 1;\n const currentTime = context.currentTime;\n const currentAnimateTimings = context.currentAnimateTimings;\n const animateDuration = currentAnimateTimings.duration;\n keyframes.forEach((kf, i) => {\n const offset = generatedOffset > 0 ? (i == limit ? 1 : (generatedOffset * i)) : offsets[i];\n const durationUpToThisFrame = offset * animateDuration;\n context.currentTime = currentTime + currentAnimateTimings.delay + durationUpToThisFrame;\n currentAnimateTimings.duration = durationUpToThisFrame;\n this._validateStyleAst(kf, context);\n kf.offset = offset;\n ast.styles.push(kf);\n });\n return ast;\n }\n visitReference(metadata, context) {\n return {\n type: 8 /* Reference */,\n animation: visitDslNode(this, normalizeAnimationEntry(metadata.animation), context),\n options: normalizeAnimationOptions(metadata.options)\n };\n }\n visitAnimateChild(metadata, context) {\n context.depCount++;\n return {\n type: 9 /* AnimateChild */,\n options: normalizeAnimationOptions(metadata.options)\n };\n }\n visitAnimateRef(metadata, context) {\n return {\n type: 10 /* AnimateRef */,\n animation: this.visitReference(metadata.animation, context),\n options: normalizeAnimationOptions(metadata.options)\n };\n }\n visitQuery(metadata, context) {\n const parentSelector = context.currentQuerySelector;\n const options = (metadata.options || {});\n context.queryCount++;\n context.currentQuery = metadata;\n const [selector, includeSelf] = normalizeSelector(metadata.selector);\n context.currentQuerySelector =\n parentSelector.length ? (parentSelector + ' ' + selector) : selector;\n getOrSetAsInMap(context.collectedStyles, context.currentQuerySelector, {});\n const animation = visitDslNode(this, normalizeAnimationEntry(metadata.animation), context);\n context.currentQuery = null;\n context.currentQuerySelector = parentSelector;\n return {\n type: 11 /* Query */,\n selector,\n limit: options.limit || 0,\n optional: !!options.optional,\n includeSelf,\n animation,\n originalSelector: metadata.selector,\n options: normalizeAnimationOptions(metadata.options)\n };\n }\n visitStagger(metadata, context) {\n if (!context.currentQuery) {\n context.errors.push(`stagger() can only be used inside of query()`);\n }\n const timings = metadata.timings === 'full' ?\n { duration: 0, delay: 0, easing: 'full' } :\n resolveTiming(metadata.timings, context.errors, true);\n return {\n type: 12 /* Stagger */,\n animation: visitDslNode(this, normalizeAnimationEntry(metadata.animation), context),\n timings,\n options: null\n };\n }\n}\nfunction normalizeSelector(selector) {\n const hasAmpersand = selector.split(/\\s*,\\s*/).find(token => token == SELF_TOKEN) ? true : false;\n if (hasAmpersand) {\n selector = selector.replace(SELF_TOKEN_REGEX, '');\n }\n // the :enter and :leave selectors are filled in at runtime during timeline building\n selector = selector.replace(/@\\*/g, NG_TRIGGER_SELECTOR)\n .replace(/@\\w+/g, match => NG_TRIGGER_SELECTOR + '-' + match.substr(1))\n .replace(/:animating/g, NG_ANIMATING_SELECTOR);\n return [selector, hasAmpersand];\n}\nfunction normalizeParams(obj) {\n return obj ? copyObj(obj) : null;\n}\nclass AnimationAstBuilderContext {\n constructor(errors) {\n this.errors = errors;\n this.queryCount = 0;\n this.depCount = 0;\n this.currentTransition = null;\n this.currentQuery = null;\n this.currentQuerySelector = null;\n this.currentAnimateTimings = null;\n this.currentTime = 0;\n this.collectedStyles = {};\n this.options = null;\n }\n}\nfunction consumeOffset(styles) {\n if (typeof styles == 'string')\n return null;\n let offset = null;\n if (Array.isArray(styles)) {\n styles.forEach(styleTuple => {\n if (isObject(styleTuple) && styleTuple.hasOwnProperty('offset')) {\n const obj = styleTuple;\n offset = parseFloat(obj['offset']);\n delete obj['offset'];\n }\n });\n }\n else if (isObject(styles) && styles.hasOwnProperty('offset')) {\n const obj = styles;\n offset = parseFloat(obj['offset']);\n delete obj['offset'];\n }\n return offset;\n}\nfunction isObject(value) {\n return !Array.isArray(value) && typeof value == 'object';\n}\nfunction constructTimingAst(value, errors) {\n let timings = null;\n if (value.hasOwnProperty('duration')) {\n timings = value;\n }\n else if (typeof value == 'number') {\n const duration = resolveTiming(value, errors).duration;\n return makeTimingAst(duration, 0, '');\n }\n const strValue = value;\n const isDynamic = strValue.split(/\\s+/).some(v => v.charAt(0) == '{' && v.charAt(1) == '{');\n if (isDynamic) {\n const ast = makeTimingAst(0, 0, '');\n ast.dynamic = true;\n ast.strValue = strValue;\n return ast;\n }\n timings = timings || resolveTiming(strValue, errors);\n return makeTimingAst(timings.duration, timings.delay, timings.easing);\n}\nfunction normalizeAnimationOptions(options) {\n if (options) {\n options = copyObj(options);\n if (options['params']) {\n options['params'] = normalizeParams(options['params']);\n }\n }\n else {\n options = {};\n }\n return options;\n}\nfunction makeTimingAst(duration, delay, easing) {\n return { duration, delay, easing };\n}\n\nfunction createTimelineInstruction(element, keyframes, preStyleProps, postStyleProps, duration, delay, easing = null, subTimeline = false) {\n return {\n type: 1 /* TimelineAnimation */,\n element,\n keyframes,\n preStyleProps,\n postStyleProps,\n duration,\n delay,\n totalTime: duration + delay,\n easing,\n subTimeline\n };\n}\n\nclass ElementInstructionMap {\n constructor() {\n this._map = new Map();\n }\n consume(element) {\n let instructions = this._map.get(element);\n if (instructions) {\n this._map.delete(element);\n }\n else {\n instructions = [];\n }\n return instructions;\n }\n append(element, instructions) {\n let existingInstructions = this._map.get(element);\n if (!existingInstructions) {\n this._map.set(element, existingInstructions = []);\n }\n existingInstructions.push(...instructions);\n }\n has(element) {\n return this._map.has(element);\n }\n clear() {\n this._map.clear();\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nconst ONE_FRAME_IN_MILLISECONDS = 1;\nconst ENTER_TOKEN = ':enter';\nconst ENTER_TOKEN_REGEX = new RegExp(ENTER_TOKEN, 'g');\nconst LEAVE_TOKEN = ':leave';\nconst LEAVE_TOKEN_REGEX = new RegExp(LEAVE_TOKEN, 'g');\n/*\n * The code within this file aims to generate web-animations-compatible keyframes from Angular's\n * animation DSL code.\n *\n * The code below will be converted from:\n *\n * ```\n * sequence([\n * style({ opacity: 0 }),\n * animate(1000, style({ opacity: 0 }))\n * ])\n * ```\n *\n * To:\n * ```\n * keyframes = [{ opacity: 0, offset: 0 }, { opacity: 1, offset: 1 }]\n * duration = 1000\n * delay = 0\n * easing = ''\n * ```\n *\n * For this operation to cover the combination of animation verbs (style, animate, group, etc...) a\n * combination of prototypical inheritance, AST traversal and merge-sort-like algorithms are used.\n *\n * [AST Traversal]\n * Each of the animation verbs, when executed, will return an string-map object representing what\n * type of action it is (style, animate, group, etc...) and the data associated with it. This means\n * that when functional composition mix of these functions is evaluated (like in the example above)\n * then it will end up producing a tree of objects representing the animation itself.\n *\n * When this animation object tree is processed by the visitor code below it will visit each of the\n * verb statements within the visitor. And during each visit it will build the context of the\n * animation keyframes by interacting with the `TimelineBuilder`.\n *\n * [TimelineBuilder]\n * This class is responsible for tracking the styles and building a series of keyframe objects for a\n * timeline between a start and end time. The builder starts off with an initial timeline and each\n * time the AST comes across a `group()`, `keyframes()` or a combination of the two wihtin a\n * `sequence()` then it will generate a sub timeline for each step as well as a new one after\n * they are complete.\n *\n * As the AST is traversed, the timing state on each of the timelines will be incremented. If a sub\n * timeline was created (based on one of the cases above) then the parent timeline will attempt to\n * merge the styles used within the sub timelines into itself (only with group() this will happen).\n * This happens with a merge operation (much like how the merge works in mergesort) and it will only\n * copy the most recently used styles from the sub timelines into the parent timeline. This ensures\n * that if the styles are used later on in another phase of the animation then they will be the most\n * up-to-date values.\n *\n * [How Missing Styles Are Updated]\n * Each timeline has a `backFill` property which is responsible for filling in new styles into\n * already processed keyframes if a new style shows up later within the animation sequence.\n *\n * ```\n * sequence([\n * style({ width: 0 }),\n * animate(1000, style({ width: 100 })),\n * animate(1000, style({ width: 200 })),\n * animate(1000, style({ width: 300 }))\n * animate(1000, style({ width: 400, height: 400 })) // notice how `height` doesn't exist anywhere\n * else\n * ])\n * ```\n *\n * What is happening here is that the `height` value is added later in the sequence, but is missing\n * from all previous animation steps. Therefore when a keyframe is created it would also be missing\n * from all previous keyframes up until where it is first used. For the timeline keyframe generation\n * to properly fill in the style it will place the previous value (the value from the parent\n * timeline) or a default value of `*` into the backFill object. Given that each of the keyframe\n * styles are objects that prototypically inhert from the backFill object, this means that if a\n * value is added into the backFill then it will automatically propagate any missing values to all\n * keyframes. Therefore the missing `height` value will be properly filled into the already\n * processed keyframes.\n *\n * When a sub-timeline is created it will have its own backFill property. This is done so that\n * styles present within the sub-timeline do not accidentally seep into the previous/future timeline\n * keyframes\n *\n * (For prototypically-inherited contents to be detected a `for(i in obj)` loop must be used.)\n *\n * [Validation]\n * The code in this file is not responsible for validation. That functionality happens with within\n * the `AnimationValidatorVisitor` code.\n */\nfunction buildAnimationTimelines(driver, rootElement, ast, enterClassName, leaveClassName, startingStyles = {}, finalStyles = {}, options, subInstructions, errors = []) {\n return new AnimationTimelineBuilderVisitor().buildKeyframes(driver, rootElement, ast, enterClassName, leaveClassName, startingStyles, finalStyles, options, subInstructions, errors);\n}\nclass AnimationTimelineBuilderVisitor {\n buildKeyframes(driver, rootElement, ast, enterClassName, leaveClassName, startingStyles, finalStyles, options, subInstructions, errors = []) {\n subInstructions = subInstructions || new ElementInstructionMap();\n const context = new AnimationTimelineContext(driver, rootElement, subInstructions, enterClassName, leaveClassName, errors, []);\n context.options = options;\n context.currentTimeline.setStyles([startingStyles], null, context.errors, options);\n visitDslNode(this, ast, context);\n // this checks to see if an actual animation happened\n const timelines = context.timelines.filter(timeline => timeline.containsAnimation());\n if (timelines.length && Object.keys(finalStyles).length) {\n const tl = timelines[timelines.length - 1];\n if (!tl.allowOnlyTimelineStyles()) {\n tl.setStyles([finalStyles], null, context.errors, options);\n }\n }\n return timelines.length ? timelines.map(timeline => timeline.buildKeyframes()) :\n [createTimelineInstruction(rootElement, [], [], [], 0, 0, '', false)];\n }\n visitTrigger(ast, context) {\n // these values are not visited in this AST\n }\n visitState(ast, context) {\n // these values are not visited in this AST\n }\n visitTransition(ast, context) {\n // these values are not visited in this AST\n }\n visitAnimateChild(ast, context) {\n const elementInstructions = context.subInstructions.consume(context.element);\n if (elementInstructions) {\n const innerContext = context.createSubContext(ast.options);\n const startTime = context.currentTimeline.currentTime;\n const endTime = this._visitSubInstructions(elementInstructions, innerContext, innerContext.options);\n if (startTime != endTime) {\n // we do this on the upper context because we created a sub context for\n // the sub child animations\n context.transformIntoNewTimeline(endTime);\n }\n }\n context.previousNode = ast;\n }\n visitAnimateRef(ast, context) {\n const innerContext = context.createSubContext(ast.options);\n innerContext.transformIntoNewTimeline();\n this.visitReference(ast.animation, innerContext);\n context.transformIntoNewTimeline(innerContext.currentTimeline.currentTime);\n context.previousNode = ast;\n }\n _visitSubInstructions(instructions, context, options) {\n const startTime = context.currentTimeline.currentTime;\n let furthestTime = startTime;\n // this is a special-case for when a user wants to skip a sub\n // animation from being fired entirely.\n const duration = options.duration != null ? resolveTimingValue(options.duration) : null;\n const delay = options.delay != null ? resolveTimingValue(options.delay) : null;\n if (duration !== 0) {\n instructions.forEach(instruction => {\n const instructionTimings = context.appendInstructionToTimeline(instruction, duration, delay);\n furthestTime =\n Math.max(furthestTime, instructionTimings.duration + instructionTimings.delay);\n });\n }\n return furthestTime;\n }\n visitReference(ast, context) {\n context.updateOptions(ast.options, true);\n visitDslNode(this, ast.animation, context);\n context.previousNode = ast;\n }\n visitSequence(ast, context) {\n const subContextCount = context.subContextCount;\n let ctx = context;\n const options = ast.options;\n if (options && (options.params || options.delay)) {\n ctx = context.createSubContext(options);\n ctx.transformIntoNewTimeline();\n if (options.delay != null) {\n if (ctx.previousNode.type == 6 /* Style */) {\n ctx.currentTimeline.snapshotCurrentStyles();\n ctx.previousNode = DEFAULT_NOOP_PREVIOUS_NODE;\n }\n const delay = resolveTimingValue(options.delay);\n ctx.delayNextStep(delay);\n }\n }\n if (ast.steps.length) {\n ast.steps.forEach(s => visitDslNode(this, s, ctx));\n // this is here just incase the inner steps only contain or end with a style() call\n ctx.currentTimeline.applyStylesToKeyframe();\n // this means that some animation function within the sequence\n // ended up creating a sub timeline (which means the current\n // timeline cannot overlap with the contents of the sequence)\n if (ctx.subContextCount > subContextCount) {\n ctx.transformIntoNewTimeline();\n }\n }\n context.previousNode = ast;\n }\n visitGroup(ast, context) {\n const innerTimelines = [];\n let furthestTime = context.currentTimeline.currentTime;\n const delay = ast.options && ast.options.delay ? resolveTimingValue(ast.options.delay) : 0;\n ast.steps.forEach(s => {\n const innerContext = context.createSubContext(ast.options);\n if (delay) {\n innerContext.delayNextStep(delay);\n }\n visitDslNode(this, s, innerContext);\n furthestTime = Math.max(furthestTime, innerContext.currentTimeline.currentTime);\n innerTimelines.push(innerContext.currentTimeline);\n });\n // this operation is run after the AST loop because otherwise\n // if the parent timeline's collected styles were updated then\n // it would pass in invalid data into the new-to-be forked items\n innerTimelines.forEach(timeline => context.currentTimeline.mergeTimelineCollectedStyles(timeline));\n context.transformIntoNewTimeline(furthestTime);\n context.previousNode = ast;\n }\n _visitTiming(ast, context) {\n if (ast.dynamic) {\n const strValue = ast.strValue;\n const timingValue = context.params ? interpolateParams(strValue, context.params, context.errors) : strValue;\n return resolveTiming(timingValue, context.errors);\n }\n else {\n return { duration: ast.duration, delay: ast.delay, easing: ast.easing };\n }\n }\n visitAnimate(ast, context) {\n const timings = context.currentAnimateTimings = this._visitTiming(ast.timings, context);\n const timeline = context.currentTimeline;\n if (timings.delay) {\n context.incrementTime(timings.delay);\n timeline.snapshotCurrentStyles();\n }\n const style = ast.style;\n if (style.type == 5 /* Keyframes */) {\n this.visitKeyframes(style, context);\n }\n else {\n context.incrementTime(timings.duration);\n this.visitStyle(style, context);\n timeline.applyStylesToKeyframe();\n }\n context.currentAnimateTimings = null;\n context.previousNode = ast;\n }\n visitStyle(ast, context) {\n const timeline = context.currentTimeline;\n const timings = context.currentAnimateTimings;\n // this is a special case for when a style() call\n // directly follows an animate() call (but not inside of an animate() call)\n if (!timings && timeline.getCurrentStyleProperties().length) {\n timeline.forwardFrame();\n }\n const easing = (timings && timings.easing) || ast.easing;\n if (ast.isEmptyStep) {\n timeline.applyEmptyStep(easing);\n }\n else {\n timeline.setStyles(ast.styles, easing, context.errors, context.options);\n }\n context.previousNode = ast;\n }\n visitKeyframes(ast, context) {\n const currentAnimateTimings = context.currentAnimateTimings;\n const startTime = (context.currentTimeline).duration;\n const duration = currentAnimateTimings.duration;\n const innerContext = context.createSubContext();\n const innerTimeline = innerContext.currentTimeline;\n innerTimeline.easing = currentAnimateTimings.easing;\n ast.styles.forEach(step => {\n const offset = step.offset || 0;\n innerTimeline.forwardTime(offset * duration);\n innerTimeline.setStyles(step.styles, step.easing, context.errors, context.options);\n innerTimeline.applyStylesToKeyframe();\n });\n // this will ensure that the parent timeline gets all the styles from\n // the child even if the new timeline below is not used\n context.currentTimeline.mergeTimelineCollectedStyles(innerTimeline);\n // we do this because the window between this timeline and the sub timeline\n // should ensure that the styles within are exactly the same as they were before\n context.transformIntoNewTimeline(startTime + duration);\n context.previousNode = ast;\n }\n visitQuery(ast, context) {\n // in the event that the first step before this is a style step we need\n // to ensure the styles are applied before the children are animated\n const startTime = context.currentTimeline.currentTime;\n const options = (ast.options || {});\n const delay = options.delay ? resolveTimingValue(options.delay) : 0;\n if (delay &&\n (context.previousNode.type === 6 /* Style */ ||\n (startTime == 0 && context.currentTimeline.getCurrentStyleProperties().length))) {\n context.currentTimeline.snapshotCurrentStyles();\n context.previousNode = DEFAULT_NOOP_PREVIOUS_NODE;\n }\n let furthestTime = startTime;\n const elms = context.invokeQuery(ast.selector, ast.originalSelector, ast.limit, ast.includeSelf, options.optional ? true : false, context.errors);\n context.currentQueryTotal = elms.length;\n let sameElementTimeline = null;\n elms.forEach((element, i) => {\n context.currentQueryIndex = i;\n const innerContext = context.createSubContext(ast.options, element);\n if (delay) {\n innerContext.delayNextStep(delay);\n }\n if (element === context.element) {\n sameElementTimeline = innerContext.currentTimeline;\n }\n visitDslNode(this, ast.animation, innerContext);\n // this is here just incase the inner steps only contain or end\n // with a style() call (which is here to signal that this is a preparatory\n // call to style an element before it is animated again)\n innerContext.currentTimeline.applyStylesToKeyframe();\n const endTime = innerContext.currentTimeline.currentTime;\n furthestTime = Math.max(furthestTime, endTime);\n });\n context.currentQueryIndex = 0;\n context.currentQueryTotal = 0;\n context.transformIntoNewTimeline(furthestTime);\n if (sameElementTimeline) {\n context.currentTimeline.mergeTimelineCollectedStyles(sameElementTimeline);\n context.currentTimeline.snapshotCurrentStyles();\n }\n context.previousNode = ast;\n }\n visitStagger(ast, context) {\n const parentContext = context.parentContext;\n const tl = context.currentTimeline;\n const timings = ast.timings;\n const duration = Math.abs(timings.duration);\n const maxTime = duration * (context.currentQueryTotal - 1);\n let delay = duration * context.currentQueryIndex;\n let staggerTransformer = timings.duration < 0 ? 'reverse' : timings.easing;\n switch (staggerTransformer) {\n case 'reverse':\n delay = maxTime - delay;\n break;\n case 'full':\n delay = parentContext.currentStaggerTime;\n break;\n }\n const timeline = context.currentTimeline;\n if (delay) {\n timeline.delayNextStep(delay);\n }\n const startingTime = timeline.currentTime;\n visitDslNode(this, ast.animation, context);\n context.previousNode = ast;\n // time = duration + delay\n // the reason why this computation is so complex is because\n // the inner timeline may either have a delay value or a stretched\n // keyframe depending on if a subtimeline is not used or is used.\n parentContext.currentStaggerTime =\n (tl.currentTime - startingTime) + (tl.startTime - parentContext.currentTimeline.startTime);\n }\n}\nconst DEFAULT_NOOP_PREVIOUS_NODE = {};\nclass AnimationTimelineContext {\n constructor(_driver, element, subInstructions, _enterClassName, _leaveClassName, errors, timelines, initialTimeline) {\n this._driver = _driver;\n this.element = element;\n this.subInstructions = subInstructions;\n this._enterClassName = _enterClassName;\n this._leaveClassName = _leaveClassName;\n this.errors = errors;\n this.timelines = timelines;\n this.parentContext = null;\n this.currentAnimateTimings = null;\n this.previousNode = DEFAULT_NOOP_PREVIOUS_NODE;\n this.subContextCount = 0;\n this.options = {};\n this.currentQueryIndex = 0;\n this.currentQueryTotal = 0;\n this.currentStaggerTime = 0;\n this.currentTimeline = initialTimeline || new TimelineBuilder(this._driver, element, 0);\n timelines.push(this.currentTimeline);\n }\n get params() {\n return this.options.params;\n }\n updateOptions(options, skipIfExists) {\n if (!options)\n return;\n const newOptions = options;\n let optionsToUpdate = this.options;\n // NOTE: this will get patched up when other animation methods support duration overrides\n if (newOptions.duration != null) {\n optionsToUpdate.duration = resolveTimingValue(newOptions.duration);\n }\n if (newOptions.delay != null) {\n optionsToUpdate.delay = resolveTimingValue(newOptions.delay);\n }\n const newParams = newOptions.params;\n if (newParams) {\n let paramsToUpdate = optionsToUpdate.params;\n if (!paramsToUpdate) {\n paramsToUpdate = this.options.params = {};\n }\n Object.keys(newParams).forEach(name => {\n if (!skipIfExists || !paramsToUpdate.hasOwnProperty(name)) {\n paramsToUpdate[name] = interpolateParams(newParams[name], paramsToUpdate, this.errors);\n }\n });\n }\n }\n _copyOptions() {\n const options = {};\n if (this.options) {\n const oldParams = this.options.params;\n if (oldParams) {\n const params = options['params'] = {};\n Object.keys(oldParams).forEach(name => {\n params[name] = oldParams[name];\n });\n }\n }\n return options;\n }\n createSubContext(options = null, element, newTime) {\n const target = element || this.element;\n const context = new AnimationTimelineContext(this._driver, target, this.subInstructions, this._enterClassName, this._leaveClassName, this.errors, this.timelines, this.currentTimeline.fork(target, newTime || 0));\n context.previousNode = this.previousNode;\n context.currentAnimateTimings = this.currentAnimateTimings;\n context.options = this._copyOptions();\n context.updateOptions(options);\n context.currentQueryIndex = this.currentQueryIndex;\n context.currentQueryTotal = this.currentQueryTotal;\n context.parentContext = this;\n this.subContextCount++;\n return context;\n }\n transformIntoNewTimeline(newTime) {\n this.previousNode = DEFAULT_NOOP_PREVIOUS_NODE;\n this.currentTimeline = this.currentTimeline.fork(this.element, newTime);\n this.timelines.push(this.currentTimeline);\n return this.currentTimeline;\n }\n appendInstructionToTimeline(instruction, duration, delay) {\n const updatedTimings = {\n duration: duration != null ? duration : instruction.duration,\n delay: this.currentTimeline.currentTime + (delay != null ? delay : 0) + instruction.delay,\n easing: ''\n };\n const builder = new SubTimelineBuilder(this._driver, instruction.element, instruction.keyframes, instruction.preStyleProps, instruction.postStyleProps, updatedTimings, instruction.stretchStartingKeyframe);\n this.timelines.push(builder);\n return updatedTimings;\n }\n incrementTime(time) {\n this.currentTimeline.forwardTime(this.currentTimeline.duration + time);\n }\n delayNextStep(delay) {\n // negative delays are not yet supported\n if (delay > 0) {\n this.currentTimeline.delayNextStep(delay);\n }\n }\n invokeQuery(selector, originalSelector, limit, includeSelf, optional, errors) {\n let results = [];\n if (includeSelf) {\n results.push(this.element);\n }\n if (selector.length > 0) { // if :self is only used then the selector is empty\n selector = selector.replace(ENTER_TOKEN_REGEX, '.' + this._enterClassName);\n selector = selector.replace(LEAVE_TOKEN_REGEX, '.' + this._leaveClassName);\n const multi = limit != 1;\n let elements = this._driver.query(this.element, selector, multi);\n if (limit !== 0) {\n elements = limit < 0 ? elements.slice(elements.length + limit, elements.length) :\n elements.slice(0, limit);\n }\n results.push(...elements);\n }\n if (!optional && results.length == 0) {\n errors.push(`\\`query(\"${originalSelector}\")\\` returned zero elements. (Use \\`query(\"${originalSelector}\", { optional: true })\\` if you wish to allow this.)`);\n }\n return results;\n }\n}\nclass TimelineBuilder {\n constructor(_driver, element, startTime, _elementTimelineStylesLookup) {\n this._driver = _driver;\n this.element = element;\n this.startTime = startTime;\n this._elementTimelineStylesLookup = _elementTimelineStylesLookup;\n this.duration = 0;\n this._previousKeyframe = {};\n this._currentKeyframe = {};\n this._keyframes = new Map();\n this._styleSummary = {};\n this._pendingStyles = {};\n this._backFill = {};\n this._currentEmptyStepKeyframe = null;\n if (!this._elementTimelineStylesLookup) {\n this._elementTimelineStylesLookup = new Map();\n }\n this._localTimelineStyles = Object.create(this._backFill, {});\n this._globalTimelineStyles = this._elementTimelineStylesLookup.get(element);\n if (!this._globalTimelineStyles) {\n this._globalTimelineStyles = this._localTimelineStyles;\n this._elementTimelineStylesLookup.set(element, this._localTimelineStyles);\n }\n this._loadKeyframe();\n }\n containsAnimation() {\n switch (this._keyframes.size) {\n case 0:\n return false;\n case 1:\n return this.getCurrentStyleProperties().length > 0;\n default:\n return true;\n }\n }\n getCurrentStyleProperties() {\n return Object.keys(this._currentKeyframe);\n }\n get currentTime() {\n return this.startTime + this.duration;\n }\n delayNextStep(delay) {\n // in the event that a style() step is placed right before a stagger()\n // and that style() step is the very first style() value in the animation\n // then we need to make a copy of the keyframe [0, copy, 1] so that the delay\n // properly applies the style() values to work with the stagger...\n const hasPreStyleStep = this._keyframes.size == 1 && Object.keys(this._pendingStyles).length;\n if (this.duration || hasPreStyleStep) {\n this.forwardTime(this.currentTime + delay);\n if (hasPreStyleStep) {\n this.snapshotCurrentStyles();\n }\n }\n else {\n this.startTime += delay;\n }\n }\n fork(element, currentTime) {\n this.applyStylesToKeyframe();\n return new TimelineBuilder(this._driver, element, currentTime || this.currentTime, this._elementTimelineStylesLookup);\n }\n _loadKeyframe() {\n if (this._currentKeyframe) {\n this._previousKeyframe = this._currentKeyframe;\n }\n this._currentKeyframe = this._keyframes.get(this.duration);\n if (!this._currentKeyframe) {\n this._currentKeyframe = Object.create(this._backFill, {});\n this._keyframes.set(this.duration, this._currentKeyframe);\n }\n }\n forwardFrame() {\n this.duration += ONE_FRAME_IN_MILLISECONDS;\n this._loadKeyframe();\n }\n forwardTime(time) {\n this.applyStylesToKeyframe();\n this.duration = time;\n this._loadKeyframe();\n }\n _updateStyle(prop, value) {\n this._localTimelineStyles[prop] = value;\n this._globalTimelineStyles[prop] = value;\n this._styleSummary[prop] = { time: this.currentTime, value };\n }\n allowOnlyTimelineStyles() {\n return this._currentEmptyStepKeyframe !== this._currentKeyframe;\n }\n applyEmptyStep(easing) {\n if (easing) {\n this._previousKeyframe['easing'] = easing;\n }\n // special case for animate(duration):\n // all missing styles are filled with a `*` value then\n // if any destination styles are filled in later on the same\n // keyframe then they will override the overridden styles\n // We use `_globalTimelineStyles` here because there may be\n // styles in previous keyframes that are not present in this timeline\n Object.keys(this._globalTimelineStyles).forEach(prop => {\n this._backFill[prop] = this._globalTimelineStyles[prop] || AUTO_STYLE;\n this._currentKeyframe[prop] = AUTO_STYLE;\n });\n this._currentEmptyStepKeyframe = this._currentKeyframe;\n }\n setStyles(input, easing, errors, options) {\n if (easing) {\n this._previousKeyframe['easing'] = easing;\n }\n const params = (options && options.params) || {};\n const styles = flattenStyles(input, this._globalTimelineStyles);\n Object.keys(styles).forEach(prop => {\n const val = interpolateParams(styles[prop], params, errors);\n this._pendingStyles[prop] = val;\n if (!this._localTimelineStyles.hasOwnProperty(prop)) {\n this._backFill[prop] = this._globalTimelineStyles.hasOwnProperty(prop) ?\n this._globalTimelineStyles[prop] :\n AUTO_STYLE;\n }\n this._updateStyle(prop, val);\n });\n }\n applyStylesToKeyframe() {\n const styles = this._pendingStyles;\n const props = Object.keys(styles);\n if (props.length == 0)\n return;\n this._pendingStyles = {};\n props.forEach(prop => {\n const val = styles[prop];\n this._currentKeyframe[prop] = val;\n });\n Object.keys(this._localTimelineStyles).forEach(prop => {\n if (!this._currentKeyframe.hasOwnProperty(prop)) {\n this._currentKeyframe[prop] = this._localTimelineStyles[prop];\n }\n });\n }\n snapshotCurrentStyles() {\n Object.keys(this._localTimelineStyles).forEach(prop => {\n const val = this._localTimelineStyles[prop];\n this._pendingStyles[prop] = val;\n this._updateStyle(prop, val);\n });\n }\n getFinalKeyframe() {\n return this._keyframes.get(this.duration);\n }\n get properties() {\n const properties = [];\n for (let prop in this._currentKeyframe) {\n properties.push(prop);\n }\n return properties;\n }\n mergeTimelineCollectedStyles(timeline) {\n Object.keys(timeline._styleSummary).forEach(prop => {\n const details0 = this._styleSummary[prop];\n const details1 = timeline._styleSummary[prop];\n if (!details0 || details1.time > details0.time) {\n this._updateStyle(prop, details1.value);\n }\n });\n }\n buildKeyframes() {\n this.applyStylesToKeyframe();\n const preStyleProps = new Set();\n const postStyleProps = new Set();\n const isEmpty = this._keyframes.size === 1 && this.duration === 0;\n let finalKeyframes = [];\n this._keyframes.forEach((keyframe, time) => {\n const finalKeyframe = copyStyles(keyframe, true);\n Object.keys(finalKeyframe).forEach(prop => {\n const value = finalKeyframe[prop];\n if (value == ɵPRE_STYLE) {\n preStyleProps.add(prop);\n }\n else if (value == AUTO_STYLE) {\n postStyleProps.add(prop);\n }\n });\n if (!isEmpty) {\n finalKeyframe['offset'] = time / this.duration;\n }\n finalKeyframes.push(finalKeyframe);\n });\n const preProps = preStyleProps.size ? iteratorToArray(preStyleProps.values()) : [];\n const postProps = postStyleProps.size ? iteratorToArray(postStyleProps.values()) : [];\n // special case for a 0-second animation (which is designed just to place styles onscreen)\n if (isEmpty) {\n const kf0 = finalKeyframes[0];\n const kf1 = copyObj(kf0);\n kf0['offset'] = 0;\n kf1['offset'] = 1;\n finalKeyframes = [kf0, kf1];\n }\n return createTimelineInstruction(this.element, finalKeyframes, preProps, postProps, this.duration, this.startTime, this.easing, false);\n }\n}\nclass SubTimelineBuilder extends TimelineBuilder {\n constructor(driver, element, keyframes, preStyleProps, postStyleProps, timings, _stretchStartingKeyframe = false) {\n super(driver, element, timings.delay);\n this.element = element;\n this.keyframes = keyframes;\n this.preStyleProps = preStyleProps;\n this.postStyleProps = postStyleProps;\n this._stretchStartingKeyframe = _stretchStartingKeyframe;\n this.timings = { duration: timings.duration, delay: timings.delay, easing: timings.easing };\n }\n containsAnimation() {\n return this.keyframes.length > 1;\n }\n buildKeyframes() {\n let keyframes = this.keyframes;\n let { delay, duration, easing } = this.timings;\n if (this._stretchStartingKeyframe && delay) {\n const newKeyframes = [];\n const totalTime = duration + delay;\n const startingGap = delay / totalTime;\n // the original starting keyframe now starts once the delay is done\n const newFirstKeyframe = copyStyles(keyframes[0], false);\n newFirstKeyframe['offset'] = 0;\n newKeyframes.push(newFirstKeyframe);\n const oldFirstKeyframe = copyStyles(keyframes[0], false);\n oldFirstKeyframe['offset'] = roundOffset(startingGap);\n newKeyframes.push(oldFirstKeyframe);\n /*\n When the keyframe is stretched then it means that the delay before the animation\n starts is gone. Instead the first keyframe is placed at the start of the animation\n and it is then copied to where it starts when the original delay is over. This basically\n means nothing animates during that delay, but the styles are still renderered. For this\n to work the original offset values that exist in the original keyframes must be \"warped\"\n so that they can take the new keyframe + delay into account.\n \n delay=1000, duration=1000, keyframes = 0 .5 1\n \n turns into\n \n delay=0, duration=2000, keyframes = 0 .33 .66 1\n */\n // offsets between 1 ... n -1 are all warped by the keyframe stretch\n const limit = keyframes.length - 1;\n for (let i = 1; i <= limit; i++) {\n let kf = copyStyles(keyframes[i], false);\n const oldOffset = kf['offset'];\n const timeAtKeyframe = delay + oldOffset * duration;\n kf['offset'] = roundOffset(timeAtKeyframe / totalTime);\n newKeyframes.push(kf);\n }\n // the new starting keyframe should be added at the start\n duration = totalTime;\n delay = 0;\n easing = '';\n keyframes = newKeyframes;\n }\n return createTimelineInstruction(this.element, keyframes, this.preStyleProps, this.postStyleProps, duration, delay, easing, true);\n }\n}\nfunction roundOffset(offset, decimalPoints = 3) {\n const mult = Math.pow(10, decimalPoints - 1);\n return Math.round(offset * mult) / mult;\n}\nfunction flattenStyles(input, allStyles) {\n const styles = {};\n let allProperties;\n input.forEach(token => {\n if (token === '*') {\n allProperties = allProperties || Object.keys(allStyles);\n allProperties.forEach(prop => {\n styles[prop] = AUTO_STYLE;\n });\n }\n else {\n copyStyles(token, false, styles);\n }\n });\n return styles;\n}\n\nclass Animation {\n constructor(_driver, input) {\n this._driver = _driver;\n const errors = [];\n const ast = buildAnimationAst(_driver, input, errors);\n if (errors.length) {\n const errorMessage = `animation validation failed:\\n${errors.join('\\n')}`;\n throw new Error(errorMessage);\n }\n this._animationAst = ast;\n }\n buildTimelines(element, startingStyles, destinationStyles, options, subInstructions) {\n const start = Array.isArray(startingStyles) ? normalizeStyles(startingStyles) :\n startingStyles;\n const dest = Array.isArray(destinationStyles) ? normalizeStyles(destinationStyles) :\n destinationStyles;\n const errors = [];\n subInstructions = subInstructions || new ElementInstructionMap();\n const result = buildAnimationTimelines(this._driver, element, this._animationAst, ENTER_CLASSNAME, LEAVE_CLASSNAME, start, dest, options, subInstructions, errors);\n if (errors.length) {\n const errorMessage = `animation building failed:\\n${errors.join('\\n')}`;\n throw new Error(errorMessage);\n }\n return result;\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * @publicApi\n */\nclass AnimationStyleNormalizer {\n}\n/**\n * @publicApi\n */\nclass NoopAnimationStyleNormalizer {\n normalizePropertyName(propertyName, errors) {\n return propertyName;\n }\n normalizeStyleValue(userProvidedProperty, normalizedProperty, value, errors) {\n return value;\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nclass WebAnimationsStyleNormalizer extends AnimationStyleNormalizer {\n normalizePropertyName(propertyName, errors) {\n return dashCaseToCamelCase(propertyName);\n }\n normalizeStyleValue(userProvidedProperty, normalizedProperty, value, errors) {\n let unit = '';\n const strVal = value.toString().trim();\n if (DIMENSIONAL_PROP_MAP[normalizedProperty] && value !== 0 && value !== '0') {\n if (typeof value === 'number') {\n unit = 'px';\n }\n else {\n const valAndSuffixMatch = value.match(/^[+-]?[\\d\\.]+([a-z]*)$/);\n if (valAndSuffixMatch && valAndSuffixMatch[1].length == 0) {\n errors.push(`Please provide a CSS unit value for ${userProvidedProperty}:${value}`);\n }\n }\n }\n return strVal + unit;\n }\n}\nconst ɵ0$1 = () => makeBooleanMap('width,height,minWidth,minHeight,maxWidth,maxHeight,left,top,bottom,right,fontSize,outlineWidth,outlineOffset,paddingTop,paddingLeft,paddingBottom,paddingRight,marginTop,marginLeft,marginBottom,marginRight,borderRadius,borderWidth,borderTopWidth,borderLeftWidth,borderRightWidth,borderBottomWidth,textIndent,perspective'\n .split(','));\nconst DIMENSIONAL_PROP_MAP = (ɵ0$1)();\nfunction makeBooleanMap(keys) {\n const map = {};\n keys.forEach(key => map[key] = true);\n return map;\n}\n\nfunction createTransitionInstruction(element, triggerName, fromState, toState, isRemovalTransition, fromStyles, toStyles, timelines, queriedElements, preStyleProps, postStyleProps, totalTime, errors) {\n return {\n type: 0 /* TransitionAnimation */,\n element,\n triggerName,\n isRemovalTransition,\n fromState,\n fromStyles,\n toState,\n toStyles,\n timelines,\n queriedElements,\n preStyleProps,\n postStyleProps,\n totalTime,\n errors\n };\n}\n\nconst EMPTY_OBJECT = {};\nclass AnimationTransitionFactory {\n constructor(_triggerName, ast, _stateStyles) {\n this._triggerName = _triggerName;\n this.ast = ast;\n this._stateStyles = _stateStyles;\n }\n match(currentState, nextState, element, params) {\n return oneOrMoreTransitionsMatch(this.ast.matchers, currentState, nextState, element, params);\n }\n buildStyles(stateName, params, errors) {\n const backupStateStyler = this._stateStyles['*'];\n const stateStyler = this._stateStyles[stateName];\n const backupStyles = backupStateStyler ? backupStateStyler.buildStyles(params, errors) : {};\n return stateStyler ? stateStyler.buildStyles(params, errors) : backupStyles;\n }\n build(driver, element, currentState, nextState, enterClassName, leaveClassName, currentOptions, nextOptions, subInstructions, skipAstBuild) {\n const errors = [];\n const transitionAnimationParams = this.ast.options && this.ast.options.params || EMPTY_OBJECT;\n const currentAnimationParams = currentOptions && currentOptions.params || EMPTY_OBJECT;\n const currentStateStyles = this.buildStyles(currentState, currentAnimationParams, errors);\n const nextAnimationParams = nextOptions && nextOptions.params || EMPTY_OBJECT;\n const nextStateStyles = this.buildStyles(nextState, nextAnimationParams, errors);\n const queriedElements = new Set();\n const preStyleMap = new Map();\n const postStyleMap = new Map();\n const isRemoval = nextState === 'void';\n const animationOptions = { params: Object.assign(Object.assign({}, transitionAnimationParams), nextAnimationParams) };\n const timelines = skipAstBuild ?\n [] :\n buildAnimationTimelines(driver, element, this.ast.animation, enterClassName, leaveClassName, currentStateStyles, nextStateStyles, animationOptions, subInstructions, errors);\n let totalTime = 0;\n timelines.forEach(tl => {\n totalTime = Math.max(tl.duration + tl.delay, totalTime);\n });\n if (errors.length) {\n return createTransitionInstruction(element, this._triggerName, currentState, nextState, isRemoval, currentStateStyles, nextStateStyles, [], [], preStyleMap, postStyleMap, totalTime, errors);\n }\n timelines.forEach(tl => {\n const elm = tl.element;\n const preProps = getOrSetAsInMap(preStyleMap, elm, {});\n tl.preStyleProps.forEach(prop => preProps[prop] = true);\n const postProps = getOrSetAsInMap(postStyleMap, elm, {});\n tl.postStyleProps.forEach(prop => postProps[prop] = true);\n if (elm !== element) {\n queriedElements.add(elm);\n }\n });\n const queriedElementsList = iteratorToArray(queriedElements.values());\n return createTransitionInstruction(element, this._triggerName, currentState, nextState, isRemoval, currentStateStyles, nextStateStyles, timelines, queriedElementsList, preStyleMap, postStyleMap, totalTime);\n }\n}\nfunction oneOrMoreTransitionsMatch(matchFns, currentState, nextState, element, params) {\n return matchFns.some(fn => fn(currentState, nextState, element, params));\n}\nclass AnimationStateStyles {\n constructor(styles, defaultParams) {\n this.styles = styles;\n this.defaultParams = defaultParams;\n }\n buildStyles(params, errors) {\n const finalStyles = {};\n const combinedParams = copyObj(this.defaultParams);\n Object.keys(params).forEach(key => {\n const value = params[key];\n if (value != null) {\n combinedParams[key] = value;\n }\n });\n this.styles.styles.forEach(value => {\n if (typeof value !== 'string') {\n const styleObj = value;\n Object.keys(styleObj).forEach(prop => {\n let val = styleObj[prop];\n if (val.length > 1) {\n val = interpolateParams(val, combinedParams, errors);\n }\n finalStyles[prop] = val;\n });\n }\n });\n return finalStyles;\n }\n}\n\n/**\n * @publicApi\n */\nfunction buildTrigger(name, ast) {\n return new AnimationTrigger(name, ast);\n}\n/**\n * @publicApi\n */\nclass AnimationTrigger {\n constructor(name, ast) {\n this.name = name;\n this.ast = ast;\n this.transitionFactories = [];\n this.states = {};\n ast.states.forEach(ast => {\n const defaultParams = (ast.options && ast.options.params) || {};\n this.states[ast.name] = new AnimationStateStyles(ast.style, defaultParams);\n });\n balanceProperties(this.states, 'true', '1');\n balanceProperties(this.states, 'false', '0');\n ast.transitions.forEach(ast => {\n this.transitionFactories.push(new AnimationTransitionFactory(name, ast, this.states));\n });\n this.fallbackTransition = createFallbackTransition(name, this.states);\n }\n get containsQueries() {\n return this.ast.queryCount > 0;\n }\n matchTransition(currentState, nextState, element, params) {\n const entry = this.transitionFactories.find(f => f.match(currentState, nextState, element, params));\n return entry || null;\n }\n matchStyles(currentState, params, errors) {\n return this.fallbackTransition.buildStyles(currentState, params, errors);\n }\n}\nfunction createFallbackTransition(triggerName, states) {\n const matchers = [(fromState, toState) => true];\n const animation = { type: 2 /* Sequence */, steps: [], options: null };\n const transition = {\n type: 1 /* Transition */,\n animation,\n matchers,\n options: null,\n queryCount: 0,\n depCount: 0\n };\n return new AnimationTransitionFactory(triggerName, transition, states);\n}\nfunction balanceProperties(obj, key1, key2) {\n if (obj.hasOwnProperty(key1)) {\n if (!obj.hasOwnProperty(key2)) {\n obj[key2] = obj[key1];\n }\n }\n else if (obj.hasOwnProperty(key2)) {\n obj[key1] = obj[key2];\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nconst EMPTY_INSTRUCTION_MAP = new ElementInstructionMap();\nclass TimelineAnimationEngine {\n constructor(bodyNode, _driver, _normalizer) {\n this.bodyNode = bodyNode;\n this._driver = _driver;\n this._normalizer = _normalizer;\n this._animations = {};\n this._playersById = {};\n this.players = [];\n }\n register(id, metadata) {\n const errors = [];\n const ast = buildAnimationAst(this._driver, metadata, errors);\n if (errors.length) {\n throw new Error(`Unable to build the animation due to the following errors: ${errors.join('\\n')}`);\n }\n else {\n this._animations[id] = ast;\n }\n }\n _buildPlayer(i, preStyles, postStyles) {\n const element = i.element;\n const keyframes = normalizeKeyframes(this._driver, this._normalizer, element, i.keyframes, preStyles, postStyles);\n return this._driver.animate(element, keyframes, i.duration, i.delay, i.easing, [], true);\n }\n create(id, element, options = {}) {\n const errors = [];\n const ast = this._animations[id];\n let instructions;\n const autoStylesMap = new Map();\n if (ast) {\n instructions = buildAnimationTimelines(this._driver, element, ast, ENTER_CLASSNAME, LEAVE_CLASSNAME, {}, {}, options, EMPTY_INSTRUCTION_MAP, errors);\n instructions.forEach(inst => {\n const styles = getOrSetAsInMap(autoStylesMap, inst.element, {});\n inst.postStyleProps.forEach(prop => styles[prop] = null);\n });\n }\n else {\n errors.push('The requested animation doesn\\'t exist or has already been destroyed');\n instructions = [];\n }\n if (errors.length) {\n throw new Error(`Unable to create the animation due to the following errors: ${errors.join('\\n')}`);\n }\n autoStylesMap.forEach((styles, element) => {\n Object.keys(styles).forEach(prop => {\n styles[prop] = this._driver.computeStyle(element, prop, AUTO_STYLE);\n });\n });\n const players = instructions.map(i => {\n const styles = autoStylesMap.get(i.element);\n return this._buildPlayer(i, {}, styles);\n });\n const player = optimizeGroupPlayer(players);\n this._playersById[id] = player;\n player.onDestroy(() => this.destroy(id));\n this.players.push(player);\n return player;\n }\n destroy(id) {\n const player = this._getPlayer(id);\n player.destroy();\n delete this._playersById[id];\n const index = this.players.indexOf(player);\n if (index >= 0) {\n this.players.splice(index, 1);\n }\n }\n _getPlayer(id) {\n const player = this._playersById[id];\n if (!player) {\n throw new Error(`Unable to find the timeline player referenced by ${id}`);\n }\n return player;\n }\n listen(id, element, eventName, callback) {\n // triggerName, fromState, toState are all ignored for timeline animations\n const baseEvent = makeAnimationEvent(element, '', '', '');\n listenOnPlayer(this._getPlayer(id), eventName, baseEvent, callback);\n return () => { };\n }\n command(id, element, command, args) {\n if (command == 'register') {\n this.register(id, args[0]);\n return;\n }\n if (command == 'create') {\n const options = (args[0] || {});\n this.create(id, element, options);\n return;\n }\n const player = this._getPlayer(id);\n switch (command) {\n case 'play':\n player.play();\n break;\n case 'pause':\n player.pause();\n break;\n case 'reset':\n player.reset();\n break;\n case 'restart':\n player.restart();\n break;\n case 'finish':\n player.finish();\n break;\n case 'init':\n player.init();\n break;\n case 'setPosition':\n player.setPosition(parseFloat(args[0]));\n break;\n case 'destroy':\n this.destroy(id);\n break;\n }\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nconst QUEUED_CLASSNAME = 'ng-animate-queued';\nconst QUEUED_SELECTOR = '.ng-animate-queued';\nconst DISABLED_CLASSNAME = 'ng-animate-disabled';\nconst DISABLED_SELECTOR = '.ng-animate-disabled';\nconst STAR_CLASSNAME = 'ng-star-inserted';\nconst STAR_SELECTOR = '.ng-star-inserted';\nconst EMPTY_PLAYER_ARRAY = [];\nconst NULL_REMOVAL_STATE = {\n namespaceId: '',\n setForRemoval: false,\n setForMove: false,\n hasAnimation: false,\n removedBeforeQueried: false\n};\nconst NULL_REMOVED_QUERIED_STATE = {\n namespaceId: '',\n setForMove: false,\n setForRemoval: false,\n hasAnimation: false,\n removedBeforeQueried: true\n};\nconst REMOVAL_FLAG = '__ng_removed';\nclass StateValue {\n constructor(input, namespaceId = '') {\n this.namespaceId = namespaceId;\n const isObj = input && input.hasOwnProperty('value');\n const value = isObj ? input['value'] : input;\n this.value = normalizeTriggerValue(value);\n if (isObj) {\n const options = copyObj(input);\n delete options['value'];\n this.options = options;\n }\n else {\n this.options = {};\n }\n if (!this.options.params) {\n this.options.params = {};\n }\n }\n get params() {\n return this.options.params;\n }\n absorbOptions(options) {\n const newParams = options.params;\n if (newParams) {\n const oldParams = this.options.params;\n Object.keys(newParams).forEach(prop => {\n if (oldParams[prop] == null) {\n oldParams[prop] = newParams[prop];\n }\n });\n }\n }\n}\nconst VOID_VALUE = 'void';\nconst DEFAULT_STATE_VALUE = new StateValue(VOID_VALUE);\nclass AnimationTransitionNamespace {\n constructor(id, hostElement, _engine) {\n this.id = id;\n this.hostElement = hostElement;\n this._engine = _engine;\n this.players = [];\n this._triggers = {};\n this._queue = [];\n this._elementListeners = new Map();\n this._hostClassName = 'ng-tns-' + id;\n addClass(hostElement, this._hostClassName);\n }\n listen(element, name, phase, callback) {\n if (!this._triggers.hasOwnProperty(name)) {\n throw new Error(`Unable to listen on the animation trigger event \"${phase}\" because the animation trigger \"${name}\" doesn\\'t exist!`);\n }\n if (phase == null || phase.length == 0) {\n throw new Error(`Unable to listen on the animation trigger \"${name}\" because the provided event is undefined!`);\n }\n if (!isTriggerEventValid(phase)) {\n throw new Error(`The provided animation trigger event \"${phase}\" for the animation trigger \"${name}\" is not supported!`);\n }\n const listeners = getOrSetAsInMap(this._elementListeners, element, []);\n const data = { name, phase, callback };\n listeners.push(data);\n const triggersWithStates = getOrSetAsInMap(this._engine.statesByElement, element, {});\n if (!triggersWithStates.hasOwnProperty(name)) {\n addClass(element, NG_TRIGGER_CLASSNAME);\n addClass(element, NG_TRIGGER_CLASSNAME + '-' + name);\n triggersWithStates[name] = DEFAULT_STATE_VALUE;\n }\n return () => {\n // the event listener is removed AFTER the flush has occurred such\n // that leave animations callbacks can fire (otherwise if the node\n // is removed in between then the listeners would be deregistered)\n this._engine.afterFlush(() => {\n const index = listeners.indexOf(data);\n if (index >= 0) {\n listeners.splice(index, 1);\n }\n if (!this._triggers[name]) {\n delete triggersWithStates[name];\n }\n });\n };\n }\n register(name, ast) {\n if (this._triggers[name]) {\n // throw\n return false;\n }\n else {\n this._triggers[name] = ast;\n return true;\n }\n }\n _getTrigger(name) {\n const trigger = this._triggers[name];\n if (!trigger) {\n throw new Error(`The provided animation trigger \"${name}\" has not been registered!`);\n }\n return trigger;\n }\n trigger(element, triggerName, value, defaultToFallback = true) {\n const trigger = this._getTrigger(triggerName);\n const player = new TransitionAnimationPlayer(this.id, triggerName, element);\n let triggersWithStates = this._engine.statesByElement.get(element);\n if (!triggersWithStates) {\n addClass(element, NG_TRIGGER_CLASSNAME);\n addClass(element, NG_TRIGGER_CLASSNAME + '-' + triggerName);\n this._engine.statesByElement.set(element, triggersWithStates = {});\n }\n let fromState = triggersWithStates[triggerName];\n const toState = new StateValue(value, this.id);\n const isObj = value && value.hasOwnProperty('value');\n if (!isObj && fromState) {\n toState.absorbOptions(fromState.options);\n }\n triggersWithStates[triggerName] = toState;\n if (!fromState) {\n fromState = DEFAULT_STATE_VALUE;\n }\n const isRemoval = toState.value === VOID_VALUE;\n // normally this isn't reached by here, however, if an object expression\n // is passed in then it may be a new object each time. Comparing the value\n // is important since that will stay the same despite there being a new object.\n // The removal arc here is special cased because the same element is triggered\n // twice in the event that it contains animations on the outer/inner portions\n // of the host container\n if (!isRemoval && fromState.value === toState.value) {\n // this means that despite the value not changing, some inner params\n // have changed which means that the animation final styles need to be applied\n if (!objEquals(fromState.params, toState.params)) {\n const errors = [];\n const fromStyles = trigger.matchStyles(fromState.value, fromState.params, errors);\n const toStyles = trigger.matchStyles(toState.value, toState.params, errors);\n if (errors.length) {\n this._engine.reportError(errors);\n }\n else {\n this._engine.afterFlush(() => {\n eraseStyles(element, fromStyles);\n setStyles(element, toStyles);\n });\n }\n }\n return;\n }\n const playersOnElement = getOrSetAsInMap(this._engine.playersByElement, element, []);\n playersOnElement.forEach(player => {\n // only remove the player if it is queued on the EXACT same trigger/namespace\n // we only also deal with queued players here because if the animation has\n // started then we want to keep the player alive until the flush happens\n // (which is where the previousPlayers are passed into the new palyer)\n if (player.namespaceId == this.id && player.triggerName == triggerName && player.queued) {\n player.destroy();\n }\n });\n let transition = trigger.matchTransition(fromState.value, toState.value, element, toState.params);\n let isFallbackTransition = false;\n if (!transition) {\n if (!defaultToFallback)\n return;\n transition = trigger.fallbackTransition;\n isFallbackTransition = true;\n }\n this._engine.totalQueuedPlayers++;\n this._queue.push({ element, triggerName, transition, fromState, toState, player, isFallbackTransition });\n if (!isFallbackTransition) {\n addClass(element, QUEUED_CLASSNAME);\n player.onStart(() => {\n removeClass(element, QUEUED_CLASSNAME);\n });\n }\n player.onDone(() => {\n let index = this.players.indexOf(player);\n if (index >= 0) {\n this.players.splice(index, 1);\n }\n const players = this._engine.playersByElement.get(element);\n if (players) {\n let index = players.indexOf(player);\n if (index >= 0) {\n players.splice(index, 1);\n }\n }\n });\n this.players.push(player);\n playersOnElement.push(player);\n return player;\n }\n deregister(name) {\n delete this._triggers[name];\n this._engine.statesByElement.forEach((stateMap, element) => {\n delete stateMap[name];\n });\n this._elementListeners.forEach((listeners, element) => {\n this._elementListeners.set(element, listeners.filter(entry => {\n return entry.name != name;\n }));\n });\n }\n clearElementCache(element) {\n this._engine.statesByElement.delete(element);\n this._elementListeners.delete(element);\n const elementPlayers = this._engine.playersByElement.get(element);\n if (elementPlayers) {\n elementPlayers.forEach(player => player.destroy());\n this._engine.playersByElement.delete(element);\n }\n }\n _signalRemovalForInnerTriggers(rootElement, context) {\n const elements = this._engine.driver.query(rootElement, NG_TRIGGER_SELECTOR, true);\n // emulate a leave animation for all inner nodes within this node.\n // If there are no animations found for any of the nodes then clear the cache\n // for the element.\n elements.forEach(elm => {\n // this means that an inner remove() operation has already kicked off\n // the animation on this element...\n if (elm[REMOVAL_FLAG])\n return;\n const namespaces = this._engine.fetchNamespacesByElement(elm);\n if (namespaces.size) {\n namespaces.forEach(ns => ns.triggerLeaveAnimation(elm, context, false, true));\n }\n else {\n this.clearElementCache(elm);\n }\n });\n // If the child elements were removed along with the parent, their animations might not\n // have completed. Clear all the elements from the cache so we don't end up with a memory leak.\n this._engine.afterFlushAnimationsDone(() => elements.forEach(elm => this.clearElementCache(elm)));\n }\n triggerLeaveAnimation(element, context, destroyAfterComplete, defaultToFallback) {\n const triggerStates = this._engine.statesByElement.get(element);\n if (triggerStates) {\n const players = [];\n Object.keys(triggerStates).forEach(triggerName => {\n // this check is here in the event that an element is removed\n // twice (both on the host level and the component level)\n if (this._triggers[triggerName]) {\n const player = this.trigger(element, triggerName, VOID_VALUE, defaultToFallback);\n if (player) {\n players.push(player);\n }\n }\n });\n if (players.length) {\n this._engine.markElementAsRemoved(this.id, element, true, context);\n if (destroyAfterComplete) {\n optimizeGroupPlayer(players).onDone(() => this._engine.processLeaveNode(element));\n }\n return true;\n }\n }\n return false;\n }\n prepareLeaveAnimationListeners(element) {\n const listeners = this._elementListeners.get(element);\n if (listeners) {\n const visitedTriggers = new Set();\n listeners.forEach(listener => {\n const triggerName = listener.name;\n if (visitedTriggers.has(triggerName))\n return;\n visitedTriggers.add(triggerName);\n const trigger = this._triggers[triggerName];\n const transition = trigger.fallbackTransition;\n const elementStates = this._engine.statesByElement.get(element);\n const fromState = elementStates[triggerName] || DEFAULT_STATE_VALUE;\n const toState = new StateValue(VOID_VALUE);\n const player = new TransitionAnimationPlayer(this.id, triggerName, element);\n this._engine.totalQueuedPlayers++;\n this._queue.push({\n element,\n triggerName,\n transition,\n fromState,\n toState,\n player,\n isFallbackTransition: true\n });\n });\n }\n }\n removeNode(element, context) {\n const engine = this._engine;\n if (element.childElementCount) {\n this._signalRemovalForInnerTriggers(element, context);\n }\n // this means that a * => VOID animation was detected and kicked off\n if (this.triggerLeaveAnimation(element, context, true))\n return;\n // find the player that is animating and make sure that the\n // removal is delayed until that player has completed\n let containsPotentialParentTransition = false;\n if (engine.totalAnimations) {\n const currentPlayers = engine.players.length ? engine.playersByQueriedElement.get(element) : [];\n // when this `if statement` does not continue forward it means that\n // a previous animation query has selected the current element and\n // is animating it. In this situation want to continue forwards and\n // allow the element to be queued up for animation later.\n if (currentPlayers && currentPlayers.length) {\n containsPotentialParentTransition = true;\n }\n else {\n let parent = element;\n while (parent = parent.parentNode) {\n const triggers = engine.statesByElement.get(parent);\n if (triggers) {\n containsPotentialParentTransition = true;\n break;\n }\n }\n }\n }\n // at this stage we know that the element will either get removed\n // during flush or will be picked up by a parent query. Either way\n // we need to fire the listeners for this element when it DOES get\n // removed (once the query parent animation is done or after flush)\n this.prepareLeaveAnimationListeners(element);\n // whether or not a parent has an animation we need to delay the deferral of the leave\n // operation until we have more information (which we do after flush() has been called)\n if (containsPotentialParentTransition) {\n engine.markElementAsRemoved(this.id, element, false, context);\n }\n else {\n const removalFlag = element[REMOVAL_FLAG];\n if (!removalFlag || removalFlag === NULL_REMOVAL_STATE) {\n // we do this after the flush has occurred such\n // that the callbacks can be fired\n engine.afterFlush(() => this.clearElementCache(element));\n engine.destroyInnerAnimations(element);\n engine._onRemovalComplete(element, context);\n }\n }\n }\n insertNode(element, parent) {\n addClass(element, this._hostClassName);\n }\n drainQueuedTransitions(microtaskId) {\n const instructions = [];\n this._queue.forEach(entry => {\n const player = entry.player;\n if (player.destroyed)\n return;\n const element = entry.element;\n const listeners = this._elementListeners.get(element);\n if (listeners) {\n listeners.forEach((listener) => {\n if (listener.name == entry.triggerName) {\n const baseEvent = makeAnimationEvent(element, entry.triggerName, entry.fromState.value, entry.toState.value);\n baseEvent['_data'] = microtaskId;\n listenOnPlayer(entry.player, listener.phase, baseEvent, listener.callback);\n }\n });\n }\n if (player.markedForDestroy) {\n this._engine.afterFlush(() => {\n // now we can destroy the element properly since the event listeners have\n // been bound to the player\n player.destroy();\n });\n }\n else {\n instructions.push(entry);\n }\n });\n this._queue = [];\n return instructions.sort((a, b) => {\n // if depCount == 0 them move to front\n // otherwise if a contains b then move back\n const d0 = a.transition.ast.depCount;\n const d1 = b.transition.ast.depCount;\n if (d0 == 0 || d1 == 0) {\n return d0 - d1;\n }\n return this._engine.driver.containsElement(a.element, b.element) ? 1 : -1;\n });\n }\n destroy(context) {\n this.players.forEach(p => p.destroy());\n this._signalRemovalForInnerTriggers(this.hostElement, context);\n }\n elementContainsData(element) {\n let containsData = false;\n if (this._elementListeners.has(element))\n containsData = true;\n containsData =\n (this._queue.find(entry => entry.element === element) ? true : false) || containsData;\n return containsData;\n }\n}\nclass TransitionAnimationEngine {\n constructor(bodyNode, driver, _normalizer) {\n this.bodyNode = bodyNode;\n this.driver = driver;\n this._normalizer = _normalizer;\n this.players = [];\n this.newHostElements = new Map();\n this.playersByElement = new Map();\n this.playersByQueriedElement = new Map();\n this.statesByElement = new Map();\n this.disabledNodes = new Set();\n this.totalAnimations = 0;\n this.totalQueuedPlayers = 0;\n this._namespaceLookup = {};\n this._namespaceList = [];\n this._flushFns = [];\n this._whenQuietFns = [];\n this.namespacesByHostElement = new Map();\n this.collectedEnterElements = [];\n this.collectedLeaveElements = [];\n // this method is designed to be overridden by the code that uses this engine\n this.onRemovalComplete = (element, context) => { };\n }\n /** @internal */\n _onRemovalComplete(element, context) {\n this.onRemovalComplete(element, context);\n }\n get queuedPlayers() {\n const players = [];\n this._namespaceList.forEach(ns => {\n ns.players.forEach(player => {\n if (player.queued) {\n players.push(player);\n }\n });\n });\n return players;\n }\n createNamespace(namespaceId, hostElement) {\n const ns = new AnimationTransitionNamespace(namespaceId, hostElement, this);\n if (hostElement.parentNode) {\n this._balanceNamespaceList(ns, hostElement);\n }\n else {\n // defer this later until flush during when the host element has\n // been inserted so that we know exactly where to place it in\n // the namespace list\n this.newHostElements.set(hostElement, ns);\n // given that this host element is apart of the animation code, it\n // may or may not be inserted by a parent node that is an of an\n // animation renderer type. If this happens then we can still have\n // access to this item when we query for :enter nodes. If the parent\n // is a renderer then the set data-structure will normalize the entry\n this.collectEnterElement(hostElement);\n }\n return this._namespaceLookup[namespaceId] = ns;\n }\n _balanceNamespaceList(ns, hostElement) {\n const limit = this._namespaceList.length - 1;\n if (limit >= 0) {\n let found = false;\n for (let i = limit; i >= 0; i--) {\n const nextNamespace = this._namespaceList[i];\n if (this.driver.containsElement(nextNamespace.hostElement, hostElement)) {\n this._namespaceList.splice(i + 1, 0, ns);\n found = true;\n break;\n }\n }\n if (!found) {\n this._namespaceList.splice(0, 0, ns);\n }\n }\n else {\n this._namespaceList.push(ns);\n }\n this.namespacesByHostElement.set(hostElement, ns);\n return ns;\n }\n register(namespaceId, hostElement) {\n let ns = this._namespaceLookup[namespaceId];\n if (!ns) {\n ns = this.createNamespace(namespaceId, hostElement);\n }\n return ns;\n }\n registerTrigger(namespaceId, name, trigger) {\n let ns = this._namespaceLookup[namespaceId];\n if (ns && ns.register(name, trigger)) {\n this.totalAnimations++;\n }\n }\n destroy(namespaceId, context) {\n if (!namespaceId)\n return;\n const ns = this._fetchNamespace(namespaceId);\n this.afterFlush(() => {\n this.namespacesByHostElement.delete(ns.hostElement);\n delete this._namespaceLookup[namespaceId];\n const index = this._namespaceList.indexOf(ns);\n if (index >= 0) {\n this._namespaceList.splice(index, 1);\n }\n });\n this.afterFlushAnimationsDone(() => ns.destroy(context));\n }\n _fetchNamespace(id) {\n return this._namespaceLookup[id];\n }\n fetchNamespacesByElement(element) {\n // normally there should only be one namespace per element, however\n // if @triggers are placed on both the component element and then\n // its host element (within the component code) then there will be\n // two namespaces returned. We use a set here to simply the dedupe\n // of namespaces incase there are multiple triggers both the elm and host\n const namespaces = new Set();\n const elementStates = this.statesByElement.get(element);\n if (elementStates) {\n const keys = Object.keys(elementStates);\n for (let i = 0; i < keys.length; i++) {\n const nsId = elementStates[keys[i]].namespaceId;\n if (nsId) {\n const ns = this._fetchNamespace(nsId);\n if (ns) {\n namespaces.add(ns);\n }\n }\n }\n }\n return namespaces;\n }\n trigger(namespaceId, element, name, value) {\n if (isElementNode(element)) {\n const ns = this._fetchNamespace(namespaceId);\n if (ns) {\n ns.trigger(element, name, value);\n return true;\n }\n }\n return false;\n }\n insertNode(namespaceId, element, parent, insertBefore) {\n if (!isElementNode(element))\n return;\n // special case for when an element is removed and reinserted (move operation)\n // when this occurs we do not want to use the element for deletion later\n const details = element[REMOVAL_FLAG];\n if (details && details.setForRemoval) {\n details.setForRemoval = false;\n details.setForMove = true;\n const index = this.collectedLeaveElements.indexOf(element);\n if (index >= 0) {\n this.collectedLeaveElements.splice(index, 1);\n }\n }\n // in the event that the namespaceId is blank then the caller\n // code does not contain any animation code in it, but it is\n // just being called so that the node is marked as being inserted\n if (namespaceId) {\n const ns = this._fetchNamespace(namespaceId);\n // This if-statement is a workaround for router issue #21947.\n // The router sometimes hits a race condition where while a route\n // is being instantiated a new navigation arrives, triggering leave\n // animation of DOM that has not been fully initialized, until this\n // is resolved, we need to handle the scenario when DOM is not in a\n // consistent state during the animation.\n if (ns) {\n ns.insertNode(element, parent);\n }\n }\n // only *directives and host elements are inserted before\n if (insertBefore) {\n this.collectEnterElement(element);\n }\n }\n collectEnterElement(element) {\n this.collectedEnterElements.push(element);\n }\n markElementAsDisabled(element, value) {\n if (value) {\n if (!this.disabledNodes.has(element)) {\n this.disabledNodes.add(element);\n addClass(element, DISABLED_CLASSNAME);\n }\n }\n else if (this.disabledNodes.has(element)) {\n this.disabledNodes.delete(element);\n removeClass(element, DISABLED_CLASSNAME);\n }\n }\n removeNode(namespaceId, element, isHostElement, context) {\n if (isElementNode(element)) {\n const ns = namespaceId ? this._fetchNamespace(namespaceId) : null;\n if (ns) {\n ns.removeNode(element, context);\n }\n else {\n this.markElementAsRemoved(namespaceId, element, false, context);\n }\n if (isHostElement) {\n const hostNS = this.namespacesByHostElement.get(element);\n if (hostNS && hostNS.id !== namespaceId) {\n hostNS.removeNode(element, context);\n }\n }\n }\n else {\n this._onRemovalComplete(element, context);\n }\n }\n markElementAsRemoved(namespaceId, element, hasAnimation, context) {\n this.collectedLeaveElements.push(element);\n element[REMOVAL_FLAG] =\n { namespaceId, setForRemoval: context, hasAnimation, removedBeforeQueried: false };\n }\n listen(namespaceId, element, name, phase, callback) {\n if (isElementNode(element)) {\n return this._fetchNamespace(namespaceId).listen(element, name, phase, callback);\n }\n return () => { };\n }\n _buildInstruction(entry, subTimelines, enterClassName, leaveClassName, skipBuildAst) {\n return entry.transition.build(this.driver, entry.element, entry.fromState.value, entry.toState.value, enterClassName, leaveClassName, entry.fromState.options, entry.toState.options, subTimelines, skipBuildAst);\n }\n destroyInnerAnimations(containerElement) {\n let elements = this.driver.query(containerElement, NG_TRIGGER_SELECTOR, true);\n elements.forEach(element => this.destroyActiveAnimationsForElement(element));\n if (this.playersByQueriedElement.size == 0)\n return;\n elements = this.driver.query(containerElement, NG_ANIMATING_SELECTOR, true);\n elements.forEach(element => this.finishActiveQueriedAnimationOnElement(element));\n }\n destroyActiveAnimationsForElement(element) {\n const players = this.playersByElement.get(element);\n if (players) {\n players.forEach(player => {\n // special case for when an element is set for destruction, but hasn't started.\n // in this situation we want to delay the destruction until the flush occurs\n // so that any event listeners attached to the player are triggered.\n if (player.queued) {\n player.markedForDestroy = true;\n }\n else {\n player.destroy();\n }\n });\n }\n }\n finishActiveQueriedAnimationOnElement(element) {\n const players = this.playersByQueriedElement.get(element);\n if (players) {\n players.forEach(player => player.finish());\n }\n }\n whenRenderingDone() {\n return new Promise(resolve => {\n if (this.players.length) {\n return optimizeGroupPlayer(this.players).onDone(() => resolve());\n }\n else {\n resolve();\n }\n });\n }\n processLeaveNode(element) {\n const details = element[REMOVAL_FLAG];\n if (details && details.setForRemoval) {\n // this will prevent it from removing it twice\n element[REMOVAL_FLAG] = NULL_REMOVAL_STATE;\n if (details.namespaceId) {\n this.destroyInnerAnimations(element);\n const ns = this._fetchNamespace(details.namespaceId);\n if (ns) {\n ns.clearElementCache(element);\n }\n }\n this._onRemovalComplete(element, details.setForRemoval);\n }\n if (this.driver.matchesElement(element, DISABLED_SELECTOR)) {\n this.markElementAsDisabled(element, false);\n }\n this.driver.query(element, DISABLED_SELECTOR, true).forEach(node => {\n this.markElementAsDisabled(node, false);\n });\n }\n flush(microtaskId = -1) {\n let players = [];\n if (this.newHostElements.size) {\n this.newHostElements.forEach((ns, element) => this._balanceNamespaceList(ns, element));\n this.newHostElements.clear();\n }\n if (this.totalAnimations && this.collectedEnterElements.length) {\n for (let i = 0; i < this.collectedEnterElements.length; i++) {\n const elm = this.collectedEnterElements[i];\n addClass(elm, STAR_CLASSNAME);\n }\n }\n if (this._namespaceList.length &&\n (this.totalQueuedPlayers || this.collectedLeaveElements.length)) {\n const cleanupFns = [];\n try {\n players = this._flushAnimations(cleanupFns, microtaskId);\n }\n finally {\n for (let i = 0; i < cleanupFns.length; i++) {\n cleanupFns[i]();\n }\n }\n }\n else {\n for (let i = 0; i < this.collectedLeaveElements.length; i++) {\n const element = this.collectedLeaveElements[i];\n this.processLeaveNode(element);\n }\n }\n this.totalQueuedPlayers = 0;\n this.collectedEnterElements.length = 0;\n this.collectedLeaveElements.length = 0;\n this._flushFns.forEach(fn => fn());\n this._flushFns = [];\n if (this._whenQuietFns.length) {\n // we move these over to a variable so that\n // if any new callbacks are registered in another\n // flush they do not populate the existing set\n const quietFns = this._whenQuietFns;\n this._whenQuietFns = [];\n if (players.length) {\n optimizeGroupPlayer(players).onDone(() => {\n quietFns.forEach(fn => fn());\n });\n }\n else {\n quietFns.forEach(fn => fn());\n }\n }\n }\n reportError(errors) {\n throw new Error(`Unable to process animations due to the following failed trigger transitions\\n ${errors.join('\\n')}`);\n }\n _flushAnimations(cleanupFns, microtaskId) {\n const subTimelines = new ElementInstructionMap();\n const skippedPlayers = [];\n const skippedPlayersMap = new Map();\n const queuedInstructions = [];\n const queriedElements = new Map();\n const allPreStyleElements = new Map();\n const allPostStyleElements = new Map();\n const disabledElementsSet = new Set();\n this.disabledNodes.forEach(node => {\n disabledElementsSet.add(node);\n const nodesThatAreDisabled = this.driver.query(node, QUEUED_SELECTOR, true);\n for (let i = 0; i < nodesThatAreDisabled.length; i++) {\n disabledElementsSet.add(nodesThatAreDisabled[i]);\n }\n });\n const bodyNode = this.bodyNode;\n const allTriggerElements = Array.from(this.statesByElement.keys());\n const enterNodeMap = buildRootMap(allTriggerElements, this.collectedEnterElements);\n // this must occur before the instructions are built below such that\n // the :enter queries match the elements (since the timeline queries\n // are fired during instruction building).\n const enterNodeMapIds = new Map();\n let i = 0;\n enterNodeMap.forEach((nodes, root) => {\n const className = ENTER_CLASSNAME + i++;\n enterNodeMapIds.set(root, className);\n nodes.forEach(node => addClass(node, className));\n });\n const allLeaveNodes = [];\n const mergedLeaveNodes = new Set();\n const leaveNodesWithoutAnimations = new Set();\n for (let i = 0; i < this.collectedLeaveElements.length; i++) {\n const element = this.collectedLeaveElements[i];\n const details = element[REMOVAL_FLAG];\n if (details && details.setForRemoval) {\n allLeaveNodes.push(element);\n mergedLeaveNodes.add(element);\n if (details.hasAnimation) {\n this.driver.query(element, STAR_SELECTOR, true).forEach(elm => mergedLeaveNodes.add(elm));\n }\n else {\n leaveNodesWithoutAnimations.add(element);\n }\n }\n }\n const leaveNodeMapIds = new Map();\n const leaveNodeMap = buildRootMap(allTriggerElements, Array.from(mergedLeaveNodes));\n leaveNodeMap.forEach((nodes, root) => {\n const className = LEAVE_CLASSNAME + i++;\n leaveNodeMapIds.set(root, className);\n nodes.forEach(node => addClass(node, className));\n });\n cleanupFns.push(() => {\n enterNodeMap.forEach((nodes, root) => {\n const className = enterNodeMapIds.get(root);\n nodes.forEach(node => removeClass(node, className));\n });\n leaveNodeMap.forEach((nodes, root) => {\n const className = leaveNodeMapIds.get(root);\n nodes.forEach(node => removeClass(node, className));\n });\n allLeaveNodes.forEach(element => {\n this.processLeaveNode(element);\n });\n });\n const allPlayers = [];\n const erroneousTransitions = [];\n for (let i = this._namespaceList.length - 1; i >= 0; i--) {\n const ns = this._namespaceList[i];\n ns.drainQueuedTransitions(microtaskId).forEach(entry => {\n const player = entry.player;\n const element = entry.element;\n allPlayers.push(player);\n if (this.collectedEnterElements.length) {\n const details = element[REMOVAL_FLAG];\n // move animations are currently not supported...\n if (details && details.setForMove) {\n player.destroy();\n return;\n }\n }\n const nodeIsOrphaned = !bodyNode || !this.driver.containsElement(bodyNode, element);\n const leaveClassName = leaveNodeMapIds.get(element);\n const enterClassName = enterNodeMapIds.get(element);\n const instruction = this._buildInstruction(entry, subTimelines, enterClassName, leaveClassName, nodeIsOrphaned);\n if (instruction.errors && instruction.errors.length) {\n erroneousTransitions.push(instruction);\n return;\n }\n // even though the element may not be apart of the DOM, it may\n // still be added at a later point (due to the mechanics of content\n // projection and/or dynamic component insertion) therefore it's\n // important we still style the element.\n if (nodeIsOrphaned) {\n player.onStart(() => eraseStyles(element, instruction.fromStyles));\n player.onDestroy(() => setStyles(element, instruction.toStyles));\n skippedPlayers.push(player);\n return;\n }\n // if a unmatched transition is queued to go then it SHOULD NOT render\n // an animation and cancel the previously running animations.\n if (entry.isFallbackTransition) {\n player.onStart(() => eraseStyles(element, instruction.fromStyles));\n player.onDestroy(() => setStyles(element, instruction.toStyles));\n skippedPlayers.push(player);\n return;\n }\n // this means that if a parent animation uses this animation as a sub trigger\n // then it will instruct the timeline builder to not add a player delay, but\n // instead stretch the first keyframe gap up until the animation starts. The\n // reason this is important is to prevent extra initialization styles from being\n // required by the user in the animation.\n instruction.timelines.forEach(tl => tl.stretchStartingKeyframe = true);\n subTimelines.append(element, instruction.timelines);\n const tuple = { instruction, player, element };\n queuedInstructions.push(tuple);\n instruction.queriedElements.forEach(element => getOrSetAsInMap(queriedElements, element, []).push(player));\n instruction.preStyleProps.forEach((stringMap, element) => {\n const props = Object.keys(stringMap);\n if (props.length) {\n let setVal = allPreStyleElements.get(element);\n if (!setVal) {\n allPreStyleElements.set(element, setVal = new Set());\n }\n props.forEach(prop => setVal.add(prop));\n }\n });\n instruction.postStyleProps.forEach((stringMap, element) => {\n const props = Object.keys(stringMap);\n let setVal = allPostStyleElements.get(element);\n if (!setVal) {\n allPostStyleElements.set(element, setVal = new Set());\n }\n props.forEach(prop => setVal.add(prop));\n });\n });\n }\n if (erroneousTransitions.length) {\n const errors = [];\n erroneousTransitions.forEach(instruction => {\n errors.push(`@${instruction.triggerName} has failed due to:\\n`);\n instruction.errors.forEach(error => errors.push(`- ${error}\\n`));\n });\n allPlayers.forEach(player => player.destroy());\n this.reportError(errors);\n }\n const allPreviousPlayersMap = new Map();\n // this map works to tell which element in the DOM tree is contained by\n // which animation. Further down below this map will get populated once\n // the players are built and in doing so it can efficiently figure out\n // if a sub player is skipped due to a parent player having priority.\n const animationElementMap = new Map();\n queuedInstructions.forEach(entry => {\n const element = entry.element;\n if (subTimelines.has(element)) {\n animationElementMap.set(element, element);\n this._beforeAnimationBuild(entry.player.namespaceId, entry.instruction, allPreviousPlayersMap);\n }\n });\n skippedPlayers.forEach(player => {\n const element = player.element;\n const previousPlayers = this._getPreviousPlayers(element, false, player.namespaceId, player.triggerName, null);\n previousPlayers.forEach(prevPlayer => {\n getOrSetAsInMap(allPreviousPlayersMap, element, []).push(prevPlayer);\n prevPlayer.destroy();\n });\n });\n // this is a special case for nodes that will be removed (either by)\n // having their own leave animations or by being queried in a container\n // that will be removed once a parent animation is complete. The idea\n // here is that * styles must be identical to ! styles because of\n // backwards compatibility (* is also filled in by default in many places).\n // Otherwise * styles will return an empty value or auto since the element\n // that is being getComputedStyle'd will not be visible (since * = destination)\n const replaceNodes = allLeaveNodes.filter(node => {\n return replacePostStylesAsPre(node, allPreStyleElements, allPostStyleElements);\n });\n // POST STAGE: fill the * styles\n const postStylesMap = new Map();\n const allLeaveQueriedNodes = cloakAndComputeStyles(postStylesMap, this.driver, leaveNodesWithoutAnimations, allPostStyleElements, AUTO_STYLE);\n allLeaveQueriedNodes.forEach(node => {\n if (replacePostStylesAsPre(node, allPreStyleElements, allPostStyleElements)) {\n replaceNodes.push(node);\n }\n });\n // PRE STAGE: fill the ! styles\n const preStylesMap = new Map();\n enterNodeMap.forEach((nodes, root) => {\n cloakAndComputeStyles(preStylesMap, this.driver, new Set(nodes), allPreStyleElements, ɵPRE_STYLE);\n });\n replaceNodes.forEach(node => {\n const post = postStylesMap.get(node);\n const pre = preStylesMap.get(node);\n postStylesMap.set(node, Object.assign(Object.assign({}, post), pre));\n });\n const rootPlayers = [];\n const subPlayers = [];\n const NO_PARENT_ANIMATION_ELEMENT_DETECTED = {};\n queuedInstructions.forEach(entry => {\n const { element, player, instruction } = entry;\n // this means that it was never consumed by a parent animation which\n // means that it is independent and therefore should be set for animation\n if (subTimelines.has(element)) {\n if (disabledElementsSet.has(element)) {\n player.onDestroy(() => setStyles(element, instruction.toStyles));\n player.disabled = true;\n player.overrideTotalTime(instruction.totalTime);\n skippedPlayers.push(player);\n return;\n }\n // this will flow up the DOM and query the map to figure out\n // if a parent animation has priority over it. In the situation\n // that a parent is detected then it will cancel the loop. If\n // nothing is detected, or it takes a few hops to find a parent,\n // then it will fill in the missing nodes and signal them as having\n // a detected parent (or a NO_PARENT value via a special constant).\n let parentWithAnimation = NO_PARENT_ANIMATION_ELEMENT_DETECTED;\n if (animationElementMap.size > 1) {\n let elm = element;\n const parentsToAdd = [];\n while (elm = elm.parentNode) {\n const detectedParent = animationElementMap.get(elm);\n if (detectedParent) {\n parentWithAnimation = detectedParent;\n break;\n }\n parentsToAdd.push(elm);\n }\n parentsToAdd.forEach(parent => animationElementMap.set(parent, parentWithAnimation));\n }\n const innerPlayer = this._buildAnimation(player.namespaceId, instruction, allPreviousPlayersMap, skippedPlayersMap, preStylesMap, postStylesMap);\n player.setRealPlayer(innerPlayer);\n if (parentWithAnimation === NO_PARENT_ANIMATION_ELEMENT_DETECTED) {\n rootPlayers.push(player);\n }\n else {\n const parentPlayers = this.playersByElement.get(parentWithAnimation);\n if (parentPlayers && parentPlayers.length) {\n player.parentPlayer = optimizeGroupPlayer(parentPlayers);\n }\n skippedPlayers.push(player);\n }\n }\n else {\n eraseStyles(element, instruction.fromStyles);\n player.onDestroy(() => setStyles(element, instruction.toStyles));\n // there still might be a ancestor player animating this\n // element therefore we will still add it as a sub player\n // even if its animation may be disabled\n subPlayers.push(player);\n if (disabledElementsSet.has(element)) {\n skippedPlayers.push(player);\n }\n }\n });\n // find all of the sub players' corresponding inner animation player\n subPlayers.forEach(player => {\n // even if any players are not found for a sub animation then it\n // will still complete itself after the next tick since it's Noop\n const playersForElement = skippedPlayersMap.get(player.element);\n if (playersForElement && playersForElement.length) {\n const innerPlayer = optimizeGroupPlayer(playersForElement);\n player.setRealPlayer(innerPlayer);\n }\n });\n // the reason why we don't actually play the animation is\n // because all that a skipped player is designed to do is to\n // fire the start/done transition callback events\n skippedPlayers.forEach(player => {\n if (player.parentPlayer) {\n player.syncPlayerEvents(player.parentPlayer);\n }\n else {\n player.destroy();\n }\n });\n // run through all of the queued removals and see if they\n // were picked up by a query. If not then perform the removal\n // operation right away unless a parent animation is ongoing.\n for (let i = 0; i < allLeaveNodes.length; i++) {\n const element = allLeaveNodes[i];\n const details = element[REMOVAL_FLAG];\n removeClass(element, LEAVE_CLASSNAME);\n // this means the element has a removal animation that is being\n // taken care of and therefore the inner elements will hang around\n // until that animation is over (or the parent queried animation)\n if (details && details.hasAnimation)\n continue;\n let players = [];\n // if this element is queried or if it contains queried children\n // then we want for the element not to be removed from the page\n // until the queried animations have finished\n if (queriedElements.size) {\n let queriedPlayerResults = queriedElements.get(element);\n if (queriedPlayerResults && queriedPlayerResults.length) {\n players.push(...queriedPlayerResults);\n }\n let queriedInnerElements = this.driver.query(element, NG_ANIMATING_SELECTOR, true);\n for (let j = 0; j < queriedInnerElements.length; j++) {\n let queriedPlayers = queriedElements.get(queriedInnerElements[j]);\n if (queriedPlayers && queriedPlayers.length) {\n players.push(...queriedPlayers);\n }\n }\n }\n const activePlayers = players.filter(p => !p.destroyed);\n if (activePlayers.length) {\n removeNodesAfterAnimationDone(this, element, activePlayers);\n }\n else {\n this.processLeaveNode(element);\n }\n }\n // this is required so the cleanup method doesn't remove them\n allLeaveNodes.length = 0;\n rootPlayers.forEach(player => {\n this.players.push(player);\n player.onDone(() => {\n player.destroy();\n const index = this.players.indexOf(player);\n this.players.splice(index, 1);\n });\n player.play();\n });\n return rootPlayers;\n }\n elementContainsData(namespaceId, element) {\n let containsData = false;\n const details = element[REMOVAL_FLAG];\n if (details && details.setForRemoval)\n containsData = true;\n if (this.playersByElement.has(element))\n containsData = true;\n if (this.playersByQueriedElement.has(element))\n containsData = true;\n if (this.statesByElement.has(element))\n containsData = true;\n return this._fetchNamespace(namespaceId).elementContainsData(element) || containsData;\n }\n afterFlush(callback) {\n this._flushFns.push(callback);\n }\n afterFlushAnimationsDone(callback) {\n this._whenQuietFns.push(callback);\n }\n _getPreviousPlayers(element, isQueriedElement, namespaceId, triggerName, toStateValue) {\n let players = [];\n if (isQueriedElement) {\n const queriedElementPlayers = this.playersByQueriedElement.get(element);\n if (queriedElementPlayers) {\n players = queriedElementPlayers;\n }\n }\n else {\n const elementPlayers = this.playersByElement.get(element);\n if (elementPlayers) {\n const isRemovalAnimation = !toStateValue || toStateValue == VOID_VALUE;\n elementPlayers.forEach(player => {\n if (player.queued)\n return;\n if (!isRemovalAnimation && player.triggerName != triggerName)\n return;\n players.push(player);\n });\n }\n }\n if (namespaceId || triggerName) {\n players = players.filter(player => {\n if (namespaceId && namespaceId != player.namespaceId)\n return false;\n if (triggerName && triggerName != player.triggerName)\n return false;\n return true;\n });\n }\n return players;\n }\n _beforeAnimationBuild(namespaceId, instruction, allPreviousPlayersMap) {\n const triggerName = instruction.triggerName;\n const rootElement = instruction.element;\n // when a removal animation occurs, ALL previous players are collected\n // and destroyed (even if they are outside of the current namespace)\n const targetNameSpaceId = instruction.isRemovalTransition ? undefined : namespaceId;\n const targetTriggerName = instruction.isRemovalTransition ? undefined : triggerName;\n for (const timelineInstruction of instruction.timelines) {\n const element = timelineInstruction.element;\n const isQueriedElement = element !== rootElement;\n const players = getOrSetAsInMap(allPreviousPlayersMap, element, []);\n const previousPlayers = this._getPreviousPlayers(element, isQueriedElement, targetNameSpaceId, targetTriggerName, instruction.toState);\n previousPlayers.forEach(player => {\n const realPlayer = player.getRealPlayer();\n if (realPlayer.beforeDestroy) {\n realPlayer.beforeDestroy();\n }\n player.destroy();\n players.push(player);\n });\n }\n // this needs to be done so that the PRE/POST styles can be\n // computed properly without interfering with the previous animation\n eraseStyles(rootElement, instruction.fromStyles);\n }\n _buildAnimation(namespaceId, instruction, allPreviousPlayersMap, skippedPlayersMap, preStylesMap, postStylesMap) {\n const triggerName = instruction.triggerName;\n const rootElement = instruction.element;\n // we first run this so that the previous animation player\n // data can be passed into the successive animation players\n const allQueriedPlayers = [];\n const allConsumedElements = new Set();\n const allSubElements = new Set();\n const allNewPlayers = instruction.timelines.map(timelineInstruction => {\n const element = timelineInstruction.element;\n allConsumedElements.add(element);\n // FIXME (matsko): make sure to-be-removed animations are removed properly\n const details = element[REMOVAL_FLAG];\n if (details && details.removedBeforeQueried)\n return new NoopAnimationPlayer(timelineInstruction.duration, timelineInstruction.delay);\n const isQueriedElement = element !== rootElement;\n const previousPlayers = flattenGroupPlayers((allPreviousPlayersMap.get(element) || EMPTY_PLAYER_ARRAY)\n .map(p => p.getRealPlayer()))\n .filter(p => {\n // the `element` is not apart of the AnimationPlayer definition, but\n // Mock/WebAnimations\n // use the element within their implementation. This will be added in Angular5 to\n // AnimationPlayer\n const pp = p;\n return pp.element ? pp.element === element : false;\n });\n const preStyles = preStylesMap.get(element);\n const postStyles = postStylesMap.get(element);\n const keyframes = normalizeKeyframes(this.driver, this._normalizer, element, timelineInstruction.keyframes, preStyles, postStyles);\n const player = this._buildPlayer(timelineInstruction, keyframes, previousPlayers);\n // this means that this particular player belongs to a sub trigger. It is\n // important that we match this player up with the corresponding (@trigger.listener)\n if (timelineInstruction.subTimeline && skippedPlayersMap) {\n allSubElements.add(element);\n }\n if (isQueriedElement) {\n const wrappedPlayer = new TransitionAnimationPlayer(namespaceId, triggerName, element);\n wrappedPlayer.setRealPlayer(player);\n allQueriedPlayers.push(wrappedPlayer);\n }\n return player;\n });\n allQueriedPlayers.forEach(player => {\n getOrSetAsInMap(this.playersByQueriedElement, player.element, []).push(player);\n player.onDone(() => deleteOrUnsetInMap(this.playersByQueriedElement, player.element, player));\n });\n allConsumedElements.forEach(element => addClass(element, NG_ANIMATING_CLASSNAME));\n const player = optimizeGroupPlayer(allNewPlayers);\n player.onDestroy(() => {\n allConsumedElements.forEach(element => removeClass(element, NG_ANIMATING_CLASSNAME));\n setStyles(rootElement, instruction.toStyles);\n });\n // this basically makes all of the callbacks for sub element animations\n // be dependent on the upper players for when they finish\n allSubElements.forEach(element => {\n getOrSetAsInMap(skippedPlayersMap, element, []).push(player);\n });\n return player;\n }\n _buildPlayer(instruction, keyframes, previousPlayers) {\n if (keyframes.length > 0) {\n return this.driver.animate(instruction.element, keyframes, instruction.duration, instruction.delay, instruction.easing, previousPlayers);\n }\n // special case for when an empty transition|definition is provided\n // ... there is no point in rendering an empty animation\n return new NoopAnimationPlayer(instruction.duration, instruction.delay);\n }\n}\nclass TransitionAnimationPlayer {\n constructor(namespaceId, triggerName, element) {\n this.namespaceId = namespaceId;\n this.triggerName = triggerName;\n this.element = element;\n this._player = new NoopAnimationPlayer();\n this._containsRealPlayer = false;\n this._queuedCallbacks = {};\n this.destroyed = false;\n this.markedForDestroy = false;\n this.disabled = false;\n this.queued = true;\n this.totalTime = 0;\n }\n setRealPlayer(player) {\n if (this._containsRealPlayer)\n return;\n this._player = player;\n Object.keys(this._queuedCallbacks).forEach(phase => {\n this._queuedCallbacks[phase].forEach(callback => listenOnPlayer(player, phase, undefined, callback));\n });\n this._queuedCallbacks = {};\n this._containsRealPlayer = true;\n this.overrideTotalTime(player.totalTime);\n this.queued = false;\n }\n getRealPlayer() {\n return this._player;\n }\n overrideTotalTime(totalTime) {\n this.totalTime = totalTime;\n }\n syncPlayerEvents(player) {\n const p = this._player;\n if (p.triggerCallback) {\n player.onStart(() => p.triggerCallback('start'));\n }\n player.onDone(() => this.finish());\n player.onDestroy(() => this.destroy());\n }\n _queueEvent(name, callback) {\n getOrSetAsInMap(this._queuedCallbacks, name, []).push(callback);\n }\n onDone(fn) {\n if (this.queued) {\n this._queueEvent('done', fn);\n }\n this._player.onDone(fn);\n }\n onStart(fn) {\n if (this.queued) {\n this._queueEvent('start', fn);\n }\n this._player.onStart(fn);\n }\n onDestroy(fn) {\n if (this.queued) {\n this._queueEvent('destroy', fn);\n }\n this._player.onDestroy(fn);\n }\n init() {\n this._player.init();\n }\n hasStarted() {\n return this.queued ? false : this._player.hasStarted();\n }\n play() {\n !this.queued && this._player.play();\n }\n pause() {\n !this.queued && this._player.pause();\n }\n restart() {\n !this.queued && this._player.restart();\n }\n finish() {\n this._player.finish();\n }\n destroy() {\n this.destroyed = true;\n this._player.destroy();\n }\n reset() {\n !this.queued && this._player.reset();\n }\n setPosition(p) {\n if (!this.queued) {\n this._player.setPosition(p);\n }\n }\n getPosition() {\n return this.queued ? 0 : this._player.getPosition();\n }\n /** @internal */\n triggerCallback(phaseName) {\n const p = this._player;\n if (p.triggerCallback) {\n p.triggerCallback(phaseName);\n }\n }\n}\nfunction deleteOrUnsetInMap(map, key, value) {\n let currentValues;\n if (map instanceof Map) {\n currentValues = map.get(key);\n if (currentValues) {\n if (currentValues.length) {\n const index = currentValues.indexOf(value);\n currentValues.splice(index, 1);\n }\n if (currentValues.length == 0) {\n map.delete(key);\n }\n }\n }\n else {\n currentValues = map[key];\n if (currentValues) {\n if (currentValues.length) {\n const index = currentValues.indexOf(value);\n currentValues.splice(index, 1);\n }\n if (currentValues.length == 0) {\n delete map[key];\n }\n }\n }\n return currentValues;\n}\nfunction normalizeTriggerValue(value) {\n // we use `!= null` here because it's the most simple\n // way to test against a \"falsy\" value without mixing\n // in empty strings or a zero value. DO NOT OPTIMIZE.\n return value != null ? value : null;\n}\nfunction isElementNode(node) {\n return node && node['nodeType'] === 1;\n}\nfunction isTriggerEventValid(eventName) {\n return eventName == 'start' || eventName == 'done';\n}\nfunction cloakElement(element, value) {\n const oldValue = element.style.display;\n element.style.display = value != null ? value : 'none';\n return oldValue;\n}\nfunction cloakAndComputeStyles(valuesMap, driver, elements, elementPropsMap, defaultStyle) {\n const cloakVals = [];\n elements.forEach(element => cloakVals.push(cloakElement(element)));\n const failedElements = [];\n elementPropsMap.forEach((props, element) => {\n const styles = {};\n props.forEach(prop => {\n const value = styles[prop] = driver.computeStyle(element, prop, defaultStyle);\n // there is no easy way to detect this because a sub element could be removed\n // by a parent animation element being detached.\n if (!value || value.length == 0) {\n element[REMOVAL_FLAG] = NULL_REMOVED_QUERIED_STATE;\n failedElements.push(element);\n }\n });\n valuesMap.set(element, styles);\n });\n // we use a index variable here since Set.forEach(a, i) does not return\n // an index value for the closure (but instead just the value)\n let i = 0;\n elements.forEach(element => cloakElement(element, cloakVals[i++]));\n return failedElements;\n}\n/*\nSince the Angular renderer code will return a collection of inserted\nnodes in all areas of a DOM tree, it's up to this algorithm to figure\nout which nodes are roots for each animation @trigger.\n\nBy placing each inserted node into a Set and traversing upwards, it\nis possible to find the @trigger elements and well any direct *star\ninsertion nodes, if a @trigger root is found then the enter element\nis placed into the Map[@trigger] spot.\n */\nfunction buildRootMap(roots, nodes) {\n const rootMap = new Map();\n roots.forEach(root => rootMap.set(root, []));\n if (nodes.length == 0)\n return rootMap;\n const NULL_NODE = 1;\n const nodeSet = new Set(nodes);\n const localRootMap = new Map();\n function getRoot(node) {\n if (!node)\n return NULL_NODE;\n let root = localRootMap.get(node);\n if (root)\n return root;\n const parent = node.parentNode;\n if (rootMap.has(parent)) { // ngIf inside @trigger\n root = parent;\n }\n else if (nodeSet.has(parent)) { // ngIf inside ngIf\n root = NULL_NODE;\n }\n else { // recurse upwards\n root = getRoot(parent);\n }\n localRootMap.set(node, root);\n return root;\n }\n nodes.forEach(node => {\n const root = getRoot(node);\n if (root !== NULL_NODE) {\n rootMap.get(root).push(node);\n }\n });\n return rootMap;\n}\nconst CLASSES_CACHE_KEY = '$$classes';\nfunction containsClass(element, className) {\n if (element.classList) {\n return element.classList.contains(className);\n }\n else {\n const classes = element[CLASSES_CACHE_KEY];\n return classes && classes[className];\n }\n}\nfunction addClass(element, className) {\n if (element.classList) {\n element.classList.add(className);\n }\n else {\n let classes = element[CLASSES_CACHE_KEY];\n if (!classes) {\n classes = element[CLASSES_CACHE_KEY] = {};\n }\n classes[className] = true;\n }\n}\nfunction removeClass(element, className) {\n if (element.classList) {\n element.classList.remove(className);\n }\n else {\n let classes = element[CLASSES_CACHE_KEY];\n if (classes) {\n delete classes[className];\n }\n }\n}\nfunction removeNodesAfterAnimationDone(engine, element, players) {\n optimizeGroupPlayer(players).onDone(() => engine.processLeaveNode(element));\n}\nfunction flattenGroupPlayers(players) {\n const finalPlayers = [];\n _flattenGroupPlayersRecur(players, finalPlayers);\n return finalPlayers;\n}\nfunction _flattenGroupPlayersRecur(players, finalPlayers) {\n for (let i = 0; i < players.length; i++) {\n const player = players[i];\n if (player instanceof ɵAnimationGroupPlayer) {\n _flattenGroupPlayersRecur(player.players, finalPlayers);\n }\n else {\n finalPlayers.push(player);\n }\n }\n}\nfunction objEquals(a, b) {\n const k1 = Object.keys(a);\n const k2 = Object.keys(b);\n if (k1.length != k2.length)\n return false;\n for (let i = 0; i < k1.length; i++) {\n const prop = k1[i];\n if (!b.hasOwnProperty(prop) || a[prop] !== b[prop])\n return false;\n }\n return true;\n}\nfunction replacePostStylesAsPre(element, allPreStyleElements, allPostStyleElements) {\n const postEntry = allPostStyleElements.get(element);\n if (!postEntry)\n return false;\n let preEntry = allPreStyleElements.get(element);\n if (preEntry) {\n postEntry.forEach(data => preEntry.add(data));\n }\n else {\n allPreStyleElements.set(element, postEntry);\n }\n allPostStyleElements.delete(element);\n return true;\n}\n\nclass AnimationEngine {\n constructor(bodyNode, _driver, normalizer) {\n this.bodyNode = bodyNode;\n this._driver = _driver;\n this._triggerCache = {};\n // this method is designed to be overridden by the code that uses this engine\n this.onRemovalComplete = (element, context) => { };\n this._transitionEngine = new TransitionAnimationEngine(bodyNode, _driver, normalizer);\n this._timelineEngine = new TimelineAnimationEngine(bodyNode, _driver, normalizer);\n this._transitionEngine.onRemovalComplete = (element, context) => this.onRemovalComplete(element, context);\n }\n registerTrigger(componentId, namespaceId, hostElement, name, metadata) {\n const cacheKey = componentId + '-' + name;\n let trigger = this._triggerCache[cacheKey];\n if (!trigger) {\n const errors = [];\n const ast = buildAnimationAst(this._driver, metadata, errors);\n if (errors.length) {\n throw new Error(`The animation trigger \"${name}\" has failed to build due to the following errors:\\n - ${errors.join('\\n - ')}`);\n }\n trigger = buildTrigger(name, ast);\n this._triggerCache[cacheKey] = trigger;\n }\n this._transitionEngine.registerTrigger(namespaceId, name, trigger);\n }\n register(namespaceId, hostElement) {\n this._transitionEngine.register(namespaceId, hostElement);\n }\n destroy(namespaceId, context) {\n this._transitionEngine.destroy(namespaceId, context);\n }\n onInsert(namespaceId, element, parent, insertBefore) {\n this._transitionEngine.insertNode(namespaceId, element, parent, insertBefore);\n }\n onRemove(namespaceId, element, context, isHostElement) {\n this._transitionEngine.removeNode(namespaceId, element, isHostElement || false, context);\n }\n disableAnimations(element, disable) {\n this._transitionEngine.markElementAsDisabled(element, disable);\n }\n process(namespaceId, element, property, value) {\n if (property.charAt(0) == '@') {\n const [id, action] = parseTimelineCommand(property);\n const args = value;\n this._timelineEngine.command(id, element, action, args);\n }\n else {\n this._transitionEngine.trigger(namespaceId, element, property, value);\n }\n }\n listen(namespaceId, element, eventName, eventPhase, callback) {\n // @@listen\n if (eventName.charAt(0) == '@') {\n const [id, action] = parseTimelineCommand(eventName);\n return this._timelineEngine.listen(id, element, action, callback);\n }\n return this._transitionEngine.listen(namespaceId, element, eventName, eventPhase, callback);\n }\n flush(microtaskId = -1) {\n this._transitionEngine.flush(microtaskId);\n }\n get players() {\n return this._transitionEngine.players\n .concat(this._timelineEngine.players);\n }\n whenRenderingDone() {\n return this._transitionEngine.whenRenderingDone();\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Returns an instance of `SpecialCasedStyles` if and when any special (non animateable) styles are\n * detected.\n *\n * In CSS there exist properties that cannot be animated within a keyframe animation\n * (whether it be via CSS keyframes or web-animations) and the animation implementation\n * will ignore them. This function is designed to detect those special cased styles and\n * return a container that will be executed at the start and end of the animation.\n *\n * @returns an instance of `SpecialCasedStyles` if any special styles are detected otherwise `null`\n */\nfunction packageNonAnimatableStyles(element, styles) {\n let startStyles = null;\n let endStyles = null;\n if (Array.isArray(styles) && styles.length) {\n startStyles = filterNonAnimatableStyles(styles[0]);\n if (styles.length > 1) {\n endStyles = filterNonAnimatableStyles(styles[styles.length - 1]);\n }\n }\n else if (styles) {\n startStyles = filterNonAnimatableStyles(styles);\n }\n return (startStyles || endStyles) ? new SpecialCasedStyles(element, startStyles, endStyles) :\n null;\n}\n/**\n * Designed to be executed during a keyframe-based animation to apply any special-cased styles.\n *\n * When started (when the `start()` method is run) then the provided `startStyles`\n * will be applied. When finished (when the `finish()` method is called) the\n * `endStyles` will be applied as well any any starting styles. Finally when\n * `destroy()` is called then all styles will be removed.\n */\nclass SpecialCasedStyles {\n constructor(_element, _startStyles, _endStyles) {\n this._element = _element;\n this._startStyles = _startStyles;\n this._endStyles = _endStyles;\n this._state = 0 /* Pending */;\n let initialStyles = SpecialCasedStyles.initialStylesByElement.get(_element);\n if (!initialStyles) {\n SpecialCasedStyles.initialStylesByElement.set(_element, initialStyles = {});\n }\n this._initialStyles = initialStyles;\n }\n start() {\n if (this._state < 1 /* Started */) {\n if (this._startStyles) {\n setStyles(this._element, this._startStyles, this._initialStyles);\n }\n this._state = 1 /* Started */;\n }\n }\n finish() {\n this.start();\n if (this._state < 2 /* Finished */) {\n setStyles(this._element, this._initialStyles);\n if (this._endStyles) {\n setStyles(this._element, this._endStyles);\n this._endStyles = null;\n }\n this._state = 1 /* Started */;\n }\n }\n destroy() {\n this.finish();\n if (this._state < 3 /* Destroyed */) {\n SpecialCasedStyles.initialStylesByElement.delete(this._element);\n if (this._startStyles) {\n eraseStyles(this._element, this._startStyles);\n this._endStyles = null;\n }\n if (this._endStyles) {\n eraseStyles(this._element, this._endStyles);\n this._endStyles = null;\n }\n setStyles(this._element, this._initialStyles);\n this._state = 3 /* Destroyed */;\n }\n }\n}\nSpecialCasedStyles.initialStylesByElement = new WeakMap();\nfunction filterNonAnimatableStyles(styles) {\n let result = null;\n const props = Object.keys(styles);\n for (let i = 0; i < props.length; i++) {\n const prop = props[i];\n if (isNonAnimatableStyle(prop)) {\n result = result || {};\n result[prop] = styles[prop];\n }\n }\n return result;\n}\nfunction isNonAnimatableStyle(prop) {\n return prop === 'display' || prop === 'position';\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nconst ELAPSED_TIME_MAX_DECIMAL_PLACES = 3;\nconst ANIMATION_PROP = 'animation';\nconst ANIMATIONEND_EVENT = 'animationend';\nconst ONE_SECOND$1 = 1000;\nclass ElementAnimationStyleHandler {\n constructor(_element, _name, _duration, _delay, _easing, _fillMode, _onDoneFn) {\n this._element = _element;\n this._name = _name;\n this._duration = _duration;\n this._delay = _delay;\n this._easing = _easing;\n this._fillMode = _fillMode;\n this._onDoneFn = _onDoneFn;\n this._finished = false;\n this._destroyed = false;\n this._startTime = 0;\n this._position = 0;\n this._eventFn = (e) => this._handleCallback(e);\n }\n apply() {\n applyKeyframeAnimation(this._element, `${this._duration}ms ${this._easing} ${this._delay}ms 1 normal ${this._fillMode} ${this._name}`);\n addRemoveAnimationEvent(this._element, this._eventFn, false);\n this._startTime = Date.now();\n }\n pause() {\n playPauseAnimation(this._element, this._name, 'paused');\n }\n resume() {\n playPauseAnimation(this._element, this._name, 'running');\n }\n setPosition(position) {\n const index = findIndexForAnimation(this._element, this._name);\n this._position = position * this._duration;\n setAnimationStyle(this._element, 'Delay', `-${this._position}ms`, index);\n }\n getPosition() {\n return this._position;\n }\n _handleCallback(event) {\n const timestamp = event._ngTestManualTimestamp || Date.now();\n const elapsedTime = parseFloat(event.elapsedTime.toFixed(ELAPSED_TIME_MAX_DECIMAL_PLACES)) * ONE_SECOND$1;\n if (event.animationName == this._name &&\n Math.max(timestamp - this._startTime, 0) >= this._delay && elapsedTime >= this._duration) {\n this.finish();\n }\n }\n finish() {\n if (this._finished)\n return;\n this._finished = true;\n this._onDoneFn();\n addRemoveAnimationEvent(this._element, this._eventFn, true);\n }\n destroy() {\n if (this._destroyed)\n return;\n this._destroyed = true;\n this.finish();\n removeKeyframeAnimation(this._element, this._name);\n }\n}\nfunction playPauseAnimation(element, name, status) {\n const index = findIndexForAnimation(element, name);\n setAnimationStyle(element, 'PlayState', status, index);\n}\nfunction applyKeyframeAnimation(element, value) {\n const anim = getAnimationStyle(element, '').trim();\n let index = 0;\n if (anim.length) {\n index = countChars(anim, ',') + 1;\n value = `${anim}, ${value}`;\n }\n setAnimationStyle(element, '', value);\n return index;\n}\nfunction removeKeyframeAnimation(element, name) {\n const anim = getAnimationStyle(element, '');\n const tokens = anim.split(',');\n const index = findMatchingTokenIndex(tokens, name);\n if (index >= 0) {\n tokens.splice(index, 1);\n const newValue = tokens.join(',');\n setAnimationStyle(element, '', newValue);\n }\n}\nfunction findIndexForAnimation(element, value) {\n const anim = getAnimationStyle(element, '');\n if (anim.indexOf(',') > 0) {\n const tokens = anim.split(',');\n return findMatchingTokenIndex(tokens, value);\n }\n return findMatchingTokenIndex([anim], value);\n}\nfunction findMatchingTokenIndex(tokens, searchToken) {\n for (let i = 0; i < tokens.length; i++) {\n if (tokens[i].indexOf(searchToken) >= 0) {\n return i;\n }\n }\n return -1;\n}\nfunction addRemoveAnimationEvent(element, fn, doRemove) {\n doRemove ? element.removeEventListener(ANIMATIONEND_EVENT, fn) :\n element.addEventListener(ANIMATIONEND_EVENT, fn);\n}\nfunction setAnimationStyle(element, name, value, index) {\n const prop = ANIMATION_PROP + name;\n if (index != null) {\n const oldValue = element.style[prop];\n if (oldValue.length) {\n const tokens = oldValue.split(',');\n tokens[index] = value;\n value = tokens.join(',');\n }\n }\n element.style[prop] = value;\n}\nfunction getAnimationStyle(element, name) {\n return element.style[ANIMATION_PROP + name] || '';\n}\nfunction countChars(value, char) {\n let count = 0;\n for (let i = 0; i < value.length; i++) {\n const c = value.charAt(i);\n if (c === char)\n count++;\n }\n return count;\n}\n\nconst DEFAULT_FILL_MODE = 'forwards';\nconst DEFAULT_EASING = 'linear';\nclass CssKeyframesPlayer {\n constructor(element, keyframes, animationName, _duration, _delay, easing, _finalStyles, _specialStyles) {\n this.element = element;\n this.keyframes = keyframes;\n this.animationName = animationName;\n this._duration = _duration;\n this._delay = _delay;\n this._finalStyles = _finalStyles;\n this._specialStyles = _specialStyles;\n this._onDoneFns = [];\n this._onStartFns = [];\n this._onDestroyFns = [];\n this._started = false;\n this.currentSnapshot = {};\n this._state = 0;\n this.easing = easing || DEFAULT_EASING;\n this.totalTime = _duration + _delay;\n this._buildStyler();\n }\n onStart(fn) {\n this._onStartFns.push(fn);\n }\n onDone(fn) {\n this._onDoneFns.push(fn);\n }\n onDestroy(fn) {\n this._onDestroyFns.push(fn);\n }\n destroy() {\n this.init();\n if (this._state >= 4 /* DESTROYED */)\n return;\n this._state = 4 /* DESTROYED */;\n this._styler.destroy();\n this._flushStartFns();\n this._flushDoneFns();\n if (this._specialStyles) {\n this._specialStyles.destroy();\n }\n this._onDestroyFns.forEach(fn => fn());\n this._onDestroyFns = [];\n }\n _flushDoneFns() {\n this._onDoneFns.forEach(fn => fn());\n this._onDoneFns = [];\n }\n _flushStartFns() {\n this._onStartFns.forEach(fn => fn());\n this._onStartFns = [];\n }\n finish() {\n this.init();\n if (this._state >= 3 /* FINISHED */)\n return;\n this._state = 3 /* FINISHED */;\n this._styler.finish();\n this._flushStartFns();\n if (this._specialStyles) {\n this._specialStyles.finish();\n }\n this._flushDoneFns();\n }\n setPosition(value) {\n this._styler.setPosition(value);\n }\n getPosition() {\n return this._styler.getPosition();\n }\n hasStarted() {\n return this._state >= 2 /* STARTED */;\n }\n init() {\n if (this._state >= 1 /* INITIALIZED */)\n return;\n this._state = 1 /* INITIALIZED */;\n const elm = this.element;\n this._styler.apply();\n if (this._delay) {\n this._styler.pause();\n }\n }\n play() {\n this.init();\n if (!this.hasStarted()) {\n this._flushStartFns();\n this._state = 2 /* STARTED */;\n if (this._specialStyles) {\n this._specialStyles.start();\n }\n }\n this._styler.resume();\n }\n pause() {\n this.init();\n this._styler.pause();\n }\n restart() {\n this.reset();\n this.play();\n }\n reset() {\n this._styler.destroy();\n this._buildStyler();\n this._styler.apply();\n }\n _buildStyler() {\n this._styler = new ElementAnimationStyleHandler(this.element, this.animationName, this._duration, this._delay, this.easing, DEFAULT_FILL_MODE, () => this.finish());\n }\n /** @internal */\n triggerCallback(phaseName) {\n const methods = phaseName == 'start' ? this._onStartFns : this._onDoneFns;\n methods.forEach(fn => fn());\n methods.length = 0;\n }\n beforeDestroy() {\n this.init();\n const styles = {};\n if (this.hasStarted()) {\n const finished = this._state >= 3 /* FINISHED */;\n Object.keys(this._finalStyles).forEach(prop => {\n if (prop != 'offset') {\n styles[prop] = finished ? this._finalStyles[prop] : computeStyle(this.element, prop);\n }\n });\n }\n this.currentSnapshot = styles;\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nclass DirectStylePlayer extends NoopAnimationPlayer {\n constructor(element, styles) {\n super();\n this.element = element;\n this._startingStyles = {};\n this.__initialized = false;\n this._styles = hypenatePropsObject(styles);\n }\n init() {\n if (this.__initialized || !this._startingStyles)\n return;\n this.__initialized = true;\n Object.keys(this._styles).forEach(prop => {\n this._startingStyles[prop] = this.element.style[prop];\n });\n super.init();\n }\n play() {\n if (!this._startingStyles)\n return;\n this.init();\n Object.keys(this._styles)\n .forEach(prop => this.element.style.setProperty(prop, this._styles[prop]));\n super.play();\n }\n destroy() {\n if (!this._startingStyles)\n return;\n Object.keys(this._startingStyles).forEach(prop => {\n const value = this._startingStyles[prop];\n if (value) {\n this.element.style.setProperty(prop, value);\n }\n else {\n this.element.style.removeProperty(prop);\n }\n });\n this._startingStyles = null;\n super.destroy();\n }\n}\n\nconst KEYFRAMES_NAME_PREFIX = 'gen_css_kf_';\nconst TAB_SPACE = ' ';\nclass CssKeyframesDriver {\n constructor() {\n this._count = 0;\n this._head = document.querySelector('head');\n }\n validateStyleProperty(prop) {\n return validateStyleProperty(prop);\n }\n matchesElement(element, selector) {\n return matchesElement(element, selector);\n }\n containsElement(elm1, elm2) {\n return containsElement(elm1, elm2);\n }\n query(element, selector, multi) {\n return invokeQuery(element, selector, multi);\n }\n computeStyle(element, prop, defaultValue) {\n return window.getComputedStyle(element)[prop];\n }\n buildKeyframeElement(element, name, keyframes) {\n keyframes = keyframes.map(kf => hypenatePropsObject(kf));\n let keyframeStr = `@keyframes ${name} {\\n`;\n let tab = '';\n keyframes.forEach(kf => {\n tab = TAB_SPACE;\n const offset = parseFloat(kf['offset']);\n keyframeStr += `${tab}${offset * 100}% {\\n`;\n tab += TAB_SPACE;\n Object.keys(kf).forEach(prop => {\n const value = kf[prop];\n switch (prop) {\n case 'offset':\n return;\n case 'easing':\n if (value) {\n keyframeStr += `${tab}animation-timing-function: ${value};\\n`;\n }\n return;\n default:\n keyframeStr += `${tab}${prop}: ${value};\\n`;\n return;\n }\n });\n keyframeStr += `${tab}}\\n`;\n });\n keyframeStr += `}\\n`;\n const kfElm = document.createElement('style');\n kfElm.textContent = keyframeStr;\n return kfElm;\n }\n animate(element, keyframes, duration, delay, easing, previousPlayers = [], scrubberAccessRequested) {\n if ((typeof ngDevMode === 'undefined' || ngDevMode) && scrubberAccessRequested) {\n notifyFaultyScrubber();\n }\n const previousCssKeyframePlayers = previousPlayers.filter(player => player instanceof CssKeyframesPlayer);\n const previousStyles = {};\n if (allowPreviousPlayerStylesMerge(duration, delay)) {\n previousCssKeyframePlayers.forEach(player => {\n let styles = player.currentSnapshot;\n Object.keys(styles).forEach(prop => previousStyles[prop] = styles[prop]);\n });\n }\n keyframes = balancePreviousStylesIntoKeyframes(element, keyframes, previousStyles);\n const finalStyles = flattenKeyframesIntoStyles(keyframes);\n // if there is no animation then there is no point in applying\n // styles and waiting for an event to get fired. This causes lag.\n // It's better to just directly apply the styles to the element\n // via the direct styling animation player.\n if (duration == 0) {\n return new DirectStylePlayer(element, finalStyles);\n }\n const animationName = `${KEYFRAMES_NAME_PREFIX}${this._count++}`;\n const kfElm = this.buildKeyframeElement(element, animationName, keyframes);\n document.querySelector('head').appendChild(kfElm);\n const specialStyles = packageNonAnimatableStyles(element, keyframes);\n const player = new CssKeyframesPlayer(element, keyframes, animationName, duration, delay, easing, finalStyles, specialStyles);\n player.onDestroy(() => removeElement(kfElm));\n return player;\n }\n}\nfunction flattenKeyframesIntoStyles(keyframes) {\n let flatKeyframes = {};\n if (keyframes) {\n const kfs = Array.isArray(keyframes) ? keyframes : [keyframes];\n kfs.forEach(kf => {\n Object.keys(kf).forEach(prop => {\n if (prop == 'offset' || prop == 'easing')\n return;\n flatKeyframes[prop] = kf[prop];\n });\n });\n }\n return flatKeyframes;\n}\nfunction removeElement(node) {\n node.parentNode.removeChild(node);\n}\nlet warningIssued = false;\nfunction notifyFaultyScrubber() {\n if (warningIssued)\n return;\n console.warn('@angular/animations: please load the web-animations.js polyfill to allow programmatic access...\\n', ' visit https://bit.ly/IWukam to learn more about using the web-animation-js polyfill.');\n warningIssued = true;\n}\n\nclass WebAnimationsPlayer {\n constructor(element, keyframes, options, _specialStyles) {\n this.element = element;\n this.keyframes = keyframes;\n this.options = options;\n this._specialStyles = _specialStyles;\n this._onDoneFns = [];\n this._onStartFns = [];\n this._onDestroyFns = [];\n this._initialized = false;\n this._finished = false;\n this._started = false;\n this._destroyed = false;\n this.time = 0;\n this.parentPlayer = null;\n this.currentSnapshot = {};\n this._duration = options['duration'];\n this._delay = options['delay'] || 0;\n this.time = this._duration + this._delay;\n }\n _onFinish() {\n if (!this._finished) {\n this._finished = true;\n this._onDoneFns.forEach(fn => fn());\n this._onDoneFns = [];\n }\n }\n init() {\n this._buildPlayer();\n this._preparePlayerBeforeStart();\n }\n _buildPlayer() {\n if (this._initialized)\n return;\n this._initialized = true;\n const keyframes = this.keyframes;\n this.domPlayer =\n this._triggerWebAnimation(this.element, keyframes, this.options);\n this._finalKeyframe = keyframes.length ? keyframes[keyframes.length - 1] : {};\n this.domPlayer.addEventListener('finish', () => this._onFinish());\n }\n _preparePlayerBeforeStart() {\n // this is required so that the player doesn't start to animate right away\n if (this._delay) {\n this._resetDomPlayerState();\n }\n else {\n this.domPlayer.pause();\n }\n }\n /** @internal */\n _triggerWebAnimation(element, keyframes, options) {\n // jscompiler doesn't seem to know animate is a native property because it's not fully\n // supported yet across common browsers (we polyfill it for Edge/Safari) [CL #143630929]\n return element['animate'](keyframes, options);\n }\n onStart(fn) {\n this._onStartFns.push(fn);\n }\n onDone(fn) {\n this._onDoneFns.push(fn);\n }\n onDestroy(fn) {\n this._onDestroyFns.push(fn);\n }\n play() {\n this._buildPlayer();\n if (!this.hasStarted()) {\n this._onStartFns.forEach(fn => fn());\n this._onStartFns = [];\n this._started = true;\n if (this._specialStyles) {\n this._specialStyles.start();\n }\n }\n this.domPlayer.play();\n }\n pause() {\n this.init();\n this.domPlayer.pause();\n }\n finish() {\n this.init();\n if (this._specialStyles) {\n this._specialStyles.finish();\n }\n this._onFinish();\n this.domPlayer.finish();\n }\n reset() {\n this._resetDomPlayerState();\n this._destroyed = false;\n this._finished = false;\n this._started = false;\n }\n _resetDomPlayerState() {\n if (this.domPlayer) {\n this.domPlayer.cancel();\n }\n }\n restart() {\n this.reset();\n this.play();\n }\n hasStarted() {\n return this._started;\n }\n destroy() {\n if (!this._destroyed) {\n this._destroyed = true;\n this._resetDomPlayerState();\n this._onFinish();\n if (this._specialStyles) {\n this._specialStyles.destroy();\n }\n this._onDestroyFns.forEach(fn => fn());\n this._onDestroyFns = [];\n }\n }\n setPosition(p) {\n this.domPlayer.currentTime = p * this.time;\n }\n getPosition() {\n return this.domPlayer.currentTime / this.time;\n }\n get totalTime() {\n return this._delay + this._duration;\n }\n beforeDestroy() {\n const styles = {};\n if (this.hasStarted()) {\n Object.keys(this._finalKeyframe).forEach(prop => {\n if (prop != 'offset') {\n styles[prop] =\n this._finished ? this._finalKeyframe[prop] : computeStyle(this.element, prop);\n }\n });\n }\n this.currentSnapshot = styles;\n }\n /** @internal */\n triggerCallback(phaseName) {\n const methods = phaseName == 'start' ? this._onStartFns : this._onDoneFns;\n methods.forEach(fn => fn());\n methods.length = 0;\n }\n}\n\nclass WebAnimationsDriver {\n constructor() {\n this._isNativeImpl = /\\{\\s*\\[native\\s+code\\]\\s*\\}/.test(getElementAnimateFn().toString());\n this._cssKeyframesDriver = new CssKeyframesDriver();\n }\n validateStyleProperty(prop) {\n return validateStyleProperty(prop);\n }\n matchesElement(element, selector) {\n return matchesElement(element, selector);\n }\n containsElement(elm1, elm2) {\n return containsElement(elm1, elm2);\n }\n query(element, selector, multi) {\n return invokeQuery(element, selector, multi);\n }\n computeStyle(element, prop, defaultValue) {\n return window.getComputedStyle(element)[prop];\n }\n overrideWebAnimationsSupport(supported) {\n this._isNativeImpl = supported;\n }\n animate(element, keyframes, duration, delay, easing, previousPlayers = [], scrubberAccessRequested) {\n const useKeyframes = !scrubberAccessRequested && !this._isNativeImpl;\n if (useKeyframes) {\n return this._cssKeyframesDriver.animate(element, keyframes, duration, delay, easing, previousPlayers);\n }\n const fill = delay == 0 ? 'both' : 'forwards';\n const playerOptions = { duration, delay, fill };\n // we check for this to avoid having a null|undefined value be present\n // for the easing (which results in an error for certain browsers #9752)\n if (easing) {\n playerOptions['easing'] = easing;\n }\n const previousStyles = {};\n const previousWebAnimationPlayers = previousPlayers.filter(player => player instanceof WebAnimationsPlayer);\n if (allowPreviousPlayerStylesMerge(duration, delay)) {\n previousWebAnimationPlayers.forEach(player => {\n let styles = player.currentSnapshot;\n Object.keys(styles).forEach(prop => previousStyles[prop] = styles[prop]);\n });\n }\n keyframes = keyframes.map(styles => copyStyles(styles, false));\n keyframes = balancePreviousStylesIntoKeyframes(element, keyframes, previousStyles);\n const specialStyles = packageNonAnimatableStyles(element, keyframes);\n return new WebAnimationsPlayer(element, keyframes, playerOptions, specialStyles);\n }\n}\nfunction supportsWebAnimations() {\n return typeof getElementAnimateFn() === 'function';\n}\nfunction getElementAnimateFn() {\n return (isBrowser() && Element.prototype['animate']) || {};\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * Generated bundle index. Do not edit.\n */\n\nexport { AnimationDriver, Animation as ɵAnimation, AnimationEngine as ɵAnimationEngine, AnimationStyleNormalizer as ɵAnimationStyleNormalizer, CssKeyframesDriver as ɵCssKeyframesDriver, CssKeyframesPlayer as ɵCssKeyframesPlayer, NoopAnimationDriver as ɵNoopAnimationDriver, NoopAnimationStyleNormalizer as ɵNoopAnimationStyleNormalizer, WebAnimationsDriver as ɵWebAnimationsDriver, WebAnimationsPlayer as ɵWebAnimationsPlayer, WebAnimationsStyleNormalizer as ɵWebAnimationsStyleNormalizer, allowPreviousPlayerStylesMerge as ɵallowPreviousPlayerStylesMerge, SpecialCasedStyles as ɵangular_packages_animations_browser_browser_a, containsElement as ɵcontainsElement, invokeQuery as ɵinvokeQuery, matchesElement as ɵmatchesElement, supportsWebAnimations as ɵsupportsWebAnimations, validateStyleProperty as ɵvalidateStyleProperty };\n\n//# sourceMappingURL=browser.js.map","/**\n * @license Angular v11.0.9\n * (c) 2010-2020 Google LLC. https://angular.io/\n * License: MIT\n */\n\nimport { ViewEncapsulation, Injectable, RendererFactory2, Inject, NgZone, InjectionToken, NgModule } from '@angular/core';\nimport { ɵDomRendererFactory2, BrowserModule } from '@angular/platform-browser';\nimport { AnimationBuilder, sequence, AnimationFactory } from '@angular/animations';\nimport { ɵAnimationEngine, AnimationDriver, ɵAnimationStyleNormalizer, ɵsupportsWebAnimations, ɵWebAnimationsDriver, ɵCssKeyframesDriver, ɵWebAnimationsStyleNormalizer, ɵNoopAnimationDriver } from '@angular/animations/browser';\nimport { DOCUMENT } from '@angular/common';\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nimport * as ɵngcc0 from '@angular/core';\nimport * as ɵngcc1 from '@angular/animations/browser';\nclass BrowserAnimationBuilder extends AnimationBuilder {\n constructor(rootRenderer, doc) {\n super();\n this._nextAnimationId = 0;\n const typeData = { id: '0', encapsulation: ViewEncapsulation.None, styles: [], data: { animation: [] } };\n this._renderer = rootRenderer.createRenderer(doc.body, typeData);\n }\n build(animation) {\n const id = this._nextAnimationId.toString();\n this._nextAnimationId++;\n const entry = Array.isArray(animation) ? sequence(animation) : animation;\n issueAnimationCommand(this._renderer, null, id, 'register', [entry]);\n return new BrowserAnimationFactory(id, this._renderer);\n }\n}\nBrowserAnimationBuilder.ɵfac = function BrowserAnimationBuilder_Factory(t) { return new (t || BrowserAnimationBuilder)(ɵngcc0.ɵɵinject(ɵngcc0.RendererFactory2), ɵngcc0.ɵɵinject(DOCUMENT)); };\nBrowserAnimationBuilder.ɵprov = ɵngcc0.ɵɵdefineInjectable({ token: BrowserAnimationBuilder, factory: BrowserAnimationBuilder.ɵfac });\nBrowserAnimationBuilder.ctorParameters = () => [\n { type: RendererFactory2 },\n { type: undefined, decorators: [{ type: Inject, args: [DOCUMENT,] }] }\n];\n/*@__PURE__*/ (function () { ɵngcc0.ɵsetClassMetadata(BrowserAnimationBuilder, [{\n type: Injectable\n }], function () { return [{ type: ɵngcc0.RendererFactory2 }, { type: undefined, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }]; }, null); })();\nclass BrowserAnimationFactory extends AnimationFactory {\n constructor(_id, _renderer) {\n super();\n this._id = _id;\n this._renderer = _renderer;\n }\n create(element, options) {\n return new RendererAnimationPlayer(this._id, element, options || {}, this._renderer);\n }\n}\nclass RendererAnimationPlayer {\n constructor(id, element, options, _renderer) {\n this.id = id;\n this.element = element;\n this._renderer = _renderer;\n this.parentPlayer = null;\n this._started = false;\n this.totalTime = 0;\n this._command('create', options);\n }\n _listen(eventName, callback) {\n return this._renderer.listen(this.element, `@@${this.id}:${eventName}`, callback);\n }\n _command(command, ...args) {\n return issueAnimationCommand(this._renderer, this.element, this.id, command, args);\n }\n onDone(fn) {\n this._listen('done', fn);\n }\n onStart(fn) {\n this._listen('start', fn);\n }\n onDestroy(fn) {\n this._listen('destroy', fn);\n }\n init() {\n this._command('init');\n }\n hasStarted() {\n return this._started;\n }\n play() {\n this._command('play');\n this._started = true;\n }\n pause() {\n this._command('pause');\n }\n restart() {\n this._command('restart');\n }\n finish() {\n this._command('finish');\n }\n destroy() {\n this._command('destroy');\n }\n reset() {\n this._command('reset');\n }\n setPosition(p) {\n this._command('setPosition', p);\n }\n getPosition() {\n var _a, _b;\n return (_b = (_a = this._renderer.engine.players[+this.id]) === null || _a === void 0 ? void 0 : _a.getPosition()) !== null && _b !== void 0 ? _b : 0;\n }\n}\nfunction issueAnimationCommand(renderer, element, id, command, args) {\n return renderer.setProperty(element, `@@${id}:${command}`, args);\n}\n\nconst ANIMATION_PREFIX = '@';\nconst DISABLE_ANIMATIONS_FLAG = '@.disabled';\nclass AnimationRendererFactory {\n constructor(delegate, engine, _zone) {\n this.delegate = delegate;\n this.engine = engine;\n this._zone = _zone;\n this._currentId = 0;\n this._microtaskId = 1;\n this._animationCallbacksBuffer = [];\n this._rendererCache = new Map();\n this._cdRecurDepth = 0;\n this.promise = Promise.resolve(0);\n engine.onRemovalComplete = (element, delegate) => {\n // Note: if an component element has a leave animation, and the component\n // a host leave animation, the view engine will call `removeChild` for the parent\n // component renderer as well as for the child component renderer.\n // Therefore, we need to check if we already removed the element.\n if (delegate && delegate.parentNode(element)) {\n delegate.removeChild(element.parentNode, element);\n }\n };\n }\n createRenderer(hostElement, type) {\n const EMPTY_NAMESPACE_ID = '';\n // cache the delegates to find out which cached delegate can\n // be used by which cached renderer\n const delegate = this.delegate.createRenderer(hostElement, type);\n if (!hostElement || !type || !type.data || !type.data['animation']) {\n let renderer = this._rendererCache.get(delegate);\n if (!renderer) {\n renderer = new BaseAnimationRenderer(EMPTY_NAMESPACE_ID, delegate, this.engine);\n // only cache this result when the base renderer is used\n this._rendererCache.set(delegate, renderer);\n }\n return renderer;\n }\n const componentId = type.id;\n const namespaceId = type.id + '-' + this._currentId;\n this._currentId++;\n this.engine.register(namespaceId, hostElement);\n const registerTrigger = (trigger) => {\n if (Array.isArray(trigger)) {\n trigger.forEach(registerTrigger);\n }\n else {\n this.engine.registerTrigger(componentId, namespaceId, hostElement, trigger.name, trigger);\n }\n };\n const animationTriggers = type.data['animation'];\n animationTriggers.forEach(registerTrigger);\n return new AnimationRenderer(this, namespaceId, delegate, this.engine);\n }\n begin() {\n this._cdRecurDepth++;\n if (this.delegate.begin) {\n this.delegate.begin();\n }\n }\n _scheduleCountTask() {\n // always use promise to schedule microtask instead of use Zone\n this.promise.then(() => {\n this._microtaskId++;\n });\n }\n /** @internal */\n scheduleListenerCallback(count, fn, data) {\n if (count >= 0 && count < this._microtaskId) {\n this._zone.run(() => fn(data));\n return;\n }\n if (this._animationCallbacksBuffer.length == 0) {\n Promise.resolve(null).then(() => {\n this._zone.run(() => {\n this._animationCallbacksBuffer.forEach(tuple => {\n const [fn, data] = tuple;\n fn(data);\n });\n this._animationCallbacksBuffer = [];\n });\n });\n }\n this._animationCallbacksBuffer.push([fn, data]);\n }\n end() {\n this._cdRecurDepth--;\n // this is to prevent animations from running twice when an inner\n // component does CD when a parent component instead has inserted it\n if (this._cdRecurDepth == 0) {\n this._zone.runOutsideAngular(() => {\n this._scheduleCountTask();\n this.engine.flush(this._microtaskId);\n });\n }\n if (this.delegate.end) {\n this.delegate.end();\n }\n }\n whenRenderingDone() {\n return this.engine.whenRenderingDone();\n }\n}\nAnimationRendererFactory.ɵfac = function AnimationRendererFactory_Factory(t) { return new (t || AnimationRendererFactory)(ɵngcc0.ɵɵinject(ɵngcc0.RendererFactory2), ɵngcc0.ɵɵinject(ɵngcc1.ɵAnimationEngine), ɵngcc0.ɵɵinject(ɵngcc0.NgZone)); };\nAnimationRendererFactory.ɵprov = ɵngcc0.ɵɵdefineInjectable({ token: AnimationRendererFactory, factory: AnimationRendererFactory.ɵfac });\nAnimationRendererFactory.ctorParameters = () => [\n { type: RendererFactory2 },\n { type: ɵAnimationEngine },\n { type: NgZone }\n];\n/*@__PURE__*/ (function () { ɵngcc0.ɵsetClassMetadata(AnimationRendererFactory, [{\n type: Injectable\n }], function () { return [{ type: ɵngcc0.RendererFactory2 }, { type: ɵngcc1.ɵAnimationEngine }, { type: ɵngcc0.NgZone }]; }, null); })();\nclass BaseAnimationRenderer {\n constructor(namespaceId, delegate, engine) {\n this.namespaceId = namespaceId;\n this.delegate = delegate;\n this.engine = engine;\n this.destroyNode = this.delegate.destroyNode ? (n) => delegate.destroyNode(n) : null;\n }\n get data() {\n return this.delegate.data;\n }\n destroy() {\n this.engine.destroy(this.namespaceId, this.delegate);\n this.delegate.destroy();\n }\n createElement(name, namespace) {\n return this.delegate.createElement(name, namespace);\n }\n createComment(value) {\n return this.delegate.createComment(value);\n }\n createText(value) {\n return this.delegate.createText(value);\n }\n appendChild(parent, newChild) {\n this.delegate.appendChild(parent, newChild);\n this.engine.onInsert(this.namespaceId, newChild, parent, false);\n }\n insertBefore(parent, newChild, refChild, isMove = true) {\n this.delegate.insertBefore(parent, newChild, refChild);\n // If `isMove` true than we should animate this insert.\n this.engine.onInsert(this.namespaceId, newChild, parent, isMove);\n }\n removeChild(parent, oldChild, isHostElement) {\n this.engine.onRemove(this.namespaceId, oldChild, this.delegate, isHostElement);\n }\n selectRootElement(selectorOrNode, preserveContent) {\n return this.delegate.selectRootElement(selectorOrNode, preserveContent);\n }\n parentNode(node) {\n return this.delegate.parentNode(node);\n }\n nextSibling(node) {\n return this.delegate.nextSibling(node);\n }\n setAttribute(el, name, value, namespace) {\n this.delegate.setAttribute(el, name, value, namespace);\n }\n removeAttribute(el, name, namespace) {\n this.delegate.removeAttribute(el, name, namespace);\n }\n addClass(el, name) {\n this.delegate.addClass(el, name);\n }\n removeClass(el, name) {\n this.delegate.removeClass(el, name);\n }\n setStyle(el, style, value, flags) {\n this.delegate.setStyle(el, style, value, flags);\n }\n removeStyle(el, style, flags) {\n this.delegate.removeStyle(el, style, flags);\n }\n setProperty(el, name, value) {\n if (name.charAt(0) == ANIMATION_PREFIX && name == DISABLE_ANIMATIONS_FLAG) {\n this.disableAnimations(el, !!value);\n }\n else {\n this.delegate.setProperty(el, name, value);\n }\n }\n setValue(node, value) {\n this.delegate.setValue(node, value);\n }\n listen(target, eventName, callback) {\n return this.delegate.listen(target, eventName, callback);\n }\n disableAnimations(element, value) {\n this.engine.disableAnimations(element, value);\n }\n}\nclass AnimationRenderer extends BaseAnimationRenderer {\n constructor(factory, namespaceId, delegate, engine) {\n super(namespaceId, delegate, engine);\n this.factory = factory;\n this.namespaceId = namespaceId;\n }\n setProperty(el, name, value) {\n if (name.charAt(0) == ANIMATION_PREFIX) {\n if (name.charAt(1) == '.' && name == DISABLE_ANIMATIONS_FLAG) {\n value = value === undefined ? true : !!value;\n this.disableAnimations(el, value);\n }\n else {\n this.engine.process(this.namespaceId, el, name.substr(1), value);\n }\n }\n else {\n this.delegate.setProperty(el, name, value);\n }\n }\n listen(target, eventName, callback) {\n if (eventName.charAt(0) == ANIMATION_PREFIX) {\n const element = resolveElementFromTarget(target);\n let name = eventName.substr(1);\n let phase = '';\n // @listener.phase is for trigger animation callbacks\n // @@listener is for animation builder callbacks\n if (name.charAt(0) != ANIMATION_PREFIX) {\n [name, phase] = parseTriggerCallbackName(name);\n }\n return this.engine.listen(this.namespaceId, element, name, phase, event => {\n const countId = event['_data'] || -1;\n this.factory.scheduleListenerCallback(countId, callback, event);\n });\n }\n return this.delegate.listen(target, eventName, callback);\n }\n}\nfunction resolveElementFromTarget(target) {\n switch (target) {\n case 'body':\n return document.body;\n case 'document':\n return document;\n case 'window':\n return window;\n default:\n return target;\n }\n}\nfunction parseTriggerCallbackName(triggerName) {\n const dotIndex = triggerName.indexOf('.');\n const trigger = triggerName.substring(0, dotIndex);\n const phase = triggerName.substr(dotIndex + 1);\n return [trigger, phase];\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nclass InjectableAnimationEngine extends ɵAnimationEngine {\n constructor(doc, driver, normalizer) {\n super(doc.body, driver, normalizer);\n }\n}\nInjectableAnimationEngine.ɵfac = function InjectableAnimationEngine_Factory(t) { return new (t || InjectableAnimationEngine)(ɵngcc0.ɵɵinject(DOCUMENT), ɵngcc0.ɵɵinject(ɵngcc1.AnimationDriver), ɵngcc0.ɵɵinject(ɵngcc1.ɵAnimationStyleNormalizer)); };\nInjectableAnimationEngine.ɵprov = ɵngcc0.ɵɵdefineInjectable({ token: InjectableAnimationEngine, factory: InjectableAnimationEngine.ɵfac });\nInjectableAnimationEngine.ctorParameters = () => [\n { type: undefined, decorators: [{ type: Inject, args: [DOCUMENT,] }] },\n { type: AnimationDriver },\n { type: ɵAnimationStyleNormalizer }\n];\n/*@__PURE__*/ (function () { ɵngcc0.ɵsetClassMetadata(InjectableAnimationEngine, [{\n type: Injectable\n }], function () { return [{ type: undefined, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }, { type: ɵngcc1.AnimationDriver }, { type: ɵngcc1.ɵAnimationStyleNormalizer }]; }, null); })();\nfunction instantiateSupportedAnimationDriver() {\n return ɵsupportsWebAnimations() ? new ɵWebAnimationsDriver() : new ɵCssKeyframesDriver();\n}\nfunction instantiateDefaultStyleNormalizer() {\n return new ɵWebAnimationsStyleNormalizer();\n}\nfunction instantiateRendererFactory(renderer, engine, zone) {\n return new AnimationRendererFactory(renderer, engine, zone);\n}\n/**\n * @publicApi\n */\nconst ANIMATION_MODULE_TYPE = new InjectionToken('AnimationModuleType');\nconst SHARED_ANIMATION_PROVIDERS = [\n { provide: AnimationBuilder, useClass: BrowserAnimationBuilder },\n { provide: ɵAnimationStyleNormalizer, useFactory: instantiateDefaultStyleNormalizer },\n { provide: ɵAnimationEngine, useClass: InjectableAnimationEngine }, {\n provide: RendererFactory2,\n useFactory: instantiateRendererFactory,\n deps: [ɵDomRendererFactory2, ɵAnimationEngine, NgZone]\n }\n];\n/**\n * Separate providers from the actual module so that we can do a local modification in Google3 to\n * include them in the BrowserModule.\n */\nconst BROWSER_ANIMATIONS_PROVIDERS = [\n { provide: AnimationDriver, useFactory: instantiateSupportedAnimationDriver },\n { provide: ANIMATION_MODULE_TYPE, useValue: 'BrowserAnimations' }, ...SHARED_ANIMATION_PROVIDERS\n];\n/**\n * Separate providers from the actual module so that we can do a local modification in Google3 to\n * include them in the BrowserTestingModule.\n */\nconst BROWSER_NOOP_ANIMATIONS_PROVIDERS = [\n { provide: AnimationDriver, useClass: ɵNoopAnimationDriver },\n { provide: ANIMATION_MODULE_TYPE, useValue: 'NoopAnimations' }, ...SHARED_ANIMATION_PROVIDERS\n];\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Exports `BrowserModule` with additional [dependency-injection providers](guide/glossary#provider)\n * for use with animations. See [Animations](guide/animations).\n * @publicApi\n */\nclass BrowserAnimationsModule {\n}\nBrowserAnimationsModule.ɵmod = ɵngcc0.ɵɵdefineNgModule({ type: BrowserAnimationsModule });\nBrowserAnimationsModule.ɵinj = ɵngcc0.ɵɵdefineInjector({ factory: function BrowserAnimationsModule_Factory(t) { return new (t || BrowserAnimationsModule)(); }, providers: BROWSER_ANIMATIONS_PROVIDERS, imports: [BrowserModule] });\n(function () { (typeof ngJitMode === \"undefined\" || ngJitMode) && ɵngcc0.ɵɵsetNgModuleScope(BrowserAnimationsModule, { exports: function () { return [BrowserModule]; } }); })();\n/*@__PURE__*/ (function () { ɵngcc0.ɵsetClassMetadata(BrowserAnimationsModule, [{\n type: NgModule,\n args: [{\n exports: [BrowserModule],\n providers: BROWSER_ANIMATIONS_PROVIDERS\n }]\n }], null, null); })();\n/**\n * A null player that must be imported to allow disabling of animations.\n * @publicApi\n */\nclass NoopAnimationsModule {\n}\nNoopAnimationsModule.ɵmod = ɵngcc0.ɵɵdefineNgModule({ type: NoopAnimationsModule });\nNoopAnimationsModule.ɵinj = ɵngcc0.ɵɵdefineInjector({ factory: function NoopAnimationsModule_Factory(t) { return new (t || NoopAnimationsModule)(); }, providers: BROWSER_NOOP_ANIMATIONS_PROVIDERS, imports: [BrowserModule] });\n(function () { (typeof ngJitMode === \"undefined\" || ngJitMode) && ɵngcc0.ɵɵsetNgModuleScope(NoopAnimationsModule, { exports: function () { return [BrowserModule]; } }); })();\n/*@__PURE__*/ (function () { ɵngcc0.ɵsetClassMetadata(NoopAnimationsModule, [{\n type: NgModule,\n args: [{\n exports: [BrowserModule],\n providers: BROWSER_NOOP_ANIMATIONS_PROVIDERS\n }]\n }], null, null); })();\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * Generated bundle index. Do not edit.\n */\n\nexport { ANIMATION_MODULE_TYPE, BrowserAnimationsModule, NoopAnimationsModule, AnimationRenderer as ɵAnimationRenderer, AnimationRendererFactory as ɵAnimationRendererFactory, BrowserAnimationBuilder as ɵBrowserAnimationBuilder, BrowserAnimationFactory as ɵBrowserAnimationFactory, InjectableAnimationEngine as ɵInjectableAnimationEngine, instantiateSupportedAnimationDriver as ɵangular_packages_platform_browser_animations_animations_a, instantiateDefaultStyleNormalizer as ɵangular_packages_platform_browser_animations_animations_b, instantiateRendererFactory as ɵangular_packages_platform_browser_animations_animations_c, BROWSER_ANIMATIONS_PROVIDERS as ɵangular_packages_platform_browser_animations_animations_d, BROWSER_NOOP_ANIMATIONS_PROVIDERS as ɵangular_packages_platform_browser_animations_animations_e, BaseAnimationRenderer as ɵangular_packages_platform_browser_animations_animations_f };\n\n//# sourceMappingURL=animations.js.map","import { mergeMap } from './mergeMap';\nexport function concatMap(project, resultSelector) {\n return mergeMap(project, resultSelector, 1);\n}\n//# sourceMappingURL=concatMap.js.map","import { isFunction } from './util/isFunction';\nimport { empty as emptyObserver } from './Observer';\nimport { Subscription } from './Subscription';\nimport { rxSubscriber as rxSubscriberSymbol } from '../internal/symbol/rxSubscriber';\nimport { config } from './config';\nimport { hostReportError } from './util/hostReportError';\nexport class Subscriber extends Subscription {\n constructor(destinationOrNext, error, complete) {\n super();\n this.syncErrorValue = null;\n this.syncErrorThrown = false;\n this.syncErrorThrowable = false;\n this.isStopped = false;\n switch (arguments.length) {\n case 0:\n this.destination = emptyObserver;\n break;\n case 1:\n if (!destinationOrNext) {\n this.destination = emptyObserver;\n break;\n }\n if (typeof destinationOrNext === 'object') {\n if (destinationOrNext instanceof Subscriber) {\n this.syncErrorThrowable = destinationOrNext.syncErrorThrowable;\n this.destination = destinationOrNext;\n destinationOrNext.add(this);\n }\n else {\n this.syncErrorThrowable = true;\n this.destination = new SafeSubscriber(this, destinationOrNext);\n }\n break;\n }\n default:\n this.syncErrorThrowable = true;\n this.destination = new SafeSubscriber(this, destinationOrNext, error, complete);\n break;\n }\n }\n [rxSubscriberSymbol]() { return this; }\n static create(next, error, complete) {\n const subscriber = new Subscriber(next, error, complete);\n subscriber.syncErrorThrowable = false;\n return subscriber;\n }\n next(value) {\n if (!this.isStopped) {\n this._next(value);\n }\n }\n error(err) {\n if (!this.isStopped) {\n this.isStopped = true;\n this._error(err);\n }\n }\n complete() {\n if (!this.isStopped) {\n this.isStopped = true;\n this._complete();\n }\n }\n unsubscribe() {\n if (this.closed) {\n return;\n }\n this.isStopped = true;\n super.unsubscribe();\n }\n _next(value) {\n this.destination.next(value);\n }\n _error(err) {\n this.destination.error(err);\n this.unsubscribe();\n }\n _complete() {\n this.destination.complete();\n this.unsubscribe();\n }\n _unsubscribeAndRecycle() {\n const { _parentOrParents } = this;\n this._parentOrParents = null;\n this.unsubscribe();\n this.closed = false;\n this.isStopped = false;\n this._parentOrParents = _parentOrParents;\n return this;\n }\n}\nexport class SafeSubscriber extends Subscriber {\n constructor(_parentSubscriber, observerOrNext, error, complete) {\n super();\n this._parentSubscriber = _parentSubscriber;\n let next;\n let context = this;\n if (isFunction(observerOrNext)) {\n next = observerOrNext;\n }\n else if (observerOrNext) {\n next = observerOrNext.next;\n error = observerOrNext.error;\n complete = observerOrNext.complete;\n if (observerOrNext !== emptyObserver) {\n context = Object.create(observerOrNext);\n if (isFunction(context.unsubscribe)) {\n this.add(context.unsubscribe.bind(context));\n }\n context.unsubscribe = this.unsubscribe.bind(this);\n }\n }\n this._context = context;\n this._next = next;\n this._error = error;\n this._complete = complete;\n }\n next(value) {\n if (!this.isStopped && this._next) {\n const { _parentSubscriber } = this;\n if (!config.useDeprecatedSynchronousErrorHandling || !_parentSubscriber.syncErrorThrowable) {\n this.__tryOrUnsub(this._next, value);\n }\n else if (this.__tryOrSetError(_parentSubscriber, this._next, value)) {\n this.unsubscribe();\n }\n }\n }\n error(err) {\n if (!this.isStopped) {\n const { _parentSubscriber } = this;\n const { useDeprecatedSynchronousErrorHandling } = config;\n if (this._error) {\n if (!useDeprecatedSynchronousErrorHandling || !_parentSubscriber.syncErrorThrowable) {\n this.__tryOrUnsub(this._error, err);\n this.unsubscribe();\n }\n else {\n this.__tryOrSetError(_parentSubscriber, this._error, err);\n this.unsubscribe();\n }\n }\n else if (!_parentSubscriber.syncErrorThrowable) {\n this.unsubscribe();\n if (useDeprecatedSynchronousErrorHandling) {\n throw err;\n }\n hostReportError(err);\n }\n else {\n if (useDeprecatedSynchronousErrorHandling) {\n _parentSubscriber.syncErrorValue = err;\n _parentSubscriber.syncErrorThrown = true;\n }\n else {\n hostReportError(err);\n }\n this.unsubscribe();\n }\n }\n }\n complete() {\n if (!this.isStopped) {\n const { _parentSubscriber } = this;\n if (this._complete) {\n const wrappedComplete = () => this._complete.call(this._context);\n if (!config.useDeprecatedSynchronousErrorHandling || !_parentSubscriber.syncErrorThrowable) {\n this.__tryOrUnsub(wrappedComplete);\n this.unsubscribe();\n }\n else {\n this.__tryOrSetError(_parentSubscriber, wrappedComplete);\n this.unsubscribe();\n }\n }\n else {\n this.unsubscribe();\n }\n }\n }\n __tryOrUnsub(fn, value) {\n try {\n fn.call(this._context, value);\n }\n catch (err) {\n this.unsubscribe();\n if (config.useDeprecatedSynchronousErrorHandling) {\n throw err;\n }\n else {\n hostReportError(err);\n }\n }\n }\n __tryOrSetError(parent, fn, value) {\n if (!config.useDeprecatedSynchronousErrorHandling) {\n throw new Error('bad call');\n }\n try {\n fn.call(this._context, value);\n }\n catch (err) {\n if (config.useDeprecatedSynchronousErrorHandling) {\n parent.syncErrorValue = err;\n parent.syncErrorThrown = true;\n return true;\n }\n else {\n hostReportError(err);\n return true;\n }\n }\n return false;\n }\n _unsubscribe() {\n const { _parentSubscriber } = this;\n this._context = null;\n this._parentSubscriber = null;\n _parentSubscriber.unsubscribe();\n }\n}\n//# sourceMappingURL=Subscriber.js.map","export default function _iterableToArray(iter) {\n if (typeof Symbol !== \"undefined\" && Symbol.iterator in Object(iter)) return Array.from(iter);\n}","import { Observable } from '../Observable';\nexport const EMPTY = new Observable(subscriber => subscriber.complete());\nexport function empty(scheduler) {\n return scheduler ? emptyScheduled(scheduler) : EMPTY;\n}\nfunction emptyScheduled(scheduler) {\n return new Observable(subscriber => scheduler.schedule(() => subscriber.complete()));\n}\n//# sourceMappingURL=empty.js.map","import { Subscriber } from '../Subscriber';\nexport function refCount() {\n return function refCountOperatorFunction(source) {\n return source.lift(new RefCountOperator(source));\n };\n}\nclass RefCountOperator {\n constructor(connectable) {\n this.connectable = connectable;\n }\n call(subscriber, source) {\n const { connectable } = this;\n connectable._refCount++;\n const refCounter = new RefCountSubscriber(subscriber, connectable);\n const subscription = source.subscribe(refCounter);\n if (!refCounter.closed) {\n refCounter.connection = connectable.connect();\n }\n return subscription;\n }\n}\nclass RefCountSubscriber extends Subscriber {\n constructor(destination, connectable) {\n super(destination);\n this.connectable = connectable;\n }\n _unsubscribe() {\n const { connectable } = this;\n if (!connectable) {\n this.connection = null;\n return;\n }\n this.connectable = null;\n const refCount = connectable._refCount;\n if (refCount <= 0) {\n this.connection = null;\n return;\n }\n connectable._refCount = refCount - 1;\n if (refCount > 1) {\n this.connection = null;\n return;\n }\n const { connection } = this;\n const sharedConnection = connectable._connection;\n this.connection = null;\n if (sharedConnection && (!connection || sharedConnection === connection)) {\n sharedConnection.unsubscribe();\n }\n }\n}\n//# sourceMappingURL=refCount.js.map","import { SubjectSubscriber } from '../Subject';\nimport { Observable } from '../Observable';\nimport { Subscriber } from '../Subscriber';\nimport { Subscription } from '../Subscription';\nimport { refCount as higherOrderRefCount } from '../operators/refCount';\nexport class ConnectableObservable extends Observable {\n constructor(source, subjectFactory) {\n super();\n this.source = source;\n this.subjectFactory = subjectFactory;\n this._refCount = 0;\n this._isComplete = false;\n }\n _subscribe(subscriber) {\n return this.getSubject().subscribe(subscriber);\n }\n getSubject() {\n const subject = this._subject;\n if (!subject || subject.isStopped) {\n this._subject = this.subjectFactory();\n }\n return this._subject;\n }\n connect() {\n let connection = this._connection;\n if (!connection) {\n this._isComplete = false;\n connection = this._connection = new Subscription();\n connection.add(this.source\n .subscribe(new ConnectableSubscriber(this.getSubject(), this)));\n if (connection.closed) {\n this._connection = null;\n connection = Subscription.EMPTY;\n }\n }\n return connection;\n }\n refCount() {\n return higherOrderRefCount()(this);\n }\n}\nexport const connectableObservableDescriptor = (() => {\n const connectableProto = ConnectableObservable.prototype;\n return {\n operator: { value: null },\n _refCount: { value: 0, writable: true },\n _subject: { value: null, writable: true },\n _connection: { value: null, writable: true },\n _subscribe: { value: connectableProto._subscribe },\n _isComplete: { value: connectableProto._isComplete, writable: true },\n getSubject: { value: connectableProto.getSubject },\n connect: { value: connectableProto.connect },\n refCount: { value: connectableProto.refCount }\n };\n})();\nclass ConnectableSubscriber extends SubjectSubscriber {\n constructor(destination, connectable) {\n super(destination);\n this.connectable = connectable;\n }\n _error(err) {\n this._unsubscribe();\n super._error(err);\n }\n _complete() {\n this.connectable._isComplete = true;\n this._unsubscribe();\n super._complete();\n }\n _unsubscribe() {\n const connectable = this.connectable;\n if (connectable) {\n this.connectable = null;\n const connection = connectable._connection;\n connectable._refCount = 0;\n connectable._subject = null;\n connectable._connection = null;\n if (connection) {\n connection.unsubscribe();\n }\n }\n }\n}\nclass RefCountOperator {\n constructor(connectable) {\n this.connectable = connectable;\n }\n call(subscriber, source) {\n const { connectable } = this;\n connectable._refCount++;\n const refCounter = new RefCountSubscriber(subscriber, connectable);\n const subscription = source.subscribe(refCounter);\n if (!refCounter.closed) {\n refCounter.connection = connectable.connect();\n }\n return subscription;\n }\n}\nclass RefCountSubscriber extends Subscriber {\n constructor(destination, connectable) {\n super(destination);\n this.connectable = connectable;\n }\n _unsubscribe() {\n const { connectable } = this;\n if (!connectable) {\n this.connection = null;\n return;\n }\n this.connectable = null;\n const refCount = connectable._refCount;\n if (refCount <= 0) {\n this.connection = null;\n return;\n }\n connectable._refCount = refCount - 1;\n if (refCount > 1) {\n this.connection = null;\n return;\n }\n const { connection } = this;\n const sharedConnection = connectable._connection;\n this.connection = null;\n if (sharedConnection && (!connection || sharedConnection === connection)) {\n sharedConnection.unsubscribe();\n }\n }\n}\n//# sourceMappingURL=ConnectableObservable.js.map","import { multicast } from './multicast';\nimport { refCount } from './refCount';\nimport { Subject } from '../Subject';\nfunction shareSubjectFactory() {\n return new Subject();\n}\nexport function share() {\n return (source) => refCount()(multicast(shareSubjectFactory)(source));\n}\n//# sourceMappingURL=share.js.map","import { connectableObservableDescriptor } from '../observable/ConnectableObservable';\nexport function multicast(subjectOrSubjectFactory, selector) {\n return function multicastOperatorFunction(source) {\n let subjectFactory;\n if (typeof subjectOrSubjectFactory === 'function') {\n subjectFactory = subjectOrSubjectFactory;\n }\n else {\n subjectFactory = function subjectFactory() {\n return subjectOrSubjectFactory;\n };\n }\n if (typeof selector === 'function') {\n return source.lift(new MulticastOperator(subjectFactory, selector));\n }\n const connectable = Object.create(source, connectableObservableDescriptor);\n connectable.source = source;\n connectable.subjectFactory = subjectFactory;\n return connectable;\n };\n}\nexport class MulticastOperator {\n constructor(subjectFactory, selector) {\n this.subjectFactory = subjectFactory;\n this.selector = selector;\n }\n call(subscriber, source) {\n const { selector } = this;\n const subject = this.subjectFactory();\n const subscription = selector(subject).subscribe(subscriber);\n subscription.add(source.subscribe(subject));\n return subscription;\n }\n}\n//# sourceMappingURL=multicast.js.map","import setPrototypeOf from \"./setPrototypeOf\";\nexport default function _inherits(subClass, superClass) {\n if (typeof superClass !== \"function\" && superClass !== null) {\n throw new TypeError(\"Super expression must either be null or a function\");\n }\n\n subClass.prototype = Object.create(superClass && superClass.prototype, {\n constructor: {\n value: subClass,\n writable: true,\n configurable: true\n }\n });\n if (superClass) setPrototypeOf(subClass, superClass);\n}","'use strict';\n\n/* eslint no-invalid-this: 1 */\n\nvar ERROR_MESSAGE = 'Function.prototype.bind called on incompatible ';\nvar slice = Array.prototype.slice;\nvar toStr = Object.prototype.toString;\nvar funcType = '[object Function]';\n\nmodule.exports = function bind(that) {\n var target = this;\n if (typeof target !== 'function' || toStr.call(target) !== funcType) {\n throw new TypeError(ERROR_MESSAGE + target);\n }\n var args = slice.call(arguments, 1);\n\n var bound;\n var binder = function () {\n if (this instanceof bound) {\n var result = target.apply(\n this,\n args.concat(slice.call(arguments))\n );\n if (Object(result) === result) {\n return result;\n }\n return this;\n } else {\n return target.apply(\n that,\n args.concat(slice.call(arguments))\n );\n }\n };\n\n var boundLength = Math.max(0, target.length - args.length);\n var boundArgs = [];\n for (var i = 0; i < boundLength; i++) {\n boundArgs.push('$' + i);\n }\n\n bound = Function('binder', 'return function (' + boundArgs.join(',') + '){ return binder.apply(this,arguments); }')(binder);\n\n if (target.prototype) {\n var Empty = function Empty() {};\n Empty.prototype = target.prototype;\n bound.prototype = new Empty();\n Empty.prototype = null;\n }\n\n return bound;\n};\n","export function noop() { }\n//# sourceMappingURL=noop.js.map","import { Subscriber } from '../Subscriber';\nimport { noop } from '../util/noop';\nimport { isFunction } from '../util/isFunction';\nexport function tap(nextOrObserver, error, complete) {\n return function tapOperatorFunction(source) {\n return source.lift(new DoOperator(nextOrObserver, error, complete));\n };\n}\nclass DoOperator {\n constructor(nextOrObserver, error, complete) {\n this.nextOrObserver = nextOrObserver;\n this.error = error;\n this.complete = complete;\n }\n call(subscriber, source) {\n return source.subscribe(new TapSubscriber(subscriber, this.nextOrObserver, this.error, this.complete));\n }\n}\nclass TapSubscriber extends Subscriber {\n constructor(destination, observerOrNext, error, complete) {\n super(destination);\n this._tapNext = noop;\n this._tapError = noop;\n this._tapComplete = noop;\n this._tapError = error || noop;\n this._tapComplete = complete || noop;\n if (isFunction(observerOrNext)) {\n this._context = this;\n this._tapNext = observerOrNext;\n }\n else if (observerOrNext) {\n this._context = observerOrNext;\n this._tapNext = observerOrNext.next || noop;\n this._tapError = observerOrNext.error || noop;\n this._tapComplete = observerOrNext.complete || noop;\n }\n }\n _next(value) {\n try {\n this._tapNext.call(this._context, value);\n }\n catch (err) {\n this.destination.error(err);\n return;\n }\n this.destination.next(value);\n }\n _error(err) {\n try {\n this._tapError.call(this._context, err);\n }\n catch (err) {\n this.destination.error(err);\n return;\n }\n this.destination.error(err);\n }\n _complete() {\n try {\n this._tapComplete.call(this._context);\n }\n catch (err) {\n this.destination.error(err);\n return;\n }\n return this.destination.complete();\n }\n}\n//# sourceMappingURL=tap.js.map","export default function _classCallCheck(instance, Constructor) {\n if (!(instance instanceof Constructor)) {\n throw new TypeError(\"Cannot call a class as a function\");\n }\n}","'use strict';\n\nvar numberIsNaN = function (value) {\n\treturn value !== value;\n};\n\nmodule.exports = function is(a, b) {\n\tif (a === 0 && b === 0) {\n\t\treturn 1 / a === 1 / b;\n\t}\n\tif (a === b) {\n\t\treturn true;\n\t}\n\tif (numberIsNaN(a) && numberIsNaN(b)) {\n\t\treturn true;\n\t}\n\treturn false;\n};\n\n","export default function _typeof(obj) {\n \"@babel/helpers - typeof\";\n\n if (typeof Symbol === \"function\" && typeof Symbol.iterator === \"symbol\") {\n _typeof = function _typeof(obj) {\n return typeof obj;\n };\n } else {\n _typeof = function _typeof(obj) {\n return obj && typeof Symbol === \"function\" && obj.constructor === Symbol && obj !== Symbol.prototype ? \"symbol\" : typeof obj;\n };\n }\n\n return _typeof(obj);\n}","import _typeof from \"../../helpers/esm/typeof\";\nimport assertThisInitialized from \"./assertThisInitialized\";\nexport default function _possibleConstructorReturn(self, call) {\n if (call && (_typeof(call) === \"object\" || typeof call === \"function\")) {\n return call;\n }\n\n return assertThisInitialized(self);\n}","import getPrototypeOf from \"./getPrototypeOf\";\nimport isNativeReflectConstruct from \"./isNativeReflectConstruct\";\nimport possibleConstructorReturn from \"./possibleConstructorReturn\";\nexport default function _createSuper(Derived) {\n var hasNativeReflectConstruct = isNativeReflectConstruct();\n return function _createSuperInternal() {\n var Super = getPrototypeOf(Derived),\n result;\n\n if (hasNativeReflectConstruct) {\n var NewTarget = getPrototypeOf(this).constructor;\n result = Reflect.construct(Super, arguments, NewTarget);\n } else {\n result = Super.apply(this, arguments);\n }\n\n return possibleConstructorReturn(this, result);\n };\n}","/*!\n * Unipointer v2.3.0\n * base class for doing one thing with pointer event\n * MIT license\n */\n\n/*jshint browser: true, undef: true, unused: true, strict: true */\n\n( function( window, factory ) {\n // universal module definition\n /* jshint strict: false */ /*global define, module, require */\n if ( typeof define == 'function' && define.amd ) {\n // AMD\n define( [\n 'ev-emitter/ev-emitter'\n ], function( EvEmitter ) {\n return factory( window, EvEmitter );\n });\n } else if ( typeof module == 'object' && module.exports ) {\n // CommonJS\n module.exports = factory(\n window,\n require('ev-emitter')\n );\n } else {\n // browser global\n window.Unipointer = factory(\n window,\n window.EvEmitter\n );\n }\n\n}( window, function factory( window, EvEmitter ) {\n\n'use strict';\n\nfunction noop() {}\n\nfunction Unipointer() {}\n\n// inherit EvEmitter\nvar proto = Unipointer.prototype = Object.create( EvEmitter.prototype );\n\nproto.bindStartEvent = function( elem ) {\n this._bindStartEvent( elem, true );\n};\n\nproto.unbindStartEvent = function( elem ) {\n this._bindStartEvent( elem, false );\n};\n\n/**\n * Add or remove start event\n * @param {Boolean} isAdd - remove if falsey\n */\nproto._bindStartEvent = function( elem, isAdd ) {\n // munge isAdd, default to true\n isAdd = isAdd === undefined ? true : isAdd;\n var bindMethod = isAdd ? 'addEventListener' : 'removeEventListener';\n\n // default to mouse events\n var startEvent = 'mousedown';\n if ( window.PointerEvent ) {\n // Pointer Events\n startEvent = 'pointerdown';\n } else if ( 'ontouchstart' in window ) {\n // Touch Events. iOS Safari\n startEvent = 'touchstart';\n }\n elem[ bindMethod ]( startEvent, this );\n};\n\n// trigger handler methods for events\nproto.handleEvent = function( event ) {\n var method = 'on' + event.type;\n if ( this[ method ] ) {\n this[ method ]( event );\n }\n};\n\n// returns the touch that we're keeping track of\nproto.getTouch = function( touches ) {\n for ( var i=0; i < touches.length; i++ ) {\n var touch = touches[i];\n if ( touch.identifier == this.pointerIdentifier ) {\n return touch;\n }\n }\n};\n\n// ----- start event ----- //\n\nproto.onmousedown = function( event ) {\n // dismiss clicks from right or middle buttons\n var button = event.button;\n if ( button && ( button !== 0 && button !== 1 ) ) {\n return;\n }\n this._pointerDown( event, event );\n};\n\nproto.ontouchstart = function( event ) {\n this._pointerDown( event, event.changedTouches[0] );\n};\n\nproto.onpointerdown = function( event ) {\n this._pointerDown( event, event );\n};\n\n/**\n * pointer start\n * @param {Event} event\n * @param {Event or Touch} pointer\n */\nproto._pointerDown = function( event, pointer ) {\n // dismiss right click and other pointers\n // button = 0 is okay, 1-4 not\n if ( event.button || this.isPointerDown ) {\n return;\n }\n\n this.isPointerDown = true;\n // save pointer identifier to match up touch events\n this.pointerIdentifier = pointer.pointerId !== undefined ?\n // pointerId for pointer events, touch.indentifier for touch events\n pointer.pointerId : pointer.identifier;\n\n this.pointerDown( event, pointer );\n};\n\nproto.pointerDown = function( event, pointer ) {\n this._bindPostStartEvents( event );\n this.emitEvent( 'pointerDown', [ event, pointer ] );\n};\n\n// hash of events to be bound after start event\nvar postStartEvents = {\n mousedown: [ 'mousemove', 'mouseup' ],\n touchstart: [ 'touchmove', 'touchend', 'touchcancel' ],\n pointerdown: [ 'pointermove', 'pointerup', 'pointercancel' ],\n};\n\nproto._bindPostStartEvents = function( event ) {\n if ( !event ) {\n return;\n }\n // get proper events to match start event\n var events = postStartEvents[ event.type ];\n // bind events to node\n events.forEach( function( eventName ) {\n window.addEventListener( eventName, this );\n }, this );\n // save these arguments\n this._boundPointerEvents = events;\n};\n\nproto._unbindPostStartEvents = function() {\n // check for _boundEvents, in case dragEnd triggered twice (old IE8 bug)\n if ( !this._boundPointerEvents ) {\n return;\n }\n this._boundPointerEvents.forEach( function( eventName ) {\n window.removeEventListener( eventName, this );\n }, this );\n\n delete this._boundPointerEvents;\n};\n\n// ----- move event ----- //\n\nproto.onmousemove = function( event ) {\n this._pointerMove( event, event );\n};\n\nproto.onpointermove = function( event ) {\n if ( event.pointerId == this.pointerIdentifier ) {\n this._pointerMove( event, event );\n }\n};\n\nproto.ontouchmove = function( event ) {\n var touch = this.getTouch( event.changedTouches );\n if ( touch ) {\n this._pointerMove( event, touch );\n }\n};\n\n/**\n * pointer move\n * @param {Event} event\n * @param {Event or Touch} pointer\n * @private\n */\nproto._pointerMove = function( event, pointer ) {\n this.pointerMove( event, pointer );\n};\n\n// public\nproto.pointerMove = function( event, pointer ) {\n this.emitEvent( 'pointerMove', [ event, pointer ] );\n};\n\n// ----- end event ----- //\n\n\nproto.onmouseup = function( event ) {\n this._pointerUp( event, event );\n};\n\nproto.onpointerup = function( event ) {\n if ( event.pointerId == this.pointerIdentifier ) {\n this._pointerUp( event, event );\n }\n};\n\nproto.ontouchend = function( event ) {\n var touch = this.getTouch( event.changedTouches );\n if ( touch ) {\n this._pointerUp( event, touch );\n }\n};\n\n/**\n * pointer up\n * @param {Event} event\n * @param {Event or Touch} pointer\n * @private\n */\nproto._pointerUp = function( event, pointer ) {\n this._pointerDone();\n this.pointerUp( event, pointer );\n};\n\n// public\nproto.pointerUp = function( event, pointer ) {\n this.emitEvent( 'pointerUp', [ event, pointer ] );\n};\n\n// ----- pointer done ----- //\n\n// triggered on pointer up & pointer cancel\nproto._pointerDone = function() {\n this._pointerReset();\n this._unbindPostStartEvents();\n this.pointerDone();\n};\n\nproto._pointerReset = function() {\n // reset properties\n this.isPointerDown = false;\n delete this.pointerIdentifier;\n};\n\nproto.pointerDone = noop;\n\n// ----- pointer cancel ----- //\n\nproto.onpointercancel = function( event ) {\n if ( event.pointerId == this.pointerIdentifier ) {\n this._pointerCancel( event, event );\n }\n};\n\nproto.ontouchcancel = function( event ) {\n var touch = this.getTouch( event.changedTouches );\n if ( touch ) {\n this._pointerCancel( event, touch );\n }\n};\n\n/**\n * pointer cancel\n * @param {Event} event\n * @param {Event or Touch} pointer\n * @private\n */\nproto._pointerCancel = function( event, pointer ) {\n this._pointerDone();\n this.pointerCancel( event, pointer );\n};\n\n// public\nproto.pointerCancel = function( event, pointer ) {\n this.emitEvent( 'pointerCancel', [ event, pointer ] );\n};\n\n// ----- ----- //\n\n// utility function for getting x/y coords from event\nUnipointer.getPointerPoint = function( pointer ) {\n return {\n x: pointer.pageX,\n y: pointer.pageY\n };\n};\n\n// ----- ----- //\n\nreturn Unipointer;\n\n}));\n","/*!\n * Unidragger v2.3.1\n * Draggable base class\n * MIT license\n */\n\n/*jshint browser: true, unused: true, undef: true, strict: true */\n\n( function( window, factory ) {\n // universal module definition\n /*jshint strict: false */ /*globals define, module, require */\n\n if ( typeof define == 'function' && define.amd ) {\n // AMD\n define( [\n 'unipointer/unipointer'\n ], function( Unipointer ) {\n return factory( window, Unipointer );\n });\n } else if ( typeof module == 'object' && module.exports ) {\n // CommonJS\n module.exports = factory(\n window,\n require('unipointer')\n );\n } else {\n // browser global\n window.Unidragger = factory(\n window,\n window.Unipointer\n );\n }\n\n}( window, function factory( window, Unipointer ) {\n\n'use strict';\n\n// -------------------------- Unidragger -------------------------- //\n\nfunction Unidragger() {}\n\n// inherit Unipointer & EvEmitter\nvar proto = Unidragger.prototype = Object.create( Unipointer.prototype );\n\n// ----- bind start ----- //\n\nproto.bindHandles = function() {\n this._bindHandles( true );\n};\n\nproto.unbindHandles = function() {\n this._bindHandles( false );\n};\n\n/**\n * Add or remove start event\n * @param {Boolean} isAdd\n */\nproto._bindHandles = function( isAdd ) {\n // munge isAdd, default to true\n isAdd = isAdd === undefined ? true : isAdd;\n // bind each handle\n var bindMethod = isAdd ? 'addEventListener' : 'removeEventListener';\n var touchAction = isAdd ? this._touchActionValue : '';\n for ( var i=0; i < this.handles.length; i++ ) {\n var handle = this.handles[i];\n this._bindStartEvent( handle, isAdd );\n handle[ bindMethod ]( 'click', this );\n // touch-action: none to override browser touch gestures. metafizzy/flickity#540\n if ( window.PointerEvent ) {\n handle.style.touchAction = touchAction;\n }\n }\n};\n\n// prototype so it can be overwriteable by Flickity\nproto._touchActionValue = 'none';\n\n// ----- start event ----- //\n\n/**\n * pointer start\n * @param {Event} event\n * @param {Event or Touch} pointer\n */\nproto.pointerDown = function( event, pointer ) {\n var isOkay = this.okayPointerDown( event );\n if ( !isOkay ) {\n return;\n }\n // track start event position\n // Safari 9 overrides pageX and pageY. These values needs to be copied. flickity#842\n this.pointerDownPointer = {\n pageX: pointer.pageX,\n pageY: pointer.pageY,\n };\n\n event.preventDefault();\n this.pointerDownBlur();\n // bind move and end events\n this._bindPostStartEvents( event );\n this.emitEvent( 'pointerDown', [ event, pointer ] );\n};\n\n// nodes that have text fields\nvar cursorNodes = {\n TEXTAREA: true,\n INPUT: true,\n SELECT: true,\n OPTION: true,\n};\n\n// input types that do not have text fields\nvar clickTypes = {\n radio: true,\n checkbox: true,\n button: true,\n submit: true,\n image: true,\n file: true,\n};\n\n// dismiss inputs with text fields. flickity#403, flickity#404\nproto.okayPointerDown = function( event ) {\n var isCursorNode = cursorNodes[ event.target.nodeName ];\n var isClickType = clickTypes[ event.target.type ];\n var isOkay = !isCursorNode || isClickType;\n if ( !isOkay ) {\n this._pointerReset();\n }\n return isOkay;\n};\n\n// kludge to blur previously focused input\nproto.pointerDownBlur = function() {\n var focused = document.activeElement;\n // do not blur body for IE10, metafizzy/flickity#117\n var canBlur = focused && focused.blur && focused != document.body;\n if ( canBlur ) {\n focused.blur();\n }\n};\n\n// ----- move event ----- //\n\n/**\n * drag move\n * @param {Event} event\n * @param {Event or Touch} pointer\n */\nproto.pointerMove = function( event, pointer ) {\n var moveVector = this._dragPointerMove( event, pointer );\n this.emitEvent( 'pointerMove', [ event, pointer, moveVector ] );\n this._dragMove( event, pointer, moveVector );\n};\n\n// base pointer move logic\nproto._dragPointerMove = function( event, pointer ) {\n var moveVector = {\n x: pointer.pageX - this.pointerDownPointer.pageX,\n y: pointer.pageY - this.pointerDownPointer.pageY\n };\n // start drag if pointer has moved far enough to start drag\n if ( !this.isDragging && this.hasDragStarted( moveVector ) ) {\n this._dragStart( event, pointer );\n }\n return moveVector;\n};\n\n// condition if pointer has moved far enough to start drag\nproto.hasDragStarted = function( moveVector ) {\n return Math.abs( moveVector.x ) > 3 || Math.abs( moveVector.y ) > 3;\n};\n\n// ----- end event ----- //\n\n/**\n * pointer up\n * @param {Event} event\n * @param {Event or Touch} pointer\n */\nproto.pointerUp = function( event, pointer ) {\n this.emitEvent( 'pointerUp', [ event, pointer ] );\n this._dragPointerUp( event, pointer );\n};\n\nproto._dragPointerUp = function( event, pointer ) {\n if ( this.isDragging ) {\n this._dragEnd( event, pointer );\n } else {\n // pointer didn't move enough for drag to start\n this._staticClick( event, pointer );\n }\n};\n\n// -------------------------- drag -------------------------- //\n\n// dragStart\nproto._dragStart = function( event, pointer ) {\n this.isDragging = true;\n // prevent clicks\n this.isPreventingClicks = true;\n this.dragStart( event, pointer );\n};\n\nproto.dragStart = function( event, pointer ) {\n this.emitEvent( 'dragStart', [ event, pointer ] );\n};\n\n// dragMove\nproto._dragMove = function( event, pointer, moveVector ) {\n // do not drag if not dragging yet\n if ( !this.isDragging ) {\n return;\n }\n\n this.dragMove( event, pointer, moveVector );\n};\n\nproto.dragMove = function( event, pointer, moveVector ) {\n event.preventDefault();\n this.emitEvent( 'dragMove', [ event, pointer, moveVector ] );\n};\n\n// dragEnd\nproto._dragEnd = function( event, pointer ) {\n // set flags\n this.isDragging = false;\n // re-enable clicking async\n setTimeout( function() {\n delete this.isPreventingClicks;\n }.bind( this ) );\n\n this.dragEnd( event, pointer );\n};\n\nproto.dragEnd = function( event, pointer ) {\n this.emitEvent( 'dragEnd', [ event, pointer ] );\n};\n\n// ----- onclick ----- //\n\n// handle all clicks and prevent clicks when dragging\nproto.onclick = function( event ) {\n if ( this.isPreventingClicks ) {\n event.preventDefault();\n }\n};\n\n// ----- staticClick ----- //\n\n// triggered after pointer down & up with no/tiny movement\nproto._staticClick = function( event, pointer ) {\n // ignore emulated mouse up clicks\n if ( this.isIgnoringMouseUp && event.type == 'mouseup' ) {\n return;\n }\n\n this.staticClick( event, pointer );\n\n // set flag for emulated clicks 300ms after touchend\n if ( event.type != 'mouseup' ) {\n this.isIgnoringMouseUp = true;\n // reset flag after 300ms\n setTimeout( function() {\n delete this.isIgnoringMouseUp;\n }.bind( this ), 400 );\n }\n};\n\nproto.staticClick = function( event, pointer ) {\n this.emitEvent( 'staticClick', [ event, pointer ] );\n};\n\n// ----- utils ----- //\n\nUnidragger.getPointerPoint = Unipointer.getPointerPoint;\n\n// ----- ----- //\n\nreturn Unidragger;\n\n}));\n","import { Subject } from './Subject';\nimport { ObjectUnsubscribedError } from './util/ObjectUnsubscribedError';\nexport class BehaviorSubject extends Subject {\n constructor(_value) {\n super();\n this._value = _value;\n }\n get value() {\n return this.getValue();\n }\n _subscribe(subscriber) {\n const subscription = super._subscribe(subscriber);\n if (subscription && !subscription.closed) {\n subscriber.next(this._value);\n }\n return subscription;\n }\n getValue() {\n if (this.hasError) {\n throw this.thrownError;\n }\n else if (this.closed) {\n throw new ObjectUnsubscribedError();\n }\n else {\n return this._value;\n }\n }\n next(value) {\n super.next(this._value = value);\n }\n}\n//# sourceMappingURL=BehaviorSubject.js.map","'use strict';\n\nvar supportsDescriptors = require('define-properties').supportsDescriptors;\nvar getPolyfill = require('./polyfill');\nvar gOPD = Object.getOwnPropertyDescriptor;\nvar defineProperty = Object.defineProperty;\nvar TypeErr = TypeError;\nvar getProto = Object.getPrototypeOf;\nvar regex = /a/;\n\nmodule.exports = function shimFlags() {\n\tif (!supportsDescriptors || !getProto) {\n\t\tthrow new TypeErr('RegExp.prototype.flags requires a true ES5 environment that supports property descriptors');\n\t}\n\tvar polyfill = getPolyfill();\n\tvar proto = getProto(regex);\n\tvar descriptor = gOPD(proto, 'flags');\n\tif (!descriptor || descriptor.get !== polyfill) {\n\t\tdefineProperty(proto, 'flags', {\n\t\t\tconfigurable: true,\n\t\t\tenumerable: false,\n\t\t\tget: polyfill\n\t\t});\n\t}\n\treturn polyfill;\n};\n","/*! *****************************************************************************\r\nCopyright (c) Microsoft Corporation.\r\n\r\nPermission to use, copy, modify, and/or distribute this software for any\r\npurpose with or without fee is hereby granted.\r\n\r\nTHE SOFTWARE IS PROVIDED \"AS IS\" AND THE AUTHOR DISCLAIMS ALL WARRANTIES WITH\r\nREGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY\r\nAND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY SPECIAL, DIRECT,\r\nINDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM\r\nLOSS OF USE, DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR\r\nOTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH THE USE OR\r\nPERFORMANCE OF THIS SOFTWARE.\r\n***************************************************************************** */\r\n/* global Reflect, Promise */\r\n\r\nvar extendStatics = function(d, b) {\r\n extendStatics = Object.setPrototypeOf ||\r\n ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||\r\n function (d, b) { for (var p in b) if (Object.prototype.hasOwnProperty.call(b, p)) d[p] = b[p]; };\r\n return extendStatics(d, b);\r\n};\r\n\r\nexport function __extends(d, b) {\r\n if (typeof b !== \"function\" && b !== null)\r\n throw new TypeError(\"Class extends value \" + String(b) + \" is not a constructor or null\");\r\n extendStatics(d, b);\r\n function __() { this.constructor = d; }\r\n d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());\r\n}\r\n\r\nexport var __assign = function() {\r\n __assign = Object.assign || function __assign(t) {\r\n for (var s, i = 1, n = arguments.length; i < n; i++) {\r\n s = arguments[i];\r\n for (var p in s) if (Object.prototype.hasOwnProperty.call(s, p)) t[p] = s[p];\r\n }\r\n return t;\r\n }\r\n return __assign.apply(this, arguments);\r\n}\r\n\r\nexport function __rest(s, e) {\r\n var t = {};\r\n for (var p in s) if (Object.prototype.hasOwnProperty.call(s, p) && e.indexOf(p) < 0)\r\n t[p] = s[p];\r\n if (s != null && typeof Object.getOwnPropertySymbols === \"function\")\r\n for (var i = 0, p = Object.getOwnPropertySymbols(s); i < p.length; i++) {\r\n if (e.indexOf(p[i]) < 0 && Object.prototype.propertyIsEnumerable.call(s, p[i]))\r\n t[p[i]] = s[p[i]];\r\n }\r\n return t;\r\n}\r\n\r\nexport function __decorate(decorators, target, key, desc) {\r\n var c = arguments.length, r = c < 3 ? target : desc === null ? desc = Object.getOwnPropertyDescriptor(target, key) : desc, d;\r\n if (typeof Reflect === \"object\" && typeof Reflect.decorate === \"function\") r = Reflect.decorate(decorators, target, key, desc);\r\n else for (var i = decorators.length - 1; i >= 0; i--) if (d = decorators[i]) r = (c < 3 ? d(r) : c > 3 ? d(target, key, r) : d(target, key)) || r;\r\n return c > 3 && r && Object.defineProperty(target, key, r), r;\r\n}\r\n\r\nexport function __param(paramIndex, decorator) {\r\n return function (target, key) { decorator(target, key, paramIndex); }\r\n}\r\n\r\nexport function __metadata(metadataKey, metadataValue) {\r\n if (typeof Reflect === \"object\" && typeof Reflect.metadata === \"function\") return Reflect.metadata(metadataKey, metadataValue);\r\n}\r\n\r\nexport function __awaiter(thisArg, _arguments, P, generator) {\r\n function adopt(value) { return value instanceof P ? value : new P(function (resolve) { resolve(value); }); }\r\n return new (P || (P = Promise))(function (resolve, reject) {\r\n function fulfilled(value) { try { step(generator.next(value)); } catch (e) { reject(e); } }\r\n function rejected(value) { try { step(generator[\"throw\"](value)); } catch (e) { reject(e); } }\r\n function step(result) { result.done ? resolve(result.value) : adopt(result.value).then(fulfilled, rejected); }\r\n step((generator = generator.apply(thisArg, _arguments || [])).next());\r\n });\r\n}\r\n\r\nexport function __generator(thisArg, body) {\r\n var _ = { label: 0, sent: function() { if (t[0] & 1) throw t[1]; return t[1]; }, trys: [], ops: [] }, f, y, t, g;\r\n return g = { next: verb(0), \"throw\": verb(1), \"return\": verb(2) }, typeof Symbol === \"function\" && (g[Symbol.iterator] = function() { return this; }), g;\r\n function verb(n) { return function (v) { return step([n, v]); }; }\r\n function step(op) {\r\n if (f) throw new TypeError(\"Generator is already executing.\");\r\n while (_) try {\r\n if (f = 1, y && (t = op[0] & 2 ? y[\"return\"] : op[0] ? y[\"throw\"] || ((t = y[\"return\"]) && t.call(y), 0) : y.next) && !(t = t.call(y, op[1])).done) return t;\r\n if (y = 0, t) op = [op[0] & 2, t.value];\r\n switch (op[0]) {\r\n case 0: case 1: t = op; break;\r\n case 4: _.label++; return { value: op[1], done: false };\r\n case 5: _.label++; y = op[1]; op = [0]; continue;\r\n case 7: op = _.ops.pop(); _.trys.pop(); continue;\r\n default:\r\n if (!(t = _.trys, t = t.length > 0 && t[t.length - 1]) && (op[0] === 6 || op[0] === 2)) { _ = 0; continue; }\r\n if (op[0] === 3 && (!t || (op[1] > t[0] && op[1] < t[3]))) { _.label = op[1]; break; }\r\n if (op[0] === 6 && _.label < t[1]) { _.label = t[1]; t = op; break; }\r\n if (t && _.label < t[2]) { _.label = t[2]; _.ops.push(op); break; }\r\n if (t[2]) _.ops.pop();\r\n _.trys.pop(); continue;\r\n }\r\n op = body.call(thisArg, _);\r\n } catch (e) { op = [6, e]; y = 0; } finally { f = t = 0; }\r\n if (op[0] & 5) throw op[1]; return { value: op[0] ? op[1] : void 0, done: true };\r\n }\r\n}\r\n\r\nexport var __createBinding = Object.create ? (function(o, m, k, k2) {\r\n if (k2 === undefined) k2 = k;\r\n Object.defineProperty(o, k2, { enumerable: true, get: function() { return m[k]; } });\r\n}) : (function(o, m, k, k2) {\r\n if (k2 === undefined) k2 = k;\r\n o[k2] = m[k];\r\n});\r\n\r\nexport function __exportStar(m, o) {\r\n for (var p in m) if (p !== \"default\" && !Object.prototype.hasOwnProperty.call(o, p)) __createBinding(o, m, p);\r\n}\r\n\r\nexport function __values(o) {\r\n var s = typeof Symbol === \"function\" && Symbol.iterator, m = s && o[s], i = 0;\r\n if (m) return m.call(o);\r\n if (o && typeof o.length === \"number\") return {\r\n next: function () {\r\n if (o && i >= o.length) o = void 0;\r\n return { value: o && o[i++], done: !o };\r\n }\r\n };\r\n throw new TypeError(s ? \"Object is not iterable.\" : \"Symbol.iterator is not defined.\");\r\n}\r\n\r\nexport function __read(o, n) {\r\n var m = typeof Symbol === \"function\" && o[Symbol.iterator];\r\n if (!m) return o;\r\n var i = m.call(o), r, ar = [], e;\r\n try {\r\n while ((n === void 0 || n-- > 0) && !(r = i.next()).done) ar.push(r.value);\r\n }\r\n catch (error) { e = { error: error }; }\r\n finally {\r\n try {\r\n if (r && !r.done && (m = i[\"return\"])) m.call(i);\r\n }\r\n finally { if (e) throw e.error; }\r\n }\r\n return ar;\r\n}\r\n\r\n/** @deprecated */\r\nexport function __spread() {\r\n for (var ar = [], i = 0; i < arguments.length; i++)\r\n ar = ar.concat(__read(arguments[i]));\r\n return ar;\r\n}\r\n\r\n/** @deprecated */\r\nexport function __spreadArrays() {\r\n for (var s = 0, i = 0, il = arguments.length; i < il; i++) s += arguments[i].length;\r\n for (var r = Array(s), k = 0, i = 0; i < il; i++)\r\n for (var a = arguments[i], j = 0, jl = a.length; j < jl; j++, k++)\r\n r[k] = a[j];\r\n return r;\r\n}\r\n\r\nexport function __spreadArray(to, from) {\r\n for (var i = 0, il = from.length, j = to.length; i < il; i++, j++)\r\n to[j] = from[i];\r\n return to;\r\n}\r\n\r\nexport function __await(v) {\r\n return this instanceof __await ? (this.v = v, this) : new __await(v);\r\n}\r\n\r\nexport function __asyncGenerator(thisArg, _arguments, generator) {\r\n if (!Symbol.asyncIterator) throw new TypeError(\"Symbol.asyncIterator is not defined.\");\r\n var g = generator.apply(thisArg, _arguments || []), i, q = [];\r\n return i = {}, verb(\"next\"), verb(\"throw\"), verb(\"return\"), i[Symbol.asyncIterator] = function () { return this; }, i;\r\n function verb(n) { if (g[n]) i[n] = function (v) { return new Promise(function (a, b) { q.push([n, v, a, b]) > 1 || resume(n, v); }); }; }\r\n function resume(n, v) { try { step(g[n](v)); } catch (e) { settle(q[0][3], e); } }\r\n function step(r) { r.value instanceof __await ? Promise.resolve(r.value.v).then(fulfill, reject) : settle(q[0][2], r); }\r\n function fulfill(value) { resume(\"next\", value); }\r\n function reject(value) { resume(\"throw\", value); }\r\n function settle(f, v) { if (f(v), q.shift(), q.length) resume(q[0][0], q[0][1]); }\r\n}\r\n\r\nexport function __asyncDelegator(o) {\r\n var i, p;\r\n return i = {}, verb(\"next\"), verb(\"throw\", function (e) { throw e; }), verb(\"return\"), i[Symbol.iterator] = function () { return this; }, i;\r\n function verb(n, f) { i[n] = o[n] ? function (v) { return (p = !p) ? { value: __await(o[n](v)), done: n === \"return\" } : f ? f(v) : v; } : f; }\r\n}\r\n\r\nexport function __asyncValues(o) {\r\n if (!Symbol.asyncIterator) throw new TypeError(\"Symbol.asyncIterator is not defined.\");\r\n var m = o[Symbol.asyncIterator], i;\r\n return m ? m.call(o) : (o = typeof __values === \"function\" ? __values(o) : o[Symbol.iterator](), i = {}, verb(\"next\"), verb(\"throw\"), verb(\"return\"), i[Symbol.asyncIterator] = function () { return this; }, i);\r\n function verb(n) { i[n] = o[n] && function (v) { return new Promise(function (resolve, reject) { v = o[n](v), settle(resolve, reject, v.done, v.value); }); }; }\r\n function settle(resolve, reject, d, v) { Promise.resolve(v).then(function(v) { resolve({ value: v, done: d }); }, reject); }\r\n}\r\n\r\nexport function __makeTemplateObject(cooked, raw) {\r\n if (Object.defineProperty) { Object.defineProperty(cooked, \"raw\", { value: raw }); } else { cooked.raw = raw; }\r\n return cooked;\r\n};\r\n\r\nvar __setModuleDefault = Object.create ? (function(o, v) {\r\n Object.defineProperty(o, \"default\", { enumerable: true, value: v });\r\n}) : function(o, v) {\r\n o[\"default\"] = v;\r\n};\r\n\r\nexport function __importStar(mod) {\r\n if (mod && mod.__esModule) return mod;\r\n var result = {};\r\n if (mod != null) for (var k in mod) if (k !== \"default\" && Object.prototype.hasOwnProperty.call(mod, k)) __createBinding(result, mod, k);\r\n __setModuleDefault(result, mod);\r\n return result;\r\n}\r\n\r\nexport function __importDefault(mod) {\r\n return (mod && mod.__esModule) ? mod : { default: mod };\r\n}\r\n\r\nexport function __classPrivateFieldGet(receiver, privateMap) {\r\n if (!privateMap.has(receiver)) {\r\n throw new TypeError(\"attempted to get private field on non-instance\");\r\n }\r\n return privateMap.get(receiver);\r\n}\r\n\r\nexport function __classPrivateFieldSet(receiver, privateMap, value) {\r\n if (!privateMap.has(receiver)) {\r\n throw new TypeError(\"attempted to set private field on non-instance\");\r\n }\r\n privateMap.set(receiver, value);\r\n return value;\r\n}\r\n","export class Scheduler {\n constructor(SchedulerAction, now = Scheduler.now) {\n this.SchedulerAction = SchedulerAction;\n this.now = now;\n }\n schedule(work, delay = 0, state) {\n return new this.SchedulerAction(this, work).schedule(state, delay);\n }\n}\nScheduler.now = () => Date.now();\n//# sourceMappingURL=Scheduler.js.map","import { Scheduler } from '../Scheduler';\nexport class AsyncScheduler extends Scheduler {\n constructor(SchedulerAction, now = Scheduler.now) {\n super(SchedulerAction, () => {\n if (AsyncScheduler.delegate && AsyncScheduler.delegate !== this) {\n return AsyncScheduler.delegate.now();\n }\n else {\n return now();\n }\n });\n this.actions = [];\n this.active = false;\n this.scheduled = undefined;\n }\n schedule(work, delay = 0, state) {\n if (AsyncScheduler.delegate && AsyncScheduler.delegate !== this) {\n return AsyncScheduler.delegate.schedule(work, delay, state);\n }\n else {\n return super.schedule(work, delay, state);\n }\n }\n flush(action) {\n const { actions } = this;\n if (this.active) {\n actions.push(action);\n return;\n }\n let error;\n this.active = true;\n do {\n if (error = action.execute(action.state, action.delay)) {\n break;\n }\n } while (action = actions.shift());\n this.active = false;\n if (error) {\n while (action = actions.shift()) {\n action.unsubscribe();\n }\n throw error;\n }\n }\n}\n//# sourceMappingURL=AsyncScheduler.js.map","import setPrototypeOf from \"./setPrototypeOf\";\nimport isNativeReflectConstruct from \"./isNativeReflectConstruct\";\nexport default function _construct(Parent, args, Class) {\n if (isNativeReflectConstruct()) {\n _construct = Reflect.construct;\n } else {\n _construct = function _construct(Parent, args, Class) {\n var a = [null];\n a.push.apply(a, args);\n var Constructor = Function.bind.apply(Parent, a);\n var instance = new Constructor();\n if (Class) setPrototypeOf(instance, Class.prototype);\n return instance;\n };\n }\n\n return _construct.apply(null, arguments);\n}","import getPrototypeOf from \"./getPrototypeOf\";\nimport setPrototypeOf from \"./setPrototypeOf\";\nimport isNativeFunction from \"./isNativeFunction\";\nimport construct from \"./construct\";\nexport default function _wrapNativeSuper(Class) {\n var _cache = typeof Map === \"function\" ? new Map() : undefined;\n\n _wrapNativeSuper = function _wrapNativeSuper(Class) {\n if (Class === null || !isNativeFunction(Class)) return Class;\n\n if (typeof Class !== \"function\") {\n throw new TypeError(\"Super expression must either be null or a function\");\n }\n\n if (typeof _cache !== \"undefined\") {\n if (_cache.has(Class)) return _cache.get(Class);\n\n _cache.set(Class, Wrapper);\n }\n\n function Wrapper() {\n return construct(Class, arguments, getPrototypeOf(this).constructor);\n }\n\n Wrapper.prototype = Object.create(Class.prototype, {\n constructor: {\n value: Wrapper,\n enumerable: false,\n writable: true,\n configurable: true\n }\n });\n return setPrototypeOf(Wrapper, Class);\n };\n\n return _wrapNativeSuper(Class);\n}","export default function _isNativeFunction(fn) {\n return Function.toString.call(fn).indexOf(\"[native code]\") !== -1;\n}","/**\n * @license Angular v11.0.9\n * (c) 2010-2020 Google LLC. https://angular.io/\n * License: MIT\n */\n\nimport { Subject, Subscription, Observable, merge as merge$1 } from 'rxjs';\nimport { share } from 'rxjs/operators';\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nfunction getClosureSafeProperty(objWithPropertyToExtract) {\n for (let key in objWithPropertyToExtract) {\n if (objWithPropertyToExtract[key] === getClosureSafeProperty) {\n return key;\n }\n }\n throw Error('Could not find renamed property on target object.');\n}\n/**\n * Sets properties on a target object from a source object, but only if\n * the property doesn't already exist on the target object.\n * @param target The target to set properties on\n * @param source The source of the property keys and values to set\n */\nfunction fillProperties(target, source) {\n for (const key in source) {\n if (source.hasOwnProperty(key) && !target.hasOwnProperty(key)) {\n target[key] = source[key];\n }\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nfunction stringify(token) {\n if (typeof token === 'string') {\n return token;\n }\n if (Array.isArray(token)) {\n return '[' + token.map(stringify).join(', ') + ']';\n }\n if (token == null) {\n return '' + token;\n }\n if (token.overriddenName) {\n return `${token.overriddenName}`;\n }\n if (token.name) {\n return `${token.name}`;\n }\n const res = token.toString();\n if (res == null) {\n return '' + res;\n }\n const newLineIndex = res.indexOf('\\n');\n return newLineIndex === -1 ? res : res.substring(0, newLineIndex);\n}\n/**\n * Concatenates two strings with separator, allocating new strings only when necessary.\n *\n * @param before before string.\n * @param separator separator string.\n * @param after after string.\n * @returns concatenated string.\n */\nfunction concatStringsWithSpace(before, after) {\n return (before == null || before === '') ?\n (after === null ? '' : after) :\n ((after == null || after === '') ? before : before + ' ' + after);\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nconst __forward_ref__ = getClosureSafeProperty({ __forward_ref__: getClosureSafeProperty });\n/**\n * Allows to refer to references which are not yet defined.\n *\n * For instance, `forwardRef` is used when the `token` which we need to refer to for the purposes of\n * DI is declared, but not yet defined. It is also used when the `token` which we use when creating\n * a query is not yet defined.\n *\n * @usageNotes\n * ### Example\n * {@example core/di/ts/forward_ref/forward_ref_spec.ts region='forward_ref'}\n * @publicApi\n */\nfunction forwardRef(forwardRefFn) {\n forwardRefFn.__forward_ref__ = forwardRef;\n forwardRefFn.toString = function () {\n return stringify(this());\n };\n return forwardRefFn;\n}\n/**\n * Lazily retrieves the reference value from a forwardRef.\n *\n * Acts as the identity function when given a non-forward-ref value.\n *\n * @usageNotes\n * ### Example\n *\n * {@example core/di/ts/forward_ref/forward_ref_spec.ts region='resolve_forward_ref'}\n *\n * @see `forwardRef`\n * @publicApi\n */\nfunction resolveForwardRef(type) {\n return isForwardRef(type) ? type() : type;\n}\n/** Checks whether a function is wrapped by a `forwardRef`. */\nfunction isForwardRef(fn) {\n return typeof fn === 'function' && fn.hasOwnProperty(__forward_ref__) &&\n fn.__forward_ref__ === forwardRef;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nfunction assertNumber(actual, msg) {\n if (!(typeof actual === 'number')) {\n throwError(msg, typeof actual, 'number', '===');\n }\n}\nfunction assertNumberInRange(actual, minInclusive, maxInclusive) {\n assertNumber(actual, 'Expected a number');\n assertLessThanOrEqual(actual, maxInclusive, 'Expected number to be less than or equal to');\n assertGreaterThanOrEqual(actual, minInclusive, 'Expected number to be greater than or equal to');\n}\nfunction assertString(actual, msg) {\n if (!(typeof actual === 'string')) {\n throwError(msg, actual === null ? 'null' : typeof actual, 'string', '===');\n }\n}\nfunction assertFunction(actual, msg) {\n if (!(typeof actual === 'function')) {\n throwError(msg, actual === null ? 'null' : typeof actual, 'function', '===');\n }\n}\nfunction assertEqual(actual, expected, msg) {\n if (!(actual == expected)) {\n throwError(msg, actual, expected, '==');\n }\n}\nfunction assertNotEqual(actual, expected, msg) {\n if (!(actual != expected)) {\n throwError(msg, actual, expected, '!=');\n }\n}\nfunction assertSame(actual, expected, msg) {\n if (!(actual === expected)) {\n throwError(msg, actual, expected, '===');\n }\n}\nfunction assertNotSame(actual, expected, msg) {\n if (!(actual !== expected)) {\n throwError(msg, actual, expected, '!==');\n }\n}\nfunction assertLessThan(actual, expected, msg) {\n if (!(actual < expected)) {\n throwError(msg, actual, expected, '<');\n }\n}\nfunction assertLessThanOrEqual(actual, expected, msg) {\n if (!(actual <= expected)) {\n throwError(msg, actual, expected, '<=');\n }\n}\nfunction assertGreaterThan(actual, expected, msg) {\n if (!(actual > expected)) {\n throwError(msg, actual, expected, '>');\n }\n}\nfunction assertGreaterThanOrEqual(actual, expected, msg) {\n if (!(actual >= expected)) {\n throwError(msg, actual, expected, '>=');\n }\n}\nfunction assertNotDefined(actual, msg) {\n if (actual != null) {\n throwError(msg, actual, null, '==');\n }\n}\nfunction assertDefined(actual, msg) {\n if (actual == null) {\n throwError(msg, actual, null, '!=');\n }\n}\nfunction throwError(msg, actual, expected, comparison) {\n throw new Error(`ASSERTION ERROR: ${msg}` +\n (comparison == null ? '' : ` [Expected=> ${expected} ${comparison} ${actual} <=Actual]`));\n}\nfunction assertDomNode(node) {\n // If we're in a worker, `Node` will not be defined.\n if (!(typeof Node !== 'undefined' && node instanceof Node) &&\n !(typeof node === 'object' && node != null &&\n node.constructor.name === 'WebWorkerRenderNode')) {\n throwError(`The provided value must be an instance of a DOM Node but got ${stringify(node)}`);\n }\n}\nfunction assertIndexInRange(arr, index) {\n assertDefined(arr, 'Array must be defined.');\n const maxLen = arr.length;\n if (index < 0 || index >= maxLen) {\n throwError(`Index expected to be less than ${maxLen} but got ${index}`);\n }\n}\nfunction assertOneOf(value, ...validValues) {\n if (validValues.indexOf(value) !== -1)\n return true;\n throwError(`Expected value to be one of ${JSON.stringify(validValues)} but was ${JSON.stringify(value)}.`);\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Construct an `InjectableDef` which defines how a token will be constructed by the DI system, and\n * in which injectors (if any) it will be available.\n *\n * This should be assigned to a static `ɵprov` field on a type, which will then be an\n * `InjectableType`.\n *\n * Options:\n * * `providedIn` determines which injectors will include the injectable, by either associating it\n * with an `@NgModule` or other `InjectorType`, or by specifying that this injectable should be\n * provided in the `'root'` injector, which will be the application-level injector in most apps.\n * * `factory` gives the zero argument function which will create an instance of the injectable.\n * The factory can call `inject` to access the `Injector` and request injection of dependencies.\n *\n * @codeGenApi\n * @publicApi This instruction has been emitted by ViewEngine for some time and is deployed to npm.\n */\nfunction ɵɵdefineInjectable(opts) {\n return {\n token: opts.token,\n providedIn: opts.providedIn || null,\n factory: opts.factory,\n value: undefined,\n };\n}\n/**\n * @deprecated in v8, delete after v10. This API should be used only by generated code, and that\n * code should now use ɵɵdefineInjectable instead.\n * @publicApi\n */\nconst defineInjectable = ɵɵdefineInjectable;\n/**\n * Construct an `InjectorDef` which configures an injector.\n *\n * This should be assigned to a static injector def (`ɵinj`) field on a type, which will then be an\n * `InjectorType`.\n *\n * Options:\n *\n * * `factory`: an `InjectorType` is an instantiable type, so a zero argument `factory` function to\n * create the type must be provided. If that factory function needs to inject arguments, it can\n * use the `inject` function.\n * * `providers`: an optional array of providers to add to the injector. Each provider must\n * either have a factory or point to a type which has a `ɵprov` static property (the\n * type must be an `InjectableType`).\n * * `imports`: an optional array of imports of other `InjectorType`s or `InjectorTypeWithModule`s\n * whose providers will also be added to the injector. Locally provided types will override\n * providers from imports.\n *\n * @codeGenApi\n */\nfunction ɵɵdefineInjector(options) {\n return {\n factory: options.factory,\n providers: options.providers || [],\n imports: options.imports || [],\n };\n}\n/**\n * Read the injectable def (`ɵprov`) for `type` in a way which is immune to accidentally reading\n * inherited value.\n *\n * @param type A type which may have its own (non-inherited) `ɵprov`.\n */\nfunction getInjectableDef(type) {\n return getOwnDefinition(type, NG_PROV_DEF) || getOwnDefinition(type, NG_INJECTABLE_DEF);\n}\n/**\n * Return definition only if it is defined directly on `type` and is not inherited from a base\n * class of `type`.\n */\nfunction getOwnDefinition(type, field) {\n return type.hasOwnProperty(field) ? type[field] : null;\n}\n/**\n * Read the injectable def (`ɵprov`) for `type` or read the `ɵprov` from one of its ancestors.\n *\n * @param type A type which may have `ɵprov`, via inheritance.\n *\n * @deprecated Will be removed in a future version of Angular, where an error will occur in the\n * scenario if we find the `ɵprov` on an ancestor only.\n */\nfunction getInheritedInjectableDef(type) {\n const def = type && (type[NG_PROV_DEF] || type[NG_INJECTABLE_DEF]);\n if (def) {\n const typeName = getTypeName(type);\n // TODO(FW-1307): Re-add ngDevMode when closure can handle it\n // ngDevMode &&\n console.warn(`DEPRECATED: DI is instantiating a token \"${typeName}\" that inherits its @Injectable decorator but does not provide one itself.\\n` +\n `This will become an error in a future version of Angular. Please add @Injectable() to the \"${typeName}\" class.`);\n return def;\n }\n else {\n return null;\n }\n}\n/** Gets the name of a type, accounting for some cross-browser differences. */\nfunction getTypeName(type) {\n // `Function.prototype.name` behaves differently between IE and other browsers. In most browsers\n // it'll always return the name of the function itself, no matter how many other functions it\n // inherits from. On IE the function doesn't have its own `name` property, but it takes it from\n // the lowest level in the prototype chain. E.g. if we have `class Foo extends Parent` most\n // browsers will evaluate `Foo.name` to `Foo` while IE will return `Parent`. We work around\n // the issue by converting the function to a string and parsing its name out that way via a regex.\n if (type.hasOwnProperty('name')) {\n return type.name;\n }\n const match = ('' + type).match(/^function\\s*([^\\s(]+)/);\n return match === null ? '' : match[1];\n}\n/**\n * Read the injector def type in a way which is immune to accidentally reading inherited value.\n *\n * @param type type which may have an injector def (`ɵinj`)\n */\nfunction getInjectorDef(type) {\n return type && (type.hasOwnProperty(NG_INJ_DEF) || type.hasOwnProperty(NG_INJECTOR_DEF)) ?\n type[NG_INJ_DEF] :\n null;\n}\nconst NG_PROV_DEF = getClosureSafeProperty({ ɵprov: getClosureSafeProperty });\nconst NG_INJ_DEF = getClosureSafeProperty({ ɵinj: getClosureSafeProperty });\n// We need to keep these around so we can read off old defs if new defs are unavailable\nconst NG_INJECTABLE_DEF = getClosureSafeProperty({ ngInjectableDef: getClosureSafeProperty });\nconst NG_INJECTOR_DEF = getClosureSafeProperty({ ngInjectorDef: getClosureSafeProperty });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Injection flags for DI.\n *\n * @publicApi\n */\nvar InjectFlags;\n(function (InjectFlags) {\n // TODO(alxhub): make this 'const' when ngc no longer writes exports of it into ngfactory files.\n /** Check self and check parent injector if needed */\n InjectFlags[InjectFlags[\"Default\"] = 0] = \"Default\";\n /**\n * Specifies that an injector should retrieve a dependency from any injector until reaching the\n * host element of the current component. (Only used with Element Injector)\n */\n InjectFlags[InjectFlags[\"Host\"] = 1] = \"Host\";\n /** Don't ascend to ancestors of the node requesting injection. */\n InjectFlags[InjectFlags[\"Self\"] = 2] = \"Self\";\n /** Skip the node that is requesting injection. */\n InjectFlags[InjectFlags[\"SkipSelf\"] = 4] = \"SkipSelf\";\n /** Inject `defaultValue` instead if token not found. */\n InjectFlags[InjectFlags[\"Optional\"] = 8] = \"Optional\";\n})(InjectFlags || (InjectFlags = {}));\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Current implementation of inject.\n *\n * By default, it is `injectInjectorOnly`, which makes it `Injector`-only aware. It can be changed\n * to `directiveInject`, which brings in the `NodeInjector` system of ivy. It is designed this\n * way for two reasons:\n * 1. `Injector` should not depend on ivy logic.\n * 2. To maintain tree shake-ability we don't want to bring in unnecessary code.\n */\nlet _injectImplementation;\nfunction getInjectImplementation() {\n return _injectImplementation;\n}\n/**\n * Sets the current inject implementation.\n */\nfunction setInjectImplementation(impl) {\n const previous = _injectImplementation;\n _injectImplementation = impl;\n return previous;\n}\n/**\n * Injects `root` tokens in limp mode.\n *\n * If no injector exists, we can still inject tree-shakable providers which have `providedIn` set to\n * `\"root\"`. This is known as the limp mode injection. In such case the value is stored in the\n * `InjectableDef`.\n */\nfunction injectRootLimpMode(token, notFoundValue, flags) {\n const injectableDef = getInjectableDef(token);\n if (injectableDef && injectableDef.providedIn == 'root') {\n return injectableDef.value === undefined ? injectableDef.value = injectableDef.factory() :\n injectableDef.value;\n }\n if (flags & InjectFlags.Optional)\n return null;\n if (notFoundValue !== undefined)\n return notFoundValue;\n throw new Error(`Injector: NOT_FOUND [${stringify(token)}]`);\n}\n/**\n * Assert that `_injectImplementation` is not `fn`.\n *\n * This is useful, to prevent infinite recursion.\n *\n * @param fn Function which it should not equal to\n */\nfunction assertInjectImplementationNotEqual(fn) {\n ngDevMode &&\n assertNotEqual(_injectImplementation, fn, 'Calling ɵɵinject would cause infinite recursion');\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Convince closure compiler that the wrapped function has no side-effects.\n *\n * Closure compiler always assumes that `toString` has no side-effects. We use this quirk to\n * allow us to execute a function but have closure compiler mark the call as no-side-effects.\n * It is important that the return value for the `noSideEffects` function be assigned\n * to something which is retained otherwise the call to `noSideEffects` will be removed by closure\n * compiler.\n */\nfunction noSideEffects(fn) {\n return { toString: fn }.toString();\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * The strategy that the default change detector uses to detect changes.\n * When set, takes effect the next time change detection is triggered.\n *\n * @see {@link ChangeDetectorRef#usage-notes Change detection usage}\n *\n * @publicApi\n */\nvar ChangeDetectionStrategy;\n(function (ChangeDetectionStrategy) {\n /**\n * Use the `CheckOnce` strategy, meaning that automatic change detection is deactivated\n * until reactivated by setting the strategy to `Default` (`CheckAlways`).\n * Change detection can still be explicitly invoked.\n * This strategy applies to all child directives and cannot be overridden.\n */\n ChangeDetectionStrategy[ChangeDetectionStrategy[\"OnPush\"] = 0] = \"OnPush\";\n /**\n * Use the default `CheckAlways` strategy, in which change detection is automatic until\n * explicitly deactivated.\n */\n ChangeDetectionStrategy[ChangeDetectionStrategy[\"Default\"] = 1] = \"Default\";\n})(ChangeDetectionStrategy || (ChangeDetectionStrategy = {}));\n/**\n * Defines the possible states of the default change detector.\n * @see `ChangeDetectorRef`\n */\nvar ChangeDetectorStatus;\n(function (ChangeDetectorStatus) {\n /**\n * A state in which, after calling `detectChanges()`, the change detector\n * state becomes `Checked`, and must be explicitly invoked or reactivated.\n */\n ChangeDetectorStatus[ChangeDetectorStatus[\"CheckOnce\"] = 0] = \"CheckOnce\";\n /**\n * A state in which change detection is skipped until the change detector mode\n * becomes `CheckOnce`.\n */\n ChangeDetectorStatus[ChangeDetectorStatus[\"Checked\"] = 1] = \"Checked\";\n /**\n * A state in which change detection continues automatically until explicitly\n * deactivated.\n */\n ChangeDetectorStatus[ChangeDetectorStatus[\"CheckAlways\"] = 2] = \"CheckAlways\";\n /**\n * A state in which a change detector sub tree is not a part of the main tree and\n * should be skipped.\n */\n ChangeDetectorStatus[ChangeDetectorStatus[\"Detached\"] = 3] = \"Detached\";\n /**\n * Indicates that the change detector encountered an error checking a binding\n * or calling a directive lifecycle method and is now in an inconsistent state. Change\n * detectors in this state do not detect changes.\n */\n ChangeDetectorStatus[ChangeDetectorStatus[\"Errored\"] = 4] = \"Errored\";\n /**\n * Indicates that the change detector has been destroyed.\n */\n ChangeDetectorStatus[ChangeDetectorStatus[\"Destroyed\"] = 5] = \"Destroyed\";\n})(ChangeDetectorStatus || (ChangeDetectorStatus = {}));\n/**\n * Reports whether a given strategy is currently the default for change detection.\n * @param changeDetectionStrategy The strategy to check.\n * @returns True if the given strategy is the current default, false otherwise.\n * @see `ChangeDetectorStatus`\n * @see `ChangeDetectorRef`\n */\nfunction isDefaultChangeDetectionStrategy(changeDetectionStrategy) {\n return changeDetectionStrategy == null ||\n changeDetectionStrategy === ChangeDetectionStrategy.Default;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Defines template and style encapsulation options available for Component's {@link Component}.\n *\n * See {@link Component#encapsulation encapsulation}.\n *\n * @usageNotes\n * ### Example\n *\n * {@example core/ts/metadata/encapsulation.ts region='longform'}\n *\n * @publicApi\n */\nvar ViewEncapsulation;\n(function (ViewEncapsulation) {\n /**\n * Emulate `Native` scoping of styles by adding an attribute containing surrogate id to the Host\n * Element and pre-processing the style rules provided via {@link Component#styles styles} or\n * {@link Component#styleUrls styleUrls}, and adding the new Host Element attribute to all\n * selectors.\n *\n * This is the default option.\n */\n ViewEncapsulation[ViewEncapsulation[\"Emulated\"] = 0] = \"Emulated\";\n // Historically the 1 value was for `Native` encapsulation which has been removed as of v11.\n /**\n * Don't provide any template or style encapsulation.\n */\n ViewEncapsulation[ViewEncapsulation[\"None\"] = 2] = \"None\";\n /**\n * Use Shadow DOM to encapsulate styles.\n *\n * For the DOM this means using modern [Shadow\n * DOM](https://w3c.github.io/webcomponents/spec/shadow/) and\n * creating a ShadowRoot for Component's Host Element.\n */\n ViewEncapsulation[ViewEncapsulation[\"ShadowDom\"] = 3] = \"ShadowDom\";\n})(ViewEncapsulation || (ViewEncapsulation = {}));\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nconst __globalThis = typeof globalThis !== 'undefined' && globalThis;\nconst __window = typeof window !== 'undefined' && window;\nconst __self = typeof self !== 'undefined' && typeof WorkerGlobalScope !== 'undefined' &&\n self instanceof WorkerGlobalScope && self;\nconst __global = typeof global !== 'undefined' && global;\n// Always use __globalThis if available, which is the spec-defined global variable across all\n// environments, then fallback to __global first, because in Node tests both __global and\n// __window may be defined and _global should be __global in that case.\nconst _global = __globalThis || __global || __window || __self;\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nfunction ngDevModeResetPerfCounters() {\n const locationString = typeof location !== 'undefined' ? location.toString() : '';\n const newCounters = {\n namedConstructors: locationString.indexOf('ngDevMode=namedConstructors') != -1,\n firstCreatePass: 0,\n tNode: 0,\n tView: 0,\n rendererCreateTextNode: 0,\n rendererSetText: 0,\n rendererCreateElement: 0,\n rendererAddEventListener: 0,\n rendererSetAttribute: 0,\n rendererRemoveAttribute: 0,\n rendererSetProperty: 0,\n rendererSetClassName: 0,\n rendererAddClass: 0,\n rendererRemoveClass: 0,\n rendererSetStyle: 0,\n rendererRemoveStyle: 0,\n rendererDestroy: 0,\n rendererDestroyNode: 0,\n rendererMoveNode: 0,\n rendererRemoveNode: 0,\n rendererAppendChild: 0,\n rendererInsertBefore: 0,\n rendererCreateComment: 0,\n };\n // Make sure to refer to ngDevMode as ['ngDevMode'] for closure.\n const allowNgDevModeTrue = locationString.indexOf('ngDevMode=false') === -1;\n _global['ngDevMode'] = allowNgDevModeTrue && newCounters;\n return newCounters;\n}\n/**\n * This function checks to see if the `ngDevMode` has been set. If yes,\n * then we honor it, otherwise we default to dev mode with additional checks.\n *\n * The idea is that unless we are doing production build where we explicitly\n * set `ngDevMode == false` we should be helping the developer by providing\n * as much early warning and errors as possible.\n *\n * `ɵɵdefineComponent` is guaranteed to have been called before any component template functions\n * (and thus Ivy instructions), so a single initialization there is sufficient to ensure ngDevMode\n * is defined for the entire instruction set.\n *\n * When checking `ngDevMode` on toplevel, always init it before referencing it\n * (e.g. `((typeof ngDevMode === 'undefined' || ngDevMode) && initNgDevMode())`), otherwise you can\n * get a `ReferenceError` like in https://github.com/angular/angular/issues/31595.\n *\n * Details on possible values for `ngDevMode` can be found on its docstring.\n *\n * NOTE:\n * - changes to the `ngDevMode` name must be synced with `compiler-cli/src/tooling.ts`.\n */\nfunction initNgDevMode() {\n // The below checks are to ensure that calling `initNgDevMode` multiple times does not\n // reset the counters.\n // If the `ngDevMode` is not an object, then it means we have not created the perf counters\n // yet.\n if (typeof ngDevMode === 'undefined' || ngDevMode) {\n if (typeof ngDevMode !== 'object') {\n ngDevModeResetPerfCounters();\n }\n return typeof ngDevMode !== 'undefined' && !!ngDevMode;\n }\n return false;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * This file contains reuseable \"empty\" symbols that can be used as default return values\n * in different parts of the rendering code. Because the same symbols are returned, this\n * allows for identity checks against these values to be consistently used by the framework\n * code.\n */\nconst EMPTY_OBJ = {};\nconst EMPTY_ARRAY = [];\n// freezing the values prevents any code from accidentally inserting new values in\nif ((typeof ngDevMode === 'undefined' || ngDevMode) && initNgDevMode()) {\n // These property accesses can be ignored because ngDevMode will be set to false\n // when optimizing code and the whole if statement will be dropped.\n // tslint:disable-next-line:no-toplevel-property-access\n Object.freeze(EMPTY_OBJ);\n // tslint:disable-next-line:no-toplevel-property-access\n Object.freeze(EMPTY_ARRAY);\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nconst NG_COMP_DEF = getClosureSafeProperty({ ɵcmp: getClosureSafeProperty });\nconst NG_DIR_DEF = getClosureSafeProperty({ ɵdir: getClosureSafeProperty });\nconst NG_PIPE_DEF = getClosureSafeProperty({ ɵpipe: getClosureSafeProperty });\nconst NG_MOD_DEF = getClosureSafeProperty({ ɵmod: getClosureSafeProperty });\nconst NG_LOC_ID_DEF = getClosureSafeProperty({ ɵloc: getClosureSafeProperty });\nconst NG_FACTORY_DEF = getClosureSafeProperty({ ɵfac: getClosureSafeProperty });\n/**\n * If a directive is diPublic, bloomAdd sets a property on the type with this constant as\n * the key and the directive's unique ID as the value. This allows us to map directives to their\n * bloom filter bit for DI.\n */\n// TODO(misko): This is wrong. The NG_ELEMENT_ID should never be minified.\nconst NG_ELEMENT_ID = getClosureSafeProperty({ __NG_ELEMENT_ID__: getClosureSafeProperty });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nlet _renderCompCount = 0;\n/**\n * Create a component definition object.\n *\n *\n * # Example\n * ```\n * class MyDirective {\n * // Generated by Angular Template Compiler\n * // [Symbol] syntax will not be supported by TypeScript until v2.7\n * static ɵcmp = defineComponent({\n * ...\n * });\n * }\n * ```\n * @codeGenApi\n */\nfunction ɵɵdefineComponent(componentDefinition) {\n return noSideEffects(() => {\n // Initialize ngDevMode. This must be the first statement in ɵɵdefineComponent.\n // See the `initNgDevMode` docstring for more information.\n (typeof ngDevMode === 'undefined' || ngDevMode) && initNgDevMode();\n const type = componentDefinition.type;\n const typePrototype = type.prototype;\n const declaredInputs = {};\n const def = {\n type: type,\n providersResolver: null,\n decls: componentDefinition.decls,\n vars: componentDefinition.vars,\n factory: null,\n template: componentDefinition.template || null,\n consts: componentDefinition.consts || null,\n ngContentSelectors: componentDefinition.ngContentSelectors,\n hostBindings: componentDefinition.hostBindings || null,\n hostVars: componentDefinition.hostVars || 0,\n hostAttrs: componentDefinition.hostAttrs || null,\n contentQueries: componentDefinition.contentQueries || null,\n declaredInputs: declaredInputs,\n inputs: null,\n outputs: null,\n exportAs: componentDefinition.exportAs || null,\n onPush: componentDefinition.changeDetection === ChangeDetectionStrategy.OnPush,\n directiveDefs: null,\n pipeDefs: null,\n selectors: componentDefinition.selectors || EMPTY_ARRAY,\n viewQuery: componentDefinition.viewQuery || null,\n features: componentDefinition.features || null,\n data: componentDefinition.data || {},\n // TODO(misko): convert ViewEncapsulation into const enum so that it can be used\n // directly in the next line. Also `None` should be 0 not 2.\n encapsulation: componentDefinition.encapsulation || ViewEncapsulation.Emulated,\n id: 'c',\n styles: componentDefinition.styles || EMPTY_ARRAY,\n _: null,\n setInput: null,\n schemas: componentDefinition.schemas || null,\n tView: null,\n };\n const directiveTypes = componentDefinition.directives;\n const feature = componentDefinition.features;\n const pipeTypes = componentDefinition.pipes;\n def.id += _renderCompCount++;\n def.inputs = invertObject(componentDefinition.inputs, declaredInputs),\n def.outputs = invertObject(componentDefinition.outputs),\n feature && feature.forEach((fn) => fn(def));\n def.directiveDefs = directiveTypes ?\n () => (typeof directiveTypes === 'function' ? directiveTypes() : directiveTypes)\n .map(extractDirectiveDef) :\n null;\n def.pipeDefs = pipeTypes ?\n () => (typeof pipeTypes === 'function' ? pipeTypes() : pipeTypes).map(extractPipeDef) :\n null;\n return def;\n });\n}\n/**\n * Generated next to NgModules to monkey-patch directive and pipe references onto a component's\n * definition, when generating a direct reference in the component file would otherwise create an\n * import cycle.\n *\n * See [this explanation](https://hackmd.io/Odw80D0pR6yfsOjg_7XCJg?view) for more details.\n *\n * @codeGenApi\n */\nfunction ɵɵsetComponentScope(type, directives, pipes) {\n const def = type.ɵcmp;\n def.directiveDefs = () => directives.map(extractDirectiveDef);\n def.pipeDefs = () => pipes.map(extractPipeDef);\n}\nfunction extractDirectiveDef(type) {\n const def = getComponentDef(type) || getDirectiveDef(type);\n if (ngDevMode && !def) {\n throw new Error(`'${type.name}' is neither 'ComponentType' or 'DirectiveType'.`);\n }\n return def;\n}\nfunction extractPipeDef(type) {\n const def = getPipeDef(type);\n if (ngDevMode && !def) {\n throw new Error(`'${type.name}' is not a 'PipeType'.`);\n }\n return def;\n}\nconst autoRegisterModuleById = {};\n/**\n * @codeGenApi\n */\nfunction ɵɵdefineNgModule(def) {\n const res = {\n type: def.type,\n bootstrap: def.bootstrap || EMPTY_ARRAY,\n declarations: def.declarations || EMPTY_ARRAY,\n imports: def.imports || EMPTY_ARRAY,\n exports: def.exports || EMPTY_ARRAY,\n transitiveCompileScopes: null,\n schemas: def.schemas || null,\n id: def.id || null,\n };\n if (def.id != null) {\n noSideEffects(() => {\n autoRegisterModuleById[def.id] = def.type;\n });\n }\n return res;\n}\n/**\n * Adds the module metadata that is necessary to compute the module's transitive scope to an\n * existing module definition.\n *\n * Scope metadata of modules is not used in production builds, so calls to this function can be\n * marked pure to tree-shake it from the bundle, allowing for all referenced declarations\n * to become eligible for tree-shaking as well.\n *\n * @codeGenApi\n */\nfunction ɵɵsetNgModuleScope(type, scope) {\n return noSideEffects(() => {\n const ngModuleDef = getNgModuleDef(type, true);\n ngModuleDef.declarations = scope.declarations || EMPTY_ARRAY;\n ngModuleDef.imports = scope.imports || EMPTY_ARRAY;\n ngModuleDef.exports = scope.exports || EMPTY_ARRAY;\n });\n}\n/**\n * Inverts an inputs or outputs lookup such that the keys, which were the\n * minified keys, are part of the values, and the values are parsed so that\n * the publicName of the property is the new key\n *\n * e.g. for\n *\n * ```\n * class Comp {\n * @Input()\n * propName1: string;\n *\n * @Input('publicName2')\n * declaredPropName2: number;\n * }\n * ```\n *\n * will be serialized as\n *\n * ```\n * {\n * propName1: 'propName1',\n * declaredPropName2: ['publicName2', 'declaredPropName2'],\n * }\n * ```\n *\n * which is than translated by the minifier as:\n *\n * ```\n * {\n * minifiedPropName1: 'propName1',\n * minifiedPropName2: ['publicName2', 'declaredPropName2'],\n * }\n * ```\n *\n * becomes: (public name => minifiedName)\n *\n * ```\n * {\n * 'propName1': 'minifiedPropName1',\n * 'publicName2': 'minifiedPropName2',\n * }\n * ```\n *\n * Optionally the function can take `secondary` which will result in: (public name => declared name)\n *\n * ```\n * {\n * 'propName1': 'propName1',\n * 'publicName2': 'declaredPropName2',\n * }\n * ```\n *\n\n */\nfunction invertObject(obj, secondary) {\n if (obj == null)\n return EMPTY_OBJ;\n const newLookup = {};\n for (const minifiedKey in obj) {\n if (obj.hasOwnProperty(minifiedKey)) {\n let publicName = obj[minifiedKey];\n let declaredName = publicName;\n if (Array.isArray(publicName)) {\n declaredName = publicName[1];\n publicName = publicName[0];\n }\n newLookup[publicName] = minifiedKey;\n if (secondary) {\n (secondary[publicName] = declaredName);\n }\n }\n }\n return newLookup;\n}\n/**\n * Create a directive definition object.\n *\n * # Example\n * ```ts\n * class MyDirective {\n * // Generated by Angular Template Compiler\n * // [Symbol] syntax will not be supported by TypeScript until v2.7\n * static ɵdir = ɵɵdefineDirective({\n * ...\n * });\n * }\n * ```\n *\n * @codeGenApi\n */\nconst ɵɵdefineDirective = ɵɵdefineComponent;\n/**\n * Create a pipe definition object.\n *\n * # Example\n * ```\n * class MyPipe implements PipeTransform {\n * // Generated by Angular Template Compiler\n * static ɵpipe = definePipe({\n * ...\n * });\n * }\n * ```\n * @param pipeDef Pipe definition generated by the compiler\n *\n * @codeGenApi\n */\nfunction ɵɵdefinePipe(pipeDef) {\n return {\n type: pipeDef.type,\n name: pipeDef.name,\n factory: null,\n pure: pipeDef.pure !== false,\n onDestroy: pipeDef.type.prototype.ngOnDestroy || null\n };\n}\n/**\n * The following getter methods retrieve the definition from the type. Currently the retrieval\n * honors inheritance, but in the future we may change the rule to require that definitions are\n * explicit. This would require some sort of migration strategy.\n */\nfunction getComponentDef(type) {\n return type[NG_COMP_DEF] || null;\n}\nfunction getDirectiveDef(type) {\n return type[NG_DIR_DEF] || null;\n}\nfunction getPipeDef(type) {\n return type[NG_PIPE_DEF] || null;\n}\nfunction getNgModuleDef(type, throwNotFound) {\n const ngModuleDef = type[NG_MOD_DEF] || null;\n if (!ngModuleDef && throwNotFound === true) {\n throw new Error(`Type ${stringify(type)} does not have 'ɵmod' property.`);\n }\n return ngModuleDef;\n}\nfunction getNgLocaleIdDef(type) {\n return type[NG_LOC_ID_DEF] || null;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n// Below are constants for LView indices to help us look up LView members\n// without having to remember the specific indices.\n// Uglify will inline these when minifying so there shouldn't be a cost.\nconst HOST = 0;\nconst TVIEW = 1;\nconst FLAGS = 2;\nconst PARENT = 3;\nconst NEXT = 4;\nconst TRANSPLANTED_VIEWS_TO_REFRESH = 5;\nconst T_HOST = 6;\nconst CLEANUP = 7;\nconst CONTEXT = 8;\nconst INJECTOR = 9;\nconst RENDERER_FACTORY = 10;\nconst RENDERER = 11;\nconst SANITIZER = 12;\nconst CHILD_HEAD = 13;\nconst CHILD_TAIL = 14;\n// FIXME(misko): Investigate if the three declarations aren't all same thing.\nconst DECLARATION_VIEW = 15;\nconst DECLARATION_COMPONENT_VIEW = 16;\nconst DECLARATION_LCONTAINER = 17;\nconst PREORDER_HOOK_FLAGS = 18;\nconst QUERIES = 19;\n/**\n * Size of LView's header. Necessary to adjust for it when setting slots.\n *\n * IMPORTANT: `HEADER_OFFSET` should only be referred to the in the `ɵɵ*` instructions to translate\n * instruction index into `LView` index. All other indexes should be in the `LView` index space and\n * there should be no need to refer to `HEADER_OFFSET` anywhere else.\n */\nconst HEADER_OFFSET = 20;\n/**\n * Converts `TViewType` into human readable text.\n * Make sure this matches with `TViewType`\n */\nconst TViewTypeAsString = [\n 'Root',\n 'Component',\n 'Embedded',\n];\n// Note: This hack is necessary so we don't erroneously get a circular dependency\n// failure based on types.\nconst unusedValueExportToPlacateAjd = 1;\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Special location which allows easy identification of type. If we have an array which was\n * retrieved from the `LView` and that array has `true` at `TYPE` location, we know it is\n * `LContainer`.\n */\nconst TYPE = 1;\n/**\n * Below are constants for LContainer indices to help us look up LContainer members\n * without having to remember the specific indices.\n * Uglify will inline these when minifying so there shouldn't be a cost.\n */\n/**\n * Flag to signify that this `LContainer` may have transplanted views which need to be change\n * detected. (see: `LView[DECLARATION_COMPONENT_VIEW])`.\n *\n * This flag, once set, is never unset for the `LContainer`. This means that when unset we can skip\n * a lot of work in `refreshEmbeddedViews`. But when set we still need to verify\n * that the `MOVED_VIEWS` are transplanted and on-push.\n */\nconst HAS_TRANSPLANTED_VIEWS = 2;\n// PARENT, NEXT, TRANSPLANTED_VIEWS_TO_REFRESH are indices 3, 4, and 5\n// As we already have these constants in LView, we don't need to re-create them.\n// T_HOST is index 6\n// We already have this constants in LView, we don't need to re-create it.\nconst NATIVE = 7;\nconst VIEW_REFS = 8;\nconst MOVED_VIEWS = 9;\n/**\n * Size of LContainer's header. Represents the index after which all views in the\n * container will be inserted. We need to keep a record of current views so we know\n * which views are already in the DOM (and don't need to be re-added) and so we can\n * remove views from the DOM when they are no longer required.\n */\nconst CONTAINER_HEADER_OFFSET = 10;\n// Note: This hack is necessary so we don't erroneously get a circular dependency\n// failure based on types.\nconst unusedValueExportToPlacateAjd$1 = 1;\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * True if `value` is `LView`.\n * @param value wrapped value of `RNode`, `LView`, `LContainer`\n */\nfunction isLView(value) {\n return Array.isArray(value) && typeof value[TYPE] === 'object';\n}\n/**\n * True if `value` is `LContainer`.\n * @param value wrapped value of `RNode`, `LView`, `LContainer`\n */\nfunction isLContainer(value) {\n return Array.isArray(value) && value[TYPE] === true;\n}\nfunction isContentQueryHost(tNode) {\n return (tNode.flags & 8 /* hasContentQuery */) !== 0;\n}\nfunction isComponentHost(tNode) {\n return (tNode.flags & 2 /* isComponentHost */) === 2 /* isComponentHost */;\n}\nfunction isDirectiveHost(tNode) {\n return (tNode.flags & 1 /* isDirectiveHost */) === 1 /* isDirectiveHost */;\n}\nfunction isComponentDef(def) {\n return def.template !== null;\n}\nfunction isRootView(target) {\n return (target[FLAGS] & 512 /* IsRoot */) !== 0;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n// [Assert functions do not constraint type when they are guarded by a truthy\n// expression.](https://github.com/microsoft/TypeScript/issues/37295)\nfunction assertTNodeForLView(tNode, lView) {\n assertTNodeForTView(tNode, lView[TVIEW]);\n}\nfunction assertTNodeForTView(tNode, tView) {\n assertTNode(tNode);\n tNode.hasOwnProperty('tView_') &&\n assertEqual(tNode.tView_, tView, 'This TNode does not belong to this TView.');\n}\nfunction assertTNode(tNode) {\n assertDefined(tNode, 'TNode must be defined');\n if (!(tNode && typeof tNode === 'object' && tNode.hasOwnProperty('directiveStylingLast'))) {\n throwError('Not of type TNode, got: ' + tNode);\n }\n}\nfunction assertTIcu(tIcu) {\n assertDefined(tIcu, 'Expected TIcu to be defined');\n if (!(typeof tIcu.currentCaseLViewIndex === 'number')) {\n throwError('Object is not of TIcu type.');\n }\n}\nfunction assertComponentType(actual, msg = 'Type passed in is not ComponentType, it does not have \\'ɵcmp\\' property.') {\n if (!getComponentDef(actual)) {\n throwError(msg);\n }\n}\nfunction assertNgModuleType(actual, msg = 'Type passed in is not NgModuleType, it does not have \\'ɵmod\\' property.') {\n if (!getNgModuleDef(actual)) {\n throwError(msg);\n }\n}\nfunction assertCurrentTNodeIsParent(isParent) {\n assertEqual(isParent, true, 'currentTNode should be a parent');\n}\nfunction assertHasParent(tNode) {\n assertDefined(tNode, 'currentTNode should exist!');\n assertDefined(tNode.parent, 'currentTNode should have a parent');\n}\nfunction assertDataNext(lView, index, arr) {\n if (arr == null)\n arr = lView;\n assertEqual(arr.length, index, `index ${index} expected to be at the end of arr (length ${arr.length})`);\n}\nfunction assertLContainer(value) {\n assertDefined(value, 'LContainer must be defined');\n assertEqual(isLContainer(value), true, 'Expecting LContainer');\n}\nfunction assertLViewOrUndefined(value) {\n value && assertEqual(isLView(value), true, 'Expecting LView or undefined or null');\n}\nfunction assertLView(value) {\n assertDefined(value, 'LView must be defined');\n assertEqual(isLView(value), true, 'Expecting LView');\n}\nfunction assertFirstCreatePass(tView, errMessage) {\n assertEqual(tView.firstCreatePass, true, errMessage || 'Should only be called in first create pass.');\n}\nfunction assertFirstUpdatePass(tView, errMessage) {\n assertEqual(tView.firstUpdatePass, true, errMessage || 'Should only be called in first update pass.');\n}\n/**\n * This is a basic sanity check that an object is probably a directive def. DirectiveDef is\n * an interface, so we can't do a direct instanceof check.\n */\nfunction assertDirectiveDef(obj) {\n if (obj.type === undefined || obj.selectors == undefined || obj.inputs === undefined) {\n throwError(`Expected a DirectiveDef/ComponentDef and this object does not seem to have the expected shape.`);\n }\n}\nfunction assertIndexInDeclRange(lView, index) {\n const tView = lView[1];\n assertBetween(HEADER_OFFSET, tView.bindingStartIndex, index);\n}\nfunction assertIndexInVarsRange(lView, index) {\n const tView = lView[1];\n assertBetween(tView.bindingStartIndex, tView.expandoStartIndex, index);\n}\nfunction assertIndexInExpandoRange(lView, index) {\n const tView = lView[1];\n assertBetween(tView.expandoStartIndex, lView.length, index);\n}\nfunction assertBetween(lower, upper, index) {\n if (!(lower <= index && index < upper)) {\n throwError(`Index out of range (expecting ${lower} <= ${index} < ${upper})`);\n }\n}\n/**\n * This is a basic sanity check that the `injectorIndex` seems to point to what looks like a\n * NodeInjector data structure.\n *\n * @param lView `LView` which should be checked.\n * @param injectorIndex index into the `LView` where the `NodeInjector` is expected.\n */\nfunction assertNodeInjector(lView, injectorIndex) {\n assertIndexInExpandoRange(lView, injectorIndex);\n assertIndexInExpandoRange(lView, injectorIndex + 8 /* PARENT */);\n assertNumber(lView[injectorIndex + 0], 'injectorIndex should point to a bloom filter');\n assertNumber(lView[injectorIndex + 1], 'injectorIndex should point to a bloom filter');\n assertNumber(lView[injectorIndex + 2], 'injectorIndex should point to a bloom filter');\n assertNumber(lView[injectorIndex + 3], 'injectorIndex should point to a bloom filter');\n assertNumber(lView[injectorIndex + 4], 'injectorIndex should point to a bloom filter');\n assertNumber(lView[injectorIndex + 5], 'injectorIndex should point to a bloom filter');\n assertNumber(lView[injectorIndex + 6], 'injectorIndex should point to a bloom filter');\n assertNumber(lView[injectorIndex + 7], 'injectorIndex should point to a bloom filter');\n assertNumber(lView[injectorIndex + 8 /* PARENT */], 'injectorIndex should point to parent injector');\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nfunction getFactoryDef(type, throwNotFound) {\n const hasFactoryDef = type.hasOwnProperty(NG_FACTORY_DEF);\n if (!hasFactoryDef && throwNotFound === true && ngDevMode) {\n throw new Error(`Type ${stringify(type)} does not have 'ɵfac' property.`);\n }\n return hasFactoryDef ? type[NG_FACTORY_DEF] : null;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nclass RuntimeError extends Error {\n constructor(code, message) {\n super(formatRuntimeError(code, message));\n this.code = code;\n }\n}\n/** Called to format a runtime error */\nfunction formatRuntimeError(code, message) {\n const fullCode = code ? `NG0${code}: ` : '';\n return `${fullCode}${message}`;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Used for stringify render output in Ivy.\n * Important! This function is very performance-sensitive and we should\n * be extra careful not to introduce megamorphic reads in it.\n * Check `core/test/render3/perf/render_stringify` for benchmarks and alternate implementations.\n */\nfunction renderStringify(value) {\n if (typeof value === 'string')\n return value;\n if (value == null)\n return '';\n // Use `String` so that it invokes the `toString` method of the value. Note that this\n // appears to be faster than calling `value.toString` (see `render_stringify` benchmark).\n return String(value);\n}\n/**\n * Used to stringify a value so that it can be displayed in an error message.\n * Important! This function contains a megamorphic read and should only be\n * used for error messages.\n */\nfunction stringifyForError(value) {\n if (typeof value === 'function')\n return value.name || value.toString();\n if (typeof value === 'object' && value != null && typeof value.type === 'function') {\n return value.type.name || value.type.toString();\n }\n return renderStringify(value);\n}\n\n/** Called when directives inject each other (creating a circular dependency) */\nfunction throwCyclicDependencyError(token, path) {\n const depPath = path ? `. Dependency path: ${path.join(' > ')} > ${token}` : '';\n throw new RuntimeError(\"200\" /* CYCLIC_DI_DEPENDENCY */, `Circular dependency in DI detected for ${token}${depPath}`);\n}\nfunction throwMixedMultiProviderError() {\n throw new Error(`Cannot mix multi providers and regular providers`);\n}\nfunction throwInvalidProviderError(ngModuleType, providers, provider) {\n let ngModuleDetail = '';\n if (ngModuleType && providers) {\n const providerDetail = providers.map(v => v == provider ? '?' + provider + '?' : '...');\n ngModuleDetail =\n ` - only instances of Provider and Type are allowed, got: [${providerDetail.join(', ')}]`;\n }\n throw new Error(`Invalid provider for the NgModule '${stringify(ngModuleType)}'` + ngModuleDetail);\n}\n/** Throws an error when a token is not found in DI. */\nfunction throwProviderNotFoundError(token, injectorName) {\n const injectorDetails = injectorName ? ` in ${injectorName}` : '';\n throw new RuntimeError(\"201\" /* PROVIDER_NOT_FOUND */, `No provider for ${stringifyForError(token)} found${injectorDetails}`);\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Represents a basic change from a previous to a new value for a single\n * property on a directive instance. Passed as a value in a\n * {@link SimpleChanges} object to the `ngOnChanges` hook.\n *\n * @see `OnChanges`\n *\n * @publicApi\n */\nclass SimpleChange {\n constructor(previousValue, currentValue, firstChange) {\n this.previousValue = previousValue;\n this.currentValue = currentValue;\n this.firstChange = firstChange;\n }\n /**\n * Check whether the new value is the first value assigned.\n */\n isFirstChange() {\n return this.firstChange;\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * The NgOnChangesFeature decorates a component with support for the ngOnChanges\n * lifecycle hook, so it should be included in any component that implements\n * that hook.\n *\n * If the component or directive uses inheritance, the NgOnChangesFeature MUST\n * be included as a feature AFTER {@link InheritDefinitionFeature}, otherwise\n * inherited properties will not be propagated to the ngOnChanges lifecycle\n * hook.\n *\n * Example usage:\n *\n * ```\n * static ɵcmp = defineComponent({\n * ...\n * inputs: {name: 'publicName'},\n * features: [NgOnChangesFeature]\n * });\n * ```\n *\n * @codeGenApi\n */\nfunction ɵɵNgOnChangesFeature() {\n return NgOnChangesFeatureImpl;\n}\nfunction NgOnChangesFeatureImpl(definition) {\n if (definition.type.prototype.ngOnChanges) {\n definition.setInput = ngOnChangesSetInput;\n }\n return rememberChangeHistoryAndInvokeOnChangesHook;\n}\n// This option ensures that the ngOnChanges lifecycle hook will be inherited\n// from superclasses (in InheritDefinitionFeature).\n/** @nocollapse */\n// tslint:disable-next-line:no-toplevel-property-access\nɵɵNgOnChangesFeature.ngInherit = true;\n/**\n * This is a synthetic lifecycle hook which gets inserted into `TView.preOrderHooks` to simulate\n * `ngOnChanges`.\n *\n * The hook reads the `NgSimpleChangesStore` data from the component instance and if changes are\n * found it invokes `ngOnChanges` on the component instance.\n *\n * @param this Component instance. Because this function gets inserted into `TView.preOrderHooks`,\n * it is guaranteed to be called with component instance.\n */\nfunction rememberChangeHistoryAndInvokeOnChangesHook() {\n const simpleChangesStore = getSimpleChangesStore(this);\n const current = simpleChangesStore === null || simpleChangesStore === void 0 ? void 0 : simpleChangesStore.current;\n if (current) {\n const previous = simpleChangesStore.previous;\n if (previous === EMPTY_OBJ) {\n simpleChangesStore.previous = current;\n }\n else {\n // New changes are copied to the previous store, so that we don't lose history for inputs\n // which were not changed this time\n for (let key in current) {\n previous[key] = current[key];\n }\n }\n simpleChangesStore.current = null;\n this.ngOnChanges(current);\n }\n}\nfunction ngOnChangesSetInput(instance, value, publicName, privateName) {\n const simpleChangesStore = getSimpleChangesStore(instance) ||\n setSimpleChangesStore(instance, { previous: EMPTY_OBJ, current: null });\n const current = simpleChangesStore.current || (simpleChangesStore.current = {});\n const previous = simpleChangesStore.previous;\n const declaredName = this.declaredInputs[publicName];\n const previousChange = previous[declaredName];\n current[declaredName] = new SimpleChange(previousChange && previousChange.currentValue, value, previous === EMPTY_OBJ);\n instance[privateName] = value;\n}\nconst SIMPLE_CHANGES_STORE = '__ngSimpleChanges__';\nfunction getSimpleChangesStore(instance) {\n return instance[SIMPLE_CHANGES_STORE] || null;\n}\nfunction setSimpleChangesStore(instance, store) {\n return instance[SIMPLE_CHANGES_STORE] = store;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nconst SVG_NAMESPACE = 'http://www.w3.org/2000/svg';\nconst MATH_ML_NAMESPACE = 'http://www.w3.org/1998/MathML/';\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * This property will be monkey-patched on elements, components and directives\n */\nconst MONKEY_PATCH_KEY_NAME = '__ngContext__';\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Most of the use of `document` in Angular is from within the DI system so it is possible to simply\n * inject the `DOCUMENT` token and are done.\n *\n * Ivy is special because it does not rely upon the DI and must get hold of the document some other\n * way.\n *\n * The solution is to define `getDocument()` and `setDocument()` top-level functions for ivy.\n * Wherever ivy needs the global document, it calls `getDocument()` instead.\n *\n * When running ivy outside of a browser environment, it is necessary to call `setDocument()` to\n * tell ivy what the global `document` is.\n *\n * Angular does this for us in each of the standard platforms (`Browser`, `Server`, and `WebWorker`)\n * by calling `setDocument()` when providing the `DOCUMENT` token.\n */\nlet DOCUMENT = undefined;\n/**\n * Tell ivy what the `document` is for this platform.\n *\n * It is only necessary to call this if the current platform is not a browser.\n *\n * @param document The object representing the global `document` in this environment.\n */\nfunction setDocument(document) {\n DOCUMENT = document;\n}\n/**\n * Access the object that represents the `document` for this platform.\n *\n * Ivy calls this whenever it needs to access the `document` object.\n * For example to create the renderer or to do sanitization.\n */\nfunction getDocument() {\n if (DOCUMENT !== undefined) {\n return DOCUMENT;\n }\n else if (typeof document !== 'undefined') {\n return document;\n }\n // No \"document\" can be found. This should only happen if we are running ivy outside Angular and\n // the current platform is not a browser. Since this is not a supported scenario at the moment\n // this should not happen in Angular apps.\n // Once we support running ivy outside of Angular we will need to publish `setDocument()` as a\n // public API. Meanwhile we just return `undefined` and let the application fail.\n return undefined;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n// TODO: cleanup once the code is merged in angular/angular\nvar RendererStyleFlags3;\n(function (RendererStyleFlags3) {\n RendererStyleFlags3[RendererStyleFlags3[\"Important\"] = 1] = \"Important\";\n RendererStyleFlags3[RendererStyleFlags3[\"DashCase\"] = 2] = \"DashCase\";\n})(RendererStyleFlags3 || (RendererStyleFlags3 = {}));\n/** Returns whether the `renderer` is a `ProceduralRenderer3` */\nfunction isProceduralRenderer(renderer) {\n return !!(renderer.listen);\n}\nconst ɵ0 = (hostElement, rendererType) => {\n return getDocument();\n};\nconst domRendererFactory3 = {\n createRenderer: ɵ0\n};\n// Note: This hack is necessary so we don't erroneously get a circular dependency\n// failure based on types.\nconst unusedValueExportToPlacateAjd$2 = 1;\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * For efficiency reasons we often put several different data types (`RNode`, `LView`, `LContainer`)\n * in same location in `LView`. This is because we don't want to pre-allocate space for it\n * because the storage is sparse. This file contains utilities for dealing with such data types.\n *\n * How do we know what is stored at a given location in `LView`.\n * - `Array.isArray(value) === false` => `RNode` (The normal storage value)\n * - `Array.isArray(value) === true` => then the `value[0]` represents the wrapped value.\n * - `typeof value[TYPE] === 'object'` => `LView`\n * - This happens when we have a component at a given location\n * - `typeof value[TYPE] === true` => `LContainer`\n * - This happens when we have `LContainer` binding at a given location.\n *\n *\n * NOTE: it is assumed that `Array.isArray` and `typeof` operations are very efficient.\n */\n/**\n * Returns `RNode`.\n * @param value wrapped value of `RNode`, `LView`, `LContainer`\n */\nfunction unwrapRNode(value) {\n while (Array.isArray(value)) {\n value = value[HOST];\n }\n return value;\n}\n/**\n * Returns `LView` or `null` if not found.\n * @param value wrapped value of `RNode`, `LView`, `LContainer`\n */\nfunction unwrapLView(value) {\n while (Array.isArray(value)) {\n // This check is same as `isLView()` but we don't call at as we don't want to call\n // `Array.isArray()` twice and give JITer more work for inlining.\n if (typeof value[TYPE] === 'object')\n return value;\n value = value[HOST];\n }\n return null;\n}\n/**\n * Returns `LContainer` or `null` if not found.\n * @param value wrapped value of `RNode`, `LView`, `LContainer`\n */\nfunction unwrapLContainer(value) {\n while (Array.isArray(value)) {\n // This check is same as `isLContainer()` but we don't call at as we don't want to call\n // `Array.isArray()` twice and give JITer more work for inlining.\n if (value[TYPE] === true)\n return value;\n value = value[HOST];\n }\n return null;\n}\n/**\n * Retrieves an element value from the provided `viewData`, by unwrapping\n * from any containers, component views, or style contexts.\n */\nfunction getNativeByIndex(index, lView) {\n ngDevMode && assertIndexInRange(lView, index);\n ngDevMode && assertGreaterThanOrEqual(index, HEADER_OFFSET, 'Expected to be past HEADER_OFFSET');\n return unwrapRNode(lView[index]);\n}\n/**\n * Retrieve an `RNode` for a given `TNode` and `LView`.\n *\n * This function guarantees in dev mode to retrieve a non-null `RNode`.\n *\n * @param tNode\n * @param lView\n */\nfunction getNativeByTNode(tNode, lView) {\n ngDevMode && assertTNodeForLView(tNode, lView);\n ngDevMode && assertIndexInRange(lView, tNode.index);\n const node = unwrapRNode(lView[tNode.index]);\n ngDevMode && !isProceduralRenderer(lView[RENDERER]) && assertDomNode(node);\n return node;\n}\n/**\n * Retrieve an `RNode` or `null` for a given `TNode` and `LView`.\n *\n * Some `TNode`s don't have associated `RNode`s. For example `Projection`\n *\n * @param tNode\n * @param lView\n */\nfunction getNativeByTNodeOrNull(tNode, lView) {\n const index = tNode === null ? -1 : tNode.index;\n if (index !== -1) {\n ngDevMode && assertTNodeForLView(tNode, lView);\n const node = unwrapRNode(lView[index]);\n ngDevMode && node !== null && !isProceduralRenderer(lView[RENDERER]) && assertDomNode(node);\n return node;\n }\n return null;\n}\n// fixme(misko): The return Type should be `TNode|null`\nfunction getTNode(tView, index) {\n ngDevMode && assertGreaterThan(index, -1, 'wrong index for TNode');\n ngDevMode && assertLessThan(index, tView.data.length, 'wrong index for TNode');\n const tNode = tView.data[index];\n ngDevMode && tNode !== null && assertTNode(tNode);\n return tNode;\n}\n/** Retrieves a value from any `LView` or `TData`. */\nfunction load(view, index) {\n ngDevMode && assertIndexInRange(view, index);\n return view[index];\n}\nfunction getComponentLViewByIndex(nodeIndex, hostView) {\n // Could be an LView or an LContainer. If LContainer, unwrap to find LView.\n ngDevMode && assertIndexInRange(hostView, nodeIndex);\n const slotValue = hostView[nodeIndex];\n const lView = isLView(slotValue) ? slotValue : slotValue[HOST];\n return lView;\n}\n/**\n * Returns the monkey-patch value data present on the target (which could be\n * a component, directive or a DOM node).\n */\nfunction readPatchedData(target) {\n ngDevMode && assertDefined(target, 'Target expected');\n return target[MONKEY_PATCH_KEY_NAME] || null;\n}\nfunction readPatchedLView(target) {\n const value = readPatchedData(target);\n if (value) {\n return Array.isArray(value) ? value : value.lView;\n }\n return null;\n}\n/** Checks whether a given view is in creation mode */\nfunction isCreationMode(view) {\n return (view[FLAGS] & 4 /* CreationMode */) === 4 /* CreationMode */;\n}\n/**\n * Returns a boolean for whether the view is attached to the change detection tree.\n *\n * Note: This determines whether a view should be checked, not whether it's inserted\n * into a container. For that, you'll want `viewAttachedToContainer` below.\n */\nfunction viewAttachedToChangeDetector(view) {\n return (view[FLAGS] & 128 /* Attached */) === 128 /* Attached */;\n}\n/** Returns a boolean for whether the view is attached to a container. */\nfunction viewAttachedToContainer(view) {\n return isLContainer(view[PARENT]);\n}\nfunction getConstant(consts, index) {\n if (index === null || index === undefined)\n return null;\n ngDevMode && assertIndexInRange(consts, index);\n return consts[index];\n}\n/**\n * Resets the pre-order hook flags of the view.\n * @param lView the LView on which the flags are reset\n */\nfunction resetPreOrderHookFlags(lView) {\n lView[PREORDER_HOOK_FLAGS] = 0;\n}\n/**\n * Updates the `TRANSPLANTED_VIEWS_TO_REFRESH` counter on the `LContainer` as well as the parents\n * whose\n * 1. counter goes from 0 to 1, indicating that there is a new child that has a view to refresh\n * or\n * 2. counter goes from 1 to 0, indicating there are no more descendant views to refresh\n */\nfunction updateTransplantedViewCount(lContainer, amount) {\n lContainer[TRANSPLANTED_VIEWS_TO_REFRESH] += amount;\n let viewOrContainer = lContainer;\n let parent = lContainer[PARENT];\n while (parent !== null &&\n ((amount === 1 && viewOrContainer[TRANSPLANTED_VIEWS_TO_REFRESH] === 1) ||\n (amount === -1 && viewOrContainer[TRANSPLANTED_VIEWS_TO_REFRESH] === 0))) {\n parent[TRANSPLANTED_VIEWS_TO_REFRESH] += amount;\n viewOrContainer = parent;\n parent = parent[PARENT];\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nconst instructionState = {\n lFrame: createLFrame(null),\n bindingsEnabled: true,\n isInCheckNoChangesMode: false,\n};\n/**\n * Returns true if the instruction state stack is empty.\n *\n * Intended to be called from tests only (tree shaken otherwise).\n */\nfunction specOnlyIsInstructionStateEmpty() {\n return instructionState.lFrame.parent === null;\n}\nfunction getElementDepthCount() {\n return instructionState.lFrame.elementDepthCount;\n}\nfunction increaseElementDepthCount() {\n instructionState.lFrame.elementDepthCount++;\n}\nfunction decreaseElementDepthCount() {\n instructionState.lFrame.elementDepthCount--;\n}\nfunction getBindingsEnabled() {\n return instructionState.bindingsEnabled;\n}\n/**\n * Enables directive matching on elements.\n *\n * * Example:\n * ```\n * \n * Should match component / directive.\n * \n * \n * \n * \n * Should not match component / directive because we are in ngNonBindable.\n * \n * \n *
\n * ```\n *\n * @codeGenApi\n */\nfunction ɵɵenableBindings() {\n instructionState.bindingsEnabled = true;\n}\n/**\n * Disables directive matching on element.\n *\n * * Example:\n * ```\n * \n * Should match component / directive.\n * \n * \n * \n * \n * Should not match component / directive because we are in ngNonBindable.\n * \n * \n *
\n * ```\n *\n * @codeGenApi\n */\nfunction ɵɵdisableBindings() {\n instructionState.bindingsEnabled = false;\n}\n/**\n * Return the current `LView`.\n */\nfunction getLView() {\n return instructionState.lFrame.lView;\n}\n/**\n * Return the current `TView`.\n */\nfunction getTView() {\n return instructionState.lFrame.tView;\n}\n/**\n * Restores `contextViewData` to the given OpaqueViewState instance.\n *\n * Used in conjunction with the getCurrentView() instruction to save a snapshot\n * of the current view and restore it when listeners are invoked. This allows\n * walking the declaration view tree in listeners to get vars from parent views.\n *\n * @param viewToRestore The OpaqueViewState instance to restore.\n *\n * @codeGenApi\n */\nfunction ɵɵrestoreView(viewToRestore) {\n instructionState.lFrame.contextLView = viewToRestore;\n}\nfunction getCurrentTNode() {\n let currentTNode = getCurrentTNodePlaceholderOk();\n while (currentTNode !== null && currentTNode.type === 64 /* Placeholder */) {\n currentTNode = currentTNode.parent;\n }\n return currentTNode;\n}\nfunction getCurrentTNodePlaceholderOk() {\n return instructionState.lFrame.currentTNode;\n}\nfunction getCurrentParentTNode() {\n const lFrame = instructionState.lFrame;\n const currentTNode = lFrame.currentTNode;\n return lFrame.isParent ? currentTNode : currentTNode.parent;\n}\nfunction setCurrentTNode(tNode, isParent) {\n ngDevMode && tNode && assertTNodeForTView(tNode, instructionState.lFrame.tView);\n const lFrame = instructionState.lFrame;\n lFrame.currentTNode = tNode;\n lFrame.isParent = isParent;\n}\nfunction isCurrentTNodeParent() {\n return instructionState.lFrame.isParent;\n}\nfunction setCurrentTNodeAsNotParent() {\n instructionState.lFrame.isParent = false;\n}\nfunction setCurrentTNodeAsParent() {\n instructionState.lFrame.isParent = true;\n}\nfunction getContextLView() {\n return instructionState.lFrame.contextLView;\n}\nfunction isInCheckNoChangesMode() {\n // TODO(misko): remove this from the LView since it is ngDevMode=true mode only.\n return instructionState.isInCheckNoChangesMode;\n}\nfunction setIsInCheckNoChangesMode(mode) {\n instructionState.isInCheckNoChangesMode = mode;\n}\n// top level variables should not be exported for performance reasons (PERF_NOTES.md)\nfunction getBindingRoot() {\n const lFrame = instructionState.lFrame;\n let index = lFrame.bindingRootIndex;\n if (index === -1) {\n index = lFrame.bindingRootIndex = lFrame.tView.bindingStartIndex;\n }\n return index;\n}\nfunction getBindingIndex() {\n return instructionState.lFrame.bindingIndex;\n}\nfunction setBindingIndex(value) {\n return instructionState.lFrame.bindingIndex = value;\n}\nfunction nextBindingIndex() {\n return instructionState.lFrame.bindingIndex++;\n}\nfunction incrementBindingIndex(count) {\n const lFrame = instructionState.lFrame;\n const index = lFrame.bindingIndex;\n lFrame.bindingIndex = lFrame.bindingIndex + count;\n return index;\n}\nfunction isInI18nBlock() {\n return instructionState.lFrame.inI18n;\n}\nfunction setInI18nBlock(isInI18nBlock) {\n instructionState.lFrame.inI18n = isInI18nBlock;\n}\n/**\n * Set a new binding root index so that host template functions can execute.\n *\n * Bindings inside the host template are 0 index. But because we don't know ahead of time\n * how many host bindings we have we can't pre-compute them. For this reason they are all\n * 0 index and we just shift the root so that they match next available location in the LView.\n *\n * @param bindingRootIndex Root index for `hostBindings`\n * @param currentDirectiveIndex `TData[currentDirectiveIndex]` will point to the current directive\n * whose `hostBindings` are being processed.\n */\nfunction setBindingRootForHostBindings(bindingRootIndex, currentDirectiveIndex) {\n const lFrame = instructionState.lFrame;\n lFrame.bindingIndex = lFrame.bindingRootIndex = bindingRootIndex;\n setCurrentDirectiveIndex(currentDirectiveIndex);\n}\n/**\n * When host binding is executing this points to the directive index.\n * `TView.data[getCurrentDirectiveIndex()]` is `DirectiveDef`\n * `LView[getCurrentDirectiveIndex()]` is directive instance.\n */\nfunction getCurrentDirectiveIndex() {\n return instructionState.lFrame.currentDirectiveIndex;\n}\n/**\n * Sets an index of a directive whose `hostBindings` are being processed.\n *\n * @param currentDirectiveIndex `TData` index where current directive instance can be found.\n */\nfunction setCurrentDirectiveIndex(currentDirectiveIndex) {\n instructionState.lFrame.currentDirectiveIndex = currentDirectiveIndex;\n}\n/**\n * Retrieve the current `DirectiveDef` which is active when `hostBindings` instruction is being\n * executed.\n *\n * @param tData Current `TData` where the `DirectiveDef` will be looked up at.\n */\nfunction getCurrentDirectiveDef(tData) {\n const currentDirectiveIndex = instructionState.lFrame.currentDirectiveIndex;\n return currentDirectiveIndex === -1 ? null : tData[currentDirectiveIndex];\n}\nfunction getCurrentQueryIndex() {\n return instructionState.lFrame.currentQueryIndex;\n}\nfunction setCurrentQueryIndex(value) {\n instructionState.lFrame.currentQueryIndex = value;\n}\n/**\n * Returns a `TNode` of the location where the current `LView` is declared at.\n *\n * @param lView an `LView` that we want to find parent `TNode` for.\n */\nfunction getDeclarationTNode(lView) {\n const tView = lView[TVIEW];\n // Return the declaration parent for embedded views\n if (tView.type === 2 /* Embedded */) {\n ngDevMode && assertDefined(tView.declTNode, 'Embedded TNodes should have declaration parents.');\n return tView.declTNode;\n }\n // Components don't have `TView.declTNode` because each instance of component could be\n // inserted in different location, hence `TView.declTNode` is meaningless.\n // Falling back to `T_HOST` in case we cross component boundary.\n if (tView.type === 1 /* Component */) {\n return lView[T_HOST];\n }\n // Remaining TNode type is `TViewType.Root` which doesn't have a parent TNode.\n return null;\n}\n/**\n * This is a light weight version of the `enterView` which is needed by the DI system.\n *\n * @param lView `LView` location of the DI context.\n * @param tNode `TNode` for DI context\n * @param flags DI context flags. if `SkipSelf` flag is set than we walk up the declaration\n * tree from `tNode` until we find parent declared `TElementNode`.\n * @returns `true` if we have successfully entered DI associated with `tNode` (or with declared\n * `TNode` if `flags` has `SkipSelf`). Failing to enter DI implies that no associated\n * `NodeInjector` can be found and we should instead use `ModuleInjector`.\n * - If `true` than this call must be fallowed by `leaveDI`\n * - If `false` than this call failed and we should NOT call `leaveDI`\n */\nfunction enterDI(lView, tNode, flags) {\n ngDevMode && assertLViewOrUndefined(lView);\n if (flags & InjectFlags.SkipSelf) {\n ngDevMode && assertTNodeForTView(tNode, lView[TVIEW]);\n let parentTNode = tNode;\n let parentLView = lView;\n while (true) {\n ngDevMode && assertDefined(parentTNode, 'Parent TNode should be defined');\n parentTNode = parentTNode.parent;\n if (parentTNode === null && !(flags & InjectFlags.Host)) {\n parentTNode = getDeclarationTNode(parentLView);\n if (parentTNode === null)\n break;\n // In this case, a parent exists and is definitely an element. So it will definitely\n // have an existing lView as the declaration view, which is why we can assume it's defined.\n ngDevMode && assertDefined(parentLView, 'Parent LView should be defined');\n parentLView = parentLView[DECLARATION_VIEW];\n // In Ivy there are Comment nodes that correspond to ngIf and NgFor embedded directives\n // We want to skip those and look only at Elements and ElementContainers to ensure\n // we're looking at true parent nodes, and not content or other types.\n if (parentTNode.type & (2 /* Element */ | 8 /* ElementContainer */)) {\n break;\n }\n }\n else {\n break;\n }\n }\n if (parentTNode === null) {\n // If we failed to find a parent TNode this means that we should use module injector.\n return false;\n }\n else {\n tNode = parentTNode;\n lView = parentLView;\n }\n }\n ngDevMode && assertTNodeForLView(tNode, lView);\n const lFrame = instructionState.lFrame = allocLFrame();\n lFrame.currentTNode = tNode;\n lFrame.lView = lView;\n return true;\n}\n/**\n * Swap the current lView with a new lView.\n *\n * For performance reasons we store the lView in the top level of the module.\n * This way we minimize the number of properties to read. Whenever a new view\n * is entered we have to store the lView for later, and when the view is\n * exited the state has to be restored\n *\n * @param newView New lView to become active\n * @returns the previously active lView;\n */\nfunction enterView(newView) {\n ngDevMode && assertNotEqual(newView[0], newView[1], '????');\n ngDevMode && assertLViewOrUndefined(newView);\n const newLFrame = allocLFrame();\n if (ngDevMode) {\n assertEqual(newLFrame.isParent, true, 'Expected clean LFrame');\n assertEqual(newLFrame.lView, null, 'Expected clean LFrame');\n assertEqual(newLFrame.tView, null, 'Expected clean LFrame');\n assertEqual(newLFrame.selectedIndex, -1, 'Expected clean LFrame');\n assertEqual(newLFrame.elementDepthCount, 0, 'Expected clean LFrame');\n assertEqual(newLFrame.currentDirectiveIndex, -1, 'Expected clean LFrame');\n assertEqual(newLFrame.currentNamespace, null, 'Expected clean LFrame');\n assertEqual(newLFrame.bindingRootIndex, -1, 'Expected clean LFrame');\n assertEqual(newLFrame.currentQueryIndex, 0, 'Expected clean LFrame');\n }\n const tView = newView[TVIEW];\n instructionState.lFrame = newLFrame;\n ngDevMode && tView.firstChild && assertTNodeForTView(tView.firstChild, tView);\n newLFrame.currentTNode = tView.firstChild;\n newLFrame.lView = newView;\n newLFrame.tView = tView;\n newLFrame.contextLView = newView;\n newLFrame.bindingIndex = tView.bindingStartIndex;\n newLFrame.inI18n = false;\n}\n/**\n * Allocates next free LFrame. This function tries to reuse the `LFrame`s to lower memory pressure.\n */\nfunction allocLFrame() {\n const currentLFrame = instructionState.lFrame;\n const childLFrame = currentLFrame === null ? null : currentLFrame.child;\n const newLFrame = childLFrame === null ? createLFrame(currentLFrame) : childLFrame;\n return newLFrame;\n}\nfunction createLFrame(parent) {\n const lFrame = {\n currentTNode: null,\n isParent: true,\n lView: null,\n tView: null,\n selectedIndex: -1,\n contextLView: null,\n elementDepthCount: 0,\n currentNamespace: null,\n currentDirectiveIndex: -1,\n bindingRootIndex: -1,\n bindingIndex: -1,\n currentQueryIndex: 0,\n parent: parent,\n child: null,\n inI18n: false,\n };\n parent !== null && (parent.child = lFrame); // link the new LFrame for reuse.\n return lFrame;\n}\n/**\n * A lightweight version of leave which is used with DI.\n *\n * This function only resets `currentTNode` and `LView` as those are the only properties\n * used with DI (`enterDI()`).\n *\n * NOTE: This function is reexported as `leaveDI`. However `leaveDI` has return type of `void` where\n * as `leaveViewLight` has `LFrame`. This is so that `leaveViewLight` can be used in `leaveView`.\n */\nfunction leaveViewLight() {\n const oldLFrame = instructionState.lFrame;\n instructionState.lFrame = oldLFrame.parent;\n oldLFrame.currentTNode = null;\n oldLFrame.lView = null;\n return oldLFrame;\n}\n/**\n * This is a lightweight version of the `leaveView` which is needed by the DI system.\n *\n * NOTE: this function is an alias so that we can change the type of the function to have `void`\n * return type.\n */\nconst leaveDI = leaveViewLight;\n/**\n * Leave the current `LView`\n *\n * This pops the `LFrame` with the associated `LView` from the stack.\n *\n * IMPORTANT: We must zero out the `LFrame` values here otherwise they will be retained. This is\n * because for performance reasons we don't release `LFrame` but rather keep it for next use.\n */\nfunction leaveView() {\n const oldLFrame = leaveViewLight();\n oldLFrame.isParent = true;\n oldLFrame.tView = null;\n oldLFrame.selectedIndex = -1;\n oldLFrame.contextLView = null;\n oldLFrame.elementDepthCount = 0;\n oldLFrame.currentDirectiveIndex = -1;\n oldLFrame.currentNamespace = null;\n oldLFrame.bindingRootIndex = -1;\n oldLFrame.bindingIndex = -1;\n oldLFrame.currentQueryIndex = 0;\n}\nfunction nextContextImpl(level) {\n const contextLView = instructionState.lFrame.contextLView =\n walkUpViews(level, instructionState.lFrame.contextLView);\n return contextLView[CONTEXT];\n}\nfunction walkUpViews(nestingLevel, currentView) {\n while (nestingLevel > 0) {\n ngDevMode &&\n assertDefined(currentView[DECLARATION_VIEW], 'Declaration view should be defined if nesting level is greater than 0.');\n currentView = currentView[DECLARATION_VIEW];\n nestingLevel--;\n }\n return currentView;\n}\n/**\n * Gets the currently selected element index.\n *\n * Used with {@link property} instruction (and more in the future) to identify the index in the\n * current `LView` to act on.\n */\nfunction getSelectedIndex() {\n return instructionState.lFrame.selectedIndex;\n}\n/**\n * Sets the most recent index passed to {@link select}\n *\n * Used with {@link property} instruction (and more in the future) to identify the index in the\n * current `LView` to act on.\n *\n * (Note that if an \"exit function\" was set earlier (via `setElementExitFn()`) then that will be\n * run if and when the provided `index` value is different from the current selected index value.)\n */\nfunction setSelectedIndex(index) {\n ngDevMode && index !== -1 &&\n assertGreaterThanOrEqual(index, HEADER_OFFSET, 'Index must be past HEADER_OFFSET (or -1).');\n ngDevMode &&\n assertLessThan(index, instructionState.lFrame.lView.length, 'Can\\'t set index passed end of LView');\n instructionState.lFrame.selectedIndex = index;\n}\n/**\n * Gets the `tNode` that represents currently selected element.\n */\nfunction getSelectedTNode() {\n const lFrame = instructionState.lFrame;\n return getTNode(lFrame.tView, lFrame.selectedIndex);\n}\n/**\n * Sets the namespace used to create elements to `'http://www.w3.org/2000/svg'` in global state.\n *\n * @codeGenApi\n */\nfunction ɵɵnamespaceSVG() {\n instructionState.lFrame.currentNamespace = SVG_NAMESPACE;\n}\n/**\n * Sets the namespace used to create elements to `'http://www.w3.org/1998/MathML/'` in global state.\n *\n * @codeGenApi\n */\nfunction ɵɵnamespaceMathML() {\n instructionState.lFrame.currentNamespace = MATH_ML_NAMESPACE;\n}\n/**\n * Sets the namespace used to create elements to `null`, which forces element creation to use\n * `createElement` rather than `createElementNS`.\n *\n * @codeGenApi\n */\nfunction ɵɵnamespaceHTML() {\n namespaceHTMLInternal();\n}\n/**\n * Sets the namespace used to create elements to `null`, which forces element creation to use\n * `createElement` rather than `createElementNS`.\n */\nfunction namespaceHTMLInternal() {\n instructionState.lFrame.currentNamespace = null;\n}\nfunction getNamespace() {\n return instructionState.lFrame.currentNamespace;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Adds all directive lifecycle hooks from the given `DirectiveDef` to the given `TView`.\n *\n * Must be run *only* on the first template pass.\n *\n * Sets up the pre-order hooks on the provided `tView`,\n * see {@link HookData} for details about the data structure.\n *\n * @param directiveIndex The index of the directive in LView\n * @param directiveDef The definition containing the hooks to setup in tView\n * @param tView The current TView\n */\nfunction registerPreOrderHooks(directiveIndex, directiveDef, tView) {\n ngDevMode && assertFirstCreatePass(tView);\n const { ngOnChanges, ngOnInit, ngDoCheck } = directiveDef.type.prototype;\n if (ngOnChanges) {\n const wrappedOnChanges = NgOnChangesFeatureImpl(directiveDef);\n (tView.preOrderHooks || (tView.preOrderHooks = [])).push(directiveIndex, wrappedOnChanges);\n (tView.preOrderCheckHooks || (tView.preOrderCheckHooks = []))\n .push(directiveIndex, wrappedOnChanges);\n }\n if (ngOnInit) {\n (tView.preOrderHooks || (tView.preOrderHooks = [])).push(0 - directiveIndex, ngOnInit);\n }\n if (ngDoCheck) {\n (tView.preOrderHooks || (tView.preOrderHooks = [])).push(directiveIndex, ngDoCheck);\n (tView.preOrderCheckHooks || (tView.preOrderCheckHooks = [])).push(directiveIndex, ngDoCheck);\n }\n}\n/**\n *\n * Loops through the directives on the provided `tNode` and queues hooks to be\n * run that are not initialization hooks.\n *\n * Should be executed during `elementEnd()` and similar to\n * preserve hook execution order. Content, view, and destroy hooks for projected\n * components and directives must be called *before* their hosts.\n *\n * Sets up the content, view, and destroy hooks on the provided `tView`,\n * see {@link HookData} for details about the data structure.\n *\n * NOTE: This does not set up `onChanges`, `onInit` or `doCheck`, those are set up\n * separately at `elementStart`.\n *\n * @param tView The current TView\n * @param tNode The TNode whose directives are to be searched for hooks to queue\n */\nfunction registerPostOrderHooks(tView, tNode) {\n ngDevMode && assertFirstCreatePass(tView);\n // It's necessary to loop through the directives at elementEnd() (rather than processing in\n // directiveCreate) so we can preserve the current hook order. Content, view, and destroy\n // hooks for projected components and directives must be called *before* their hosts.\n for (let i = tNode.directiveStart, end = tNode.directiveEnd; i < end; i++) {\n const directiveDef = tView.data[i];\n ngDevMode && assertDefined(directiveDef, 'Expecting DirectiveDef');\n const lifecycleHooks = directiveDef.type.prototype;\n const { ngAfterContentInit, ngAfterContentChecked, ngAfterViewInit, ngAfterViewChecked, ngOnDestroy } = lifecycleHooks;\n if (ngAfterContentInit) {\n (tView.contentHooks || (tView.contentHooks = [])).push(-i, ngAfterContentInit);\n }\n if (ngAfterContentChecked) {\n (tView.contentHooks || (tView.contentHooks = [])).push(i, ngAfterContentChecked);\n (tView.contentCheckHooks || (tView.contentCheckHooks = [])).push(i, ngAfterContentChecked);\n }\n if (ngAfterViewInit) {\n (tView.viewHooks || (tView.viewHooks = [])).push(-i, ngAfterViewInit);\n }\n if (ngAfterViewChecked) {\n (tView.viewHooks || (tView.viewHooks = [])).push(i, ngAfterViewChecked);\n (tView.viewCheckHooks || (tView.viewCheckHooks = [])).push(i, ngAfterViewChecked);\n }\n if (ngOnDestroy != null) {\n (tView.destroyHooks || (tView.destroyHooks = [])).push(i, ngOnDestroy);\n }\n }\n}\n/**\n * Executing hooks requires complex logic as we need to deal with 2 constraints.\n *\n * 1. Init hooks (ngOnInit, ngAfterContentInit, ngAfterViewInit) must all be executed once and only\n * once, across many change detection cycles. This must be true even if some hooks throw, or if\n * some recursively trigger a change detection cycle.\n * To solve that, it is required to track the state of the execution of these init hooks.\n * This is done by storing and maintaining flags in the view: the {@link InitPhaseState},\n * and the index within that phase. They can be seen as a cursor in the following structure:\n * [[onInit1, onInit2], [afterContentInit1], [afterViewInit1, afterViewInit2, afterViewInit3]]\n * They are are stored as flags in LView[FLAGS].\n *\n * 2. Pre-order hooks can be executed in batches, because of the select instruction.\n * To be able to pause and resume their execution, we also need some state about the hook's array\n * that is being processed:\n * - the index of the next hook to be executed\n * - the number of init hooks already found in the processed part of the array\n * They are are stored as flags in LView[PREORDER_HOOK_FLAGS].\n */\n/**\n * Executes pre-order check hooks ( OnChanges, DoChanges) given a view where all the init hooks were\n * executed once. This is a light version of executeInitAndCheckPreOrderHooks where we can skip read\n * / write of the init-hooks related flags.\n * @param lView The LView where hooks are defined\n * @param hooks Hooks to be run\n * @param nodeIndex 3 cases depending on the value:\n * - undefined: all hooks from the array should be executed (post-order case)\n * - null: execute hooks only from the saved index until the end of the array (pre-order case, when\n * flushing the remaining hooks)\n * - number: execute hooks only from the saved index until that node index exclusive (pre-order\n * case, when executing select(number))\n */\nfunction executeCheckHooks(lView, hooks, nodeIndex) {\n callHooks(lView, hooks, 3 /* InitPhaseCompleted */, nodeIndex);\n}\n/**\n * Executes post-order init and check hooks (one of AfterContentInit, AfterContentChecked,\n * AfterViewInit, AfterViewChecked) given a view where there are pending init hooks to be executed.\n * @param lView The LView where hooks are defined\n * @param hooks Hooks to be run\n * @param initPhase A phase for which hooks should be run\n * @param nodeIndex 3 cases depending on the value:\n * - undefined: all hooks from the array should be executed (post-order case)\n * - null: execute hooks only from the saved index until the end of the array (pre-order case, when\n * flushing the remaining hooks)\n * - number: execute hooks only from the saved index until that node index exclusive (pre-order\n * case, when executing select(number))\n */\nfunction executeInitAndCheckHooks(lView, hooks, initPhase, nodeIndex) {\n ngDevMode &&\n assertNotEqual(initPhase, 3 /* InitPhaseCompleted */, 'Init pre-order hooks should not be called more than once');\n if ((lView[FLAGS] & 3 /* InitPhaseStateMask */) === initPhase) {\n callHooks(lView, hooks, initPhase, nodeIndex);\n }\n}\nfunction incrementInitPhaseFlags(lView, initPhase) {\n ngDevMode &&\n assertNotEqual(initPhase, 3 /* InitPhaseCompleted */, 'Init hooks phase should not be incremented after all init hooks have been run.');\n let flags = lView[FLAGS];\n if ((flags & 3 /* InitPhaseStateMask */) === initPhase) {\n flags &= 2047 /* IndexWithinInitPhaseReset */;\n flags += 1 /* InitPhaseStateIncrementer */;\n lView[FLAGS] = flags;\n }\n}\n/**\n * Calls lifecycle hooks with their contexts, skipping init hooks if it's not\n * the first LView pass\n *\n * @param currentView The current view\n * @param arr The array in which the hooks are found\n * @param initPhaseState the current state of the init phase\n * @param currentNodeIndex 3 cases depending on the value:\n * - undefined: all hooks from the array should be executed (post-order case)\n * - null: execute hooks only from the saved index until the end of the array (pre-order case, when\n * flushing the remaining hooks)\n * - number: execute hooks only from the saved index until that node index exclusive (pre-order\n * case, when executing select(number))\n */\nfunction callHooks(currentView, arr, initPhase, currentNodeIndex) {\n ngDevMode &&\n assertEqual(isInCheckNoChangesMode(), false, 'Hooks should never be run when in check no changes mode.');\n const startIndex = currentNodeIndex !== undefined ?\n (currentView[PREORDER_HOOK_FLAGS] & 65535 /* IndexOfTheNextPreOrderHookMaskMask */) :\n 0;\n const nodeIndexLimit = currentNodeIndex != null ? currentNodeIndex : -1;\n const max = arr.length - 1; // Stop the loop at length - 1, because we look for the hook at i + 1\n let lastNodeIndexFound = 0;\n for (let i = startIndex; i < max; i++) {\n const hook = arr[i + 1];\n if (typeof hook === 'number') {\n lastNodeIndexFound = arr[i];\n if (currentNodeIndex != null && lastNodeIndexFound >= currentNodeIndex) {\n break;\n }\n }\n else {\n const isInitHook = arr[i] < 0;\n if (isInitHook)\n currentView[PREORDER_HOOK_FLAGS] += 65536 /* NumberOfInitHooksCalledIncrementer */;\n if (lastNodeIndexFound < nodeIndexLimit || nodeIndexLimit == -1) {\n callHook(currentView, initPhase, arr, i);\n currentView[PREORDER_HOOK_FLAGS] =\n (currentView[PREORDER_HOOK_FLAGS] & 4294901760 /* NumberOfInitHooksCalledMask */) + i +\n 2;\n }\n i++;\n }\n }\n}\n/**\n * Execute one hook against the current `LView`.\n *\n * @param currentView The current view\n * @param initPhaseState the current state of the init phase\n * @param arr The array in which the hooks are found\n * @param i The current index within the hook data array\n */\nfunction callHook(currentView, initPhase, arr, i) {\n const isInitHook = arr[i] < 0;\n const hook = arr[i + 1];\n const directiveIndex = isInitHook ? -arr[i] : arr[i];\n const directive = currentView[directiveIndex];\n if (isInitHook) {\n const indexWithintInitPhase = currentView[FLAGS] >> 11 /* IndexWithinInitPhaseShift */;\n // The init phase state must be always checked here as it may have been recursively updated.\n if (indexWithintInitPhase <\n (currentView[PREORDER_HOOK_FLAGS] >> 16 /* NumberOfInitHooksCalledShift */) &&\n (currentView[FLAGS] & 3 /* InitPhaseStateMask */) === initPhase) {\n currentView[FLAGS] += 2048 /* IndexWithinInitPhaseIncrementer */;\n hook.call(directive);\n }\n }\n else {\n hook.call(directive);\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nconst NO_PARENT_INJECTOR = -1;\n/**\n * Each injector is saved in 9 contiguous slots in `LView` and 9 contiguous slots in\n * `TView.data`. This allows us to store information about the current node's tokens (which\n * can be shared in `TView`) as well as the tokens of its ancestor nodes (which cannot be\n * shared, so they live in `LView`).\n *\n * Each of these slots (aside from the last slot) contains a bloom filter. This bloom filter\n * determines whether a directive is available on the associated node or not. This prevents us\n * from searching the directives array at this level unless it's probable the directive is in it.\n *\n * See: https://en.wikipedia.org/wiki/Bloom_filter for more about bloom filters.\n *\n * Because all injectors have been flattened into `LView` and `TViewData`, they cannot typed\n * using interfaces as they were previously. The start index of each `LInjector` and `TInjector`\n * will differ based on where it is flattened into the main array, so it's not possible to know\n * the indices ahead of time and save their types here. The interfaces are still included here\n * for documentation purposes.\n *\n * export interface LInjector extends Array {\n *\n * // Cumulative bloom for directive IDs 0-31 (IDs are % BLOOM_SIZE)\n * [0]: number;\n *\n * // Cumulative bloom for directive IDs 32-63\n * [1]: number;\n *\n * // Cumulative bloom for directive IDs 64-95\n * [2]: number;\n *\n * // Cumulative bloom for directive IDs 96-127\n * [3]: number;\n *\n * // Cumulative bloom for directive IDs 128-159\n * [4]: number;\n *\n * // Cumulative bloom for directive IDs 160 - 191\n * [5]: number;\n *\n * // Cumulative bloom for directive IDs 192 - 223\n * [6]: number;\n *\n * // Cumulative bloom for directive IDs 224 - 255\n * [7]: number;\n *\n * // We need to store a reference to the injector's parent so DI can keep looking up\n * // the injector tree until it finds the dependency it's looking for.\n * [PARENT_INJECTOR]: number;\n * }\n *\n * export interface TInjector extends Array {\n *\n * // Shared node bloom for directive IDs 0-31 (IDs are % BLOOM_SIZE)\n * [0]: number;\n *\n * // Shared node bloom for directive IDs 32-63\n * [1]: number;\n *\n * // Shared node bloom for directive IDs 64-95\n * [2]: number;\n *\n * // Shared node bloom for directive IDs 96-127\n * [3]: number;\n *\n * // Shared node bloom for directive IDs 128-159\n * [4]: number;\n *\n * // Shared node bloom for directive IDs 160 - 191\n * [5]: number;\n *\n * // Shared node bloom for directive IDs 192 - 223\n * [6]: number;\n *\n * // Shared node bloom for directive IDs 224 - 255\n * [7]: number;\n *\n * // Necessary to find directive indices for a particular node.\n * [TNODE]: TElementNode|TElementContainerNode|TContainerNode;\n * }\n */\n/**\n * Factory for creating instances of injectors in the NodeInjector.\n *\n * This factory is complicated by the fact that it can resolve `multi` factories as well.\n *\n * NOTE: Some of the fields are optional which means that this class has two hidden classes.\n * - One without `multi` support (most common)\n * - One with `multi` values, (rare).\n *\n * Since VMs can cache up to 4 inline hidden classes this is OK.\n *\n * - Single factory: Only `resolving` and `factory` is defined.\n * - `providers` factory: `componentProviders` is a number and `index = -1`.\n * - `viewProviders` factory: `componentProviders` is a number and `index` points to `providers`.\n */\nclass NodeInjectorFactory {\n constructor(\n /**\n * Factory to invoke in order to create a new instance.\n */\n factory, \n /**\n * Set to `true` if the token is declared in `viewProviders` (or if it is component).\n */\n isViewProvider, injectImplementation) {\n this.factory = factory;\n /**\n * Marker set to true during factory invocation to see if we get into recursive loop.\n * Recursive loop causes an error to be displayed.\n */\n this.resolving = false;\n ngDevMode && assertDefined(factory, 'Factory not specified');\n ngDevMode && assertEqual(typeof factory, 'function', 'Expected factory function.');\n this.canSeeViewProviders = isViewProvider;\n this.injectImpl = injectImplementation;\n }\n}\nfunction isFactory(obj) {\n return obj instanceof NodeInjectorFactory;\n}\n// Note: This hack is necessary so we don't erroneously get a circular dependency\n// failure based on types.\nconst unusedValueExportToPlacateAjd$3 = 1;\n\n/**\n * Converts `TNodeType` into human readable text.\n * Make sure this matches with `TNodeType`\n */\nfunction toTNodeTypeAsString(tNodeType) {\n let text = '';\n (tNodeType & 1 /* Text */) && (text += '|Text');\n (tNodeType & 2 /* Element */) && (text += '|Element');\n (tNodeType & 4 /* Container */) && (text += '|Container');\n (tNodeType & 8 /* ElementContainer */) && (text += '|ElementContainer');\n (tNodeType & 16 /* Projection */) && (text += '|Projection');\n (tNodeType & 32 /* Icu */) && (text += '|IcuContainer');\n (tNodeType & 64 /* Placeholder */) && (text += '|Placeholder');\n return text.length > 0 ? text.substring(1) : text;\n}\n// Note: This hack is necessary so we don't erroneously get a circular dependency\n// failure based on types.\nconst unusedValueExportToPlacateAjd$4 = 1;\n/**\n * Returns `true` if the `TNode` has a directive which has `@Input()` for `class` binding.\n *\n * ```\n * \n * ```\n * and\n * ```\n * @Directive({\n * })\n * class MyDirective {\n * @Input()\n * class: string;\n * }\n * ```\n *\n * In the above case it is necessary to write the reconciled styling information into the\n * directive's input.\n *\n * @param tNode\n */\nfunction hasClassInput(tNode) {\n return (tNode.flags & 16 /* hasClassInput */) !== 0;\n}\n/**\n * Returns `true` if the `TNode` has a directive which has `@Input()` for `style` binding.\n *\n * ```\n * \n * ```\n * and\n * ```\n * @Directive({\n * })\n * class MyDirective {\n * @Input()\n * class: string;\n * }\n * ```\n *\n * In the above case it is necessary to write the reconciled styling information into the\n * directive's input.\n *\n * @param tNode\n */\nfunction hasStyleInput(tNode) {\n return (tNode.flags & 32 /* hasStyleInput */) !== 0;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nfunction assertTNodeType(tNode, expectedTypes, message) {\n assertDefined(tNode, 'should be called with a TNode');\n if ((tNode.type & expectedTypes) === 0) {\n throwError(message ||\n `Expected [${toTNodeTypeAsString(expectedTypes)}] but got ${toTNodeTypeAsString(tNode.type)}.`);\n }\n}\nfunction assertPureTNodeType(type) {\n if (!(type === 2 /* Element */ || //\n type === 1 /* Text */ || //\n type === 4 /* Container */ || //\n type === 8 /* ElementContainer */ || //\n type === 32 /* Icu */ || //\n type === 16 /* Projection */ || //\n type === 64 /* Placeholder */)) {\n throwError(`Expected TNodeType to have only a single type selected, but got ${toTNodeTypeAsString(type)}.`);\n }\n}\n\n/**\n * Assigns all attribute values to the provided element via the inferred renderer.\n *\n * This function accepts two forms of attribute entries:\n *\n * default: (key, value):\n * attrs = [key1, value1, key2, value2]\n *\n * namespaced: (NAMESPACE_MARKER, uri, name, value)\n * attrs = [NAMESPACE_MARKER, uri, name, value, NAMESPACE_MARKER, uri, name, value]\n *\n * The `attrs` array can contain a mix of both the default and namespaced entries.\n * The \"default\" values are set without a marker, but if the function comes across\n * a marker value then it will attempt to set a namespaced value. If the marker is\n * not of a namespaced value then the function will quit and return the index value\n * where it stopped during the iteration of the attrs array.\n *\n * See [AttributeMarker] to understand what the namespace marker value is.\n *\n * Note that this instruction does not support assigning style and class values to\n * an element. See `elementStart` and `elementHostAttrs` to learn how styling values\n * are applied to an element.\n * @param renderer The renderer to be used\n * @param native The element that the attributes will be assigned to\n * @param attrs The attribute array of values that will be assigned to the element\n * @returns the index value that was last accessed in the attributes array\n */\nfunction setUpAttributes(renderer, native, attrs) {\n const isProc = isProceduralRenderer(renderer);\n let i = 0;\n while (i < attrs.length) {\n const value = attrs[i];\n if (typeof value === 'number') {\n // only namespaces are supported. Other value types (such as style/class\n // entries) are not supported in this function.\n if (value !== 0 /* NamespaceURI */) {\n break;\n }\n // we just landed on the marker value ... therefore\n // we should skip to the next entry\n i++;\n const namespaceURI = attrs[i++];\n const attrName = attrs[i++];\n const attrVal = attrs[i++];\n ngDevMode && ngDevMode.rendererSetAttribute++;\n isProc ?\n renderer.setAttribute(native, attrName, attrVal, namespaceURI) :\n native.setAttributeNS(namespaceURI, attrName, attrVal);\n }\n else {\n // attrName is string;\n const attrName = value;\n const attrVal = attrs[++i];\n // Standard attributes\n ngDevMode && ngDevMode.rendererSetAttribute++;\n if (isAnimationProp(attrName)) {\n if (isProc) {\n renderer.setProperty(native, attrName, attrVal);\n }\n }\n else {\n isProc ?\n renderer.setAttribute(native, attrName, attrVal) :\n native.setAttribute(attrName, attrVal);\n }\n i++;\n }\n }\n // another piece of code may iterate over the same attributes array. Therefore\n // it may be helpful to return the exact spot where the attributes array exited\n // whether by running into an unsupported marker or if all the static values were\n // iterated over.\n return i;\n}\n/**\n * Test whether the given value is a marker that indicates that the following\n * attribute values in a `TAttributes` array are only the names of attributes,\n * and not name-value pairs.\n * @param marker The attribute marker to test.\n * @returns true if the marker is a \"name-only\" marker (e.g. `Bindings`, `Template` or `I18n`).\n */\nfunction isNameOnlyAttributeMarker(marker) {\n return marker === 3 /* Bindings */ || marker === 4 /* Template */ ||\n marker === 6 /* I18n */;\n}\nfunction isAnimationProp(name) {\n // Perf note: accessing charCodeAt to check for the first character of a string is faster as\n // compared to accessing a character at index 0 (ex. name[0]). The main reason for this is that\n // charCodeAt doesn't allocate memory to return a substring.\n return name.charCodeAt(0) === 64 /* AT_SIGN */;\n}\n/**\n * Merges `src` `TAttributes` into `dst` `TAttributes` removing any duplicates in the process.\n *\n * This merge function keeps the order of attrs same.\n *\n * @param dst Location of where the merged `TAttributes` should end up.\n * @param src `TAttributes` which should be appended to `dst`\n */\nfunction mergeHostAttrs(dst, src) {\n if (src === null || src.length === 0) {\n // do nothing\n }\n else if (dst === null || dst.length === 0) {\n // We have source, but dst is empty, just make a copy.\n dst = src.slice();\n }\n else {\n let srcMarker = -1 /* ImplicitAttributes */;\n for (let i = 0; i < src.length; i++) {\n const item = src[i];\n if (typeof item === 'number') {\n srcMarker = item;\n }\n else {\n if (srcMarker === 0 /* NamespaceURI */) {\n // Case where we need to consume `key1`, `key2`, `value` items.\n }\n else if (srcMarker === -1 /* ImplicitAttributes */ ||\n srcMarker === 2 /* Styles */) {\n // Case where we have to consume `key1` and `value` only.\n mergeHostAttribute(dst, srcMarker, item, null, src[++i]);\n }\n else {\n // Case where we have to consume `key1` only.\n mergeHostAttribute(dst, srcMarker, item, null, null);\n }\n }\n }\n }\n return dst;\n}\n/**\n * Append `key`/`value` to existing `TAttributes` taking region marker and duplicates into account.\n *\n * @param dst `TAttributes` to append to.\n * @param marker Region where the `key`/`value` should be added.\n * @param key1 Key to add to `TAttributes`\n * @param key2 Key to add to `TAttributes` (in case of `AttributeMarker.NamespaceURI`)\n * @param value Value to add or to overwrite to `TAttributes` Only used if `marker` is not Class.\n */\nfunction mergeHostAttribute(dst, marker, key1, key2, value) {\n let i = 0;\n // Assume that new markers will be inserted at the end.\n let markerInsertPosition = dst.length;\n // scan until correct type.\n if (marker === -1 /* ImplicitAttributes */) {\n markerInsertPosition = -1;\n }\n else {\n while (i < dst.length) {\n const dstValue = dst[i++];\n if (typeof dstValue === 'number') {\n if (dstValue === marker) {\n markerInsertPosition = -1;\n break;\n }\n else if (dstValue > marker) {\n // We need to save this as we want the markers to be inserted in specific order.\n markerInsertPosition = i - 1;\n break;\n }\n }\n }\n }\n // search until you find place of insertion\n while (i < dst.length) {\n const item = dst[i];\n if (typeof item === 'number') {\n // since `i` started as the index after the marker, we did not find it if we are at the next\n // marker\n break;\n }\n else if (item === key1) {\n // We already have same token\n if (key2 === null) {\n if (value !== null) {\n dst[i + 1] = value;\n }\n return;\n }\n else if (key2 === dst[i + 1]) {\n dst[i + 2] = value;\n return;\n }\n }\n // Increment counter.\n i++;\n if (key2 !== null)\n i++;\n if (value !== null)\n i++;\n }\n // insert at location.\n if (markerInsertPosition !== -1) {\n dst.splice(markerInsertPosition, 0, marker);\n i = markerInsertPosition + 1;\n }\n dst.splice(i++, 0, key1);\n if (key2 !== null) {\n dst.splice(i++, 0, key2);\n }\n if (value !== null) {\n dst.splice(i++, 0, value);\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/// Parent Injector Utils ///////////////////////////////////////////////////////////////\nfunction hasParentInjector(parentLocation) {\n return parentLocation !== NO_PARENT_INJECTOR;\n}\nfunction getParentInjectorIndex(parentLocation) {\n ngDevMode && assertNumber(parentLocation, 'Number expected');\n ngDevMode && assertNotEqual(parentLocation, -1, 'Not a valid state.');\n const parentInjectorIndex = parentLocation & 32767 /* InjectorIndexMask */;\n ngDevMode &&\n assertGreaterThan(parentInjectorIndex, HEADER_OFFSET, 'Parent injector must be pointing past HEADER_OFFSET.');\n return parentLocation & 32767 /* InjectorIndexMask */;\n}\nfunction getParentInjectorViewOffset(parentLocation) {\n return parentLocation >> 16 /* ViewOffsetShift */;\n}\n/**\n * Unwraps a parent injector location number to find the view offset from the current injector,\n * then walks up the declaration view tree until the view is found that contains the parent\n * injector.\n *\n * @param location The location of the parent injector, which contains the view offset\n * @param startView The LView instance from which to start walking up the view tree\n * @returns The LView instance that contains the parent injector\n */\nfunction getParentInjectorView(location, startView) {\n let viewOffset = getParentInjectorViewOffset(location);\n let parentView = startView;\n // For most cases, the parent injector can be found on the host node (e.g. for component\n // or container), but we must keep the loop here to support the rarer case of deeply nested\n // tags or inline views, where the parent injector might live many views\n // above the child injector.\n while (viewOffset > 0) {\n parentView = parentView[DECLARATION_VIEW];\n viewOffset--;\n }\n return parentView;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Defines if the call to `inject` should include `viewProviders` in its resolution.\n *\n * This is set to true when we try to instantiate a component. This value is reset in\n * `getNodeInjectable` to a value which matches the declaration location of the token about to be\n * instantiated. This is done so that if we are injecting a token which was declared outside of\n * `viewProviders` we don't accidentally pull `viewProviders` in.\n *\n * Example:\n *\n * ```\n * @Injectable()\n * class MyService {\n * constructor(public value: String) {}\n * }\n *\n * @Component({\n * providers: [\n * MyService,\n * {provide: String, value: 'providers' }\n * ]\n * viewProviders: [\n * {provide: String, value: 'viewProviders'}\n * ]\n * })\n * class MyComponent {\n * constructor(myService: MyService, value: String) {\n * // We expect that Component can see into `viewProviders`.\n * expect(value).toEqual('viewProviders');\n * // `MyService` was not declared in `viewProviders` hence it can't see it.\n * expect(myService.value).toEqual('providers');\n * }\n * }\n *\n * ```\n */\nlet includeViewProviders = true;\nfunction setIncludeViewProviders(v) {\n const oldValue = includeViewProviders;\n includeViewProviders = v;\n return oldValue;\n}\n/**\n * The number of slots in each bloom filter (used by DI). The larger this number, the fewer\n * directives that will share slots, and thus, the fewer false positives when checking for\n * the existence of a directive.\n */\nconst BLOOM_SIZE = 256;\nconst BLOOM_MASK = BLOOM_SIZE - 1;\n/** Counter used to generate unique IDs for directives. */\nlet nextNgElementId = 0;\n/**\n * Registers this directive as present in its node's injector by flipping the directive's\n * corresponding bit in the injector's bloom filter.\n *\n * @param injectorIndex The index of the node injector where this token should be registered\n * @param tView The TView for the injector's bloom filters\n * @param type The directive token to register\n */\nfunction bloomAdd(injectorIndex, tView, type) {\n ngDevMode && assertEqual(tView.firstCreatePass, true, 'expected firstCreatePass to be true');\n let id;\n if (typeof type === 'string') {\n id = type.charCodeAt(0) || 0;\n }\n else if (type.hasOwnProperty(NG_ELEMENT_ID)) {\n id = type[NG_ELEMENT_ID];\n }\n // Set a unique ID on the directive type, so if something tries to inject the directive,\n // we can easily retrieve the ID and hash it into the bloom bit that should be checked.\n if (id == null) {\n id = type[NG_ELEMENT_ID] = nextNgElementId++;\n }\n // We only have BLOOM_SIZE (256) slots in our bloom filter (8 buckets * 32 bits each),\n // so all unique IDs must be modulo-ed into a number from 0 - 255 to fit into the filter.\n const bloomBit = id & BLOOM_MASK;\n // Create a mask that targets the specific bit associated with the directive.\n // JS bit operations are 32 bits, so this will be a number between 2^0 and 2^31, corresponding\n // to bit positions 0 - 31 in a 32 bit integer.\n const mask = 1 << bloomBit;\n // Use the raw bloomBit number to determine which bloom filter bucket we should check\n // e.g: bf0 = [0 - 31], bf1 = [32 - 63], bf2 = [64 - 95], bf3 = [96 - 127], etc\n const b7 = bloomBit & 0x80;\n const b6 = bloomBit & 0x40;\n const b5 = bloomBit & 0x20;\n const tData = tView.data;\n if (b7) {\n b6 ? (b5 ? (tData[injectorIndex + 7] |= mask) : (tData[injectorIndex + 6] |= mask)) :\n (b5 ? (tData[injectorIndex + 5] |= mask) : (tData[injectorIndex + 4] |= mask));\n }\n else {\n b6 ? (b5 ? (tData[injectorIndex + 3] |= mask) : (tData[injectorIndex + 2] |= mask)) :\n (b5 ? (tData[injectorIndex + 1] |= mask) : (tData[injectorIndex] |= mask));\n }\n}\n/**\n * Creates (or gets an existing) injector for a given element or container.\n *\n * @param tNode for which an injector should be retrieved / created.\n * @param lView View where the node is stored\n * @returns Node injector\n */\nfunction getOrCreateNodeInjectorForNode(tNode, lView) {\n const existingInjectorIndex = getInjectorIndex(tNode, lView);\n if (existingInjectorIndex !== -1) {\n return existingInjectorIndex;\n }\n const tView = lView[TVIEW];\n if (tView.firstCreatePass) {\n tNode.injectorIndex = lView.length;\n insertBloom(tView.data, tNode); // foundation for node bloom\n insertBloom(lView, null); // foundation for cumulative bloom\n insertBloom(tView.blueprint, null);\n }\n const parentLoc = getParentInjectorLocation(tNode, lView);\n const injectorIndex = tNode.injectorIndex;\n // If a parent injector can't be found, its location is set to -1.\n // In that case, we don't need to set up a cumulative bloom\n if (hasParentInjector(parentLoc)) {\n const parentIndex = getParentInjectorIndex(parentLoc);\n const parentLView = getParentInjectorView(parentLoc, lView);\n const parentData = parentLView[TVIEW].data;\n // Creates a cumulative bloom filter that merges the parent's bloom filter\n // and its own cumulative bloom (which contains tokens for all ancestors)\n for (let i = 0; i < 8 /* BLOOM_SIZE */; i++) {\n lView[injectorIndex + i] = parentLView[parentIndex + i] | parentData[parentIndex + i];\n }\n }\n lView[injectorIndex + 8 /* PARENT */] = parentLoc;\n return injectorIndex;\n}\nfunction insertBloom(arr, footer) {\n arr.push(0, 0, 0, 0, 0, 0, 0, 0, footer);\n}\nfunction getInjectorIndex(tNode, lView) {\n if (tNode.injectorIndex === -1 ||\n // If the injector index is the same as its parent's injector index, then the index has been\n // copied down from the parent node. No injector has been created yet on this node.\n (tNode.parent && tNode.parent.injectorIndex === tNode.injectorIndex) ||\n // After the first template pass, the injector index might exist but the parent values\n // might not have been calculated yet for this instance\n lView[tNode.injectorIndex + 8 /* PARENT */] === null) {\n return -1;\n }\n else {\n ngDevMode && assertIndexInRange(lView, tNode.injectorIndex);\n return tNode.injectorIndex;\n }\n}\n/**\n * Finds the index of the parent injector, with a view offset if applicable. Used to set the\n * parent injector initially.\n *\n * @returns Returns a number that is the combination of the number of LViews that we have to go up\n * to find the LView containing the parent inject AND the index of the injector within that LView.\n */\nfunction getParentInjectorLocation(tNode, lView) {\n if (tNode.parent && tNode.parent.injectorIndex !== -1) {\n // If we have a parent `TNode` and there is an injector associated with it we are done, because\n // the parent injector is within the current `LView`.\n return tNode.parent.injectorIndex; // ViewOffset is 0\n }\n // When parent injector location is computed it may be outside of the current view. (ie it could\n // be pointing to a declared parent location). This variable stores number of declaration parents\n // we need to walk up in order to find the parent injector location.\n let declarationViewOffset = 0;\n let parentTNode = null;\n let lViewCursor = lView;\n // The parent injector is not in the current `LView`. We will have to walk the declared parent\n // `LView` hierarchy and look for it. If we walk of the top, that means that there is no parent\n // `NodeInjector`.\n while (lViewCursor !== null) {\n // First determine the `parentTNode` location. The parent pointer differs based on `TView.type`.\n const tView = lViewCursor[TVIEW];\n const tViewType = tView.type;\n if (tViewType === 2 /* Embedded */) {\n ngDevMode &&\n assertDefined(tView.declTNode, 'Embedded TNodes should have declaration parents.');\n parentTNode = tView.declTNode;\n }\n else if (tViewType === 1 /* Component */) {\n // Components don't have `TView.declTNode` because each instance of component could be\n // inserted in different location, hence `TView.declTNode` is meaningless.\n parentTNode = lViewCursor[T_HOST];\n }\n else {\n ngDevMode && assertEqual(tView.type, 0 /* Root */, 'Root type expected');\n parentTNode = null;\n }\n if (parentTNode === null) {\n // If we have no parent, than we are done.\n return NO_PARENT_INJECTOR;\n }\n ngDevMode && parentTNode && assertTNodeForLView(parentTNode, lViewCursor[DECLARATION_VIEW]);\n // Every iteration of the loop requires that we go to the declared parent.\n declarationViewOffset++;\n lViewCursor = lViewCursor[DECLARATION_VIEW];\n if (parentTNode.injectorIndex !== -1) {\n // We found a NodeInjector which points to something.\n return (parentTNode.injectorIndex |\n (declarationViewOffset << 16 /* ViewOffsetShift */));\n }\n }\n return NO_PARENT_INJECTOR;\n}\n/**\n * Makes a type or an injection token public to the DI system by adding it to an\n * injector's bloom filter.\n *\n * @param di The node injector in which a directive will be added\n * @param token The type or the injection token to be made public\n */\nfunction diPublicInInjector(injectorIndex, tView, token) {\n bloomAdd(injectorIndex, tView, token);\n}\n/**\n * Inject static attribute value into directive constructor.\n *\n * This method is used with `factory` functions which are generated as part of\n * `defineDirective` or `defineComponent`. The method retrieves the static value\n * of an attribute. (Dynamic attributes are not supported since they are not resolved\n * at the time of injection and can change over time.)\n *\n * # Example\n * Given:\n * ```\n * @Component(...)\n * class MyComponent {\n * constructor(@Attribute('title') title: string) { ... }\n * }\n * ```\n * When instantiated with\n * ```\n * \n * ```\n *\n * Then factory method generated is:\n * ```\n * MyComponent.ɵcmp = defineComponent({\n * factory: () => new MyComponent(injectAttribute('title'))\n * ...\n * })\n * ```\n *\n * @publicApi\n */\nfunction injectAttributeImpl(tNode, attrNameToInject) {\n ngDevMode && assertTNodeType(tNode, 12 /* AnyContainer */ | 3 /* AnyRNode */);\n ngDevMode && assertDefined(tNode, 'expecting tNode');\n if (attrNameToInject === 'class') {\n return tNode.classes;\n }\n if (attrNameToInject === 'style') {\n return tNode.styles;\n }\n const attrs = tNode.attrs;\n if (attrs) {\n const attrsLength = attrs.length;\n let i = 0;\n while (i < attrsLength) {\n const value = attrs[i];\n // If we hit a `Bindings` or `Template` marker then we are done.\n if (isNameOnlyAttributeMarker(value))\n break;\n // Skip namespaced attributes\n if (value === 0 /* NamespaceURI */) {\n // we skip the next two values\n // as namespaced attributes looks like\n // [..., AttributeMarker.NamespaceURI, 'http://someuri.com/test', 'test:exist',\n // 'existValue', ...]\n i = i + 2;\n }\n else if (typeof value === 'number') {\n // Skip to the first value of the marked attribute.\n i++;\n while (i < attrsLength && typeof attrs[i] === 'string') {\n i++;\n }\n }\n else if (value === attrNameToInject) {\n return attrs[i + 1];\n }\n else {\n i = i + 2;\n }\n }\n }\n return null;\n}\nfunction notFoundValueOrThrow(notFoundValue, token, flags) {\n if (flags & InjectFlags.Optional) {\n return notFoundValue;\n }\n else {\n throwProviderNotFoundError(token, 'NodeInjector');\n }\n}\n/**\n * Returns the value associated to the given token from the ModuleInjector or throws exception\n *\n * @param lView The `LView` that contains the `tNode`\n * @param token The token to look for\n * @param flags Injection flags\n * @param notFoundValue The value to return when the injection flags is `InjectFlags.Optional`\n * @returns the value from the injector or throws an exception\n */\nfunction lookupTokenUsingModuleInjector(lView, token, flags, notFoundValue) {\n if (flags & InjectFlags.Optional && notFoundValue === undefined) {\n // This must be set or the NullInjector will throw for optional deps\n notFoundValue = null;\n }\n if ((flags & (InjectFlags.Self | InjectFlags.Host)) === 0) {\n const moduleInjector = lView[INJECTOR];\n // switch to `injectInjectorOnly` implementation for module injector, since module injector\n // should not have access to Component/Directive DI scope (that may happen through\n // `directiveInject` implementation)\n const previousInjectImplementation = setInjectImplementation(undefined);\n try {\n if (moduleInjector) {\n return moduleInjector.get(token, notFoundValue, flags & InjectFlags.Optional);\n }\n else {\n return injectRootLimpMode(token, notFoundValue, flags & InjectFlags.Optional);\n }\n }\n finally {\n setInjectImplementation(previousInjectImplementation);\n }\n }\n return notFoundValueOrThrow(notFoundValue, token, flags);\n}\n/**\n * Returns the value associated to the given token from the NodeInjectors => ModuleInjector.\n *\n * Look for the injector providing the token by walking up the node injector tree and then\n * the module injector tree.\n *\n * This function patches `token` with `__NG_ELEMENT_ID__` which contains the id for the bloom\n * filter. `-1` is reserved for injecting `Injector` (implemented by `NodeInjector`)\n *\n * @param tNode The Node where the search for the injector should start\n * @param lView The `LView` that contains the `tNode`\n * @param token The token to look for\n * @param flags Injection flags\n * @param notFoundValue The value to return when the injection flags is `InjectFlags.Optional`\n * @returns the value from the injector, `null` when not found, or `notFoundValue` if provided\n */\nfunction getOrCreateInjectable(tNode, lView, token, flags = InjectFlags.Default, notFoundValue) {\n if (tNode !== null) {\n const bloomHash = bloomHashBitOrFactory(token);\n // If the ID stored here is a function, this is a special object like ElementRef or TemplateRef\n // so just call the factory function to create it.\n if (typeof bloomHash === 'function') {\n if (!enterDI(lView, tNode, flags)) {\n // Failed to enter DI, try module injector instead. If a token is injected with the @Host\n // flag, the module injector is not searched for that token in Ivy.\n return (flags & InjectFlags.Host) ?\n notFoundValueOrThrow(notFoundValue, token, flags) :\n lookupTokenUsingModuleInjector(lView, token, flags, notFoundValue);\n }\n try {\n const value = bloomHash();\n if (value == null && !(flags & InjectFlags.Optional)) {\n throwProviderNotFoundError(token);\n }\n else {\n return value;\n }\n }\n finally {\n leaveDI();\n }\n }\n else if (typeof bloomHash === 'number') {\n // A reference to the previous injector TView that was found while climbing the element\n // injector tree. This is used to know if viewProviders can be accessed on the current\n // injector.\n let previousTView = null;\n let injectorIndex = getInjectorIndex(tNode, lView);\n let parentLocation = NO_PARENT_INJECTOR;\n let hostTElementNode = flags & InjectFlags.Host ? lView[DECLARATION_COMPONENT_VIEW][T_HOST] : null;\n // If we should skip this injector, or if there is no injector on this node, start by\n // searching the parent injector.\n if (injectorIndex === -1 || flags & InjectFlags.SkipSelf) {\n parentLocation = injectorIndex === -1 ? getParentInjectorLocation(tNode, lView) :\n lView[injectorIndex + 8 /* PARENT */];\n if (parentLocation === NO_PARENT_INJECTOR || !shouldSearchParent(flags, false)) {\n injectorIndex = -1;\n }\n else {\n previousTView = lView[TVIEW];\n injectorIndex = getParentInjectorIndex(parentLocation);\n lView = getParentInjectorView(parentLocation, lView);\n }\n }\n // Traverse up the injector tree until we find a potential match or until we know there\n // *isn't* a match.\n while (injectorIndex !== -1) {\n ngDevMode && assertNodeInjector(lView, injectorIndex);\n // Check the current injector. If it matches, see if it contains token.\n const tView = lView[TVIEW];\n ngDevMode &&\n assertTNodeForLView(tView.data[injectorIndex + 8 /* TNODE */], lView);\n if (bloomHasToken(bloomHash, injectorIndex, tView.data)) {\n // At this point, we have an injector which *may* contain the token, so we step through\n // the providers and directives associated with the injector's corresponding node to get\n // the instance.\n const instance = searchTokensOnInjector(injectorIndex, lView, token, previousTView, flags, hostTElementNode);\n if (instance !== NOT_FOUND) {\n return instance;\n }\n }\n parentLocation = lView[injectorIndex + 8 /* PARENT */];\n if (parentLocation !== NO_PARENT_INJECTOR &&\n shouldSearchParent(flags, lView[TVIEW].data[injectorIndex + 8 /* TNODE */] === hostTElementNode) &&\n bloomHasToken(bloomHash, injectorIndex, lView)) {\n // The def wasn't found anywhere on this node, so it was a false positive.\n // Traverse up the tree and continue searching.\n previousTView = tView;\n injectorIndex = getParentInjectorIndex(parentLocation);\n lView = getParentInjectorView(parentLocation, lView);\n }\n else {\n // If we should not search parent OR If the ancestor bloom filter value does not have the\n // bit corresponding to the directive we can give up on traversing up to find the specific\n // injector.\n injectorIndex = -1;\n }\n }\n }\n }\n return lookupTokenUsingModuleInjector(lView, token, flags, notFoundValue);\n}\nconst NOT_FOUND = {};\nfunction createNodeInjector() {\n return new NodeInjector(getCurrentTNode(), getLView());\n}\nfunction searchTokensOnInjector(injectorIndex, lView, token, previousTView, flags, hostTElementNode) {\n const currentTView = lView[TVIEW];\n const tNode = currentTView.data[injectorIndex + 8 /* TNODE */];\n // First, we need to determine if view providers can be accessed by the starting element.\n // There are two possibilities\n const canAccessViewProviders = previousTView == null ?\n // 1) This is the first invocation `previousTView == null` which means that we are at the\n // `TNode` of where injector is starting to look. In such a case the only time we are allowed\n // to look into the ViewProviders is if:\n // - we are on a component\n // - AND the injector set `includeViewProviders` to true (implying that the token can see\n // ViewProviders because it is the Component or a Service which itself was declared in\n // ViewProviders)\n (isComponentHost(tNode) && includeViewProviders) :\n // 2) `previousTView != null` which means that we are now walking across the parent nodes.\n // In such a case we are only allowed to look into the ViewProviders if:\n // - We just crossed from child View to Parent View `previousTView != currentTView`\n // - AND the parent TNode is an Element.\n // This means that we just came from the Component's View and therefore are allowed to see\n // into the ViewProviders.\n (previousTView != currentTView && ((tNode.type & 3 /* AnyRNode */) !== 0));\n // This special case happens when there is a @host on the inject and when we are searching\n // on the host element node.\n const isHostSpecialCase = (flags & InjectFlags.Host) && hostTElementNode === tNode;\n const injectableIdx = locateDirectiveOrProvider(tNode, currentTView, token, canAccessViewProviders, isHostSpecialCase);\n if (injectableIdx !== null) {\n return getNodeInjectable(lView, currentTView, injectableIdx, tNode);\n }\n else {\n return NOT_FOUND;\n }\n}\n/**\n * Searches for the given token among the node's directives and providers.\n *\n * @param tNode TNode on which directives are present.\n * @param tView The tView we are currently processing\n * @param token Provider token or type of a directive to look for.\n * @param canAccessViewProviders Whether view providers should be considered.\n * @param isHostSpecialCase Whether the host special case applies.\n * @returns Index of a found directive or provider, or null when none found.\n */\nfunction locateDirectiveOrProvider(tNode, tView, token, canAccessViewProviders, isHostSpecialCase) {\n const nodeProviderIndexes = tNode.providerIndexes;\n const tInjectables = tView.data;\n const injectablesStart = nodeProviderIndexes & 1048575 /* ProvidersStartIndexMask */;\n const directivesStart = tNode.directiveStart;\n const directiveEnd = tNode.directiveEnd;\n const cptViewProvidersCount = nodeProviderIndexes >> 20 /* CptViewProvidersCountShift */;\n const startingIndex = canAccessViewProviders ? injectablesStart : injectablesStart + cptViewProvidersCount;\n // When the host special case applies, only the viewProviders and the component are visible\n const endIndex = isHostSpecialCase ? injectablesStart + cptViewProvidersCount : directiveEnd;\n for (let i = startingIndex; i < endIndex; i++) {\n const providerTokenOrDef = tInjectables[i];\n if (i < directivesStart && token === providerTokenOrDef ||\n i >= directivesStart && providerTokenOrDef.type === token) {\n return i;\n }\n }\n if (isHostSpecialCase) {\n const dirDef = tInjectables[directivesStart];\n if (dirDef && isComponentDef(dirDef) && dirDef.type === token) {\n return directivesStart;\n }\n }\n return null;\n}\n/**\n * Retrieve or instantiate the injectable from the `LView` at particular `index`.\n *\n * This function checks to see if the value has already been instantiated and if so returns the\n * cached `injectable`. Otherwise if it detects that the value is still a factory it\n * instantiates the `injectable` and caches the value.\n */\nfunction getNodeInjectable(lView, tView, index, tNode) {\n let value = lView[index];\n const tData = tView.data;\n if (isFactory(value)) {\n const factory = value;\n if (factory.resolving) {\n throwCyclicDependencyError(stringifyForError(tData[index]));\n }\n const previousIncludeViewProviders = setIncludeViewProviders(factory.canSeeViewProviders);\n factory.resolving = true;\n const previousInjectImplementation = factory.injectImpl ? setInjectImplementation(factory.injectImpl) : null;\n const success = enterDI(lView, tNode, InjectFlags.Default);\n ngDevMode &&\n assertEqual(success, true, 'Because flags do not contain \\`SkipSelf\\' we expect this to always succeed.');\n try {\n value = lView[index] = factory.factory(undefined, tData, lView, tNode);\n // This code path is hit for both directives and providers.\n // For perf reasons, we want to avoid searching for hooks on providers.\n // It does no harm to try (the hooks just won't exist), but the extra\n // checks are unnecessary and this is a hot path. So we check to see\n // if the index of the dependency is in the directive range for this\n // tNode. If it's not, we know it's a provider and skip hook registration.\n if (tView.firstCreatePass && index >= tNode.directiveStart) {\n ngDevMode && assertDirectiveDef(tData[index]);\n registerPreOrderHooks(index, tData[index], tView);\n }\n }\n finally {\n previousInjectImplementation !== null &&\n setInjectImplementation(previousInjectImplementation);\n setIncludeViewProviders(previousIncludeViewProviders);\n factory.resolving = false;\n leaveDI();\n }\n }\n return value;\n}\n/**\n * Returns the bit in an injector's bloom filter that should be used to determine whether or not\n * the directive might be provided by the injector.\n *\n * When a directive is public, it is added to the bloom filter and given a unique ID that can be\n * retrieved on the Type. When the directive isn't public or the token is not a directive `null`\n * is returned as the node injector can not possibly provide that token.\n *\n * @param token the injection token\n * @returns the matching bit to check in the bloom filter or `null` if the token is not known.\n * When the returned value is negative then it represents special values such as `Injector`.\n */\nfunction bloomHashBitOrFactory(token) {\n ngDevMode && assertDefined(token, 'token must be defined');\n if (typeof token === 'string') {\n return token.charCodeAt(0) || 0;\n }\n const tokenId = \n // First check with `hasOwnProperty` so we don't get an inherited ID.\n token.hasOwnProperty(NG_ELEMENT_ID) ? token[NG_ELEMENT_ID] : undefined;\n // Negative token IDs are used for special objects such as `Injector`\n if (typeof tokenId === 'number') {\n if (tokenId >= 0) {\n return tokenId & BLOOM_MASK;\n }\n else {\n ngDevMode &&\n assertEqual(tokenId, -1 /* Injector */, 'Expecting to get Special Injector Id');\n return createNodeInjector;\n }\n }\n else {\n return tokenId;\n }\n}\nfunction bloomHasToken(bloomHash, injectorIndex, injectorView) {\n // Create a mask that targets the specific bit associated with the directive we're looking for.\n // JS bit operations are 32 bits, so this will be a number between 2^0 and 2^31, corresponding\n // to bit positions 0 - 31 in a 32 bit integer.\n const mask = 1 << bloomHash;\n const b7 = bloomHash & 0x80;\n const b6 = bloomHash & 0x40;\n const b5 = bloomHash & 0x20;\n // Our bloom filter size is 256 bits, which is eight 32-bit bloom filter buckets:\n // bf0 = [0 - 31], bf1 = [32 - 63], bf2 = [64 - 95], bf3 = [96 - 127], etc.\n // Get the bloom filter value from the appropriate bucket based on the directive's bloomBit.\n let value;\n if (b7) {\n value = b6 ? (b5 ? injectorView[injectorIndex + 7] : injectorView[injectorIndex + 6]) :\n (b5 ? injectorView[injectorIndex + 5] : injectorView[injectorIndex + 4]);\n }\n else {\n value = b6 ? (b5 ? injectorView[injectorIndex + 3] : injectorView[injectorIndex + 2]) :\n (b5 ? injectorView[injectorIndex + 1] : injectorView[injectorIndex]);\n }\n // If the bloom filter value has the bit corresponding to the directive's bloomBit flipped on,\n // this injector is a potential match.\n return !!(value & mask);\n}\n/** Returns true if flags prevent parent injector from being searched for tokens */\nfunction shouldSearchParent(flags, isFirstHostTNode) {\n return !(flags & InjectFlags.Self) && !(flags & InjectFlags.Host && isFirstHostTNode);\n}\nclass NodeInjector {\n constructor(_tNode, _lView) {\n this._tNode = _tNode;\n this._lView = _lView;\n }\n get(token, notFoundValue) {\n return getOrCreateInjectable(this._tNode, this._lView, token, undefined, notFoundValue);\n }\n}\n/**\n * @codeGenApi\n */\nfunction ɵɵgetFactoryOf(type) {\n const typeAny = type;\n if (isForwardRef(type)) {\n return (() => {\n const factory = ɵɵgetFactoryOf(resolveForwardRef(typeAny));\n return factory ? factory() : null;\n });\n }\n let factory = getFactoryDef(typeAny);\n if (factory === null) {\n const injectorDef = getInjectorDef(typeAny);\n factory = injectorDef && injectorDef.factory;\n }\n return factory || null;\n}\n/**\n * @codeGenApi\n */\nfunction ɵɵgetInheritedFactory(type) {\n return noSideEffects(() => {\n const ownConstructor = type.prototype.constructor;\n const ownFactory = ownConstructor[NG_FACTORY_DEF] || ɵɵgetFactoryOf(ownConstructor);\n const objectPrototype = Object.prototype;\n let parent = Object.getPrototypeOf(type.prototype).constructor;\n // Go up the prototype until we hit `Object`.\n while (parent && parent !== objectPrototype) {\n const factory = parent[NG_FACTORY_DEF] || ɵɵgetFactoryOf(parent);\n // If we hit something that has a factory and the factory isn't the same as the type,\n // we've found the inherited factory. Note the check that the factory isn't the type's\n // own factory is redundant in most cases, but if the user has custom decorators on the\n // class, this lookup will start one level down in the prototype chain, causing us to\n // find the own factory first and potentially triggering an infinite loop downstream.\n if (factory && factory !== ownFactory) {\n return factory;\n }\n parent = Object.getPrototypeOf(parent);\n }\n // There is no factory defined. Either this was improper usage of inheritance\n // (no Angular decorator on the superclass) or there is no constructor at all\n // in the inheritance chain. Since the two cases cannot be distinguished, the\n // latter has to be assumed.\n return t => new t();\n });\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Facade for the attribute injection from DI.\n *\n * @codeGenApi\n */\nfunction ɵɵinjectAttribute(attrNameToInject) {\n return injectAttributeImpl(getCurrentTNode(), attrNameToInject);\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nconst ANNOTATIONS = '__annotations__';\nconst PARAMETERS = '__parameters__';\nconst PROP_METADATA = '__prop__metadata__';\n/**\n * @suppress {globalThis}\n */\nfunction makeDecorator(name, props, parentClass, additionalProcessing, typeFn) {\n return noSideEffects(() => {\n const metaCtor = makeMetadataCtor(props);\n function DecoratorFactory(...args) {\n if (this instanceof DecoratorFactory) {\n metaCtor.call(this, ...args);\n return this;\n }\n const annotationInstance = new DecoratorFactory(...args);\n return function TypeDecorator(cls) {\n if (typeFn)\n typeFn(cls, ...args);\n // Use of Object.defineProperty is important since it creates non-enumerable property which\n // prevents the property is copied during subclassing.\n const annotations = cls.hasOwnProperty(ANNOTATIONS) ?\n cls[ANNOTATIONS] :\n Object.defineProperty(cls, ANNOTATIONS, { value: [] })[ANNOTATIONS];\n annotations.push(annotationInstance);\n if (additionalProcessing)\n additionalProcessing(cls);\n return cls;\n };\n }\n if (parentClass) {\n DecoratorFactory.prototype = Object.create(parentClass.prototype);\n }\n DecoratorFactory.prototype.ngMetadataName = name;\n DecoratorFactory.annotationCls = DecoratorFactory;\n return DecoratorFactory;\n });\n}\nfunction makeMetadataCtor(props) {\n return function ctor(...args) {\n if (props) {\n const values = props(...args);\n for (const propName in values) {\n this[propName] = values[propName];\n }\n }\n };\n}\nfunction makeParamDecorator(name, props, parentClass) {\n return noSideEffects(() => {\n const metaCtor = makeMetadataCtor(props);\n function ParamDecoratorFactory(...args) {\n if (this instanceof ParamDecoratorFactory) {\n metaCtor.apply(this, args);\n return this;\n }\n const annotationInstance = new ParamDecoratorFactory(...args);\n ParamDecorator.annotation = annotationInstance;\n return ParamDecorator;\n function ParamDecorator(cls, unusedKey, index) {\n // Use of Object.defineProperty is important since it creates non-enumerable property which\n // prevents the property is copied during subclassing.\n const parameters = cls.hasOwnProperty(PARAMETERS) ?\n cls[PARAMETERS] :\n Object.defineProperty(cls, PARAMETERS, { value: [] })[PARAMETERS];\n // there might be gaps if some in between parameters do not have annotations.\n // we pad with nulls.\n while (parameters.length <= index) {\n parameters.push(null);\n }\n (parameters[index] = parameters[index] || []).push(annotationInstance);\n return cls;\n }\n }\n if (parentClass) {\n ParamDecoratorFactory.prototype = Object.create(parentClass.prototype);\n }\n ParamDecoratorFactory.prototype.ngMetadataName = name;\n ParamDecoratorFactory.annotationCls = ParamDecoratorFactory;\n return ParamDecoratorFactory;\n });\n}\nfunction makePropDecorator(name, props, parentClass, additionalProcessing) {\n return noSideEffects(() => {\n const metaCtor = makeMetadataCtor(props);\n function PropDecoratorFactory(...args) {\n if (this instanceof PropDecoratorFactory) {\n metaCtor.apply(this, args);\n return this;\n }\n const decoratorInstance = new PropDecoratorFactory(...args);\n function PropDecorator(target, name) {\n const constructor = target.constructor;\n // Use of Object.defineProperty is important because it creates a non-enumerable property\n // which prevents the property from being copied during subclassing.\n const meta = constructor.hasOwnProperty(PROP_METADATA) ?\n constructor[PROP_METADATA] :\n Object.defineProperty(constructor, PROP_METADATA, { value: {} })[PROP_METADATA];\n meta[name] = meta.hasOwnProperty(name) && meta[name] || [];\n meta[name].unshift(decoratorInstance);\n if (additionalProcessing)\n additionalProcessing(target, name, ...args);\n }\n return PropDecorator;\n }\n if (parentClass) {\n PropDecoratorFactory.prototype = Object.create(parentClass.prototype);\n }\n PropDecoratorFactory.prototype.ngMetadataName = name;\n PropDecoratorFactory.annotationCls = PropDecoratorFactory;\n return PropDecoratorFactory;\n });\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nfunction CREATE_ATTRIBUTE_DECORATOR__PRE_R3__() {\n return makeParamDecorator('Attribute', (attributeName) => ({ attributeName }));\n}\nfunction CREATE_ATTRIBUTE_DECORATOR__POST_R3__() {\n return makeParamDecorator('Attribute', (attributeName) => ({ attributeName, __NG_ELEMENT_ID__: () => ɵɵinjectAttribute(attributeName) }));\n}\nconst CREATE_ATTRIBUTE_DECORATOR_IMPL = CREATE_ATTRIBUTE_DECORATOR__POST_R3__;\n/**\n * Attribute decorator and metadata.\n *\n * @Annotation\n * @publicApi\n */\nconst Attribute = CREATE_ATTRIBUTE_DECORATOR_IMPL();\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Creates a token that can be used in a DI Provider.\n *\n * Use an `InjectionToken` whenever the type you are injecting is not reified (does not have a\n * runtime representation) such as when injecting an interface, callable type, array or\n * parameterized type.\n *\n * `InjectionToken` is parameterized on `T` which is the type of object which will be returned by\n * the `Injector`. This provides additional level of type safety.\n *\n * ```\n * interface MyInterface {...}\n * var myInterface = injector.get(new InjectionToken('SomeToken'));\n * // myInterface is inferred to be MyInterface.\n * ```\n *\n * When creating an `InjectionToken`, you can optionally specify a factory function which returns\n * (possibly by creating) a default value of the parameterized type `T`. This sets up the\n * `InjectionToken` using this factory as a provider as if it was defined explicitly in the\n * application's root injector. If the factory function, which takes zero arguments, needs to inject\n * dependencies, it can do so using the `inject` function. See below for an example.\n *\n * Additionally, if a `factory` is specified you can also specify the `providedIn` option, which\n * overrides the above behavior and marks the token as belonging to a particular `@NgModule`. As\n * mentioned above, `'root'` is the default value for `providedIn`.\n *\n * @usageNotes\n * ### Basic Example\n *\n * ### Plain InjectionToken\n *\n * {@example core/di/ts/injector_spec.ts region='InjectionToken'}\n *\n * ### Tree-shakable InjectionToken\n *\n * {@example core/di/ts/injector_spec.ts region='ShakableInjectionToken'}\n *\n *\n * @publicApi\n */\nclass InjectionToken {\n constructor(_desc, options) {\n this._desc = _desc;\n /** @internal */\n this.ngMetadataName = 'InjectionToken';\n this.ɵprov = undefined;\n if (typeof options == 'number') {\n (typeof ngDevMode === 'undefined' || ngDevMode) &&\n assertLessThan(options, 0, 'Only negative numbers are supported here');\n // This is a special hack to assign __NG_ELEMENT_ID__ to this instance.\n // See `InjectorMarkers`\n this.__NG_ELEMENT_ID__ = options;\n }\n else if (options !== undefined) {\n this.ɵprov = ɵɵdefineInjectable({\n token: this,\n providedIn: options.providedIn || 'root',\n factory: options.factory,\n });\n }\n }\n toString() {\n return `InjectionToken ${this._desc}`;\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * A DI token that you can use to create a virtual [provider](guide/glossary#provider)\n * that will populate the `entryComponents` field of components and NgModules\n * based on its `useValue` property value.\n * All components that are referenced in the `useValue` value (either directly\n * or in a nested array or map) are added to the `entryComponents` property.\n *\n * @usageNotes\n *\n * The following example shows how the router can populate the `entryComponents`\n * field of an NgModule based on a router configuration that refers\n * to components.\n *\n * ```typescript\n * // helper function inside the router\n * function provideRoutes(routes) {\n * return [\n * {provide: ROUTES, useValue: routes},\n * {provide: ANALYZE_FOR_ENTRY_COMPONENTS, useValue: routes, multi: true}\n * ];\n * }\n *\n * // user code\n * let routes = [\n * {path: '/root', component: RootComp},\n * {path: '/teams', component: TeamsComp}\n * ];\n *\n * @NgModule({\n * providers: [provideRoutes(routes)]\n * })\n * class ModuleWithRoutes {}\n * ```\n *\n * @publicApi\n * @deprecated Since 9.0.0. With Ivy, this property is no longer necessary.\n */\nconst ANALYZE_FOR_ENTRY_COMPONENTS = new InjectionToken('AnalyzeForEntryComponents');\n/**\n * Base class for query metadata.\n *\n * @see `ContentChildren`.\n * @see `ContentChild`.\n * @see `ViewChildren`.\n * @see `ViewChild`.\n *\n * @publicApi\n */\nclass Query {\n}\nconst ɵ0$1 = (selector, data = {}) => (Object.assign({ selector, first: false, isViewQuery: false, descendants: false }, data));\n/**\n * ContentChildren decorator and metadata.\n *\n *\n * @Annotation\n * @publicApi\n */\nconst ContentChildren = makePropDecorator('ContentChildren', ɵ0$1, Query);\nconst ɵ1 = (selector, data = {}) => (Object.assign({ selector, first: true, isViewQuery: false, descendants: true }, data));\n/**\n * ContentChild decorator and metadata.\n *\n *\n * @Annotation\n *\n * @publicApi\n */\nconst ContentChild = makePropDecorator('ContentChild', ɵ1, Query);\nconst ɵ2 = (selector, data = {}) => (Object.assign({ selector, first: false, isViewQuery: true, descendants: true }, data));\n/**\n * ViewChildren decorator and metadata.\n *\n * @Annotation\n * @publicApi\n */\nconst ViewChildren = makePropDecorator('ViewChildren', ɵ2, Query);\nconst ɵ3 = (selector, data) => (Object.assign({ selector, first: true, isViewQuery: true, descendants: true }, data));\n/**\n * ViewChild decorator and metadata.\n *\n * @Annotation\n * @publicApi\n */\nconst ViewChild = makePropDecorator('ViewChild', ɵ3, Query);\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nvar R3ResolvedDependencyType;\n(function (R3ResolvedDependencyType) {\n R3ResolvedDependencyType[R3ResolvedDependencyType[\"Token\"] = 0] = \"Token\";\n R3ResolvedDependencyType[R3ResolvedDependencyType[\"Attribute\"] = 1] = \"Attribute\";\n R3ResolvedDependencyType[R3ResolvedDependencyType[\"ChangeDetectorRef\"] = 2] = \"ChangeDetectorRef\";\n R3ResolvedDependencyType[R3ResolvedDependencyType[\"Invalid\"] = 3] = \"Invalid\";\n})(R3ResolvedDependencyType || (R3ResolvedDependencyType = {}));\nvar R3FactoryTarget;\n(function (R3FactoryTarget) {\n R3FactoryTarget[R3FactoryTarget[\"Directive\"] = 0] = \"Directive\";\n R3FactoryTarget[R3FactoryTarget[\"Component\"] = 1] = \"Component\";\n R3FactoryTarget[R3FactoryTarget[\"Injectable\"] = 2] = \"Injectable\";\n R3FactoryTarget[R3FactoryTarget[\"Pipe\"] = 3] = \"Pipe\";\n R3FactoryTarget[R3FactoryTarget[\"NgModule\"] = 4] = \"NgModule\";\n})(R3FactoryTarget || (R3FactoryTarget = {}));\nvar ViewEncapsulation$1;\n(function (ViewEncapsulation) {\n ViewEncapsulation[ViewEncapsulation[\"Emulated\"] = 0] = \"Emulated\";\n // Historically the 1 value was for `Native` encapsulation which has been removed as of v11.\n ViewEncapsulation[ViewEncapsulation[\"None\"] = 2] = \"None\";\n ViewEncapsulation[ViewEncapsulation[\"ShadowDom\"] = 3] = \"ShadowDom\";\n})(ViewEncapsulation$1 || (ViewEncapsulation$1 = {}));\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nfunction getCompilerFacade() {\n const globalNg = _global['ng'];\n if (!globalNg || !globalNg.ɵcompilerFacade) {\n throw new Error(`Angular JIT compilation failed: '@angular/compiler' not loaded!\\n` +\n ` - JIT compilation is discouraged for production use-cases! Consider AOT mode instead.\\n` +\n ` - Did you bootstrap using '@angular/platform-browser-dynamic' or '@angular/platform-server'?\\n` +\n ` - Alternatively provide the compiler with 'import \"@angular/compiler\";' before bootstrapping.`);\n }\n return globalNg.ɵcompilerFacade;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * @description\n *\n * Represents a type that a Component or other object is instances of.\n *\n * An example of a `Type` is `MyCustomComponent` class, which in JavaScript is represented by\n * the `MyCustomComponent` constructor function.\n *\n * @publicApi\n */\nconst Type = Function;\nfunction isType(v) {\n return typeof v === 'function';\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Equivalent to ES6 spread, add each item to an array.\n *\n * @param items The items to add\n * @param arr The array to which you want to add the items\n */\nfunction addAllToArray(items, arr) {\n for (let i = 0; i < items.length; i++) {\n arr.push(items[i]);\n }\n}\n/**\n * Flattens an array.\n */\nfunction flatten(list, dst) {\n if (dst === undefined)\n dst = list;\n for (let i = 0; i < list.length; i++) {\n let item = list[i];\n if (Array.isArray(item)) {\n // we need to inline it.\n if (dst === list) {\n // Our assumption that the list was already flat was wrong and\n // we need to clone flat since we need to write to it.\n dst = list.slice(0, i);\n }\n flatten(item, dst);\n }\n else if (dst !== list) {\n dst.push(item);\n }\n }\n return dst;\n}\nfunction deepForEach(input, fn) {\n input.forEach(value => Array.isArray(value) ? deepForEach(value, fn) : fn(value));\n}\nfunction addToArray(arr, index, value) {\n // perf: array.push is faster than array.splice!\n if (index >= arr.length) {\n arr.push(value);\n }\n else {\n arr.splice(index, 0, value);\n }\n}\nfunction removeFromArray(arr, index) {\n // perf: array.pop is faster than array.splice!\n if (index >= arr.length - 1) {\n return arr.pop();\n }\n else {\n return arr.splice(index, 1)[0];\n }\n}\nfunction newArray(size, value) {\n const list = [];\n for (let i = 0; i < size; i++) {\n list.push(value);\n }\n return list;\n}\n/**\n * Remove item from array (Same as `Array.splice()` but faster.)\n *\n * `Array.splice()` is not as fast because it has to allocate an array for the elements which were\n * removed. This causes memory pressure and slows down code when most of the time we don't\n * care about the deleted items array.\n *\n * https://jsperf.com/fast-array-splice (About 20x faster)\n *\n * @param array Array to splice\n * @param index Index of element in array to remove.\n * @param count Number of items to remove.\n */\nfunction arraySplice(array, index, count) {\n const length = array.length - count;\n while (index < length) {\n array[index] = array[index + count];\n index++;\n }\n while (count--) {\n array.pop(); // shrink the array\n }\n}\n/**\n * Same as `Array.splice(index, 0, value)` but faster.\n *\n * `Array.splice()` is not fast because it has to allocate an array for the elements which were\n * removed. This causes memory pressure and slows down code when most of the time we don't\n * care about the deleted items array.\n *\n * @param array Array to splice.\n * @param index Index in array where the `value` should be added.\n * @param value Value to add to array.\n */\nfunction arrayInsert(array, index, value) {\n ngDevMode && assertLessThanOrEqual(index, array.length, 'Can\\'t insert past array end.');\n let end = array.length;\n while (end > index) {\n const previousEnd = end - 1;\n array[end] = array[previousEnd];\n end = previousEnd;\n }\n array[index] = value;\n}\n/**\n * Same as `Array.splice2(index, 0, value1, value2)` but faster.\n *\n * `Array.splice()` is not fast because it has to allocate an array for the elements which were\n * removed. This causes memory pressure and slows down code when most of the time we don't\n * care about the deleted items array.\n *\n * @param array Array to splice.\n * @param index Index in array where the `value` should be added.\n * @param value1 Value to add to array.\n * @param value2 Value to add to array.\n */\nfunction arrayInsert2(array, index, value1, value2) {\n ngDevMode && assertLessThanOrEqual(index, array.length, 'Can\\'t insert past array end.');\n let end = array.length;\n if (end == index) {\n // inserting at the end.\n array.push(value1, value2);\n }\n else if (end === 1) {\n // corner case when we have less items in array than we have items to insert.\n array.push(value2, array[0]);\n array[0] = value1;\n }\n else {\n end--;\n array.push(array[end - 1], array[end]);\n while (end > index) {\n const previousEnd = end - 2;\n array[end] = array[previousEnd];\n end--;\n }\n array[index] = value1;\n array[index + 1] = value2;\n }\n}\n/**\n * Insert a `value` into an `array` so that the array remains sorted.\n *\n * NOTE:\n * - Duplicates are not allowed, and are ignored.\n * - This uses binary search algorithm for fast inserts.\n *\n * @param array A sorted array to insert into.\n * @param value The value to insert.\n * @returns index of the inserted value.\n */\nfunction arrayInsertSorted(array, value) {\n let index = arrayIndexOfSorted(array, value);\n if (index < 0) {\n // if we did not find it insert it.\n index = ~index;\n arrayInsert(array, index, value);\n }\n return index;\n}\n/**\n * Remove `value` from a sorted `array`.\n *\n * NOTE:\n * - This uses binary search algorithm for fast removals.\n *\n * @param array A sorted array to remove from.\n * @param value The value to remove.\n * @returns index of the removed value.\n * - positive index if value found and removed.\n * - negative index if value not found. (`~index` to get the value where it should have been\n * inserted)\n */\nfunction arrayRemoveSorted(array, value) {\n const index = arrayIndexOfSorted(array, value);\n if (index >= 0) {\n arraySplice(array, index, 1);\n }\n return index;\n}\n/**\n * Get an index of an `value` in a sorted `array`.\n *\n * NOTE:\n * - This uses binary search algorithm for fast removals.\n *\n * @param array A sorted array to binary search.\n * @param value The value to look for.\n * @returns index of the value.\n * - positive index if value found.\n * - negative index if value not found. (`~index` to get the value where it should have been\n * located)\n */\nfunction arrayIndexOfSorted(array, value) {\n return _arrayIndexOfSorted(array, value, 0);\n}\n/**\n * Set a `value` for a `key`.\n *\n * @param keyValueArray to modify.\n * @param key The key to locate or create.\n * @param value The value to set for a `key`.\n * @returns index (always even) of where the value vas set.\n */\nfunction keyValueArraySet(keyValueArray, key, value) {\n let index = keyValueArrayIndexOf(keyValueArray, key);\n if (index >= 0) {\n // if we found it set it.\n keyValueArray[index | 1] = value;\n }\n else {\n index = ~index;\n arrayInsert2(keyValueArray, index, key, value);\n }\n return index;\n}\n/**\n * Retrieve a `value` for a `key` (on `undefined` if not found.)\n *\n * @param keyValueArray to search.\n * @param key The key to locate.\n * @return The `value` stored at the `key` location or `undefined if not found.\n */\nfunction keyValueArrayGet(keyValueArray, key) {\n const index = keyValueArrayIndexOf(keyValueArray, key);\n if (index >= 0) {\n // if we found it retrieve it.\n return keyValueArray[index | 1];\n }\n return undefined;\n}\n/**\n * Retrieve a `key` index value in the array or `-1` if not found.\n *\n * @param keyValueArray to search.\n * @param key The key to locate.\n * @returns index of where the key is (or should have been.)\n * - positive (even) index if key found.\n * - negative index if key not found. (`~index` (even) to get the index where it should have\n * been inserted.)\n */\nfunction keyValueArrayIndexOf(keyValueArray, key) {\n return _arrayIndexOfSorted(keyValueArray, key, 1);\n}\n/**\n * Delete a `key` (and `value`) from the `KeyValueArray`.\n *\n * @param keyValueArray to modify.\n * @param key The key to locate or delete (if exist).\n * @returns index of where the key was (or should have been.)\n * - positive (even) index if key found and deleted.\n * - negative index if key not found. (`~index` (even) to get the index where it should have\n * been.)\n */\nfunction keyValueArrayDelete(keyValueArray, key) {\n const index = keyValueArrayIndexOf(keyValueArray, key);\n if (index >= 0) {\n // if we found it remove it.\n arraySplice(keyValueArray, index, 2);\n }\n return index;\n}\n/**\n * INTERNAL: Get an index of an `value` in a sorted `array` by grouping search by `shift`.\n *\n * NOTE:\n * - This uses binary search algorithm for fast removals.\n *\n * @param array A sorted array to binary search.\n * @param value The value to look for.\n * @param shift grouping shift.\n * - `0` means look at every location\n * - `1` means only look at every other (even) location (the odd locations are to be ignored as\n * they are values.)\n * @returns index of the value.\n * - positive index if value found.\n * - negative index if value not found. (`~index` to get the value where it should have been\n * inserted)\n */\nfunction _arrayIndexOfSorted(array, value, shift) {\n ngDevMode && assertEqual(Array.isArray(array), true, 'Expecting an array');\n let start = 0;\n let end = array.length >> shift;\n while (end !== start) {\n const middle = start + ((end - start) >> 1); // find the middle.\n const current = array[middle << shift];\n if (value === current) {\n return (middle << shift);\n }\n else if (current > value) {\n end = middle;\n }\n else {\n start = middle + 1; // We already searched middle so make it non-inclusive by adding 1\n }\n }\n return ~(end << shift);\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/*\n * #########################\n * Attention: These Regular expressions have to hold even if the code is minified!\n * ##########################\n */\n/**\n * Regular expression that detects pass-through constructors for ES5 output. This Regex\n * intends to capture the common delegation pattern emitted by TypeScript and Babel. Also\n * it intends to capture the pattern where existing constructors have been downleveled from\n * ES2015 to ES5 using TypeScript w/ downlevel iteration. e.g.\n *\n * ```\n * function MyClass() {\n * var _this = _super.apply(this, arguments) || this;\n * ```\n *\n * ```\n * function MyClass() {\n * var _this = _super.apply(this, __spread(arguments)) || this;\n * ```\n *\n * More details can be found in: https://github.com/angular/angular/issues/38453.\n */\nconst ES5_DELEGATE_CTOR = /^function\\s+\\S+\\(\\)\\s*{[\\s\\S]+\\.apply\\(this,\\s*(arguments|[^()]+\\(arguments\\))\\)/;\n/** Regular expression that detects ES2015 classes which extend from other classes. */\nconst ES2015_INHERITED_CLASS = /^class\\s+[A-Za-z\\d$_]*\\s*extends\\s+[^{]+{/;\n/**\n * Regular expression that detects ES2015 classes which extend from other classes and\n * have an explicit constructor defined.\n */\nconst ES2015_INHERITED_CLASS_WITH_CTOR = /^class\\s+[A-Za-z\\d$_]*\\s*extends\\s+[^{]+{[\\s\\S]*constructor\\s*\\(/;\n/**\n * Regular expression that detects ES2015 classes which extend from other classes\n * and inherit a constructor.\n */\nconst ES2015_INHERITED_CLASS_WITH_DELEGATE_CTOR = /^class\\s+[A-Za-z\\d$_]*\\s*extends\\s+[^{]+{[\\s\\S]*constructor\\s*\\(\\)\\s*{\\s*super\\(\\.\\.\\.arguments\\)/;\n/**\n * Determine whether a stringified type is a class which delegates its constructor\n * to its parent.\n *\n * This is not trivial since compiled code can actually contain a constructor function\n * even if the original source code did not. For instance, when the child class contains\n * an initialized instance property.\n */\nfunction isDelegateCtor(typeStr) {\n return ES5_DELEGATE_CTOR.test(typeStr) ||\n ES2015_INHERITED_CLASS_WITH_DELEGATE_CTOR.test(typeStr) ||\n (ES2015_INHERITED_CLASS.test(typeStr) && !ES2015_INHERITED_CLASS_WITH_CTOR.test(typeStr));\n}\nclass ReflectionCapabilities {\n constructor(reflect) {\n this._reflect = reflect || _global['Reflect'];\n }\n isReflectionEnabled() {\n return true;\n }\n factory(t) {\n return (...args) => new t(...args);\n }\n /** @internal */\n _zipTypesAndAnnotations(paramTypes, paramAnnotations) {\n let result;\n if (typeof paramTypes === 'undefined') {\n result = newArray(paramAnnotations.length);\n }\n else {\n result = newArray(paramTypes.length);\n }\n for (let i = 0; i < result.length; i++) {\n // TS outputs Object for parameters without types, while Traceur omits\n // the annotations. For now we preserve the Traceur behavior to aid\n // migration, but this can be revisited.\n if (typeof paramTypes === 'undefined') {\n result[i] = [];\n }\n else if (paramTypes[i] && paramTypes[i] != Object) {\n result[i] = [paramTypes[i]];\n }\n else {\n result[i] = [];\n }\n if (paramAnnotations && paramAnnotations[i] != null) {\n result[i] = result[i].concat(paramAnnotations[i]);\n }\n }\n return result;\n }\n _ownParameters(type, parentCtor) {\n const typeStr = type.toString();\n // If we have no decorators, we only have function.length as metadata.\n // In that case, to detect whether a child class declared an own constructor or not,\n // we need to look inside of that constructor to check whether it is\n // just calling the parent.\n // This also helps to work around for https://github.com/Microsoft/TypeScript/issues/12439\n // that sets 'design:paramtypes' to []\n // if a class inherits from another class but has no ctor declared itself.\n if (isDelegateCtor(typeStr)) {\n return null;\n }\n // Prefer the direct API.\n if (type.parameters && type.parameters !== parentCtor.parameters) {\n return type.parameters;\n }\n // API of tsickle for lowering decorators to properties on the class.\n const tsickleCtorParams = type.ctorParameters;\n if (tsickleCtorParams && tsickleCtorParams !== parentCtor.ctorParameters) {\n // Newer tsickle uses a function closure\n // Retain the non-function case for compatibility with older tsickle\n const ctorParameters = typeof tsickleCtorParams === 'function' ? tsickleCtorParams() : tsickleCtorParams;\n const paramTypes = ctorParameters.map((ctorParam) => ctorParam && ctorParam.type);\n const paramAnnotations = ctorParameters.map((ctorParam) => ctorParam && convertTsickleDecoratorIntoMetadata(ctorParam.decorators));\n return this._zipTypesAndAnnotations(paramTypes, paramAnnotations);\n }\n // API for metadata created by invoking the decorators.\n const paramAnnotations = type.hasOwnProperty(PARAMETERS) && type[PARAMETERS];\n const paramTypes = this._reflect && this._reflect.getOwnMetadata &&\n this._reflect.getOwnMetadata('design:paramtypes', type);\n if (paramTypes || paramAnnotations) {\n return this._zipTypesAndAnnotations(paramTypes, paramAnnotations);\n }\n // If a class has no decorators, at least create metadata\n // based on function.length.\n // Note: We know that this is a real constructor as we checked\n // the content of the constructor above.\n return newArray(type.length);\n }\n parameters(type) {\n // Note: only report metadata if we have at least one class decorator\n // to stay in sync with the static reflector.\n if (!isType(type)) {\n return [];\n }\n const parentCtor = getParentCtor(type);\n let parameters = this._ownParameters(type, parentCtor);\n if (!parameters && parentCtor !== Object) {\n parameters = this.parameters(parentCtor);\n }\n return parameters || [];\n }\n _ownAnnotations(typeOrFunc, parentCtor) {\n // Prefer the direct API.\n if (typeOrFunc.annotations && typeOrFunc.annotations !== parentCtor.annotations) {\n let annotations = typeOrFunc.annotations;\n if (typeof annotations === 'function' && annotations.annotations) {\n annotations = annotations.annotations;\n }\n return annotations;\n }\n // API of tsickle for lowering decorators to properties on the class.\n if (typeOrFunc.decorators && typeOrFunc.decorators !== parentCtor.decorators) {\n return convertTsickleDecoratorIntoMetadata(typeOrFunc.decorators);\n }\n // API for metadata created by invoking the decorators.\n if (typeOrFunc.hasOwnProperty(ANNOTATIONS)) {\n return typeOrFunc[ANNOTATIONS];\n }\n return null;\n }\n annotations(typeOrFunc) {\n if (!isType(typeOrFunc)) {\n return [];\n }\n const parentCtor = getParentCtor(typeOrFunc);\n const ownAnnotations = this._ownAnnotations(typeOrFunc, parentCtor) || [];\n const parentAnnotations = parentCtor !== Object ? this.annotations(parentCtor) : [];\n return parentAnnotations.concat(ownAnnotations);\n }\n _ownPropMetadata(typeOrFunc, parentCtor) {\n // Prefer the direct API.\n if (typeOrFunc.propMetadata &&\n typeOrFunc.propMetadata !== parentCtor.propMetadata) {\n let propMetadata = typeOrFunc.propMetadata;\n if (typeof propMetadata === 'function' && propMetadata.propMetadata) {\n propMetadata = propMetadata.propMetadata;\n }\n return propMetadata;\n }\n // API of tsickle for lowering decorators to properties on the class.\n if (typeOrFunc.propDecorators &&\n typeOrFunc.propDecorators !== parentCtor.propDecorators) {\n const propDecorators = typeOrFunc.propDecorators;\n const propMetadata = {};\n Object.keys(propDecorators).forEach(prop => {\n propMetadata[prop] = convertTsickleDecoratorIntoMetadata(propDecorators[prop]);\n });\n return propMetadata;\n }\n // API for metadata created by invoking the decorators.\n if (typeOrFunc.hasOwnProperty(PROP_METADATA)) {\n return typeOrFunc[PROP_METADATA];\n }\n return null;\n }\n propMetadata(typeOrFunc) {\n if (!isType(typeOrFunc)) {\n return {};\n }\n const parentCtor = getParentCtor(typeOrFunc);\n const propMetadata = {};\n if (parentCtor !== Object) {\n const parentPropMetadata = this.propMetadata(parentCtor);\n Object.keys(parentPropMetadata).forEach((propName) => {\n propMetadata[propName] = parentPropMetadata[propName];\n });\n }\n const ownPropMetadata = this._ownPropMetadata(typeOrFunc, parentCtor);\n if (ownPropMetadata) {\n Object.keys(ownPropMetadata).forEach((propName) => {\n const decorators = [];\n if (propMetadata.hasOwnProperty(propName)) {\n decorators.push(...propMetadata[propName]);\n }\n decorators.push(...ownPropMetadata[propName]);\n propMetadata[propName] = decorators;\n });\n }\n return propMetadata;\n }\n ownPropMetadata(typeOrFunc) {\n if (!isType(typeOrFunc)) {\n return {};\n }\n return this._ownPropMetadata(typeOrFunc, getParentCtor(typeOrFunc)) || {};\n }\n hasLifecycleHook(type, lcProperty) {\n return type instanceof Type && lcProperty in type.prototype;\n }\n guards(type) {\n return {};\n }\n getter(name) {\n return new Function('o', 'return o.' + name + ';');\n }\n setter(name) {\n return new Function('o', 'v', 'return o.' + name + ' = v;');\n }\n method(name) {\n const functionBody = `if (!o.${name}) throw new Error('\"${name}\" is undefined');\n return o.${name}.apply(o, args);`;\n return new Function('o', 'args', functionBody);\n }\n // There is not a concept of import uri in Js, but this is useful in developing Dart applications.\n importUri(type) {\n // StaticSymbol\n if (typeof type === 'object' && type['filePath']) {\n return type['filePath'];\n }\n // Runtime type\n return `./${stringify(type)}`;\n }\n resourceUri(type) {\n return `./${stringify(type)}`;\n }\n resolveIdentifier(name, moduleUrl, members, runtime) {\n return runtime;\n }\n resolveEnum(enumIdentifier, name) {\n return enumIdentifier[name];\n }\n}\nfunction convertTsickleDecoratorIntoMetadata(decoratorInvocations) {\n if (!decoratorInvocations) {\n return [];\n }\n return decoratorInvocations.map(decoratorInvocation => {\n const decoratorType = decoratorInvocation.type;\n const annotationCls = decoratorType.annotationCls;\n const annotationArgs = decoratorInvocation.args ? decoratorInvocation.args : [];\n return new annotationCls(...annotationArgs);\n });\n}\nfunction getParentCtor(ctor) {\n const parentProto = ctor.prototype ? Object.getPrototypeOf(ctor.prototype) : null;\n const parentCtor = parentProto ? parentProto.constructor : null;\n // Note: We always use `Object` as the null value\n // to simplify checking later on.\n return parentCtor || Object;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nconst ɵ0$2 = (token) => ({ token });\n/**\n * Inject decorator and metadata.\n *\n * @Annotation\n * @publicApi\n */\nconst Inject = makeParamDecorator('Inject', ɵ0$2);\n/**\n * Optional decorator and metadata.\n *\n * @Annotation\n * @publicApi\n */\nconst Optional = makeParamDecorator('Optional');\n/**\n * Self decorator and metadata.\n *\n * @Annotation\n * @publicApi\n */\nconst Self = makeParamDecorator('Self');\n/**\n * `SkipSelf` decorator and metadata.\n *\n * @Annotation\n * @publicApi\n */\nconst SkipSelf = makeParamDecorator('SkipSelf');\n/**\n * Host decorator and metadata.\n *\n * @Annotation\n * @publicApi\n */\nconst Host = makeParamDecorator('Host');\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nlet _reflect = null;\nfunction getReflect() {\n return (_reflect = _reflect || new ReflectionCapabilities());\n}\nfunction reflectDependencies(type) {\n return convertDependencies(getReflect().parameters(type));\n}\nfunction convertDependencies(deps) {\n const compiler = getCompilerFacade();\n return deps.map(dep => reflectDependency(compiler, dep));\n}\nfunction reflectDependency(compiler, dep) {\n const meta = {\n token: null,\n host: false,\n optional: false,\n resolved: compiler.R3ResolvedDependencyType.Token,\n self: false,\n skipSelf: false,\n };\n function setTokenAndResolvedType(token) {\n meta.resolved = compiler.R3ResolvedDependencyType.Token;\n meta.token = token;\n }\n if (Array.isArray(dep) && dep.length > 0) {\n for (let j = 0; j < dep.length; j++) {\n const param = dep[j];\n if (param === undefined) {\n // param may be undefined if type of dep is not set by ngtsc\n continue;\n }\n const proto = Object.getPrototypeOf(param);\n if (param instanceof Optional || proto.ngMetadataName === 'Optional') {\n meta.optional = true;\n }\n else if (param instanceof SkipSelf || proto.ngMetadataName === 'SkipSelf') {\n meta.skipSelf = true;\n }\n else if (param instanceof Self || proto.ngMetadataName === 'Self') {\n meta.self = true;\n }\n else if (param instanceof Host || proto.ngMetadataName === 'Host') {\n meta.host = true;\n }\n else if (param instanceof Inject) {\n meta.token = param.token;\n }\n else if (param instanceof Attribute) {\n if (param.attributeName === undefined) {\n throw new Error(`Attribute name must be defined.`);\n }\n meta.token = param.attributeName;\n meta.resolved = compiler.R3ResolvedDependencyType.Attribute;\n }\n else if (param.__ChangeDetectorRef__ === true) {\n meta.token = param;\n meta.resolved = compiler.R3ResolvedDependencyType.ChangeDetectorRef;\n }\n else {\n setTokenAndResolvedType(param);\n }\n }\n }\n else if (dep === undefined || (Array.isArray(dep) && dep.length === 0)) {\n meta.token = undefined;\n meta.resolved = R3ResolvedDependencyType.Invalid;\n }\n else {\n setTokenAndResolvedType(dep);\n }\n return meta;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Used to resolve resource URLs on `@Component` when used with JIT compilation.\n *\n * Example:\n * ```\n * @Component({\n * selector: 'my-comp',\n * templateUrl: 'my-comp.html', // This requires asynchronous resolution\n * })\n * class MyComponent{\n * }\n *\n * // Calling `renderComponent` will fail because `renderComponent` is a synchronous process\n * // and `MyComponent`'s `@Component.templateUrl` needs to be resolved asynchronously.\n *\n * // Calling `resolveComponentResources()` will resolve `@Component.templateUrl` into\n * // `@Component.template`, which allows `renderComponent` to proceed in a synchronous manner.\n *\n * // Use browser's `fetch()` function as the default resource resolution strategy.\n * resolveComponentResources(fetch).then(() => {\n * // After resolution all URLs have been converted into `template` strings.\n * renderComponent(MyComponent);\n * });\n *\n * ```\n *\n * NOTE: In AOT the resolution happens during compilation, and so there should be no need\n * to call this method outside JIT mode.\n *\n * @param resourceResolver a function which is responsible for returning a `Promise` to the\n * contents of the resolved URL. Browser's `fetch()` method is a good default implementation.\n */\nfunction resolveComponentResources(resourceResolver) {\n // Store all promises which are fetching the resources.\n const componentResolved = [];\n // Cache so that we don't fetch the same resource more than once.\n const urlMap = new Map();\n function cachedResourceResolve(url) {\n let promise = urlMap.get(url);\n if (!promise) {\n const resp = resourceResolver(url);\n urlMap.set(url, promise = resp.then(unwrapResponse));\n }\n return promise;\n }\n componentResourceResolutionQueue.forEach((component, type) => {\n const promises = [];\n if (component.templateUrl) {\n promises.push(cachedResourceResolve(component.templateUrl).then((template) => {\n component.template = template;\n }));\n }\n const styleUrls = component.styleUrls;\n const styles = component.styles || (component.styles = []);\n const styleOffset = component.styles.length;\n styleUrls && styleUrls.forEach((styleUrl, index) => {\n styles.push(''); // pre-allocate array.\n promises.push(cachedResourceResolve(styleUrl).then((style) => {\n styles[styleOffset + index] = style;\n styleUrls.splice(styleUrls.indexOf(styleUrl), 1);\n if (styleUrls.length == 0) {\n component.styleUrls = undefined;\n }\n }));\n });\n const fullyResolved = Promise.all(promises).then(() => componentDefResolved(type));\n componentResolved.push(fullyResolved);\n });\n clearResolutionOfComponentResourcesQueue();\n return Promise.all(componentResolved).then(() => undefined);\n}\nlet componentResourceResolutionQueue = new Map();\n// Track when existing ɵcmp for a Type is waiting on resources.\nconst componentDefPendingResolution = new Set();\nfunction maybeQueueResolutionOfComponentResources(type, metadata) {\n if (componentNeedsResolution(metadata)) {\n componentResourceResolutionQueue.set(type, metadata);\n componentDefPendingResolution.add(type);\n }\n}\nfunction isComponentDefPendingResolution(type) {\n return componentDefPendingResolution.has(type);\n}\nfunction componentNeedsResolution(component) {\n return !!((component.templateUrl && !component.hasOwnProperty('template')) ||\n component.styleUrls && component.styleUrls.length);\n}\nfunction clearResolutionOfComponentResourcesQueue() {\n const old = componentResourceResolutionQueue;\n componentResourceResolutionQueue = new Map();\n return old;\n}\nfunction restoreComponentResolutionQueue(queue) {\n componentDefPendingResolution.clear();\n queue.forEach((_, type) => componentDefPendingResolution.add(type));\n componentResourceResolutionQueue = queue;\n}\nfunction isComponentResourceResolutionQueueEmpty() {\n return componentResourceResolutionQueue.size === 0;\n}\nfunction unwrapResponse(response) {\n return typeof response == 'string' ? response : response.text();\n}\nfunction componentDefResolved(type) {\n componentDefPendingResolution.delete(type);\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nconst _THROW_IF_NOT_FOUND = {};\nconst THROW_IF_NOT_FOUND = _THROW_IF_NOT_FOUND;\nconst NG_TEMP_TOKEN_PATH = 'ngTempTokenPath';\nconst NG_TOKEN_PATH = 'ngTokenPath';\nconst NEW_LINE = /\\n/gm;\nconst NO_NEW_LINE = 'ɵ';\nconst SOURCE = '__source';\nconst ɵ0$3 = getClosureSafeProperty;\nconst USE_VALUE = getClosureSafeProperty({ provide: String, useValue: ɵ0$3 });\n/**\n * Current injector value used by `inject`.\n * - `undefined`: it is an error to call `inject`\n * - `null`: `inject` can be called but there is no injector (limp-mode).\n * - Injector instance: Use the injector for resolution.\n */\nlet _currentInjector = undefined;\nfunction setCurrentInjector(injector) {\n const former = _currentInjector;\n _currentInjector = injector;\n return former;\n}\nfunction injectInjectorOnly(token, flags = InjectFlags.Default) {\n if (_currentInjector === undefined) {\n throw new Error(`inject() must be called from an injection context`);\n }\n else if (_currentInjector === null) {\n return injectRootLimpMode(token, undefined, flags);\n }\n else {\n return _currentInjector.get(token, flags & InjectFlags.Optional ? null : undefined, flags);\n }\n}\nfunction ɵɵinject(token, flags = InjectFlags.Default) {\n return (getInjectImplementation() || injectInjectorOnly)(resolveForwardRef(token), flags);\n}\n/**\n * Throws an error indicating that a factory function could not be generated by the compiler for a\n * particular class.\n *\n * This instruction allows the actual error message to be optimized away when ngDevMode is turned\n * off, saving bytes of generated code while still providing a good experience in dev mode.\n *\n * The name of the class is not mentioned here, but will be in the generated factory function name\n * and thus in the stack trace.\n *\n * @codeGenApi\n */\nfunction ɵɵinvalidFactoryDep(index) {\n const msg = ngDevMode ?\n `This constructor is not compatible with Angular Dependency Injection because its dependency at index ${index} of the parameter list is invalid.\nThis can happen if the dependency type is a primitive like a string or if an ancestor of this class is missing an Angular decorator.\n\nPlease check that 1) the type for the parameter at index ${index} is correct and 2) the correct Angular decorators are defined for this class and its ancestors.` :\n 'invalid';\n throw new Error(msg);\n}\n/**\n * Injects a token from the currently active injector.\n *\n * Must be used in the context of a factory function such as one defined for an\n * `InjectionToken`. Throws an error if not called from such a context.\n *\n * Within such a factory function, using this function to request injection of a dependency\n * is faster and more type-safe than providing an additional array of dependencies\n * (as has been common with `useFactory` providers).\n *\n * @param token The injection token for the dependency to be injected.\n * @param flags Optional flags that control how injection is executed.\n * The flags correspond to injection strategies that can be specified with\n * parameter decorators `@Host`, `@Self`, `@SkipSef`, and `@Optional`.\n * @returns True if injection is successful, null otherwise.\n *\n * @usageNotes\n *\n * ### Example\n *\n * {@example core/di/ts/injector_spec.ts region='ShakableInjectionToken'}\n *\n * @publicApi\n */\nconst inject = ɵɵinject;\nfunction injectArgs(types) {\n const args = [];\n for (let i = 0; i < types.length; i++) {\n const arg = resolveForwardRef(types[i]);\n if (Array.isArray(arg)) {\n if (arg.length === 0) {\n throw new Error('Arguments array must have arguments.');\n }\n let type = undefined;\n let flags = InjectFlags.Default;\n for (let j = 0; j < arg.length; j++) {\n const meta = arg[j];\n if (meta instanceof Optional || meta.ngMetadataName === 'Optional' || meta === Optional) {\n flags |= InjectFlags.Optional;\n }\n else if (meta instanceof SkipSelf || meta.ngMetadataName === 'SkipSelf' || meta === SkipSelf) {\n flags |= InjectFlags.SkipSelf;\n }\n else if (meta instanceof Self || meta.ngMetadataName === 'Self' || meta === Self) {\n flags |= InjectFlags.Self;\n }\n else if (meta instanceof Host || meta.ngMetadataName === 'Host' || meta === Host) {\n flags |= InjectFlags.Host;\n }\n else if (meta instanceof Inject || meta === Inject) {\n type = meta.token;\n }\n else {\n type = meta;\n }\n }\n args.push(ɵɵinject(type, flags));\n }\n else {\n args.push(ɵɵinject(arg));\n }\n }\n return args;\n}\nfunction catchInjectorError(e, token, injectorErrorName, source) {\n const tokenPath = e[NG_TEMP_TOKEN_PATH];\n if (token[SOURCE]) {\n tokenPath.unshift(token[SOURCE]);\n }\n e.message = formatError('\\n' + e.message, tokenPath, injectorErrorName, source);\n e[NG_TOKEN_PATH] = tokenPath;\n e[NG_TEMP_TOKEN_PATH] = null;\n throw e;\n}\nfunction formatError(text, obj, injectorErrorName, source = null) {\n text = text && text.charAt(0) === '\\n' && text.charAt(1) == NO_NEW_LINE ? text.substr(2) : text;\n let context = stringify(obj);\n if (Array.isArray(obj)) {\n context = obj.map(stringify).join(' -> ');\n }\n else if (typeof obj === 'object') {\n let parts = [];\n for (let key in obj) {\n if (obj.hasOwnProperty(key)) {\n let value = obj[key];\n parts.push(key + ':' + (typeof value === 'string' ? JSON.stringify(value) : stringify(value)));\n }\n }\n context = `{${parts.join(', ')}}`;\n }\n return `${injectorErrorName}${source ? '(' + source + ')' : ''}[${context}]: ${text.replace(NEW_LINE, '\\n ')}`;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * The Trusted Types policy, or null if Trusted Types are not\n * enabled/supported, or undefined if the policy has not been created yet.\n */\nlet policy;\n/**\n * Returns the Trusted Types policy, or null if Trusted Types are not\n * enabled/supported. The first call to this function will create the policy.\n */\nfunction getPolicy() {\n if (policy === undefined) {\n policy = null;\n if (_global.trustedTypes) {\n try {\n policy = _global.trustedTypes.createPolicy('angular', {\n createHTML: (s) => s,\n createScript: (s) => s,\n createScriptURL: (s) => s,\n });\n }\n catch (_a) {\n // trustedTypes.createPolicy throws if called with a name that is\n // already registered, even in report-only mode. Until the API changes,\n // catch the error not to break the applications functionally. In such\n // cases, the code will fall back to using strings.\n }\n }\n }\n return policy;\n}\n/**\n * Unsafely promote a string to a TrustedHTML, falling back to strings when\n * Trusted Types are not available.\n * @security This is a security-sensitive function; any use of this function\n * must go through security review. In particular, it must be assured that the\n * provided string will never cause an XSS vulnerability if used in a context\n * that will be interpreted as HTML by a browser, e.g. when assigning to\n * element.innerHTML.\n */\nfunction trustedHTMLFromString(html) {\n var _a;\n return ((_a = getPolicy()) === null || _a === void 0 ? void 0 : _a.createHTML(html)) || html;\n}\n/**\n * Unsafely promote a string to a TrustedScript, falling back to strings when\n * Trusted Types are not available.\n * @security In particular, it must be assured that the provided string will\n * never cause an XSS vulnerability if used in a context that will be\n * interpreted and executed as a script by a browser, e.g. when calling eval.\n */\nfunction trustedScriptFromString(script) {\n var _a;\n return ((_a = getPolicy()) === null || _a === void 0 ? void 0 : _a.createScript(script)) || script;\n}\n/**\n * Unsafely promote a string to a TrustedScriptURL, falling back to strings\n * when Trusted Types are not available.\n * @security This is a security-sensitive function; any use of this function\n * must go through security review. In particular, it must be assured that the\n * provided string will never cause an XSS vulnerability if used in a context\n * that will cause a browser to load and execute a resource, e.g. when\n * assigning to script.src.\n */\nfunction trustedScriptURLFromString(url) {\n var _a;\n return ((_a = getPolicy()) === null || _a === void 0 ? void 0 : _a.createScriptURL(url)) || url;\n}\n/**\n * Unsafely call the Function constructor with the given string arguments. It\n * is only available in development mode, and should be stripped out of\n * production code.\n * @security This is a security-sensitive function; any use of this function\n * must go through security review. In particular, it must be assured that it\n * is only called from development code, as use in production code can lead to\n * XSS vulnerabilities.\n */\nfunction newTrustedFunctionForDev(...args) {\n if (typeof ngDevMode === 'undefined') {\n throw new Error('newTrustedFunctionForDev should never be called in production');\n }\n if (!_global.trustedTypes) {\n // In environments that don't support Trusted Types, fall back to the most\n // straightforward implementation:\n return new Function(...args);\n }\n // Chrome currently does not support passing TrustedScript to the Function\n // constructor. The following implements the workaround proposed on the page\n // below, where the Chromium bug is also referenced:\n // https://github.com/w3c/webappsec-trusted-types/wiki/Trusted-Types-for-function-constructor\n const fnArgs = args.slice(0, -1).join(',');\n const fnBody = args.pop().toString();\n const body = `(function anonymous(${fnArgs}\n) { ${fnBody}\n})`;\n // Using eval directly confuses the compiler and prevents this module from\n // being stripped out of JS binaries even if not used. The global['eval']\n // indirection fixes that.\n const fn = _global['eval'](trustedScriptFromString(body));\n // To completely mimic the behavior of calling \"new Function\", two more\n // things need to happen:\n // 1. Stringifying the resulting function should return its source code\n fn.toString = () => body;\n // 2. When calling the resulting function, `this` should refer to `global`\n return fn.bind(_global);\n // When Trusted Types support in Function constructors is widely available,\n // the implementation of this function can be simplified to:\n // return new Function(...args.map(a => trustedScriptFromString(a)));\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nclass SafeValueImpl {\n constructor(changingThisBreaksApplicationSecurity) {\n this.changingThisBreaksApplicationSecurity = changingThisBreaksApplicationSecurity;\n }\n toString() {\n return `SafeValue must use [property]=binding: ${this.changingThisBreaksApplicationSecurity}` +\n ` (see https://g.co/ng/security#xss)`;\n }\n}\nclass SafeHtmlImpl extends SafeValueImpl {\n getTypeName() {\n return \"HTML\" /* Html */;\n }\n}\nclass SafeStyleImpl extends SafeValueImpl {\n getTypeName() {\n return \"Style\" /* Style */;\n }\n}\nclass SafeScriptImpl extends SafeValueImpl {\n getTypeName() {\n return \"Script\" /* Script */;\n }\n}\nclass SafeUrlImpl extends SafeValueImpl {\n getTypeName() {\n return \"URL\" /* Url */;\n }\n}\nclass SafeResourceUrlImpl extends SafeValueImpl {\n getTypeName() {\n return \"ResourceURL\" /* ResourceUrl */;\n }\n}\nfunction unwrapSafeValue(value) {\n return value instanceof SafeValueImpl ? value.changingThisBreaksApplicationSecurity :\n value;\n}\nfunction allowSanitizationBypassAndThrow(value, type) {\n const actualType = getSanitizationBypassType(value);\n if (actualType != null && actualType !== type) {\n // Allow ResourceURLs in URL contexts, they are strictly more trusted.\n if (actualType === \"ResourceURL\" /* ResourceUrl */ && type === \"URL\" /* Url */)\n return true;\n throw new Error(`Required a safe ${type}, got a ${actualType} (see https://g.co/ng/security#xss)`);\n }\n return actualType === type;\n}\nfunction getSanitizationBypassType(value) {\n return value instanceof SafeValueImpl && value.getTypeName() || null;\n}\n/**\n * Mark `html` string as trusted.\n *\n * This function wraps the trusted string in `String` and brands it in a way which makes it\n * recognizable to {@link htmlSanitizer} to be trusted implicitly.\n *\n * @param trustedHtml `html` string which needs to be implicitly trusted.\n * @returns a `html` which has been branded to be implicitly trusted.\n */\nfunction bypassSanitizationTrustHtml(trustedHtml) {\n return new SafeHtmlImpl(trustedHtml);\n}\n/**\n * Mark `style` string as trusted.\n *\n * This function wraps the trusted string in `String` and brands it in a way which makes it\n * recognizable to {@link styleSanitizer} to be trusted implicitly.\n *\n * @param trustedStyle `style` string which needs to be implicitly trusted.\n * @returns a `style` hich has been branded to be implicitly trusted.\n */\nfunction bypassSanitizationTrustStyle(trustedStyle) {\n return new SafeStyleImpl(trustedStyle);\n}\n/**\n * Mark `script` string as trusted.\n *\n * This function wraps the trusted string in `String` and brands it in a way which makes it\n * recognizable to {@link scriptSanitizer} to be trusted implicitly.\n *\n * @param trustedScript `script` string which needs to be implicitly trusted.\n * @returns a `script` which has been branded to be implicitly trusted.\n */\nfunction bypassSanitizationTrustScript(trustedScript) {\n return new SafeScriptImpl(trustedScript);\n}\n/**\n * Mark `url` string as trusted.\n *\n * This function wraps the trusted string in `String` and brands it in a way which makes it\n * recognizable to {@link urlSanitizer} to be trusted implicitly.\n *\n * @param trustedUrl `url` string which needs to be implicitly trusted.\n * @returns a `url` which has been branded to be implicitly trusted.\n */\nfunction bypassSanitizationTrustUrl(trustedUrl) {\n return new SafeUrlImpl(trustedUrl);\n}\n/**\n * Mark `url` string as trusted.\n *\n * This function wraps the trusted string in `String` and brands it in a way which makes it\n * recognizable to {@link resourceUrlSanitizer} to be trusted implicitly.\n *\n * @param trustedResourceUrl `url` string which needs to be implicitly trusted.\n * @returns a `url` which has been branded to be implicitly trusted.\n */\nfunction bypassSanitizationTrustResourceUrl(trustedResourceUrl) {\n return new SafeResourceUrlImpl(trustedResourceUrl);\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * This helper is used to get hold of an inert tree of DOM elements containing dirty HTML\n * that needs sanitizing.\n * Depending upon browser support we use one of two strategies for doing this.\n * Default: DOMParser strategy\n * Fallback: InertDocument strategy\n */\nfunction getInertBodyHelper(defaultDoc) {\n const inertDocumentHelper = new InertDocumentHelper(defaultDoc);\n return isDOMParserAvailable() ? new DOMParserHelper(inertDocumentHelper) : inertDocumentHelper;\n}\n/**\n * Uses DOMParser to create and fill an inert body element.\n * This is the default strategy used in browsers that support it.\n */\nclass DOMParserHelper {\n constructor(inertDocumentHelper) {\n this.inertDocumentHelper = inertDocumentHelper;\n }\n getInertBodyElement(html) {\n // We add these extra elements to ensure that the rest of the content is parsed as expected\n // e.g. leading whitespace is maintained and tags like `` do not get hoisted to the\n // `` tag. Note that the `` tag is closed implicitly to prevent unclosed tags\n // in `html` from consuming the otherwise explicit `` tag.\n html = '' + html;\n try {\n const body = new window.DOMParser()\n .parseFromString(trustedHTMLFromString(html), 'text/html')\n .body;\n if (body === null) {\n // In some browsers (e.g. Mozilla/5.0 iPad AppleWebKit Mobile) the `body` property only\n // becomes available in the following tick of the JS engine. In that case we fall back to\n // the `inertDocumentHelper` instead.\n return this.inertDocumentHelper.getInertBodyElement(html);\n }\n body.removeChild(body.firstChild);\n return body;\n }\n catch (_a) {\n return null;\n }\n }\n}\n/**\n * Use an HTML5 `template` element, if supported, or an inert body element created via\n * `createHtmlDocument` to create and fill an inert DOM element.\n * This is the fallback strategy if the browser does not support DOMParser.\n */\nclass InertDocumentHelper {\n constructor(defaultDoc) {\n this.defaultDoc = defaultDoc;\n this.inertDocument = this.defaultDoc.implementation.createHTMLDocument('sanitization-inert');\n if (this.inertDocument.body == null) {\n // usually there should be only one body element in the document, but IE doesn't have any, so\n // we need to create one.\n const inertHtml = this.inertDocument.createElement('html');\n this.inertDocument.appendChild(inertHtml);\n const inertBodyElement = this.inertDocument.createElement('body');\n inertHtml.appendChild(inertBodyElement);\n }\n }\n getInertBodyElement(html) {\n // Prefer using element if supported.\n const templateEl = this.inertDocument.createElement('template');\n if ('content' in templateEl) {\n templateEl.innerHTML = trustedHTMLFromString(html);\n return templateEl;\n }\n // Note that previously we used to do something like `this.inertDocument.body.innerHTML = html`\n // and we returned the inert `body` node. This was changed, because IE seems to treat setting\n // `innerHTML` on an inserted element differently, compared to one that hasn't been inserted\n // yet. In particular, IE appears to split some of the text into multiple text nodes rather\n // than keeping them in a single one which ends up messing with Ivy's i18n parsing further\n // down the line. This has been worked around by creating a new inert `body` and using it as\n // the root node in which we insert the HTML.\n const inertBody = this.inertDocument.createElement('body');\n inertBody.innerHTML = trustedHTMLFromString(html);\n // Support: IE 11 only\n // strip custom-namespaced attributes on IE<=11\n if (this.defaultDoc.documentMode) {\n this.stripCustomNsAttrs(inertBody);\n }\n return inertBody;\n }\n /**\n * When IE11 comes across an unknown namespaced attribute e.g. 'xlink:foo' it adds 'xmlns:ns1'\n * attribute to declare ns1 namespace and prefixes the attribute with 'ns1' (e.g.\n * 'ns1:xlink:foo').\n *\n * This is undesirable since we don't want to allow any of these custom attributes. This method\n * strips them all.\n */\n stripCustomNsAttrs(el) {\n const elAttrs = el.attributes;\n // loop backwards so that we can support removals.\n for (let i = elAttrs.length - 1; 0 < i; i--) {\n const attrib = elAttrs.item(i);\n const attrName = attrib.name;\n if (attrName === 'xmlns:ns1' || attrName.indexOf('ns1:') === 0) {\n el.removeAttribute(attrName);\n }\n }\n let childNode = el.firstChild;\n while (childNode) {\n if (childNode.nodeType === Node.ELEMENT_NODE)\n this.stripCustomNsAttrs(childNode);\n childNode = childNode.nextSibling;\n }\n }\n}\n/**\n * We need to determine whether the DOMParser exists in the global context and\n * supports parsing HTML; HTML parsing support is not as wide as other formats, see\n * https://developer.mozilla.org/en-US/docs/Web/API/DOMParser#Browser_compatibility.\n *\n * @suppress {uselessCode}\n */\nfunction isDOMParserAvailable() {\n try {\n return !!new window.DOMParser().parseFromString(trustedHTMLFromString(''), 'text/html');\n }\n catch (_a) {\n return false;\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * A pattern that recognizes a commonly useful subset of URLs that are safe.\n *\n * This regular expression matches a subset of URLs that will not cause script\n * execution if used in URL context within a HTML document. Specifically, this\n * regular expression matches if (comment from here on and regex copied from\n * Soy's EscapingConventions):\n * (1) Either an allowed protocol (http, https, mailto or ftp).\n * (2) or no protocol. A protocol must be followed by a colon. The below\n * allows that by allowing colons only after one of the characters [/?#].\n * A colon after a hash (#) must be in the fragment.\n * Otherwise, a colon after a (?) must be in a query.\n * Otherwise, a colon after a single solidus (/) must be in a path.\n * Otherwise, a colon after a double solidus (//) must be in the authority\n * (before port).\n *\n * The pattern disallows &, used in HTML entity declarations before\n * one of the characters in [/?#]. This disallows HTML entities used in the\n * protocol name, which should never happen, e.g. \"http\" for \"http\".\n * It also disallows HTML entities in the first path part of a relative path,\n * e.g. \"foo<bar/baz\". Our existing escaping functions should not produce\n * that. More importantly, it disallows masking of a colon,\n * e.g. \"javascript:...\".\n *\n * This regular expression was taken from the Closure sanitization library.\n */\nconst SAFE_URL_PATTERN = /^(?:(?:https?|mailto|ftp|tel|file|sms):|[^&:/?#]*(?:[/?#]|$))/gi;\n/* A pattern that matches safe srcset values */\nconst SAFE_SRCSET_PATTERN = /^(?:(?:https?|file):|[^&:/?#]*(?:[/?#]|$))/gi;\n/** A pattern that matches safe data URLs. Only matches image, video and audio types. */\nconst DATA_URL_PATTERN = /^data:(?:image\\/(?:bmp|gif|jpeg|jpg|png|tiff|webp)|video\\/(?:mpeg|mp4|ogg|webm)|audio\\/(?:mp3|oga|ogg|opus));base64,[a-z0-9+\\/]+=*$/i;\nfunction _sanitizeUrl(url) {\n url = String(url);\n if (url.match(SAFE_URL_PATTERN) || url.match(DATA_URL_PATTERN))\n return url;\n if (typeof ngDevMode === 'undefined' || ngDevMode) {\n console.warn(`WARNING: sanitizing unsafe URL value ${url} (see https://g.co/ng/security#xss)`);\n }\n return 'unsafe:' + url;\n}\nfunction sanitizeSrcset(srcset) {\n srcset = String(srcset);\n return srcset.split(',').map((srcset) => _sanitizeUrl(srcset.trim())).join(', ');\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nfunction tagSet(tags) {\n const res = {};\n for (const t of tags.split(','))\n res[t] = true;\n return res;\n}\nfunction merge(...sets) {\n const res = {};\n for (const s of sets) {\n for (const v in s) {\n if (s.hasOwnProperty(v))\n res[v] = true;\n }\n }\n return res;\n}\n// Good source of info about elements and attributes\n// https://html.spec.whatwg.org/#semantics\n// https://simon.html5.org/html-elements\n// Safe Void Elements - HTML5\n// https://html.spec.whatwg.org/#void-elements\nconst VOID_ELEMENTS = tagSet('area,br,col,hr,img,wbr');\n// Elements that you can, intentionally, leave open (and which close themselves)\n// https://html.spec.whatwg.org/#optional-tags\nconst OPTIONAL_END_TAG_BLOCK_ELEMENTS = tagSet('colgroup,dd,dt,li,p,tbody,td,tfoot,th,thead,tr');\nconst OPTIONAL_END_TAG_INLINE_ELEMENTS = tagSet('rp,rt');\nconst OPTIONAL_END_TAG_ELEMENTS = merge(OPTIONAL_END_TAG_INLINE_ELEMENTS, OPTIONAL_END_TAG_BLOCK_ELEMENTS);\n// Safe Block Elements - HTML5\nconst BLOCK_ELEMENTS = merge(OPTIONAL_END_TAG_BLOCK_ELEMENTS, tagSet('address,article,' +\n 'aside,blockquote,caption,center,del,details,dialog,dir,div,dl,figure,figcaption,footer,h1,h2,h3,h4,h5,' +\n 'h6,header,hgroup,hr,ins,main,map,menu,nav,ol,pre,section,summary,table,ul'));\n// Inline Elements - HTML5\nconst INLINE_ELEMENTS = merge(OPTIONAL_END_TAG_INLINE_ELEMENTS, tagSet('a,abbr,acronym,audio,b,' +\n 'bdi,bdo,big,br,cite,code,del,dfn,em,font,i,img,ins,kbd,label,map,mark,picture,q,ruby,rp,rt,s,' +\n 'samp,small,source,span,strike,strong,sub,sup,time,track,tt,u,var,video'));\nconst VALID_ELEMENTS = merge(VOID_ELEMENTS, BLOCK_ELEMENTS, INLINE_ELEMENTS, OPTIONAL_END_TAG_ELEMENTS);\n// Attributes that have href and hence need to be sanitized\nconst URI_ATTRS = tagSet('background,cite,href,itemtype,longdesc,poster,src,xlink:href');\n// Attributes that have special href set hence need to be sanitized\nconst SRCSET_ATTRS = tagSet('srcset');\nconst HTML_ATTRS = tagSet('abbr,accesskey,align,alt,autoplay,axis,bgcolor,border,cellpadding,cellspacing,class,clear,color,cols,colspan,' +\n 'compact,controls,coords,datetime,default,dir,download,face,headers,height,hidden,hreflang,hspace,' +\n 'ismap,itemscope,itemprop,kind,label,lang,language,loop,media,muted,nohref,nowrap,open,preload,rel,rev,role,rows,rowspan,rules,' +\n 'scope,scrolling,shape,size,sizes,span,srclang,start,summary,tabindex,target,title,translate,type,usemap,' +\n 'valign,value,vspace,width');\n// Accessibility attributes as per WAI-ARIA 1.1 (W3C Working Draft 14 December 2018)\nconst ARIA_ATTRS = tagSet('aria-activedescendant,aria-atomic,aria-autocomplete,aria-busy,aria-checked,aria-colcount,aria-colindex,' +\n 'aria-colspan,aria-controls,aria-current,aria-describedby,aria-details,aria-disabled,aria-dropeffect,' +\n 'aria-errormessage,aria-expanded,aria-flowto,aria-grabbed,aria-haspopup,aria-hidden,aria-invalid,' +\n 'aria-keyshortcuts,aria-label,aria-labelledby,aria-level,aria-live,aria-modal,aria-multiline,' +\n 'aria-multiselectable,aria-orientation,aria-owns,aria-placeholder,aria-posinset,aria-pressed,aria-readonly,' +\n 'aria-relevant,aria-required,aria-roledescription,aria-rowcount,aria-rowindex,aria-rowspan,aria-selected,' +\n 'aria-setsize,aria-sort,aria-valuemax,aria-valuemin,aria-valuenow,aria-valuetext');\n// NB: This currently consciously doesn't support SVG. SVG sanitization has had several security\n// issues in the past, so it seems safer to leave it out if possible. If support for binding SVG via\n// innerHTML is required, SVG attributes should be added here.\n// NB: Sanitization does not allow